An open API service indexing awesome lists of open source software.

https://github.com/codedecks-in/leetcode-solutions

This repository consists of solutions to the problem from LeetCode platform. Subscribe to our Channel for more updates
https://github.com/codedecks-in/leetcode-solutions

beginner-friendly breadth codedecks first-timers first-timers-only good-first-issue hacktoberfest hacktoberfest-accepted hacktoberfest-starter hacktoberfest2023 help-wanted leetcode leetcode-cpp leetcode-java leetcode-platform leetcode-practice leetcode-python leetcode-questions leetcode-solutions low-hanging-fruit

Last synced: 29 days ago
JSON representation

This repository consists of solutions to the problem from LeetCode platform. Subscribe to our Channel for more updates

Awesome Lists containing this project

README

        

# [LeetCode-Solutions](https://www.youtube.com/playlist?list=PLlUdLC2oSxz2Y1g6V8oRCzauOvbnKl2Ee)


Join Us on Telegram & Facebook











LOC Stars Badge
Forks Badge
GitHub contributors

---

![Language](https://img.shields.io/badge/language-Python%20%2F%20Java%20%2F%20JS%20%2F%20C++-orange.svg) 
[![License](https://img.shields.io/badge/license-MIT-blue.svg)](./LICENSE) 
[![contributions welcome](https://img.shields.io/badge/contributions-welcome-brightgreen.svg?style=flat)](https://github.com/dwyl/esta/issues)
[![Discord](https://img.shields.io/discord/463752820026376202.svg?label=&logo=discord&logoColor=ffffff&color=7389D8&labelColor=6A7EC2)](https://discord.gg/umYVGnvvAg)
[![first-timers-only-friendly](http://img.shields.io/badge/first--timers--only-friendly-blue.svg?style=flat-square)](https://code.publiclab.org#r=all)

### Got stuck in a LeetCode question?
### This repository will help you by providing approach of solving the problems from LeetCode platform.

### [Contributors](#contributors) helped us in providing these Awesome solutions.

### If you want to contribute, please create a Pull Request. If you are new to Github please check pull request procedure ---> [PR process](https://github.com/codedecks-in/LeetCode-Solutions/blob/master/PULL_REQUEST_PROCESS.md)

Check out ---> [Sample PR](https://github.com/codedecks-in/LeetCode-Solutions/pull/3)

- There are new LeetCode questions every week. I'll keep updating for full summary and better solutions.
- For more challenging problem solutions, you can also see our [HackerRank-Solutions](https://github.com/codedecks-in/HackerRank-Solutions), [ProjectEuler](https://github.com/codedecks-in/ProjectEuler-Solutions) repositories.
- Hope you enjoy the journey of learning data structures and algorithms.
- Notes: "🔒" means your subscription of [LeetCode premium membership](https://leetcode.com/subscribe/) is required for reading the question.

### Don't forget to give us a 🌟 to support us.

## Check out -> [Learning Resources](#learning-resources)

# Algorithms

- [Bit Manipulation](#bit-manipulation)
- [Array](#array)
- [String](#string)
- [Linked List](#linked-list)
- [Stack](#stack)
- [Queue](#queue)
- [Heap](#heap)
- [Tree](#tree)
- [Hash Table](#hash-table)
- [Math](#math)
- [Two Pointers](#two-pointers)
- [Sort](#sort)
- [Recursion](#recursion)
- [Binary Search](#binary-search)
- [Binary Search Tree](#binary-search-tree)
- [Breadth-First Search](#breadth-first-search)
- [Depth-First Search](#depth-first-search)
- [Backtracking](#backtracking)
- [Dynamic Programming](#dynamic-programming)
- [Greedy](#greedy)
- [Graph](#graph)
- [Geometry](#geometry)
- [Simulation](#simulation)
- [Design](#design)
- [Concurrency](#concurrency)

# Bit Manipulation

| # | Title | Solution | Time | Space | Difficulty | Tag | Tutorial |
| ---- | ------------------------------------------------------------------------------------- | -------------------------------------------------------------------------------------------------------------- | ------ | ------ | ---------- | --- | ---------------------------------------- |
| 136 | [Single Number](https://leetcode.com/problems/single-number/) | [Java](./Java/single-number.java)
[Python](./Python/single-number.py)
[C++](./C++/Single-Number.cpp)
[JavaScript](./JavaScript/single-number.js) | _O(n)_ | _O(1)_ | Easy | | Using XOR |
| 137 | [Single Number II](https://leetcode.com/problems/single-number-ii/) | [Python](./Python/single-number-ii.py)
[C++](./C++/Single-Number-II.cpp) | _O(n)_ | _O(1)_ | Medium | | |
| 260 | [Single Number III](https://leetcode.com/problems/single-number-iii/) | [Python](./Python/single-number-iii.py)
[C++](./C++/Single-Number-III.cpp) | _O(n)_ | _O(1)_ | Medium | | |
| 371 | [Sum of Two Integers](https://leetcode.com/problems/sum-of-two-integers/) | [Java](./Java/Sum_of_two_integers.java) | _O(1)_ | _O(1)_ | Medium |
| 476 | [Number Complement](https://leetcode.com/problems/number-complement/) | [Java](./Java/number-complement.java)
[C++](./C++/Number-Complement.cpp) | _O(1)_ | _O(1)_ | Easy | | [Tutorial](https://youtu.be/6bp5V-O3zts) |
| 520 | [Detect Capital Use](https://leetcode.com/problems/detect-capital/) | [Python](./Python/detect-capital.py)
[C++](./C++/Detect-Capital.cpp) | _O(n)_ | _O(1)_ | Easy | | |
| 1486 | [XOR Operation in an Array](https://leetcode.com/problems/xor-operation-in-an-array/) | [Java](./Java/xor-op-in-array.java)
[C++](./C++/xor-operation-in-an-array.cpp) | _O(n)_ | _O(1)_ | Easy | | Using XOR |




⬆️ Back to Top


# Sort

| # | Title | Solution | Time | Space | Difficulty | Tag | Tutorial |
| --- | --------------------------------------------------------------------------------------- | ------------------------------------------- | ------ | ------ | ---------- | --- | -------- |
| 973 | [K Closest Points to Origin](https://leetcode.com/problems/k-closest-points-to-origin/) | [C++](./C++/k-closest-points-to-origin.cpp) | _O(n)_ | _O(1)_ | Medium | | |




⬆️ Back to Top


# Array

| # | Title | Solution | Time | Space | Difficulty | Note | Video Explaination |
| ------- | ----------------------------------------------------------------------------------------------------------------------------- | ----------------------------------------------------------------------------------------------------------------- | ------------ | ------------- | ---------- | ------------------ | ---------------------------------------- |
| 118 | [Pascal's Triangle](https://leetcode.com/problems/pascals-triangle/) | [Java](./Java/PascalsTriangle118.java) | _O(N^2)_ | _O(N)_ | Easy | | |
| 56 | [Merge Intervals](https://leetcode.com/problems/merge-intervals) | [Python](./Python/56_MergeIntervals.py) | _O(nlogn)_ | _O(n)_ | Medium | Intervals | |
| 268 | [Missing Number](https://leetcode.com/problems/missing-number) | [Java](./Java/missing-number.java) | _O(n)_ | _O(1)_ | Easy | Array | [Tutorial](https://youtu.be/VwvGEE_OGss) |
| 697 | [Degree of an Array](https://leetcode.com/problems/degree-of-an-array) | [Java](./Java/Degree-of-an-Array.java) | _O(n)_ | _O(n)_ | Easy | Array | |
| 1089 | [Duplicate Zeroes](https://leetcode.com/problems/duplicate-zeros/) | [JavaScript](./JavaScript/Duplicate-Zeroes.js) | _O(n)_ | _O(n)_ | Easy | Array | |
| 1502 | [Can Make Arithmetic Progression From Sequence](https://leetcode.com/problems/can-make-arithmetic-progression-from-sequence/) | [Java](./Java/can-make-arithmetic-progression-from-sequence.java) | _O(n)_ | _O(1)_ | Easy | Array | |
| 122 | [Best Time to buy and sell Stock II](https://leetcode.com/problems/best-time-to-buy-and-sell-stock-ii) | [Python](./Python/best-time-to-buy-and-sell-stock-ii.py)
[C++](./C++/Best-Time-to-Buy-and-Sell-Stock-II.cpp) | _O(N)_ | _O(1)_ | Medium | Stocks | |
| 119 | [Pascal's Triangle II](https://leetcode.com/problems/pascals-triangle-ii) | [Python](./Python/pascals-triangle-ii.py) | _O(N^2)_ | _O(K)_ | Easy | | |
| 1480 | [Running Sum of 1d Array](https://leetcode.com/problems/running-sum-of-1d-array/) | [Java](./Java/running-sum-of-1d-array.java) | _O(N)_ | _O(N)_ | Easy | Simple sum | |
| 42 | [Trapping Rain Water](https://leetcode.com/problems/trapping-rain-water/) | [Python](./Python/trapping_rain.py) | _O(N^2)_ | _O(N)_ | Hard | Array | |
| 11 | [Container with Most Water](https://leetcode.com/problems/container-with-most-water/) | [Python](./Python/container_with_most_water.py)
[C++](./C++/container-with-most-water.cpp) | _O(N)_ | _O(N)_ | Medium | Array Two Pointers | |
| 1134 🔒 | [Armstrong Number](https://leetcode.com/problems/armstrong-number/) | [Java](./Java/Armstrong-Number.java) | _O(N)_ | _O(1)_ | Easy | | |
| 1534 | [Count Good Triplets](https://leetcode.com/problems/count-good-triplets/) | [Python](./Python/count-good-triplets.py) | _O(N^3)_ | _O(1)_ | Easy | | |
| 1572 | [Matrix Diagonal Sum](https://leetcode.com/problems/matrix-diagonal-sum/) | [Java](./Java/matrix-diagonal-sum.java) | _O(N)_ | _O(1)_ | Easy | | |
| 811 | [Subdomain Visit Count](https://leetcode.com/problems/subdomain-visit-count/) | [Javascript](./JavaScript/Subdomain-Visit-Count.js) | _O(N\*M)_ | _O(N\*M + N)_ | Easy | | |
| 53 | [Maximum Subarray](https://leetcode.com/problems/maximum-subarray/) | [C++](./C++/maximum-subarray.cpp) | _O(N)_ | _O(1)_ | Easy | Array | |
| 495 | [Teemo Attacking](https://leetcode.com/problems/teemo-attacking) | [C++](./C++/teemo-attacking.cpp) | _O(n)_ | _O(1)_ | Medium | Array | |
| 15 | [3 Sum](https://leetcode.com/problems/3sum/) | [Python](./Python/ThreeNumbersSum.py) | O( nLog(n) ) | O(1) | Medium | Array |
| 1200 | [Minimum Absolute Difference](https://leetcode.com/problems/minimum-absolute-difference/) | [Python](./python/SmallestDifference.py) | O(n) | O(1) | Easy | Array |
| 532 | [K-diff Pairs in an Array](https://leetcode.com/problems/k-diff-pairs-in-an-array/) | [C++](./C++/k-diff-pairs-in-an-array.cpp) | O(n) | O(n) | Medium | Array |
| 152 | [Maximum Product Subarray](https://leetcode.com/problems/maximum-product-subarray/) | [Javascript](./JavaScript/152.Maximum-Product-Subarray.js) | O(n) | O(n) | Medium | Array |
| 073 | [Set-Matrix-Zeroes](https://leetcode.com/problems/set-matrix-zeroes/) | [Java](./Java/set-matrix-zeroes.java) | O(MN) | O(1) | Medium | Array |
| 1288 | [Remove-Covered-Intervals](https://leetcode.com/problems/remove-covered-intervals) | [C++](./C++/Remove-Covered-Intervals.cpp) | O(N\*N) | O(1) | Medium | Array |
| 189 | [Rotate-Array](https://leetcode.com/problems/rotate-array/) | [Python](./Python/rotate-array.py) | O(N) | O(1) | Medium | Array |
| 496 | [next-greater-element-i](https://leetcode.com/problems/next-greater-element-i) | [Python](./Python/496_nextgreaterelement.py) | O(N) | O(1) | Medium | Array |
| 1470 | [Shuffle the Array](https://leetcode.com/problems/shuffle-the-array) | [Java](./Java/shuffle-the-array.java) | O(N) | O(1) | Easy | Array |
| 124 | [Permutation by Recussion](https://leetcode.com/problems/permutations/) | [Java](./Java/shuffle-the-array.java) | O(N) | O(N) | Easy | Array |
| 283 | [Move-Zeroes](https://leetcode.com/problems/move-zeroes/) | [C++](./C++/Move-Zeroes.cpp) | O(N) | O(1) | Easy | Array |
| 27 | [Remove-Element](https://leetcode.com/problems/remove-element/) | [C++](./C++/remove-element.cpp) | O(N) | O(1) | Easy | Array |
| 36 | [Valid Sudoku](https://leetcode.com/problems/valid-sudoku/) | [Java](./Java/valid-sudoku.java) | O(N^2) | O(N) | Medium | Array, 2D Matrix |
| 1512 | [Number of Good Pairs](https://leetcode.com/problems/number-of-good-pairs/) | [Java](./Java/Number-of-Good-Pairs.java) | O(N^2) | O(1) | Easy | Array |
| 162 | [Find Peak element](https://leetcode.com/problems/find-peak-element/) | [javascript](https://github.com/codedecks-in/LeetCode-Solutions/blob/master/JavaScript/findPeakElement.js) | o(Logn) | O(1) | Medium | Array |
| 54 | [Spiral Matrix](https://leetcode.com/problems/spiral-matrix/) | [C++](./C++/Spiral-matrix.cpp) | O(M\*N) | O(M\*N) | Medium | Array |
| 238 | [Product of Array Except Self](https://leetcode.com/problems/product-of-array-except-self/) | [C++](./C++/238.Product_of_array_except_self) | O(N) | O(N) | Medium | Array |



⬆️ Back to Top


# String

| # | Title | Solution | Time | Space | Difficulty | Tag | Note |
| :--: | ----------------------------------------------------------------------------------------------------------------------------------------------- | -------------------------------------------------------------------------- | ------ | ------ | ---------- | --- | --------------- |
| 3 | [Longest Substring Without Repeating Characters](https://leetcode.com/problems/longest-substring-without-repeating-characters/) | [Python](./Python/Longest_Substring_Without_Repeating_Characters.py) | _O(n)_ | _O(n)_ | Medium | `Hash Table`
`Sliding Window` | Open for improvisation, mentioned time and space complexities unconfirmed |
| 8 | [String to Integer (atoi)](https://leetcode.com/problems/string-to-integer-atoi/) | [Java](./Java/string-to-integer-atoi.java) | _O(n)_ | _O(1)_ | Medium | | |
| 9 | [Palindrome Number](https://leetcode.com/problems/palindrome-number/) | [Java](./Java/palindrome-number.java) | _O(n)_ | _O(1)_ | Easy | | |
| 151 | [Reverse Words in a String](https://leetcode.com/problems/reverse-words-in-a-string/) | [Java](./Java/reverse-words-in-a-string.java) | _O(1)_ | _O(n)_ | Medium | | |
| 383 | [Ransom Note](https://leetcode.com/problems/ransom-note/) | [Java](./Java/ransom-note.java) | _O(1)_ | _O(n)_ | Easy | | Character Count |
| 387 | [First Unique Character in a String](https://leetcode.com/problems/first-unique-character-in-a-string/) | [Java](./Java/first-unique-character-in-a-string.java) | _O(n)_ | _O(1)_ | Easy | | Character Count |
| 520 | [Detect Capital Use](https://leetcode.com/problems/detect-capital/) | [Java](./Java/detect-capital-use.java) | _O(n)_ | _O(1)_ | Easy | | |
| 767 | [Reorganize String](https://leetcode.com/problems/reorganize-string/) | [Python](./Python/reorganize-string.py) | _O(n)_ | _O(n)_ | Medium | | |
| 859 | [Buddy Strings](https://leetcode.com/problems/buddy-strings/) | [Java](./Java/buddy-strings.java) | _O(n)_ | _O(1)_ | Easy | | |
| 1221 | [Split a String in Balanced Strings](https://leetcode.com/problems/split-a-string-in-balanced-strings/) | [Python](./Python/split-a-string-in-balanced-strings.py) | _O(n)_ | _O(1)_ | Easy | | |
| 1374 | [Generate a String With Characters That Have Odd Counts](https://leetcode.com/problems/generate-a-string-with-characters-that-have-odd-counts/) | [Java](./Java/generate-a-string-with-characters-that-have-odd-counts.java) | _O(n)_ | _O(1)_ | Easy | | |
| 1614 | [Maximum Nesting Depth of the Parentheses](https://leetcode.com/problems/maximum-nesting-depth-of-the-parentheses/) | [Java](./Java/max-nesting-depth-parentheses.java) | _O(n)_ | _O(1)_ | Easy | | |



⬆️ Back to Top


# Linked List

| # | Title | Solution | Time | Space | Difficulty | Tag | Tutorial |
| --- | --------------------------------------------------------------------------------------------------------------------- | ----------------------------------------------------------------------------------- | ---------- | ------ | ---------- | ------------------ | ---------------------------------------- |
| 002 | [Add Two Numbers](https://leetcode.com/problems/add-two-numbers/) | [Java](./Java/Add-Two-Numbers.java) | _O(n)_ | _O(n)_ | Medium | Math | |
| 19 | [Remove Nth Node From End of List](https://leetcode.com/problems/remove-nth-node-from-end-of-list/) | [Java](./Java/remove-nth-node-from-end-of-list.java) | _O(n)_ | _O(1)_ | Medium | Two pointers | |
| 23 | [Merge K sorted lists](https://leetcode.com/problems/merge-k-sorted-lists/) | [C++](./C++/merge-k-sorted-lists.cpp) | _O(nlogn)_ | _O(n)_ | Hard | sorting and append | |
| 109 | [Convert Sorted List to Binary Search Tree](https://leetcode.com/problems/convert-sorted-list-to-binary-search-tree/) | [Java](./Java/convert-sorted-list-to-binary-search-tree.java) | _O(n)_ | _O(n)_ | Medium | LinkedList | |
| 141 | [Linked List Cycle](https://leetcode.com/problems/linked-list-cycle/) | [Java](./Java/linked-list-cycle.java) | _O(n)_ | _O(1)_ | Easy | Slow-Fast Pointers | |
| 142 | [Linked List Cycle II](https://leetcode.com/problems/linked-list-cycle-ii/) | [Java](./Java/linked-list-cycle-ii.java)
[C++](./C++/Linked-List-Cycle-II.cpp) | _O(n)_ | _O(1)_ | Medium | Slow-Fast Pointers | |
| 146 | [LRU Cache](https://leetcode.com/problems/lru-cache/) | [C++](./C++/LRU-Cache.cpp)
[Python](./Python/LRUCache.py) | _O(1)_ | _O(k)_ | Medium | Hash Map | |
| 160 | [Intersection of Two Linked Lists](https://leetcode.com/problems/intersection-of-two-linked-lists/) | [Java](./Java/intersection-of-two-linked-lists.java) | _O(n)_ | _O(1)_ | Easy | Two Pointers | [Tutorial](https://youtu.be/uozGB0-gbvI) |
| 186 | [Middle of the Linked List](https://leetcode.com/problems/middle-of-the-linked-list/) | [Java](./Java/middle-of-the-linked-list.java) | _O(n)_ | _O(1)_ | Easy | Two pointers |
| 143 | [Reorder List](https://leetcode.com/problems/reorder-list/) | [C++](./C++/143.Reorder_List.cpp) | _O(n)_ | _O(n)_ | Medium | Iteration and Stack |
| 24 | [Swap Nodes in Pairs](https://leetcode.com/problems/swap-nodes-in-pairs/) | [C++](./C++/Swap-nodes-in-pairs.cpp) | _O(n)_ | _O(1)_ | Medium | Two pointers |




⬆️ Back to Top


# Stack

| # | Title | Solution | Time | Space | Difficulty | Tag | Note |
| ---- | ------------------------------------------------------------------------------------------------------------------- | ----------------------------------------------------------- | ------ | ------ | ---------- | ---------------------- | ---- |
| 020 | [Valid Parentheses](https://leetcode.com/problems/valid-parentheses/) | [Python](./Python/20_ValidParentheses.py) [C++](./C++/Vlalid_Parentheses.cpp)[Java](./Java/20.ValidParentheses.java) | _O(n)_ | _O(n)_ | Easy | Stack | |
| 084 | [Largest Rectangle in Histogram](https://leetcode.com/problems/largest-rectangle-in-histogram/) | [C++](./C++/Largest-Rectangle-in-Histogram.cpp) | _O(n)_ | _O(n)_ | Hard | Stack |
| 150 | [Evaluate Reverse Polish Notation](https://leetcode.com/problems/evaluate-reverse-polish-notation/) | [Python](./Python/150.EvaluateReversePolishNotation.py)
[Java](./Java/evaluate_reverse_polish_notation.java) | _O(n)_ | _O(1)_ | Medium | Stack | |
| 1047 | [Remove All Adjacent Duplicates In String](https://leetcode.com/problems/remove-all-adjacent-duplicates-in-string/) | [C++](./C++/remove-all-adjacent-duplicates-in-string.cpp) | _O(n)_ | _O(n)_ | Easy | Stack | |
| 682 | [Baseball Game](https://leetcode.com/problems/baseball-game/) | [C++](./C++/Baseball-Game.cpp) | _O(n)_ | _O(n)_ | Easy | Stack | |
| 1381 | [Design a Stack With Increment Operation](https://leetcode.com/problems/design-a-stack-with-increment-operation/) | [Java](./Java/Design-a-Stack-With-Increment-Operation.java) | _O(n)_ | _O(n)_ | Medium | Stack | |
| 1598 | [Crawler Log Folder](https://leetcode.com/problems/crawler-log-folder/) | [C++](./C++/Crawler-Log-Folder.cpp) | _O(n)_ | _O(n)_ | Easy | Stack |
| 94 | [Binary Tree Inorder Traversal](https://leetcode.com/problems/binary-tree-inorder-traversal/) | [Python](./Python/binary-tree-inorder-traversal.py) | _O(n)_ | _O(n)_ | Medium | Recursion, Binary Tree |
| 735 | [Asteroid Collision](https://leetcode.com/problems/asteroid-collision/) | [C++](./C++/asteroid-collision.cpp) | _O(n)_ | _O(1)_ | Medium | Stack | |
| 394 | [Decode String](https://leetcode.com/problems/decode-string/) | [C++](./C++/decode-string.cpp) | _O(n)_ | _O(1)_ | Medium | Stack | |
| 921 | [Minimum Add to Make Parentheses Valid](https://leetcode.com/problems/minimum-add-to-make-parentheses-valid/) | [C++](./C++/minimum-add-to-make-parentheses-valid.cpp) | _O(n)_ | _O(1)_ | Medium | Stack | |
| 32 | [Longest Valid Parentheses](https://leetcode.com/problems/longest-valid-parentheses/) | [Python](.Python/longest-valid-parentheses.py) | _O(n)_ | _O(n)_ | Hard | Stack | |
| 1249 | [Minimum Remove to Make Valid Parentheses](https://leetcode.com/problems/minimum-remove-to-make-valid-parentheses/) | [C++](./C++/minimum-remove-to-make-valid-parentheses.cpp) | _O(n)_ | _O(n)_ | Medium | Stack | |




⬆️ Back to Top


# Queue

| # | Title | Solution | Time | Space | Difficulty | Tag | Note |
| --- | ------------------------------------------------------------------------------- | ------------------------------------------------ | ------ | ------ | ---------- | --------------------- | ---- |
| 933 | [Number of Recent Calls](https://leetcode.com/problems/number-of-recent-calls/) | [C++](./C++/Number-of-Recent-Calls.cpp) | _O(1)_ | _O(1)_ | Easy | Queue, Sliding Window |
| 641 | [Design Circular Deque](https://leetcode.com/problems/design-circular-deque/) | [Java](./Java/design-circular-deque.java/) | _O(n)_ | _O(n)_ | Medium | Queue, Design |
| 621 | [Task Scheduler ](https://leetcode.com/problems/task-scheduler/) | [Python](./Python/621-Task-Scheduler.py/) | _O(n)_ | _O(n)_ | Medium | Queue |
| 622 | [Design Circular Queue](https://leetcode.com/problems/design-circular-queue/) | [Python](./Python/622-Design-Circular-Queue.py/) | _O(n)_ | _O(n)_ | Medium | Queue |




⬆️ Back to Top


# Tree

| # | Title | Solution | Time | Space | Difficulty | Tag | Note |
| ---- | --------------------------------------------------------------------------------------------------------------- | ---------------------------------------------------------------------------------------------------------------- | ----------- | ----------- | ---------- | ---------------------------------------------- | ---- |
| 094 | [Binary Tree Inorder Traversal](https://leetcode.com/problems/binary-tree-inorder-traversal/) | [Java](./Java/binary-tree-inorder-traversal.java)
[Python](./Python/Iterative-Inorder-tree-traversal) | _O(n)_ | _O(logn)_ | Medium | Binary Tree, Stack, HashTable | |
| 100 | [Same Tree](https://leetcode.com/problems/same-tree/) | [Python](./Python/100.SymmetricTree.py)
[Java](./Java/Same-Tree.java) | _O(n)_ | _O(n)_ | Easy | Tree, Depth-first Search | |
| 101 | [Symmetric Tree](https://leetcode.com/problems/symmetric-tree/) | [Java](./Java/symmetric-tree.java)
[Python](./Python/101.SymmetricTree.py) | _O(n)_ | _O(n)_ | Easy | Tree, Breadth-first Search, Depth-first Search | |
| 144 | [Binary Tree Preorder Traversal](https://leetcode.com/problems/binary-tree-preorder-traversal/) | [Java](./Java/binary-tree-preorder-traversal.java) | _O(n)_ | _O(logn)_ | Medium | Binary Tree, Stack | |
| 145 | [Binary Tree Postorder Traversal](https://leetcode.com/problems/binary-tree-postorder-traversal/) | [Java](./Java/binary-tree-postorder-traversal.java) | _O(n)_ | _O(logn)_ | Hard | Binary Tree, Stack | |
| 103 | [ZigZag Level Order](https://leetcode.com/problems/binary-tree-zigzag-level-order-traversal/) | [JavaScript](./JavaScript/Binary-Tree-ZigZag-Traversal.js)
[C++](./C++/binary-tree-preorder-traversal.java) | _O(n)_ | _O(n)_ | Medium | Binary Tree | |
| 129 | [Sum Root to Leaf Numbers](https://leetcode.com/problems/sum-root-to-leaf-numbers/) | [Java](./Java/sum-root-to-leaf-numbers.java) | _O(n)_ | _O(logn)_ | Medium | Binary Tree, Depth First Search | |
| 307 | [Range Sum Query - Mutable](https://leetcode.com/problems/range-sum-query-mutable/) | [Java](./Java/Range-Sum-Query-Mutable.java) | _O(logn)_ | _O(n)_ | Medium | Segment Tree | |
| 919 | [Complete Binary Tree Inserter](https://leetcode.com/problems/complete-binary-tree-inserter/) | [Java](./Java/complete-binary-tree-inserter.java) | _O(n)_ | _O(n)_ | Medium | Tree | |
| 124 | [Binary Tree Maximum Path Sum](https://leetcode.com/problems/binary-tree-maximum-path-sum/) | [C++](./C++/Binary-Tree-Maximum-Path-Sum.cpp) | _O(n)_ | _O(n)_ | Hard | Tree | |
| 1028 | [Recover a Tree From Preorder Traversal](https://leetcode.com/problems/recover-a-tree-from-preorder-traversal/) | [C++](./C++/Recover-a-Tree-From-Preorder-Traversal.cpp) | _O(n)_ | _O(n)_ | Hard | Tree | |
| 968 | [Binary Tree Cameras](https://leetcode.com/problems/binary-tree-cameras/) | [C++](./C++/Binary-Tree-Cameras.cpp) | _O(n)_ | _O(logn)_ | Hard | Binary Tree, Dynamic Programming |
| 98 | [Validate Binary Search Tree](https://leetcode.com/problems/validate-binary-search-tree/) | [Javascript](./JavaScript/98.Validate-Binary-Search-Tree.js) | _O(log(n))_ | _O(log(n))_ | Medium | Binary Tree |
| 684 | [Redundant Connection](https://leetcode.com/problems/redundant-connection/) | [Java](./Java/Redundant-Connection/redundant-connection.java) | _O(N)_ | _O(N)_ | Medium | Tree, Union Find |
| 102 | [Binary Tree Level Order Traversal](https://leetcode.com/problems/binary-tree-level-order-traversal/) |[C++](./C++/Binary-Tree-Level-Order-Traversal.cpp)| _O(n)_ | _O(n)_ | Medium | Binary Tree, map | |




⬆️ Back to Top


# Hash Table

| # | Title | Solution | Time | Space | Difficulty | Tag | Video Explanation |
| --- | ------------------------------------------------------------------------- | --------------------------------------------------------------------------------------------- | ----------- | ------ | ---------- | --- | ------------------------------------------------------- |
| 001 | [Two Sum](https://leetcode.com/problems/two-sum/) | [Java](./Java/two-sum.java)
[Python](./Python/1_TwoSum.py)
[C++](./C++/two-sum.cpp) | _O(N)_ | _O(N)_ | Easy | | [Tutorial](https://youtu.be/47xMuvwP7zQ) |
| 242 | [Valid Anagram](https://leetcode.com/problems/valid-anagram/) | [Java](./Java/valid-anagram.java) | _O(n)_ | _O(1)_ | Easy | | [Tutorial](https://www.youtube.com/watch?v=sbX1Ze9lNQE) |
| 146 | [LRU Cache](https://leetcode.com/problems/lru-cache/) | [Java](./Java/LRU-Cache.java) | | | Medium | | |
| 217 | [Contains Duplicate](https://leetcode.com/problems/contains-duplicate/) | [Python](./Python/contains-duplicate.py) | _O(n)_ | _O(n)_ | | |
| 554 | [Brick Wall](https://leetcode.com/problems/brick-wall/) | [C++](./C++/brick-walls.cpp) | _O(n)_ | _O(n)_ | Medium | |
| 049 | [Group Anagrams](https://leetcode.com/problems/group-anagrams/) | [Python](./Python/group_anagram.py) | _O(nlogn)_ | _O(1)_ | Easy | |
| 554 | [Brick Wall](https://leetcode.com/problems/brick-wall/) | [C++](./C++/brick-walls.cpp) | _O(n)_ | _O(n)_ | Medium | |
| 146 | [LRU Cache](https://leetcode.com/problems/lru-cache/) | [Javascript](../JavaScript/146.LRU-Cache.js) | _O(log(n))_ | _O(n)_ | Medium | |
| 389 | [Find The Difference](https://leetcode.com/problems/find-the-difference/) | [C++](../C++/Find-The-Difference.cpp) | _O(n)_ | _O(1)_ | Easy | |




⬆️ Back to Top


# Two Pointers

| # | Title | Solution | Time | Space | Difficulty | Tag | Note |
| --- | --------------------------------------------------------------------------------------------- | ---------------------------------------------------------------------------------------------------------------------- | ---------------------- | ------------------ | ---------- | ----------- | ---------------- |
| 005 | [Longest Palindromic Substring](https://leetcode.com/problems/longest-palindromic-substring/) | [Python](./Python/5_LongestPalindromicSubstring.py)
[JavaScript](./JavaScript/5.Longest-Palindromic-Substring.js) | _O(N^2)_
_O(N^2)_ | _O(N)_
_O(1)_ | Medium | | Expand the Wings |
| 4 | [Median of Two Sorted Arrays](https://leetcode.com/problems/median-of-two-sorted-arrays/) | [Java](./Java/median-of-two-sorted-arrays.java) | _O(log(min(m,n)))_ | _O(1)_ | Hard | | |
| 845 | [Longest Mountain in Array](https://leetcode.com/problems/longest-mountain-in-array/) | [C++](./C++/Longest-Mountain-in-Array.cpp) | _O(N)_ | _O(1)_ | Medium | Two Pointer |
| 015 | [3 Sum](https://leetcode.com/problems/3sum/) | [C++](./C++/3sum.cpp) | _O(N)_ | _O(1)_ | Medium | Two Pointer | |
| 021 | [Merge Two Sorted Lists](https://leetcode.com/problems/merge-two-sorted-lists/) | [C++](./C++/Longest-Mountain-in-Array.cpp) | _O(N)_ | _O(1)_ | Easy | Two Pointer | |




⬆️ Back to Top


# Math

| # | Title | Solution | Time | Space | Difficulty | Tag | Note |
| --- | ------------------------------------------------------------------------------------- | -------------------------------------------------------------------------- | ----------------- | ------ | ---------- | ------ | ------------- |
| 050 | [Pow(x, n)](https://leetcode.com/problems/powx-n/) | [Python](./Python/50.Powxn.py)
[JavaScript](./JavaScript/50.Powxn.js) | _O(n)_ | _O(1)_ | Medium | Math | |
| 204 | [Count Primes](https://leetcode.com/problems/count-primes) | [C++](./C++/Count-Primes.cpp) | _O(n(log(logn)))_ | _O(n)_ | Easy | Math | |
| 171 | [Excel Sheet Column Number](https://leetcode.com/problems/excel-sheet-column-number/) | [C++](./C++/Excel-Sheet-Column-Number.cpp) | _O(n)_ | _O(1)_ | Easy | String | |
| 168 | [Excel Sheet Column Title](https://leetcode.com/problems/excel-sheet-column-title) | [C++](./C++/Excel-Sheet-Column-Title.cpp) | _O(n)_ | _O(n)_ | Easy | String | |
| 007 | [Reverse Integer](https://leetcode.com/problems/reverse-integer) | [Java](./Java/reverse-integer.java)
[C++](./C++/Reverse-Integer.cpp) | _O(n)_ | _O(n)_ | Easy | Math | |
| 202 | [Happy Number](https://leetcode.com/problems/happy-number) | [Java](./Java/Happy-Number.java) | _O(n^2)_ | _O(n)_ | Easy | Math | |
| 326 | [Power of Three](https://leetcode.com/problems/power-of-three) | [Java](./Java/Power-of-Three.java) | _O(logn)_ | _O(n)_ | Easy | Math | |
| 12 | [Integer to Roman](https://leetcode.com/problems/integer-to-roman) | [Java](./Java/integer-to-roman.java) | _O(n)_ | _O(1)_ | Medium | Math | |
| 13 | [Roman to Integer](https://leetcode.com/problems/roman-to-integer) | [Java](./Java/roman-to-integer.java)
[C++](./C++/Roman_to_Integer.cpp)| _O(n)_ | _O(1)_ | Easy | Math | |
| 14 | [Arithmetic Subarrays](https://leetcode.com/problems/arithmetic-subarrays/) | [Java](./Java/Arithmetic-Subarrays.java) | _O(m\*n)_ | _O(n)_ | Medium | Math | Pattern Count |
| 263 | [Ugly Number](https://leetcode.com/problems/ugly-number/) | [Java](./Java/Ugly-Number.java) | _O(n)_ | _O(n)_ | Easy | Math | |
| 412 | [Fizz Buzz](https://leetcode.com/problems/fizz-buzz/) | [Java](./Java/FizzBuzz.java) | _O(n)_ | _O(n)_ | Easy | Math | |
| 1518 | [Water Bottles](https://leetcode.com/problems/water-bottles/) | [Java](./Java/WaterBottles.java) | _O(n)_ | _O(n)_ | Easy | Math | |
| 1822 | [Sign Of Product](https://leetcode.com/problems/sign-of-the-product-of-an-array/) | [Java](./Java/SignOf.java) | _O(n)_ | _O(n)_ | Easy | Math | |
| 991 | [Broken Calculator](https://leetcode.com/problems/broken-calculator/) | [Java](./Java/BrokenCalculator.java) | _O(n)_ | _O(n)_ | Medium | Math | |
| 1837 | [Sum of Digits in Base K](https://leetcode.com/problems/sum-of-digits-in-base-k/) | [Python](./Python/baseK.py) | _O(n)_ | _O(1)_ | Easy | Math | |




⬆️ Back to Top


# Breadth-First Search

| # | Title | Solution | Time | Space | Difficulty | Tag | Note |
| ---- | ----------------------------------------------------------------------------------------------------------------------------------------------------------------- | -------------------------------------------------------------------------------- | ------------------------- | ----------------- | ---------- | --- | ---- |
| 1284 | [Minimum Number of Flips to Convert Binary Matrix to Zero Matrix](https://leetcode.com/problems/minimum-number-of-flips-to-convert-binary-matrix-to-zero-matrix/) | [C++](./C++/Minimum-Number-of-Flips-to-Convert-Binary-Matrix-to-Zero-Matrix.cpp) | _O(m * n * 2 ^ (m \* n))_ | _O(2 ^ (m \* n))_ | Hard | BFS | |
| 200 | [Number of Islands](https://leetcode.com/problems/number-of-islands/) | [Java](./Java/NumberOfIslands.java) | O(R \* C) | O(R \* C) | Medium | BFS |
| 127 | [Word Ladder](https://leetcode.com/problems/word-ladder/) | [Java](./Java/word-ladder.java) | O(N^2 \* M) | O(N \* M) | Medium | BFS |
| 994 | [Rotten Oranges](https://leetcode.com/problems/rotting-oranges/) | [Python](./Python/994_Rotting_Oranges.py) | O(N \* M) | O(N \* M) | Medium | BFS |
| 743 | [Network Delay Time](https://leetcode.com/problems/network-delay-time/) | [C++](./C++/Network-delay-time.cpp) | _O(V+E))_ | O(V) | Medium | BFS |
| 111 | [Min Depth of Binary Tree](https://leetcode.com/problems/minimum-depth-of-binary-tree/) | [JavaScript](./JavaScript/111-minimum-depth-of-binary-tree.js) | O(nlogn) | O(nlogn) | Easy | BFS |
| 100 | [Same Tree](https://leetcode.com/problems/same-tree/) | [C++](https://github.com/codedecks-in/LeetCode-Solutions/blob/master/C%2B%2B/100_Same_Tree.cpp) | O(N) | O(N) | Easy | BFS |





⬆️ Back to Top


# Depth-First Search

| # | Title | Solution | Time | Space | Difficulty | Tag | Note |
| ---- | ---------------------------------------------------------------------------------------------------------- | -------------------------------------------------- | ----------- | ----------- | ---------- | --- | ---- |
| 1463 | [Cherry Pickup II](https://leetcode.com/problems/cherry-pickup-ii/) | [C++](./C++/Cherry-Pickup-II.cpp) | _O(n \* m)_ | _O(n \* m)_ | Hard | DFS | |
| 104 | [Maximum Depth of Binary Tree](https://leetcode.com/problems/maximum-depth-of-binary-tree/) | [python](./Python/maximum-depth-of-binary-tree.py) | _O(n)_ | _O(n)_ | Easy | DFS | |
| 112 | [Path Sum](https://leetcode.com/problems/path-sum/) | [Java](./Java/path-sum.java) | _O(n)_ | _O(n)_ | Easy | DFS | |
| 110 | [Balanced Binary Tree](https://leetcode.com/problems/balanced-binary-tree/) | [Java](./Java/Balanced-Binary-Tree.java) | _O(n)_ | _O(n)_ | Easy | DFS | |
| 1376 | [ Time Needed to Inform All Employees](https://leetcode.com/problems/time-needed-to-inform-all-employees/) | [C++](./C++/Cherry-Pickup-II.cpp) | _O(n)_ | _O(n)_ | Medium | DFS | |
| 200 | [Number of Islands](https://leetcode.com/problems/number-of-islands/) | [C++](./C++/number-of-islands.cpp) | _O(m * n)_ | _O(m * n)_ | Medium | DFS | |




⬆️ Back to Top


# BackTracking

| # | Title | Solution | Time | Space | Difficulty | Tag | Note |
| --- | ------------------------------------------------------------------- | --------------------------------- | ------------------------- | ----------- | ---------- | ------------------- | ---- |
| 037 | [Sudoku Solver](https://leetcode.com/problems/sudoku-solver/) | [C++](./C++/Sudoku-Solver.cpp) | _O(n^2)_ | _O(1)_ | Hard | Hash Table | |
| 980 | [Unique Paths III](https://leetcode.com/problems/unique-paths-iii/) | [C++](./C++/Unique-Paths-III.cpp) | _O(R * C * 2 ^ (R \* C))_ | _O(R \* C)_ | Hard | DFS, Memoization | |
| 39 | [Combination Sum](https://leetcode.com/problems/combination-sum/) | [C++](./C++/combination-sum.cpp) | _O(2^n)_ | _O(n)_ | Medium | Array, Backtracking | |
| 17 | [Letter Combinations of a Phone Number](https://leetcode.com/problems/letter-combinations-of-a-phone-number/) | [C++](./C++/letter-combinations-of-a-phone-number.cpp) | _O(4^n)_ | _O(n)_ | Medium | String, Hash Table, Backtracking | |




⬆️ Back to Top


# Dynamic Programming

| # | Title | Solution | Time | Space | Difficulty | Tag | Note |
| ---- | ------------------------------------------------------------------------------------------------------------------- | --------------------------------------------------------- | --------- | --------- | ---------- | -------------------- | ---- |
| 416 | [ Partition Equal Subset Sum](https://leetcode.com/problems/partition-equal-subset-sum/) | [C++](./C++/Partition-Equal-Subset-Sum.cpp) | _O(n^2)_ | _O(n^2)_ | Medium | DP | |
| 056 | [Wildcard Matching](https://leetcode.com/problems/wildcard-matching/) | [Python](./Python/wildcard-matching.py) | _O(n^2)_ | _O(n^2)_ | Hard | |
| 343 | [Integer Break](https://leetcode.com/problems/integer-break/) | [C++](./C++/Integer-Break.cpp) | _O(n^2)_ | _O(n)_ | Medium | |
| 139 | [Word Break](https://leetcode.com/problems/word-break/) | [Python](./Python/word-break-1.py) | _O(n^3)_ | _O(n)_ | Medium | DP | |
| 1092 | [Shortest Common Supersequence](https://leetcode.com/problems/shortest-common-supersequence/) | [C++](./C++/Shortest-Common-Supersequence.cpp) | _O(n^2)_ | _O(n^2)_ | Hard | DP | |
| 72 | [Edit Distance](https://leetcode.com/problems/edit-distance/) | [Python](./Python/edit-distance.py) | _O(N\*M)_ | _O(n^2)_ | Medium | Levenshtein Distance | |
| 91 | [Decode ways](https://leetcode.com/problems/decode-ways/) | [Python](./Python/decode-ways.py) | _O(N)_ | _O(N)_ | Easy | DP | |
| 1025 | [Divisor Game](https://leetcode.com/problems/divisor-game/) | [Python](./Python/divisor-game.py) | _O(N^2)_ | _O(N)_ | Easy | DP | |
| 174 | [Dungeon Game](https://leetcode.com/problems/dungeon-game/) | [C++](./C++/dungeon-game.pp) | _O(M\*N)_ | _O(M\*N)_ | Hard | Dynamic Programming | |
| 070 | [Climbing Stairs](https://leetcode.com/problems/climbing-stairs/) | [Java](./Java/climbing-stairs.java) | _O(N)_ | _O(1)_ | Easy | DP | |
| 730 | [Count Different Palindromic Subsequences](https://leetcode.com/problems/count-different-palindromic-subsequences/) | [C++](./C++/Count-Different-Palindromic-Subsequences.cpp) | _O(N\*N)_ | _O(N\*N)_ | Hard | DP | |
| 55 | [Jump Game](https://leetcode.com/problems/jump-game/) | [Python](./Python/jumpGame.py) | _O(N)_ | _O(N)_ | Medium | DP | |




⬆️ Back to Top


# Binary Search

| # | Title | Solution | Time | Space | Difficulty | Tag | Note |
| --- | ----------------------------------------------------------------------------------------------------------- | ------------------------------------------------------------------------------------------------------------------------- | --------- | ------ | ---------- | --- | ------------- |
| 035 | [Search Insert Position](https://leetcode.com/problems/search-insert-position/) | [Python](./Python/35.SearchInsertPosition.py) | _O(logn)_ | _O(1)_ | Easy | | Binary Search |
| 278 | [First Bad Version](https://leetcode.com/problems/first-bad-version/) | [Java](./Java/May-LeetCoding-Challenge/Day-1-First-Bad-Version.java)
[JavaScript](./JavaScript/First-Bad-Version.js) | _O(logn)_ | _O(1)_ | Easy | | Binary Search |
| 033 | [Search in Rotated Sorted Array](https://leetcode.com/problems/search-in-rotated-sorted-array/) | [Python](./Python/search-in-rotated-sorted-array.py) | _O(logn)_ | _O(1)_ | Medium | | Binary Search |
| 153 | [Find Minimum in Rotated Sorted Array](https://leetcode.com/problems/find-minimum-in-rotated-sorted-array/) | [Python](./Python/find-minimum-in-rotated-sorted-array.py) | _O(logn)_ | _O(1)_ | Medium | | Binary Search |
| 704 | [Binary Search](https://leetcode.com/problems/binary-search/) | [C++](./C++/BinarySearch.cpp) | _O(logn)_ | _O(1)_ | Easy | | Binary Search |




⬆️ Back to Top


# Graph

| # | Title | Solution | Time | Space | Difficulty | Tag | Note |
| ---- | ------------------------------------------------------------------------------------------------------------------------- | ------------------------------------------------------------ | --------------- | --------- | ---------- | ----- | --------------------------------- |
| 207 | [Course Schedule](https://leetcode.com/problems/course-schedule/) | [C++](./C++/Course-Schedule.cpp) | _O(V+E)_ | _O(V+E)_ | Medium | Graph | Cycle Detection in Directed Graph |
| 1042 | [Flower Planting with No Adjacent](https://leetcode.com/problems/flower-planting-with-no-adjacent/) | [Python](./Python/1042_FlowerPlantingwithNoAdjacent.py) | _O(V+E)_ | _O(2V+E)_ | Medium | Graph | Graph Coloring |
| 797 | [All Paths From Source to Target](https://leetcode.com/problems/all-paths-from-source-to-target/) | [Java](./Java/All_Paths_From_Source_to_Target.java) | _O(N^2)_ | _O(N)_ | Medium | Graph | DFS |
| 934 | [Shortest Bridge](https://leetcode.com/problems/shortest-bridge/) | [C++](./C++/Shortest-Bridge.cpp) | _O(V)_ | _O(V)_ | Medium | Graph | DFS + BFS |
| 1192 | [Critical Connections in a Network](https://leetcode.com/problems/critical-connections-in-a-network/) | [C++](./C++/Critical-Connections-in-a-Network.cpp) | _O(V+E)_ | _O(4V+E)_ | Hard | Graph | Tarjan's Algorithm |
| 113 | [Path Sum II](https://leetcode.com/problems/path-sum-ii/) | [C++](./C++/Critical-Path-Sum-II.cpp) | _O(V+E)_ | _O(V)_ | Medium | Graph | DFS |
| 785 | [Is Graph Bipartite?](https://leetcode.com/problems/is-graph-bipartite/) | [C++](./C++/Is-Graph-Bipartite.cpp) | _O(V+E)_ | _O(V)_ | Medium | Graph | BFS |
| 947 | [Most Stones Removed with Same Row or Column](https://leetcode.com/problems/most-stones-removed-with-same-row-or-column/) | [C++](./C++/Most-Stones-Removed-with-Same-Row-or-Column.cpp) | _O(V)_ | _O(2V)_ | Medium | Graph | Union Find | | [C++](./C++/Most-Stones-Removed-with-Same-Row-or-Column.cpp) | _O(V)_ | _O(2V)_ | Medium | Graph | Union Find |
| 210 | [Course Schedule II](https://leetcode.com/problems/course-schedule-ii/) | [C++](./C++/Course-Schedule-II.cpp) | _O(V+E)_ | _O(V)_ | Medium | Graph | BFS |
| 1627 | [Graph Connectivity with Threshold](https://leetcode.com/problems/graph-connectivity-with-threshold/) | [Java](./Java/graph_connectivity_with_threshold.java) | _O(V.logV + Q)_ | _O(V)_ | Hard | Graph | Union Find + Sieve |
| 1631 | [Path with Minimum Effort](https://leetcode.com/problems/path-with-minimum-effort/) | [Java](./Java/path-with-minimum-effort.java) | _O(V^2)_ | _O(V)_ | Medium | Graph | Dijkstra's Shortest Path |



⬆️ Back to Top


# Learning Resources

codedecks

1.) [Cracking the Coding Interview (Indian Edition)](https://amzn.to/2H0dHy6)

2.) [Data Structures and Algorithms Made Easy in Java](https://amzn.to/33YqWbT)

3.) [Data Structure and Algorithmic Thinking with Python](https://amzn.to/3lz22p4)

4.) [Head First Design Patterns](https://amzn.to/37426Jk)

5.) [Dynamic Programming for Coding Interviews](https://amzn.to/3jVSPqu)

DISCLAIMER: This above mentioned resources have affiliate links, which means if you buy one of the product from my links, I’ll receive a small commission. This helps support the channel and allows us to continue to add more tutorial. Thank you for the support!




⬆️ Back to Top


## Authors

- | [Gourav Rusiya](https://github.com/GouravRusiya30/)


## Contributors

| Name | Country | Programming Language | Where to find you
(add all links to your profiles eg on Hackerrank, Codechef, LeetCode...) |
| -------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | -------------- | -------------------- | --------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- |
| [Gourav R](https://github.com/GouravRusiya30/)
| India | Java | [codedecks](https://www.youtube.com/c/codedecks/)
[Hackerrank](https://www.hackerrank.com/gouravrusiya786)
[LeetCode](https://leetcode.com/rusiya/) |
| [Dima Vishnevetsky](https://github.com/dimshik100)
| Israel | JavaScript | [Twitter](https://twitter.com/dimshik100)
[Facebook](https://www.facebook.com/dimshik) |
| [Anuj Sharma](https://github.com/Optider/)
| India | Python | [Github](https://github.com/Optider) |
| [Lokendra Bohra](https://github.com/lokendra1704/)
| India | Python | [Leetcode](https://t.co/u0OByxhcHA)
[Hackerrank](https://www.hackerrank.com/lokendra17) |
| [Yuri Spiridonov](https://github.com/YuriSpiridonov)
| Russia | Python | [Twitter](https://twitter.com/YuriSpiridonov)
[Leetcode](https://leetcode.com/yurispiridonov/)
[Hackerrank](https://www.hackerrank.com/YuriSpiridonov) |
| [Naveen Kashyap](https://github.com/naveenkash)
| India | Javascript | [Twitter](https://twitter.com/naveen_kashyapp)
[Leetcode](https://leetcode.com/naveenkash/) |
| [Rudra Mishra](https://github.com/Rudra407)
| India | C++ | [Twitter](https://twitter.com/ruDra_Mishra407)
[Leetcode](https://leetcode.com/rudramishra/) |
| [Sachin Singh Negi](https://github.com/sachinnegi)
| India | Python | [Twitter](https://twitter.com/SachinSinghNe17)
[Leetcode](https://leetcode.com/negisachin688/)
[Hackerrrak](https://www.hackerrank.com/negisachin688) |
| [Girish Thatte](https://github.com/girishgr8/)
| India | Java | [Leetcode](https://leetcode.com/girish13/)
[Hackerrank](https://www.hackerrank.com/procoder_13)
[Codechef](https://www.codechef.com/procoder_13) |
| [Kevin Chittilapilly](https://github.com/KevinChittilapilly)
| India | Java | [Leetcode](https://leetcode.com/being_kevin/)
[Hackerrank](https://www.hackerrank.com/ckevinvarghese11)
[Kaggle](https://www.kaggle.com/kevinchittilapilly) |
| [Nour Grati](https://github.com/Nour-Grati)
| Tunisia | Python | [Leetcode](https://leetcode.com/nourgrati/)
[Hackerrank](https://www.hackerrank.com/noor_grati)
[Twitter](https://twitter.com/GratiNour1) |
| [Avinash Trivedi](https://github.com/trivediavinash)
| India | C++ | [Leetcode](https://leetcode.com/avi_002/) |
| [Ishika Goel](https://github.com/ishikagoel5628)
| India | C++ | [Leetcode](https://leetcode.com/ishikagoel5628/) |
| [Fenil Dobariya](https://github.com/ifenil)
| India | Java | [Github](https://github.com/ifenil) |
| [Prashansa Tanwar](https://github.com/prashansatanwar)
| India | C++ | [Leetcode](https://leetcode.com/prashansaaa/) |
| [Ishu Raj](https://github.com/ir2010)
| India | C++ | [Leetcode](https://leetcode.com/ishuraj2010/) |
| [Rakesh Bhadhavath](https://github.com/Revenge-Rakesh)
| India | Java | [Leetcode](https://leetcode.com/goal_cracker/) |
| [Tarun Singh](https://github.com/TarunSingh56)
| India | C++ | [Leetcode](https://leetcode.com/_tarun/) |
| [Hardik Gupta](https://github.com/harrdy272)
| India | C++ | [codeforces](https://codeforces.com/profile/harrdy272)
[codechef](https://www.codechef.com/users/hardikg272)
[Hackerrank](https://www.hackerrank.com/hardikg272)
[LeetCode](https://leetcode.com/hardikg272/) |
| [Jaseem ck](https://github.com/Jaseemck)
| India | Python | [Github](https://github.com/Jaseemck) |
| [Ilias Khan](https://github.com/IliasKhan)
| India | C++ | [codechef](https://www.codechef.com/users/iliaskhan)
[Hackerrank](ckerrank.com/iliaskhan57)
[LeetCode](https://leetcode.com/ilias_khan/)
[codeforces](http://codeforces.com/profile/iliaskhan) |
| [Shamoyeeta Saha](https://github.com/Shamoyeeta)
| India | C++ | [Hackerrank](https://www.hackerrank.com/sahashamoyeeta)
[Github](https://github.com/Shamoyeeta) |
| [James Y](https://github.com/jameszu)
| New Zealand | python | [Github](https://github.com/jameszu) |
| [Hamza B](https://github.com/9Hamza)
| Saudi Arabia | Java | [Github](https://github.com/9Hamza) |
| [Meli Haktas](https://github.com/MercerFrey)
| Turkey | python | [Github](https://github.com/MercerFrey) |
| [Saurav Prateek](https://github.com/SauravP97)
| India | Java | [Github](https://github.com/SauravP97)
[Codechef](https://www.codechef.com/users/srvptk)
[Codeforces](https://codeforces.com/profile/srvptk97)
[Leetcode](https://leetcode.com/srvptk97) |
| [Anushka Verma](https://github.com/verma-anushka)
| India | C++ | [Portfolio](https://verma-anushka.github.io/anushkaverma/)
[LeetCode](https://leetcode.com/anushka_verma/) |
| [James H](https://github.com/HoangJames)
| United Kingdom | C++ | [Github](https://github.com/HoangJames) |
| [Franchis N. Saikia](https://github.com/Francode007)
| India | C++ | [Github](https://github.com/Francode007) |
| [Yarncha](https://github.com/yarncha)
| South Korea | C++ | [LeetCode](https://leetcode.com/yamcha/) |
| [Gamez0](https://github.com/Gamez0)
| South Korea | Python | [LeetCode](https://leetcode.com/Gamez0/) |
| [JeongDaHyeon](https://github.com/JeongDaHyeon)
| South Korea | Java | [GitHub](https://github.com/JeongDaHyeon) |
| [Aysia](https://www.linkedin.com/in/aysiaelise/)
| USA | JavaScript | [GitHub](https://github.com/aysiae) |
| [Poorvi Garg](https://github.com/POORVI111)
| India | C++ | [GitHub](https://github.com/POORVI111) |
| [Lakshmanan Meiyappan](https://laxmena.com)
| India | C++ | [Website - Blog](https://laxmena.com)
[GitHub](https://github.com/laxmena)
[LinekdIn](https://www.linkedin.com/in/lakshmanan-meiyappan/) |
| [Sachin_Upadhyay](https://github.com/sachsbu)
| India | Java | [GitHub](https://github.com/sachsbu)
| [Amisha Sahu](https://github.com/Amisha328)
| India | C++ | [CodeChef](https://www.codechef.com/users/amisha328)
[LeetCode](https://leetcode.com/Mishi328/)
[HackerRank](https://www.hackerrank.com/amishasahu328)
| [Shrimadh V Rao](https://github.com/Shrimadh)
| India | C++ | [GitHub](https://github.com/Shrimadh)
| [Shreyas Shrawage](https://github.com/shreyventure)
| India | Python | [CodeChef](https://www.codechef.com/users/shreyventure)
[LeetCode](https://leetcode.com/shreyventure/)
[HackerRank](https://www.hackerrank.com/shreyas_shrawage)
| [Surbhi Mayank](https://github.com/surbhi2408)
| India | C++ | [GitHub](https://github.com/surbhi2408)
| [Amrit Kumar](https://github.com/amrit-GH23)
| India | C++ | [CodeChef](https://www.codechef.com/users/amrit_kumar08)
[Linkedin](https://www.linkedin.com/in/amrit-kumar-28053b253/)


⬆️ Back to Top