https://github.com/liuyubobobo/Play-Leetcode
My Solutions to Leetcode problems. All solutions support C++ language, some support Java and Python. Multiple solutions will be given by most problems. Enjoy:) 我的Leetcode解答。所有的问题都支持C++语言,一部分问题支持Java语言。近乎所有问题都会提供多个算法解决。大家加油!:)
https://github.com/liuyubobobo/Play-Leetcode
algorithm-challenges algorithm-competitions algorithms interview-questions leetcode-cpp leetcode-solutions
Last synced: about 1 year ago
JSON representation
My Solutions to Leetcode problems. All solutions support C++ language, some support Java and Python. Multiple solutions will be given by most problems. Enjoy:) 我的Leetcode解答。所有的问题都支持C++语言,一部分问题支持Java语言。近乎所有问题都会提供多个算法解决。大家加油!:)
- Host: GitHub
- URL: https://github.com/liuyubobobo/Play-Leetcode
- Owner: liuyubobobo
- Created: 2016-12-01T17:08:20.000Z (over 9 years ago)
- Default Branch: master
- Last Pushed: 2023-11-09T09:31:35.000Z (over 2 years ago)
- Last Synced: 2025-03-23T15:43:33.112Z (about 1 year ago)
- Topics: algorithm-challenges, algorithm-competitions, algorithms, interview-questions, leetcode-cpp, leetcode-solutions
- Language: C++
- Homepage:
- Size: 5.58 MB
- Stars: 2,725
- Watchers: 119
- Forks: 721
- Open Issues: 1
-
Metadata Files:
- Readme: readme.md
Awesome Lists containing this project
- Awesome-AI-algorithm - Github
README
## My solutions to Leetcode
I will put my solutions to [Leetcode Problems](https://leetcode.com/problemset/all/) in this repo. Every problem will be solved in C++; part of the problems will be solved in Java also. I will try my best to support more language in the future :)
Please feel free to contact me if you have any questions with this repo:)
email: [liuyubobobo@gmail.com](mailto:liuyubobobo@gmail.com)
---
大家好,欢迎大家来到我的 **Leetcode 算法题解**代码仓。在这个代码仓中,近乎每一个问题都会使用多种方式进行解决,同时标注了简明的算法思想,时间复杂度和空间复杂度。所有问题都会使用C++进行解决,各别问题支持Java语言和Python语言。
如果对代码仓有任何问题,欢迎联系我:)
**电子邮件**:[liuyubobobo@gmail.com](mailto:liuyubobobo@gmail.com)
**知乎**: [刘宇波 http://www.zhihu.com/people/liuyubobobo](http://www.zhihu.com/people/liuyubobobo)
**知乎专栏:**[是不是很酷 https://zhuanlan.zhihu.com/liuyubobobo](https://zhuanlan.zhihu.com/liuyubobobo)
**个人公众号:是不是很酷**:)

**知识星球(免费)**

## 其他相关代码仓
* [**《算法与数据结构》课程**](https://coding.imooc.com/class/71.html), 代码仓: [Play-with-Algorithms](https://github.com/liuyubobobo/Play-with-Algorithms)
* [**《玩转算法面试》课程**](https://coding.imooc.com/class/82.html), 代码仓: [Play-with-Algorithm-Interview](https://github.com/liuyubobobo/Play-with-Algorithm-Interview)
* [**《看得见的算法》课程**](https://coding.imooc.com/class/138.html), 代码仓: [Play-with-Algorithm-Visualization](https://github.com/liuyubobobo/Play-with-Algorithm-Visualization)
* [**《玩转数据结构》课程**](https://coding.imooc.com/class/207.html), 代码仓: [Play-with-Data-Structures](https://github.com/liuyubobobo/Play-with-Data-Structures)
* [**《玩转图论算法》课程**](https://coding.imooc.com/class/370.html), 代码仓: [Play-with-Graph-Algorithms](https://github.com/liuyubobobo/Play-with-Graph-Algorithms)
* **LeetCode Database 题解代码仓**:[Play Leetcode Database](https://github.com/liuyubobobo/Play-Leetcode-Database/)
## Problems
| ID | Problem | Official
Solution | C++ | Java | Python |
| --- | --- | :---: | :---: | :---: | :---: |
| 001 | [Two Sum](https://leetcode.com/problems/two-sum/description/) | [solution](https://leetcode.com/problems/two-sum/solution/) | [C++](0001-0500/0001-Two-Sum/cpp-0001/) | [Java](0001-0500/0001-Two-Sum/java-0001/src/) | |
| 002 | [Add Two Numbers](https://leetcode.com/problems/add-two-numbers/description/) | [solution](https://leetcode.com/problems/add-two-numbers/solution/) | [C++](0001-0500/0002-Add-Two-Numbers/cpp-0002/) | | |
| 003 | [Longest Substring Without Repeating Characters](https://leetcode.com/problems/longest-substring-without-repeating-characters/description/) | [solution](https://leetcode.com/problems/longest-substring-without-repeating-characters/solution/) | [C++](0001-0500/0003-Longest-Substring-Without-Repeating-Characters/cpp-0003/) | [Java](0001-0500/0003-Longest-Substring-Without-Repeating-Characters/java-0003/src/) | |
| 004 | [Median of Two Sorted Arrays](https://leetcode.com/problems/median-of-two-sorted-arrays/) | [solution](https://leetcode.com/problems/median-of-two-sorted-arrays/solution/) | [C++](0001-0500/0004-Median-of-Two-Sorted-Arrays/cpp-0004/) | [Java](0001-0500/0004-Median-of-Two-Sorted-Arrays/java-0004/) | |
| 005 | [Longest Palindromic Substring](https://leetcode.com/problems/longest-palindromic-substring/) | [solution](https://leetcode.com/problems/longest-palindromic-substring/solution/) | [C++](0001-0500/0005-Longest-Palindromic-Substring/cpp-0005/) | | |
| 006 | [Zigzag Conversion](https://leetcode.com/problems/zigzag-conversion/) | [solution](https://leetcode.com/problems/zigzag-conversion/solution/) | [C++](0001-0500/0006-Zigzag-Conversion/cpp-006/) | | |
| 007 | [Reverse Integer](https://leetcode.com/problems/reverse-integer/description/) | [solution](https://leetcode.com/problems/reverse-integer/solution/) | [C++](0001-0500/0007-Reverse-Integer/cpp-0007/) | | |
| 008 | [String to Integer (atoi)](https://leetcode.com/problems/string-to-integer-atoi/) | [solution](https://leetcode.com/problems/string-to-integer-atoi/solution/) | [C++](0001-0500/0008-String-to-Integer/cpp-0008/) | | |
| | | | | | |
| 010 | [Regular Expression Matching](https://leetcode.com/problems/regular-expression-matching/) | [solution](https://leetcode.com/problems/regular-expression-matching/solution/) | [C++](0001-0500/0010-Regular-Expression-Matching/cpp-0010/) | | |
| 011 | [Container With Most Water](https://leetcode.com/problems/container-with-most-water/description/) | [solution](https://leetcode.com/problems/container-with-most-water/solution/) | [C++](0001-0500/0011-Container-With-Most-Water/cpp-0011/) | | |
| 012 | [Integer to Roman](https://leetcode.com/problems/integer-to-roman/description/) | [无] | [C++](0001-0500/0012-Integer-to-Roman/cpp-0012/) | | |
| 013 | [Roman to Integer](https://leetcode.com/problems/roman-to-integer/description/) | [无] | [C++](0001-0500/0013-Roman-to-Integer/cpp-0013/) | | |
| 014 | [Longest Common Prefix](https://leetcode.com/problems/longest-common-prefix/description/) | [无] | [C++](0001-0500/0014-Longest-Common-Prefix/cpp-0014/) | | |
| 015 | [3Sum](https://leetcode.com/problems/3sum/description/) | [无] | [C++](0001-0500/0015-3Sum/cpp-0015/) | | |
| 016 | [3Sum Closest](https://leetcode.com/problems/3sum-closest/description/) | [无] | [C++](0001-0500/0016-3Sum-Closest/cpp-0016/) | | |
| 017 | [Letter Combinations of a Phone Number](https://leetcode.com/problems/letter-combinations-of-a-phone-number/description/) | [solution](https://leetcode.com/problems/letter-combinations-of-a-phone-number/solution/) | [C++](0001-0500/0017-Letter-Combinations-of-a-Phone-Number/cpp-0017/) | [Java](0001-0500/0017-Letter-Combinations-of-a-Phone-Number/java-0017/src/) | |
| 018 | [4Sum](https://leetcode.com/problems/4sum/description/) | [无] | [C++](0001-0500/0018-4Sum/cpp-0018/) | | |
| 019 | [Remove Nth Node From End of List](https://leetcode.com/problems/remove-nth-node-from-end-of-list/description/) | [solution](https://leetcode.com/problems/remove-nth-node-from-end-of-list/solution/) | [C++](0001-0500/0019-Remove-Nth-Node-From-End-of-List/cpp-0019/) | [Java](0001-0500/0019-Remove-Nth-Node-From-End-of-List/java-0019/src/) | |
| 020 | [Valid Parentheses](https://leetcode.com/problems/valid-parentheses/description/) | [solution](https://leetcode.com/problems/valid-parentheses/solution/) | [C++](0001-0500/0020-Valid-Parentheses/cpp-0020/) | [Java](0001-0500/0020-Valid-Parentheses/java-0020/src/) | |
| 021 | [Merge Two Sorted Lists](https://leetcode.com/problems/merge-two-sorted-lists/description/) | [solution](https://leetcode.com/problems/merge-two-sorted-lists/solution/) | [C++](0001-0500/0021-Merge-Two-Sorted-Lists/cpp-0021/) | | |
| 022 | [Generate Parentheses](https://leetcode.com/problems/generate-parentheses/description/) | [solution](https://leetcode.com/problems/generate-parentheses/solution/) | [C++](0001-0500/0022-Generate-Parentheses/cpp-0022/) | [Java](0001-0500/0022-Generate-Parentheses/java-0022/) | [Python](0022-Generate-Parentheses/py-0022/) |
| 023 | [Merge k Sorted Lists](https://leetcode.com/problems/merge-k-sorted-lists/description/) | [solution](https://leetcode.com/problems/merge-k-sorted-lists/solution/) | [C++](0001-0500/0023-Merge-k-Sorted-Lists/cpp-0023/) | | |
| 024 | [Swap Nodes in Pairs](https://leetcode.com/problems/swap-nodes-in-pairs/description/) | [无] | [C++](0001-0500/0024-Swap-Nodes-in-Pairs/cpp-0024/) | [Java](0001-0500/0024-Swap-Nodes-in-Pairs/java-0024/src/) | |
| 025 | [Reverse Nodes in k-Group](https://leetcode.com/problems/reverse-nodes-in-k-group/description/) | [无] | [C++](0001-0500/0025-Reverse-Nodes-in-k-Group/cpp-0025/) | | |
| 026 | [Remove Duplicates from Sorted Array](https://leetcode.com/problems/remove-duplicates-from-sorted-array/description/) | [solution](https://leetcode.com/problems/remove-duplicates-from-sorted-array/solution/) | [C++](0001-0500/0026-Remove-Duplicates-from-Sorted-Array/cpp-0026/) | | |
| 027 | [Remove Element](https://leetcode.com/problems/remove-element/description/) | [solution](https://leetcode.com/problems/remove-element/solution/) | [C++](0001-0500/0027-Remove-Element/cpp-0027/) | | |
| 028 | [Implement strStr()](https://leetcode.com/problems/implement-strstr/description/) | [无]
[缺:完整BM算法, 其他模式匹配算法] | [C++](0001-0500/0028-Implement-strStr/cpp-0028/) | | |
| 029 | [Divide Two Integers](https://leetcode.com/problems/divide-two-integers/) | [solution](https://leetcode.com/problems/divide-two-integers/solution/)
[缺:不使用乘法加法除法] | [C++](0001-0500/0029-Divide-Two-Integers/cpp-0029/) | | |
| 030 | [Substring with Concatenation of All Words](https://leetcode.com/problems/substring-with-concatenation-of-all-words/) | [solution](https://leetcode.com/problems/substring-with-concatenation-of-all-words/solution/) | [C++](0001-0500/0030-Substring-with-Concatenation-of-All-Words/cpp-0030/) | | |
| 031 | [Next Permutation](https://leetcode.com/problems/next-permutation/) | [solution](https://leetcode.com/problems/next-permutation/solution/) | [C++](0001-0500/0031-Next-Permutation/cpp-0031/) | | |
| | | | | | |
| 033 | [Search in Rotated Sorted Array](https://leetcode.com/problems/search-in-rotated-sorted-array/description/) | [solution](https://leetcode.com/problems/search-in-rotated-sorted-array/solution/) | [C++](0001-0500/0033-Search-in-Rotated-Sorted-Array/cpp-0033/) | | |
| 034 | [Search for a Range](https://leetcode.com/problems/search-for-a-range/description/) | [solution](https://leetcode.com/problems/search-for-a-range/solution/) | [C++](0001-0500/0034-Search-for-a-Range/cpp-0034/) | | |
| 035 | [Search Insert Position](https://leetcode.com/problems/search-insert-position/) | [solution](https://leetcode.com/problems/search-insert-position/solution/) | [C++](0001-0500/0035-Search-Insert-Position/cpp-0035/) | | |
| 036 | [Valid Sudoku](https://leetcode.com/problems/valid-sudoku/description/) | [solution](https://leetcode.com/problems/valid-sudoku/solution/) | [C++](0001-0500/0036-Valid-Sudoku/cpp-0036/) | | |
| 037 | [Sudoku Solver](https://leetcode.com/problems/sudoku-solver/description/) | [solution](https://leetcode.com/problems/sudoku-solver/)
[缺:Dancing Links] | [C++](0001-0500/0037-Sudoku-Solver/cpp-0037/) | [C++](0001-0500/0037-Sudoku-Solver/java-0037/) | |
| 038 | [Count and Say](https://leetcode.com/problems/count-and-say/description/) | [无] | [C++](0001-0500/0038-Count-and-Say/cpp-0038/) | | |
| 039 | [Combination Sum](https://leetcode.com/problems/combination-sum/description/) | [无] | [C++](0001-0500/0039-Combination-Sum/cpp-0039/) | | |
| 040 | [Combination Sum II](https://leetcode.com/problems/combination-sum-ii/description/) | [无] | [C++](0001-0500/0040-Combination-Sum-II/cpp-0040/) | | |
| 041 | [First Missing Positive](https://leetcode.com/problems/first-missing-positive/) | [solution](https://leetcode.com/problems/first-missing-positive/solution/) | [C++](0001-0500/0041-First-Missing-Positive/cpp-0041/) | | |
| 042 | [Trapping Rain Water](https://leetcode.com/problems/trapping-rain-water/description/) | [solution](https://leetcode.com/problems/trapping-rain-water/solution/) | [C++](0001-0500/0042-Trapping-Rain-Water/cpp-0042/) | | |
| 043 | [Multiply Strings](https://leetcode.com/problems/multiply-strings/) | [solution](https://leetcode.com/problems/multiply-strings/solution/) | [C++](0001-0500/0043-Multiply-Strings/cpp-0043/) | | |
| | | | | | |
| 045 | [Jump Game II](https://leetcode.com/problems/jump-game-ii/) | [solution](https://leetcode.com/problems/jump-game-ii/solution/) | [C++](0001-0500/0045-Jump-Game-II/cpp-0045/) | | |
| 046 | [Permutations](https://leetcode.com/problems/permutations/description/) | [solution](https://leetcode.com/problems/permutations/solution/)
[缺:排列算法整理] | [C++](0001-0500/0046-Permutations/cpp-0046/) | [Java](0001-0500/0046-Permutations/java-0046/src/) | |
| 047 | [Permutations II](https://leetcode.com/problems/permutations-ii/description/) | [无] | [C++](0001-0500/0047-Permutations-II/cpp-0047/) | | |
| 048 | [Rotate Image](https://leetcode.com/problems/rotate-image/description/) | [solution](https://leetcode.com/problems/rotate-image/) | [C++](0001-0500/0048-Rotate-Image/cpp-0048/) | | |
| 049 | [Group Anagrams](https://leetcode.com/problems/group-anagrams/description/) | [solution](https://leetcode.com/problems/group-anagrams/solution/) | [C++](0001-0500/0049-Group-Anagrams/cpp-0049/) | | |
| 050 | [Pow(x, n)](https://leetcode.com/problems/powx-n/) | [无] | [C++](0001-0500/0050-Pow-x-n/cpp-0050/) | | |
| 051 | [N-Queens](https://leetcode.com/problems/n-queens/description/) | [缺:N皇后问题整理] | [C++](0001-0500/0051-N-Queens/cpp-0051/) | [Java](0001-0500/0051-N-Queens/java-0051/src/) | |
| 052 | [N-Queens II](https://leetcode.com/problems/n-queens-ii/) | [solution](https://leetcode.com/problems/n-queens-ii/solution/)
[缺:N皇后问题整理] | [C++](0001-0500/0052-N-Queens-II/cpp-0052/) | | |
| 053 | [Maximum Subarray](https://leetcode.com/problems/maximum-subarray/) | [solution](https://leetcode.com/problems/maximum-subarray/solution/) | [C++](0001-0500/0053-Maximum-Subarray/cpp-0053/) | | |
| 054 | [Spiral Matrix](https://leetcode.com/problems/spiral-matrix/description/) | [solution](https://leetcode.com/problems/spiral-matrix/solution/) | [C++](0001-0500/0054-Spiral-Matrix/cpp-0054/) | | |
| 055 | [Jump Game](https://leetcode.com/problems/jump-game/) | [solution](https://leetcode.com/problems/jump-game/solution/) | [C++](0001-0500/0055-Jump-Game/cpp-0055/) | | |
| 056 | [Merge Intervals](https://leetcode.com/problems/merge-intervals/description/) | [solution](https://leetcode.com/problems/merge-intervals/solution/) | [C++](0001-0500/0056-Merge-Intervals/cpp-0056/) | | |
| 057 | [Insert Interval](https://leetcode.com/problems/insert-interval/) | [solution](https://leetcode.com/problems/insert-interval/solutions/2914120/insert-intervals/?orderBy=most_votes) | [C++](0001-0500/0057-Insert-Interval/cpp-0057/) | | |
| 058 | [Length of Last Word](https://leetcode.com/problems/length-of-last-word/) | [solution](https://leetcode.com/problems/length-of-last-word/solution/) | [C++](0001-0500/0058-Length-of-Last-Word/cpp-0058/) | | |
| 059 | [Spiral Matrix II](https://leetcode.com/problems/spiral-matrix-ii/description/) | [无] | [C++](0001-0500/0059-Spiral-Matrix-II/cpp-0059/) | | |
| | | | | | |
| 061 | [Rotate List](https://leetcode.com/problems/rotate-list/description/) | [solution](https://leetcode.com/problems/rotate-list/solution/) | [C++](0001-0500/0061-Rotate-List/cpp-0061/) | | |
| 062 | [Unique Paths](https://leetcode.com/problems/unique-paths/) | [无]
[缺:数学解] | [C++](0001-0500/0062-Unique-Paths/cpp-0062/) | | |
| 063 | [Unique Paths II](https://leetcode.com/problems/unique-paths-ii/) | [solution](https://leetcode.com/problems/unique-paths-ii/solution/) | [C++](0001-0500/0063-Unique-Paths-II/cpp-0063/) | | |
| 064 | [Minimum Path Sum](https://leetcode.com/problems/minimum-path-sum/description/) | [solution](https://leetcode.com/problems/minimum-path-sum/solution/) | [C++](0001-0500/0064-Minimum-Path-Sum/cpp-0064/) | [Java](0001-0500/0064-Minimum-Path-Sum/java-0064/src/) | [Python](0001-0500/0064-Minimum-Path-Sum/py-0064/) |
| 065 | [Valid Number](https://leetcode.com/problems/valid-number/) | [solution](https://leetcode.com/problems/valid-number/solution/) | [C++](0001-0500/0065-Valid-Number/cpp-0065/) | | |
| 066 | [Plus One](https://leetcode.com/problems/plus-one/description/) | [无] | [C++](0001-0500/0066-Plus-One/cpp-0066/) | | |
| 067 | [Add Binary](https://leetcode.com/problems/add-binary/description/) | [无] | [C++](0001-0500/0067-Add-Binary/cpp-0067/) | | |
| 068 | [Text Justification](https://leetcode.com/problems/text-justification/) | [无] | [C++](0001-0500/0068-Text-Justification/cpp-0068/) | | |
| 069 | [Sqrt(x)](https://leetcode.com/problems/sqrtx/description/)| [无] | [C++](0001-0500/0069-Sqrt-x/cpp-0069/) | | |
| 070 | [Climbing Stairs](https://leetcode.com/problems/climbing-stairs/description/) | [solution](https://leetcode.com/problems/climbing-stairs/solution/) | [C++](0001-0500/0070-Climbing-Stairs/cpp-0070/) | [Java](0001-0500/0070-Climbing-Stairs/java-0070/src/) | |
| 071 | [Simplify Path](https://leetcode.com/problems/simplify-path/) | [无] | [C++](0001-0500/0071-Simplify-Path/cpp-0071/) | | |
| 072 | [Edit Distance](https://leetcode.com/problems/edit-distance/) | [solution](https://leetcode.com/problems/edit-distance/solution/) | [C++](0001-0500/0072-Edit-Distance/cpp-0072/) | | |
| 073 | [Set Matrix Zeroes](https://leetcode.com/problems/set-matrix-zeroes/description/) | [solution](https://leetcode.com/problems/set-matrix-zeroes/solution/) | [C++](0001-0500/0073-Set-Matrix-Zeroes/cpp-0073/) | | |
| 074 | [Search a 2D Matrix](https://leetcode.com/problems/search-a-2d-matrix/) | [无] | [C++](0001-0500/0074-Search-a-2D-Matrix/cpp-0074/) | | |
| 075 | [Sort Colors](https://leetcode.com/problems/sort-colors/description/) | [solution](https://leetcode.com/problems/sort-colors/solution/) | [C++](0001-0500/0075-Sort-Colors/cpp-0075/) | [Java](0001-0500/0075-Sort-Colors/java-0075/src/) | [Python](0001-0500/0075-Sort-Colors/py-0075/) |
| 076 | [Minimum Window Substring](https://leetcode.com/problems/minimum-window-substring/description/) | [solution](https://leetcode.com/problems/minimum-window-substring/solution/) | [C++](0001-0500/0076-Minimum-Window-Substring/cpp-0076/) | | |
| 077 | [Combinations](https://leetcode.com/problems/combinations/description/) | [solution](https://leetcode.com/problems/combinations/solution/) | [C++](0001-0500/0077-Combinations/cpp-0077/) | [Java](0001-0500/0077-Combinations/java-0077/src/) | |
| 078 | [Subsets](https://leetcode.com/problems/subsets/) | [solution](https://leetcode.com/problems/subsets/solution/) | [C++](0001-0500/0078-Subsets/cpp-0078/) | | |
| 079 | [Word Search](https://leetcode.com/problems/word-search/description/) | [无] | [C++](0001-0500/0079-Word-Search/cpp-0079/) | [Java](0001-0500/0079-Word-Search/java-0079/src/) | |
| 080 | [Remove Duplicates from Sorted Array II](https://leetcode.com/problems/remove-duplicates-from-sorted-array-ii/description/) | [无] | [C++](0001-0500/0080-Remove-Duplicates-from-Sorted-Array-II/cpp-0080/) | | |
| 081 | [Search in Rotated Sorted Array II](https://leetcode.com/problems/search-in-rotated-sorted-array-ii/) | [solution](https://leetcode.com/problems/search-in-rotated-sorted-array-ii/solution/) | [C++](0001-0500/0081-Search-in-Rotated-Sorted-Array-II/cpp-0081/) | | |
| 082 | [Remove Duplicates from Sorted List II](https://leetcode.com/problems/remove-duplicates-from-sorted-list-ii/) | [无] | [C++](0001-0500/0082-Remove-Duplicates-from-Sorted-List-II/cpp-0082/) | | |
| 083 | [Remove Duplicates from Sorted List](https://leetcode.com/problems/remove-duplicates-from-sorted-list/) | [无] | [C++](0001-0500/0083-Remove-Duplicates-from-Sorted-List/cpp-0083/) | | |
| 084 | [Largest Rectangle in Histogram](https://leetcode.com/problems/largest-rectangle-in-histogram/) | [solution](https://leetcode.com/problems/largest-rectangle-in-histogram/solution/) [题解](https://leetcode-cn.com/problems/largest-rectangle-in-histogram/solution/zhu-zhuang-tu-zhong-zui-da-de-ju-xing-by-leetcode/) | [C++](0001-0500/0084-Largest-Rectangle-in-Histogram/cpp-0084/) | | |
| 085 | [Maximal Rectangle](https://leetcode.com/problems/maximal-rectangle/) | [solution](https://leetcode.com/problems/maximal-rectangle/solution/) | [C++](0001-0500/0085-Maximal-Rectangle/cpp-0085/) | | |
| 086 | [Partition List](https://leetcode.com/problems/partition-list/description/) | [solution](https://leetcode.com/problems/partition-list/solution/) | [C++](0001-0500/0086-Partition-List/cpp-0086/) | | |
| 087 | [Scramble String](https://leetcode.com/problems/scramble-string/description/) | [无] | [C++](0001-0500/0087-Scramble-String/cpp-0087/) | | |
| 088 | [Merge Sorted Array](https://leetcode.com/problems/merge-sorted-array/description/) | [solution](https://leetcode.com/problems/merge-sorted-array/solution/) | [C++](0001-0500/0088-Merge-Sorted-Array/cpp-0088/) | [Java](0001-0500/0088-Merge-Sorted-Array/java-0088/) | |
| 089 | [Gray Code](https://leetcode.com/problems/gray-code/) | [无] | [C++](0001-0500/0089-Gray-Code/cpp-0089/) | | |
| 090 | [Subsets II](https://leetcode.com/problems/subsets-ii/) | [无] | [C++](0001-0500/0090-Subsets-II/cpp-0090/) | | |
| 091 | [Decode Ways](https://leetcode.com/problems/decode-ways/) | [无] | [C++](0001-0500/0091-Decode-Ways/cpp-0091/) | | |
| 092 | [Reverse Linked List II](https://leetcode.com/problems/reverse-linked-list-ii/description/) | [solution](https://leetcode.com/problems/reverse-linked-list-ii/solution/) | [C++](0001-0500/0092-Reverse-Linked-List-II/cpp-0092/) | | |
| 093 | [Restore IP Addresses](https://leetcode.com/problems/restore-ip-addresses/) | [solution](https://leetcode.com/problems/restore-ip-addresses/solution/) | [C++](0001-0500/0093-Restore-IP-Addresses/cpp-0093/) | | |
| 094 | [Binary Tree Inorder Traversal](https://leetcode.com/problems/binary-tree-inorder-traversal/description/) | [solution](https://leetcode.com/problems/binary-tree-inorder-traversal/solution/) | [C++](0001-0500/0094-Binary-Tree-Inorder-Traversal/cpp-0094/) | [Java](0001-0500/0094-Binary-Tree-Inorder-Traversal/java-0094/src/) | |
| 095 | [Unique Binary Search Trees II](https://leetcode.com/problems/unique-binary-search-trees-ii/description/) | [solution](https://leetcode.com/problems/unique-binary-search-trees-ii/solution/) | [C++](0001-0500/0095-Unique-Binary-Search-Trees-II/cpp-0095/) | | |
| 096 | [Unique Binary Search Trees](https://leetcode.com/problems/unique-binary-search-trees/description/) | [solution](https://leetcode.com/problems/unique-binary-search-trees/solution/) | [C++](0001-0500/0096-Unique-Binary-Search-Trees/cpp-0096/) | | |
| 097 | [Interleaving String](https://leetcode.com/problems/interleaving-string/) | [solution](https://leetcode.com/problems/interleaving-string/solution/)
[缺:DP] | [C++](0001-0500/0097-Interleaving-String/cpp-0097/) | | |
| 098 | [Validate Binary Search Tree](https://leetcode.com/problems/validate-binary-search-tree/description/) | [solution](https://leetcode.com/problems/validate-binary-search-tree/solution/) | [C++](0001-0500/0098-Validate-Binary-Search-Tree/cpp-0098/) | [Java](0001-0500/0098-Validate-Binary-Search-Tree/java-0098/src/) | |
| 099 | [Recover Binary Search Tree](https://leetcode.com/problems/recover-binary-search-tree/description/) | [无] | | [Java](0001-0500/0099-Recover-Binary-Search-Tree/java-0099/src/) | |
| 100 | [Same Tree](https://leetcode.com/problems/same-tree/description/) | [solution](https://leetcode.com/problems/same-tree/solution/) | [C++](0001-0500/0100-Same-Tree/cpp-0100/) | | |
| 101 | [Symmetric Tree](https://leetcode.com/problems/symmetric-tree/description/) | [solution](https://leetcode.com/problems/symmetric-tree/solution/) | [C++](0001-0500/0101-Symmetric-Tree/cpp-0101/) | | [Python](0001-0500/0101-Symmetric-Tree/py-0101/) |
| 102 | [Binary Tree Level Order Traversal](https://leetcode.com/problems/binary-tree-level-order-traversal/description/) | [solution](https://leetcode.com/problems/binary-tree-level-order-traversal/solution/) | [C++](0001-0500/0102-Binary-Tree-Level-Order-Traversal/cpp-0102/) | [Java](0001-0500/0102-Binary-Tree-Level-Order-Traversal/java-0102/src/) | |
| 103 | [Binary Tree Zigzag Level Order Traversal](https://leetcode.com/problems/binary-tree-zigzag-level-order-traversal/) | [无] | [C++](0001-0500/0103-Binary-Tree-Zigzag-Level-Order-Traversal/cpp-0103/) | | |
| 104 | [Maximum Depth of Binary Tree](https://leetcode.com/problems/maximum-depth-of-binary-tree/description/) | [solution](https://leetcode.com/problems/maximum-depth-of-binary-tree/solution/) | [C++](0001-0500/0104-Maximum-Depth-of-Binary-Tree/cpp-0104/) | [Java](0001-0500/0104-Maximum-Depth-of-Binary-Tree/java-0104/src/) | |
| 105 | [Construct Binary Tree from Preorder and Inorder Traversal](https://leetcode.com/problems/construct-binary-tree-from-preorder-and-inorder-traversal/description/) | [solution](https://leetcode.com/problems/construct-binary-tree-from-preorder-and-inorder-traversal/solution/) | [C++](0001-0500/0105-Construct-Binary-Tree-from-Preorder-and-Inorder-Traversal/cpp-0105/) | | |
| 106 | [Construct Binary Tree from Inorder and Postorder Traversal](https://leetcode.com/problems/construct-binary-tree-from-inorder-and-postorder-traversal/description/) | [无] | [C++](0001-0500/0106-Construct-Binary-Tree-from-Inorder-and-Postorder-Traversal/cpp-0106/) | | |
| 107 | [Binary Tree Level Order Traversal II](https://leetcode.com/problems/binary-tree-level-order-traversal-ii/description/) | [无] | [C++](0001-0500/0107-Binary-Tree-Level-Order-Traversal-II/cpp-0107/) | | |
| 108 | [Convert Sorted Array to Binary Search Tree](https://leetcode.com/problems/convert-sorted-array-to-binary-search-tree/) | [无] | [C++](0001-0500/0108-Convert-Sorted-Array-to-Binary-Search-Tree/cpp-0108/) | | |
| 109 | [Convert Sorted List to Binary Search Tree](https://leetcode.com/problems/convert-sorted-list-to-binary-search-tree/description/) | [solution](https://leetcode.com/problems/convert-sorted-list-to-binary-search-tree/solution/) | [C++](0001-0500/0109-Convert-Sorted-List-to-Binary-Search-Tree/cpp-0109/) | | |
| 110 | [Balanced Binary Tree](https://leetcode.com/problems/balanced-binary-tree/) | [solution](https://leetcode.com/problems/balanced-binary-tree/solution/) | [C++](0001-0500/0110-Balanced-Binary-Tree/cpp-0110/) | | |
| 111 | [Minimum Depth of Binary Tree](https://leetcode.com/problems/minimum-depth-of-binary-tree/description/) | [solution](https://leetcode.com/problems/minimum-depth-of-binary-tree/solution/) | [C++](0001-0500/0111-Minimum-Depth-of-Binary-Tree/cpp-0111/) | | |
| 112 | [Path Sum](https://leetcode.com/problems/path-sum/description/) | [solution](https://leetcode.com/problems/path-sum/solution/) | [C++](0001-0500/0112-Path-Sum/cpp-0112/) | [Java](0001-0500/0112-Path-Sum/cpp-0112/src/) | |
| 113 | [Path Sum II](https://leetcode.com/problems/path-sum-ii/description/) | [无] | [C++](0001-0500/0113-Path-Sum-II/cpp-0113/) | | |
| 114 | [Flatten Binary Tree to Linked List](https://leetcode.com/problems/flatten-binary-tree-to-linked-list/) | [solution](https://leetcode.com/problems/flatten-binary-tree-to-linked-list/solution/) | [C++](0001-0500/0114-Flatten-Binary-Tree-to-Linked-List/cpp-0114/) | | |
| 115 | [Distinct Subsequences](https://leetcode.com/problems/distinct-subsequences/description/) | [无] | [C++](0001-0500/0115/Distinct-Subsequences/cpp-0115/) | [Java](0001-0500/0115/Distinct-Subsequences/java-0115/) | |
| 116 | [Populating Next Right Pointers in Each Node](https://leetcode.com/problems/populating-next-right-pointers-in-each-node/description/) | [无] | [C++](0001-0500/0116-Populating-Next-Right-Pointers-in-Each-Node/cpp-0116/) | | |
| 117 | [Populating Next Right Pointers in Each Node II](https://leetcode.com/problems/populating-next-right-pointers-in-each-node-ii/) | [无] | [C++](0001-0500/0117-Populating-Next-Right-Pointers-in-Each-Node-II/cpp-0117/) | | |
| 118 | [Pascal's Triangle](https://leetcode.com/problems/pascals-triangle/description/) | [solution](https://leetcode.com/problems/pascals-triangle/solution/) | [C++](0001-0500/0118-Pascals-Triangle/cpp-0118/) | | |
| 119 | [Pascal's Triangle II](https://leetcode.com/problems/pascals-triangle-ii/description/) | [无] | [C++](0001-0500/0119-Pascals-Triangle-II/cpp-0119/) | | |
| 120 | [Triangle](https://leetcode.com/problems/triangle/description/) | [无] | [C++](0001-0500/0120-Triangle/cpp-0120/) | | |
| 121 | [Best Time to Buy and Sell Stock](https://leetcode.com/problems/best-time-to-buy-and-sell-stock/solution/) | | [C++](0001-0500/0121-Best-Time-to-Buy-and-Sell-Stock/cpp-0121/) | | |
| 122 | [Best Time to Buy and Sell Stock II](https://leetcode.com/problems/best-time-to-buy-and-sell-stock-ii/description/) | [solution](https://leetcode.com/problems/best-time-to-buy-and-sell-stock-ii/solution/) | [C++](0001-0500/0122-Best-Time-to-Buy-and-Sell-Stock-II/cpp-0122/) | | |
| 123 | [Best Time to Buy and Sell Stock III](https://leetcode.com/problems/best-time-to-buy-and-sell-stock-iii/description/) | | [C++](0001-0500/0123-Best-Time-to-Buy-and-Sell-Stock-III/cpp-0123/) | | |
| 124 | [Binary Tree Maximum Path Sum](https://leetcode.com/problems/binary-tree-maximum-path-sum/) | [solution](https://leetcode.com/problems/binary-tree-maximum-path-sum/) | [C++](0001-0500/0124-Binary-Tree-Maximum-Path-Sum/cpp-0124/) | | |
| 125 | [Valid Palindrome](https://leetcode.com/problems/valid-palindrome/description/) | [无] | [C++](0001-0500/0125-Valid-Palindrome/cpp-0125/) | | |
| 126 | [Word Ladder II](https://leetcode.com/problems/word-ladder-ii/description/) | [无]
[缺:双端搜索] | [C++](0001-0500/0126-Word-Ladder-II/cpp-0126/) | | |
| 127 | [Word Ladder](https://leetcode.com/problems/word-ladder/description/) | [solution](https://leetcode.com/problems/word-ladder/solution/) | [C++](0001-0500/0127-Word-Ladder/cpp-0127/) | [Java](0001-0500/0127-Word-Ladder/java-0127/) | |
| 128 | [Longest Consecutive Sequence](https://leetcode.com/problems/longest-9consecutive-sequence/description/) | | [C++](0001-0500/0128-Longest-Consecutive-Sequence/cpp-0128/) | | |
| 129 | [Sum Root to Leaf Numbers](https://leetcode.com/problems/sum-root-to-leaf-numbers/description/) | [无] | [C++](0001-0500/0129-Sum-Root-to-Leaf-Numbers/cpp-0129/) | | |
| 130 | [Surrounded Regions](https://leetcode.com/problems/surrounded-regions/description/) | [无] | [C++](0001-0500/0130-Surrounded-Regions/cpp-0130/) | | |
| 131 | [Palindrome Partitioning](https://leetcode.com/problems/palindrome-partitioning/) | [solution](https://leetcode.com/problems/palindrome-partitioning/solution/)
[缺:DP] | [C++](0001-0500/0131-Palindrome-Partitioning/cpp-0131/) | | |
| 132 | [Palindrome Partitioning II](https://leetcode.com/problems/palindrome-partitioning-ii/) | [无] | [C++](0001-0500/0132-Palindrome-Partitioning-II/cpp-0132/) | | |
| 133 | [Clone Graph](https://leetcode.com/problems/clone-graph/description/) | [无] | [C++](0001-0500/0133-Clone-Graph/cpp-0133/) | | |
| 134 | [Gas Station](https://leetcode.com/problems/gas-station/) | [solution](https://leetcode.com/problems/gas-station/solution/) | [C++](0001-0500/0134-Gas-Station/cpp-0134/) | | |
| 135 | [Candy](https://leetcode.com/problems/candy/) | [solution](https://leetcode.com/problems/candy/solution/)
[缺:O(1)空间算法] | [C++](0001-0500/0135-Candy/cpp-0135/) | | |
| 136 | [Single Number](https://leetcode.com/problems/single-number/description/) | [solution](https://leetcode.com/problems/single-number/solution/) | [C++](0001-0500/0136-Single-Number/cpp-0136/) | | |
| 137 | [Single Number II](https://leetcode.com/problems/single-number-ii/) | [solution](https://leetcode.com/problems/single-number-ii/solution/) | [C++](0001-0500/0137-Single-Number-II/cpp-0137/) | | |
| 138 | [Copy List with Random Pointer](https://leetcode.com/problems/copy-list-with-random-pointer/description/) | [solution](https://leetcode.com/problems/copy-list-with-random-pointer/solution/) | [C++](0001-0500/0138-Copy-List-with-Random-Pointer/cpp-0138/) | | |
| 139 | [Word Break](https://leetcode.com/problems/word-break/) | [solution](https://leetcode.com/problems/word-break/solution/) | [C++](0001-0500/0139-Word-Break/cpp-0139/) | | |
| | | | | | |
| 141 | [Linked List Cycle](https://leetcode.com/problems/linked-list-cycle/description/) | [solution](https://leetcode.com/problems/linked-list-cycle/solution/) | [C++](0001-0500/0141-Linked-List-Cycle/cpp-0141/) | | |
| 142 | [Linked List Cycle II](https://leetcode.com/problems/linked-list-cycle-ii/description/) | [solution](https://leetcode.com/problems/linked-list-cycle-ii/description/) | [C++](0001-0500/0142-Linked-List-Cycle-II/cpp-0142/) | | |
| 143 | [Reorder List](https://leetcode.com/problems/reorder-list/) | [无] | [C++](0001-0500/0143-Reorder-List/cpp-0143/) | | |
| 144 | [Binary Tree Preorder Traversal](https://leetcode.com/problems/binary-tree-preorder-traversal/description/) | [solution](https://leetcode.com/problems/binary-tree-preorder-traversal/) | [C++](0001-0500/0144-Binary-Tree-Preorder-Traversal/cpp-0144/) | [Java](0001-0500/0144-Binary-Tree-Preorder-Traversal/java-0144/src/) | |
| 145 | [Binary Tree Postorder Traversal](https://leetcode.com/problems/binary-tree-postorder-traversal/description/) | [solution](https://leetcode.com/problems/binary-tree-postorder-traversal/solution/) | [C++](0001-0500/0145-Binary-Tree-Postorder-Traversal/cpp-0145/) | [Java](0001-0500/0145-Binary-Tree-Postorder-Traversal/java-0145/src/) | |
| 146 | [LRU Cache](https://leetcode.com/problems/lru-cache/) | [solution](https://leetcode.com/problems/lru-cache/solution/)
[缺:封装一个Double Linked List] | [C++](0001-0500/0146-LRU-Cache/cpp-0146/) | | |
| 147 | [Insertion Sort List](https://leetcode.com/problems/insertion-sort-list/) | [无] | [C++](0001-0500/0147-Insertion-Sort-List/cpp-0147/) | | |
| 148 | [Sort List](https://leetcode.com/problems/sort-list/description/) | [无] | [C++](0001-0500/0148-Sort-List/cpp-0148/) | | |
| 149 | [Max Points on a Line](https://leetcode.com/problems/max-points-on-a-line/description/) | [solution](https://leetcode.com/problems/max-points-on-a-line/solution/) | [C++](0001-0500/0149-Max-Points-on-a-Line/cpp-0149/) | | |
| 150 | [Evaluate Reverse Polish Notation](https://leetcode.com/problems/evaluate-reverse-polish-notation/description/) | [无] | [C++](0001-0500/0150-Evaluate-Reverse-Polish-Notation/cpp-0150/) | | |
| 151 | [Reverse Words in a String](https://leetcode.com/problems/reverse-words-in-a-string/description/) | [无] | [C++](0001-0500/151-Reverse-Words-in-a-String/cpp-0151/) | | |
| 152 | [Maximum Product Subarray](https://leetcode.com/problems/maximum-product-subarray/) | [solution](https://leetcode.com/problems/maximum-product-subarray/)
[缺:Linear] | [C++](0001-0500/0152-Maximum-Product-Subarray/cpp-0152/) | | [Python](0001-0500/0152-Maximum-Product-Subarray/py-0152/) |
| 153 | [Find Minimum in Rotated Sorted Array](https://leetcode.com/problems/find-minimum-in-rotated-sorted-array/description/) | [solution](https://leetcode.com/problems/find-minimum-in-rotated-sorted-array/solution/) | [C++](0001-0500/0153-Find-Minimum-in-Rotated-Sorted-Array/cpp-0153/) | | |
| | | | | | |
| 155 | [Min Stack](https://leetcode.com/problems/min-stack/description/) | [无] | [C++](0001-0500/0155-Min-Stack/cpp-0155/) | | |
| | | | | | |
| 159 | [Longest Substring with At Most Two Distinct Characters](https://leetcode.com/problems/longest-substring-with-at-most-two-distinct-characters/description/) | [solution](https://leetcode.com/problems/longest-substring-with-at-most-two-distinct-characters/solution/) | [C++](0001-0500/0159-Longest-Substring-with-At-Most-Two-Distinct-Characters/cpp-0159/) | | |
| 160 | [Intersection of Two Linked Lists](https://leetcode.com/problems/intersection-of-two-linked-lists/description/) | [solution](https://leetcode.com/problems/intersection-of-two-linked-lists/solution/) | [C++](0001-0500/0160-Intersection-of-Two-Linked-Lists/cpp-0160/) | | |
| 161 | [One Edit Distance](https://leetcode.com/problems/one-edit-distance/) | [solution](https://leetcode.com/problems/one-edit-distance/solution/) | [C++](0001-0500/0161-One-Edit-Distance/cpp-0161/) | | |
| 162 | [Find Peak Element](https://leetcode.com/problems/find-peak-element/) | [solution](https://leetcode.com/problems/find-peak-element/solution/) | [C++](0001-0500/0162-Find-Peak-Element/cpp-0162/) | | |
| 163 | [Missing Ranges](https://leetcode.com/problems/missing-ranges/) | [solution](https://leetcode.com/problems/missing-ranges/solution/) | [C++](0001-0500/0163-Missing-Ranges/cpp-0163/) | | |
| 164 | [Maximum Gap](https://leetcode.com/problems/maximum-gap/) | [solution](https://leetcode.com/problems/maximum-gap/solution/)
[缺:桶排序] | [C++](0001-0500/0164-Maximum-Gap/cpp-0164/) | | |
| 165 | [Compare Version Numbers](https://leetcode.com/problems/compare-version-numbers/) | [solution](https://leetcode.com/problems/compare-version-numbers/solution/) | [C++](0001-0500/0165-Compare-Version-Numbers/cpp-0165/) | | |
| 166 | [Fraction to Recurring Decimal](https://leetcode.com/problems/fraction-to-recurring-decimal/) | [solution](https://leetcode.com/problems/fraction-to-recurring-decimal/solution/) | [C++](0001-0500/0166-Fraction-to-Recurring-Decimal/cpp-0166/) | | |
| 167 | [Two Sum II - Input array is sorted](https://leetcode.com/problems/two-sum-ii-input-array-is-sorted/description/) | [solution](https://leetcode.com/problems/two-sum-ii-input-array-is-sorted/solution/) | [C++](0001-0500/0167-Two-Sum-II-Input-array-is-sorted/cpp-0167/) | [Java](0001-0500/0167-Two-Sum-II-Input-array-is-sorted/java-0167/src/) | |
| 168 | [Excel Sheet Column Title](https://leetcode.com/problems/excel-sheet-column-title/) | [无] | [C++](0001-0500/0168-Excel-Sheet-Column-Title/cpp-0168/) | | |
| 169 | [Majority Element](https://leetcode.com/problems/majority-element/description/) | [solution](https://leetcode.com/problems/majority-element/solution/) | [C++](0001-0500/0169-Majority-Element/cpp-0169/) | | [Python](0001-0500/0169-Majority-Element/py-0169/) |
| 170 | [Two Sum III - Data structure design](https://leetcode.com/problems/two-sum-iii-data-structure-design/description/) | [无] | [C++](0001-0500/0170-Two-Sum-III-Data-structure-design/cpp-0170/) | | |
| 171 | [Excel Sheet Column Number](https://leetcode.com/problems/excel-sheet-column-number/description/) | [无] | [C++](0001-0500/0171-Excel-Sheet-Column-Number/cpp-0171/) | | |
| 172 | [Factorial Trailing Zeroes](https://leetcode.com/problems/factorial-trailing-zeroes/) | [solution](https://leetcode.com/problems/factorial-trailing-zeroes/solution/) | [C++](0001-0500/0172/Factorial-Trailing-Zeroes/cpp-0172/) | | |
| 173 | [Binary Search Tree Iterator](https://leetcode.com/problems/binary-search-tree-iterator/description/) | [无]
[缺:Morris遍历] | [C++](0001-0500/0173-Binary-Search-Tree-Iterator/cpp-0173/) | | |
| 174 | [Dungeon Game](https://leetcode.com/problems/dungeon-game/) | [solution](https://leetcode.com/problems/dungeon-game/solution/) | [C++](0001-0500/0174-Dungeon-Game/cpp-0174/) | | |
| 175 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 176 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 179 | [Largest Number](https://leetcode.com/problems/largest-number/) | [无] | [C++](0001-0500/0179-Largest-Number/cpp-0179/) | | |
| | | | | | |
| 181 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 184 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 186 | [Reverse Words in a String II](https://leetcode.com/problems/reverse-words-in-a-string-ii/description/) | [无] | [C++](0001-0500/0186-Reverse-Words-in-a-String-II/cpp-0186/) | | |
| | | | | | |
| 188 | [Best-Time-to-Buy-and-Sell-Stock-IV](https://leetcode.com/problems/best-time-to-buy-and-sell-stock-iv/description/) | | [C++](0001-0500/0188-Best-Time-to-Buy-and-Sell-Stock-IV/cpp-0188/) | | |
| 189 | [Rotate Array](https://leetcode.com/problems/rotate-array/description/) | [solution](https://leetcode.com/problems/rotate-array/solution/) | [C++](0001-0500/0189-Rotate-Array/cpp-0189/) | | |
| 190 | [Reverse Bits](https://leetcode.com/problems/reverse-bits/) | [solution](https://leetcode.com/problems/reverse-bits/solution/) | [C++](0001-0500/0190-Reverse-Bits/cpp-0190/) | | |
| 191 | [Number of 1 Bits](https://leetcode.com/problems/number-of-1-bits/description/) | [solution](https://leetcode.com/problems/number-of-1-bits/solution/) | [C++](0001-0500/0191-Number-of-1-Bits/cpp-0191/) | | |
| | | | | | |
| 196 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 197 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 198 | [House Robber](https://leetcode.com/problems/house-robber/description/) | [solution](https://leetcode.com/problems/house-robber/solution/) | [C++](0001-0500/0198-House-Robber/cpp-0198/) | [Java](0001-0500/0198-House-Robber/java-0198/src/) | |
| 199 | [Binary Tree Right Side View](https://leetcode.com/problems/binary-tree-right-side-view/) | [solution](https://leetcode.com/problems/binary-tree-right-side-view/solution/) | [C++](0001-0500/199-Binary-Tree-Right-Side-View/cpp-0199/) | | |
| 200 | [Number of Islands](https://leetcode.com/problems/number-of-islands/description/) | [solution](https://leetcode.com/problems/number-of-islands/solution/) | [C++](0001-0500/0200-Number-of-Islands/cpp-0200/) | [Java](0001-0500/0200-Number-of-Islands/java-0200/src/) | |
| 201 | [Bitwise AND of Numbers Range](https://leetcode.com/problems/bitwise-and-of-numbers-range/) | [solution](https://leetcode.com/problems/bitwise-and-of-numbers-range/solution/) | [C++](0001-0500/0201-Bitwise-AND-of-Numbers-Range/cpp-0201/) | | |
| 202 | [Happy Number](https://leetcode.com/problems/happy-number/description/) | [solution](https://leetcode.com/problems/happy-number/solution/) | [C++](0001-0500/0202-Happy-Number/cpp-0202/) | | |
| 203 | [Remove Linked List Elements](https://leetcode.com/problems/remove-linked-list-elements/description/) | [无] | [C++](0001-0500/0203-Remove-Linked-List-Elements/cpp-0203/) | [Java](0001-0500/0203-Remove-Linked-List-Elements/java-0203/src/) | |
| 204 | [Count Primes](https://leetcode.com/problems/count-primes/) | [无] | [C++](0001-0500/0204-Count-Primes/cpp-0204/) | | |
| 205 | [Isomorphic Strings](https://leetcode.com/problems/isomorphic-strings/description/) | [无] | [C++](0001-0500/0205-Isomorphic-Strings/cpp-0205/) | | |
| 206 | [Reverse Linked List](https://leetcode.com/problems/reverse-linked-list/description/) | [solution](https://leetcode.com/problems/reverse-linked-list/solution/) | [C++](0001-0500/0206-Reverse-Linked-List/cpp-0206/) | [Java](0001-0500/0206-Reverse-Linked-List/java-0206/src/) | |
| 207 | [Course Schedule](https://leetcode.com/problems/course-schedule/) | [无] | [C++](0001-0500/0207-Course-Schedule/cpp-0207/) | | |
| 208 | [Implement Trie (Prefix Tree)](https://leetcode.com/problems/implement-trie-prefix-tree/description/) | [solution](https://leetcode.com/problems/implement-trie-prefix-tree/solution/) | [C++](0001-0500/0208-Implement-Trie-Prefix-Tree/cpp-0208/) | | |
| 209 | [Minimum Size Subarray Sum](https://leetcode.com/problems/minimum-size-subarray-sum/description/) | [solution](https://leetcode.com/problems/minimum-size-subarray-sum/solution/) | [C++](0001-0500/0209-Minimum-Size-Subarray-Sum/cpp-0209/) | [Java](0001-0500/0209-Minimum-Size-Subarray-Sum/java-0209/src/) | |
| 210 | [Course Schedule II](https://leetcode.com/problems/course-schedule-ii/) | [solution](https://leetcode.com/problems/course-schedule-ii/solution/) | [C++](0001-0500/0210-Course-Schedule-II/cpp-0210/) | | |
| 211 | [Add and Search Word - Data structure design](https://leetcode.com/problems/add-and-search-word-data-structure-design/description/) | [无] | [C++](0001-0500/0211-Add-and-Search-Word-Data-structure-design/cpp-0211/) | [Java](0001-0500/0211-Add-and-Search-Word-Data-structure-design/java-0211/) | |
| 212 | [Word Search II](https://leetcode.com/problems/word-search-ii/) | [无] | [C++](0001-0500/0212-Word-Search-II/cpp-0212/) | | |
| 213 | [House Robber II](https://leetcode.com/problems/house-robber-ii/description/) | [无] | [C++](0001-0500/0213/House-Robber-II/cpp-0213/) | | |
| | | | | | |
| 215 | [Kth Largest Element in an Array](https://leetcode.com/problems/kth-largest-element-in-an-array/description/) | [solution](https://leetcode.com/problems/kth-largest-element-in-an-array/solution/) | [C++](0001-0500/0215-Kth-Largest-Element-in-an-Array/cpp-0215/) | | |
| 216 | [Combination Sum III](https://leetcode.com/problems/combination-sum-iii/description/) | [无] | [C++](0001-0500/0216/Combination-Sum-III/cpp-0216/) | | |
| 217 | [Contains Duplicate](https://leetcode.com/problems/contains-duplicate/description/) | [无] | [C++](0001-0500/0217/Contains-Duplicate/cpp-0217/) | | |
| 218 | [The Skyline Problem](https://leetcode.com/problems/the-skyline-problem/description/) | | [C++](0001-0500/0218-The-Skyline-Problem/cpp-0218/) | | |
| 219 | [Contains Duplicate II](https://leetcode.com/problems/contains-duplicate-ii/description/) | [solution](https://leetcode.com/problems/contains-duplicate-ii/solution/) | [C++](0001-0500/0219-Contains-Duplicate-II/cpp-0219/) | [Java](0001-0500/0219-Contains-Duplicate-II/java-0219/src/) | |
| 220 | [Contains Duplicate III](https://leetcode.com/problems/contains-duplicate-iii/description/) | [solution](https://leetcode.com/problems/contains-duplicate-iii/solution/) | [C++](0001-0500/0220-Contains-Duplicate-III/cpp-0220/) | [Java](0001-0500/0220-Contains-Duplicate-III/java-0220/) | |
| 221 | [Maximal Square](https://leetcode.com/problems/maximal-square/) | [solution](https://leetcode.com/problems/maximal-square/solution/) | [C++](0001-0500/0221-Maximal-Square/cpp-0221) | | [Python](0001-0500/0221-Maximal-Square/py-0221) |
| 222 | [Count Complete Tree Nodes](https://leetcode.com/problems/count-complete-tree-nodes/description/) | [无] | [C++](0001-0500/0222-Count-Complete-Tree-Nodes/cpp-0222/) | | |
| 223 | [Rectangle Area](https://leetcode.com/problems/rectangle-area/) | [无] | [C++](0001-0500/0223-Rectangle-Area/cpp-0223/) | | |
| 224 | [Basic Calculator](https://leetcode.com/problems/basic-calculator/description/) | [无] | [C++](0001-0500/0224-Basic-Calculator/cpp-0224/) | | |
| 225 | [Implement Stack using Queues](https://leetcode.com/problems/implement-stack-using-queues/description/) | [solution](https://leetcode.com/problems/implement-stack-using-queues/solution/) | [C++](0001-0500/0225-Implement-Stack-using-Queues/cpp-0225/) | | |
| 226 | [Invert Binary Tree](https://leetcode.com/problems/invert-binary-tree/description/) | [solution](https://leetcode.com/problems/invert-binary-tree/solution/) | [C++](0001-0500/0226-Invert-Binary-Tree/cpp-0226/) | [Java](0001-0500/0226-Invert-Binary-Tree/java-0226/src/) | [Python](0001-0500/0226-Invert-Binary-Tree/py-0226/) |
| 227 | [Basic Calculator II](https://leetcode.com/problems/basic-calculator-ii/description/) | [无] | [C++](0001-0500/0227-Basic-Calculator-II/cpp-0227/) | | |
| 228 | [Summary Ranges](https://leetcode.com/problems/summary-ranges/) | [solution](https://leetcode.com/problems/summary-ranges/solution/) | [C++](0001-0500/0228-Summary-Ranges/cpp-0228/) | | |
| 229 | [Majority Element II](https://leetcode.com/problems/majority-element-ii/) | [solution](https://leetcode.com/problems/majority-element-ii/solution/)
[缺:BM Voting] | [C++](0001-0500/0229-Majority-Element-II/cpp-0229/) | | |
| 230 | [Kth Smallest Element in a BST](https://leetcode.com/problems/kth-smallest-element-in-a-bst/description/) | [solution](https://leetcode.com/problems/kth-smallest-element-in-a-bst/solution/)
[缺:非递归] | [C++](0001-0500/0230-Kth-Smallest-Element-in-a-BST/cpp-0230/) | | |
| 231 | [Power of Two](https://leetcode.com/problems/power-of-two/) | [solution](https://leetcode.com/problems/power-of-two/solution/) | [C++](0001-0500/0231-Power-of-Two/cpp-0231/) | | |
| 232 | [Implement Queue using Stacks](https://leetcode.com/problems/implement-queue-using-stacks/description/) | [solution](https://leetcode.com/problems/implement-queue-using-stacks/solution/) | [C++](0001-0500/0232-Implement-Queue-using-Stacks/cpp-0232/) | | |
| 233 | [Number of Digit One](https://leetcode.com/problems/number-of-digit-one/) | [solution](https://leetcode.com/problems/number-of-digit-one/solution/)
[缺:数学方法] | [C++](0001-0500/0233-Number-of-Digit-One/cpp-0233/) | | |
| 234 | [Palindrome Linked List](https://leetcode.com/problems/palindrome-linked-list/description/) | [无] | [C++](0001-0500/0234-Palindrome-Linked-List/cpp-0234/) | | |
| 235 | [Lowest Common Ancestor of a Binary Search Tree](https://leetcode.com/problems/lowest-common-ancestor-of-a-binary-search-tree/description/) | [solution](https://leetcode.com/problems/lowest-common-ancestor-of-a-binary-search-tree/solution/) | [C++](0001-0500/0235-Lowest-Common-Ancestor-of-a-Binary-Search-Tree/cpp-0235/) | [Java](0001-0500/0235-Lowest-Common-Ancestor-of-a-Binary-Search-Tree/java-0235/src/) | |
| 236 | [Lowest Common Ancestor of a Binary Tree](https://leetcode.com/problems/lowest-common-ancestor-of-a-binary-tree/description/) | [solution](https://leetcode.com/problems/lowest-common-ancestor-of-a-binary-tree/solution/)
[缺:非递归解法;LCA问题总结] | [C++](0001-0500/0236-Lowest-Common-Ancestor-of-a-Binary-Tree/cpp-0236/) | | |
| 237 | [Delete Node in a Linked List](https://leetcode.com/problems/delete-node-in-a-linked-list/description/) | [solution](https://leetcode.com/problems/delete-node-in-a-linked-list/solution/) | [C++](0001-0500/0237-Delete-Node-in-a-Linked-List/cpp-0237/) | [Java](0001-0500/0237-Delete-Node-in-a-Linked-List/java-0237/src/) | |
| 238 | [Product of Array Except Self](https://leetcode.com/problems/product-of-array-except-self/) | [solution](https://leetcode.com/problems/product-of-array-except-self/solution/) | [C++](0001-0500/0238-Product-of-Array-Except-Self/cpp-0238/) | | [Python](0001-0500/0238-Product-of-Array-Except-Self/py-0238/) |
| 239 | [Sliding Window Maximum](https://leetcode.com/problems/sliding-window-maximum/description/) | [solution](https://leetcode.com/problems/sliding-window-maximum/solution/) | [C++](0001-0500/0239-Sliding-Window-Maximum/cpp-0239/) | | |
| 240 | [Search a 2D Matrix II](https://leetcode.com/problems/search-a-2d-matrix-ii/) | [solution](https://leetcode.com/problems/search-a-2d-matrix-ii/solution/)
[缺:分治] | [C++](0001-0500/240-Search-a-2D-Matrix-II/cpp-240/) | | |
| 241 | [Different Ways to Add Parentheses](https://leetcode.com/problems/different-ways-to-add-parentheses/) | [无] | [C++](0001-0500/241-Different-Ways-to-Add-Parentheses/cpp-241/) | | |
| 242 | [Valid Anagram](https://leetcode.com/problems/valid-anagram/description/) | [solution](https://leetcode.com/problems/valid-anagram/solution/) | [C++](0001-0500/0242-Valid-Anagram/cpp-0242/) | | |
| 243 | [Shortest Word Distance](https://leetcode.com/problems/shortest-word-distance/) | [solution](https://leetcode.com/problems/shortest-word-distance/solution/) | [C++](0001-0500/0243-Shortest-Word-Distance/cpp-0243/) | | |
| 244 | [Shortest Word Distance II](https://leetcode.com/problems/shortest-word-distance-ii/) | [solution](https://leetcode.com/problems/shortest-word-distance-ii/solution/) | [C++](0001-0500/0244-Shortest-Word-Distance-II/cpp-0244/) | | |
| 245 | [Shortest Word Distance III](https://leetcode.com/problems/shortest-word-distance-iii/) | [无] | [C++](0001-0500/0245-Shortest-Word-Distance-III/cpp-0245/) | | |
| 246 | [Strobogrammatic Number](https://leetcode.com/problems/strobogrammatic-number/) | [solution](https://leetcode.com/problems/strobogrammatic-number/solution/) | [C++](0001-0500/0246-Strobogrammatic-Number/cpp-0246/) | | |
| 247 | [Strobogrammatic Number II](https://leetcode.com/problems/strobogrammatic-number-ii/) | [无] | [C++](0001-0500/0247-Strobogrammatic-Number-II/cpp-0247/) | | |
| 248 | [Strobogrammatic Number III](https://leetcode.com/problems/strobogrammatic-number-iii/) | [无] | [C++](0001-0500/0248-Strobogrammatic-Number-III/cpp-0248/) | | |
| 249 | [Group Shifted Strings](https://leetcode.com/problems/group-shifted-strings/description/) | [无] | [C++](0001-0500/0249-Group-Shifted-Strings/cpp-0249/) | | |
| 250 | [Count Univalue Subtrees](https://leetcode.com/problems/count-univalue-subtrees/description/) | [solution](https://leetcode.com/problems/count-univalue-subtrees/solution/) | [C++](0001-0500/0250-Count-Univalue-Subtrees/cpp-0250/) | | |
| 251 | [Flatten 2D Vector](https://leetcode.com/problems/flatten-2d-vector/) | [solution](https://leetcode.com/problems/flatten-2d-vector/solution/) | [C++](0001-0500/0251-Flatten-2D-Vector/cpp-0251/) | | |
| 252 | [Meeting Rooms](https://leetcode.com/problems/meeting-rooms/description/) | [solution](https://leetcode.com/problems/meeting-rooms/solution/) | [C++](0001-0500/0252-Meeting-Rooms/cpp-0252/) | | |
| 253 | [Meeting Rooms II](https://leetcode.com/problems/meeting-rooms-ii/description/) | [solution](https://leetcode.com/problems/meeting-rooms-ii/solution/) | [C++](0001-0500/0253-Meeting-Rooms-II/cpp-0253/) | | |
| 254 | [Factor Combinations](https://leetcode.com/problems/factor-combinations/description/) | [无] | [C++](0001-0500/0254-Factor-Combinations/cpp-0254/) | | |
| | | | | | |
| 256 | [Paint House](https://leetcode.com/problems/paint-house/) | [无] | [C++](0001-0500/0256-Paint-House/cpp-0256/) | | |
| 257 | [Binary Tree Paths](https://leetcode.com/problems/binary-tree-paths/description/) | [solution](https://leetcode.com/problems/binary-tree-paths/solution/) | [C++](0001-0500/0257-Binary-Tree-Paths/cpp-0257/) | [Java](0001-0500/0257-Binary-Tree-Paths/java-0257/src/) | |
| 258 | [Add Digits](https://leetcode.com/problems/add-digits/) | [solution](https://leetcode.com/problems/add-digits/solution/) | [C++](0001-0500/0258-Add-Digits/cpp-0258/) | | |
| 259 | [3Sum Smaller](https://leetcode.com/problems/3sum-smaller/description/) | [solution](https://leetcode.com/problems/3sum-smaller/solution/) | [C++](0001-0500/0259-3Sum-Smaller/cpp-0259/) | | |
| 260 | [Single Number III](https://leetcode.com/problems/single-number-iii/) | [solution](https://leetcode.com/problems/single-number-iii/solution/) | [C++](0001-0500/0260-Single-Number-III/cpp-0260/) | | |
| 261 | [Graph Valid Tree](https://leetcode.com/problems/graph-valid-tree/) | [C++](0001-0500/0261-Graph-Valid-Tree/cpp-0261/) | | | |
| | | | | | |
| 263 | [Ugly Number](https://leetcode.com/problems/ugly-number/) | [无] | [C++](0001-0500/0263-Ugly-Number/cpp-0263/) | | |
| 264 | [Ugly Number II](https://leetcode.com/problems/ugly-number-ii/) | [solution](https://leetcode.com/problems/ugly-number-ii/solution/) | [C++](0001-0500/0264-Ugly-Number-II/cpp-0264/) | | |
| 265 | [Paint House II](https://leetcode.com/problems/paint-house-ii/) | [C++](0001-0500/0265-Paint-House-II/cpp-0265/) | | | |
| 266 | [Palindrome Permutation](https://leetcode.com/problems/palindrome-permutation/) | [solution](https://leetcode.com/problems/palindrome-permutation/solution/) | [C++](0001-0500/0266-Palindrome-Permutation/cpp-0266/) | | |
| 267 | [Palindrome Permutation II](https://leetcode.com/problems/palindrome-permutation-ii/) | [solution](https://leetcode.com/problems/palindrome-permutation-ii/solution/) | [C++](0001-0500/0267-Palindrome-Permutation-II/cpp-0267/) | | |
| 268 | [Missing Number](https://leetcode.com/problems/missing-number/description/) | [solution](https://leetcode.com/problems/missing-number/solution/) | [C++](0001-0500/0268-Missing-Number/cpp-0268/) | | |
| 269 | [Alien Dictionary](https://leetcode.com/problems/alien-dictionary/) | [solution](https://leetcode.com/problems/alien-dictionary/solution/) | [C++](0001-0500/0269-Alien-Dictionary/cpp-0269/) | | |
| | | | | | |
| 273 | [Integer to English Words](https://leetcode.com/problems/integer-to-english-words/) | [solution](https://leetcode.com/problems/integer-to-english-words/solution/) | [C++](0001-0500/0273-Integer-to-English-Words/cpp-0273/) | | |
| 274 | [H-Index](https://leetcode.com/problems/h-index/) | [solution](https://leetcode.com/problems/h-index/solution/)
[缺:非二分] | [C++](0001-0500/0274-H-Index/) | | |
| 275 | [H-Index II](https://leetcode.com/problems/h-index-ii/) | [solution](https://leetcode.com/problems/h-index-ii/solution/) | [C++](0001-0500/0275-H-Index-II/) | | |
| 276 | [Paint Fence](https://leetcode.com/problems/paint-fence/) | [solution](https://leetcode.com/problems/paint-fence/solution/) | [C++](0001-0500/0276-Paint-Fence/) | | |
| 277 | [Find the Celebrity](https://leetcode.com/problems/find-the-celebrity/) | [solution](https://leetcode.com/problems/find-the-celebrity/solution/)
[缺:O(n) 解法] | [C++](0001-0500/0277-Find-the-Celebrity/cpp-0277/) | | |
| 278 | [First Bad Version](https://leetcode.com/problems/first-bad-version/) | [solution](https://leetcode.com/problems/first-bad-version/solution/) | [C++](0001-0500/0278-First-Bad-Version/cpp-0278/) | | |
| 279 | [Perfect Squares](https://leetcode.com/problems/perfect-squares/description/) | [无]
四平方和数学解 | [C++](0001-0500/0279-Perfect-Squares/cpp-0279/) | [Java](0001-0500/0279-Perfect-Squares/java-0279/src/) | |
| 280 | [Wiggle Sort](https://leetcode.com/problems/wiggle-sort/description/) | [solution](https://leetcode.com/problems/wiggle-sort/solutions/2961467/wiggle-sort/?orderBy=most_votes) | [C++](0001-0500/0280-Wiggle-Sort/cpp-0280/) | | |
| | | | | | |
| 282 | [Expression Add Operators](https://leetcode.com/problems/expression-add-operators/description/) | [solution](https://leetcode.com/problems/expression-add-operators/solution/) | [C++](0001-0500/0282-Expression-Add-Operators/cpp-0282/) | | |
| 283 | [Move Zeroes](https://leetcode.com/problems/move-zeroes/description/) | [solution](https://leetcode.com/problems/move-zeroes/solution/) | [C++](0001-0500/0283-Move-Zeroes/cpp-0283/) | [Java](0001-0500/0283-Move-Zeroes/java-0283/src/) | |
| 284 | [Peeking Iterator](https://leetcode.com/problems/peeking-iterator/) | [solution](https://leetcode.com/problems/peeking-iterator/solution/) | [C++](0001-0500/0284-Peeking-Iterator/cpp-0284/) | | |
| 285 | [Inorder Successor in BST](https://leetcode.com/problems/inorder-successor-in-bst/) | [无]
[缺:空间O(h)] | [C++](0001-0500/0285-Inorder-Successor-in-BST/cpp-0285/) | | |
| 286 | [Walls and Gates](https://leetcode.com/problems/walls-and-gates/description/) | [solution](https://leetcode.com/problems/walls-and-gates/solution/) | [C++](0001-0500/0286-Walls-and-Gates/cpp-0286/) | | |
| 287 | [Find the Duplicate Number](https://leetcode.com/problems/find-the-duplicate-number/description/) | | [C++](0001-0500/0287-Find-the-Duplicate-Number/cpp-0287/) | | |
| 288 | [Unique Word Abbreviation](https://leetcode.com/problems/unique-word-abbreviation/description/) | [solution](https://leetcode.com/problems/unique-word-abbreviation/solution/) | [C++](0001-0500/0288-Unique-Word-Abbreviation/cpp-0288/) | | |
| 289 | [Game of Life](https://leetcode.com/problems/game-of-life/) | [solution](https://leetcode.com/problems/game-of-life/solution/) | [C++](0001-0500/0289-Game-of-Life/cpp-0289/) | | |
| 290 | [Word Pattern](https://leetcode.com/problems/word-pattern/description/) | [无] | [C++](0001-0500/0290-Word-Pattern/cpp-0290/) | | |
| | | | | | |
| 292 | [Nim Game](https://leetcode.com/problems/nim-game/) | [solution](https://leetcode.com/problems/nim-game/solution/) | [C++](0001-0500/0292-Nim-Game/cpp-0292/) | | |
| | | | | | |
| 295 | [Find Median from Data Stream](https://leetcode.com/problems/find-median-from-data-stream/) | [无] | [C++](0001-0500/0295-Find-Median-from-Data-Stream/cpp-0295/) | | |
| 296 | [Best Meeting Point](https://leetcode.com/problems/best-meeting-point/) | [solution](https://leetcode.com/problems/best-meeting-point/solution/) | [C++](0001-0500/0296-Best-Meeting-Point/cpp-0296/) | | |
| 297 | [Serialize and Deserialize Binary Tree](https://leetcode.com/problems/serialize-and-deserialize-binary-tree/description/) | [solution](https://leetcode.com/problems/serialize-and-deserialize-binary-tree/solution/) | [C++](0001-0500/0297-Serialize-and-Deserialize-Binary-Tree/cpp-0297/) | | |
| 298 | [Binary Tree Longest Consecutive Sequence](https://leetcode.com/problems/binary-tree-longest-consecutive-sequence/) | [solution](https://leetcode.com/problems/binary-tree-longest-consecutive-sequence/solution/) | [C++](0001-0500/0298-Binary-Tree-Longest-Consecutive-Sequence/cpp-0298/) | | |
| 299 | [Bulls and Cows](https://leetcode.com/problems/bulls-and-cows/) | [solution](https://leetcode.com/problems/bulls-and-cows/solution/) | [C++](0001-0500/0299-Bulls-and-Cows/cpp-0299/) | | |
| 300 | [Longest Increasing Subsequence](https://leetcode.com/problems/longest-increasing-subsequence/description/) | [solution](https://leetcode.com/problems/longest-increasing-subsequence/solution/) | [C++](0001-0500/0300-Longest-Increasing-Subsequence/cpp-0300/) | [Java](0001-0500/0300-Longest-Increasing-Subsequence/java-0300/src/) | |
| 301 | [0301-Remove-Invalid-Parentheses](https://leetcode.com/problems/remove-invalid-parentheses/) | [solution](https://leetcode.com/problems/remove-invalid-parentheses/solution/)
[缺:DP+构建] | [C++](0001-0500/0301-Remove-Invalid-Parentheses/cpp-0301/) | | |
| | | | | | |
| 303 | [Range Sum Query - Immutable](https://leetcode.com/problems/range-sum-query-immutable/description/) | | [C++](0001-0500/0303/Range-Sum-Query-Immutable/cpp-0303/) | | |
| 304 | [Range Sum Query 2D - Immutable](https://leetcode.com/problems/range-sum-query-2d-immutable/) | [solution](https://leetcode.com/problems/range-sum-query-2d-immutable/solution/) | [C++](0001-0500/0304-Range-Sum-Query-2D-Immutable/cpp-0304/) | | |
| 305 | [Number of Islands II](https://leetcode.com/problems/number-of-islands-ii/description/) | [solution](https://leetcode.com/problems/number-of-islands-ii/solutions/3033683/number-of-islands-ii/?orderBy=most_votes) | [C++](0001-0500/0305-Number-of-Islands-II/cpp-0305/) | | |
| 306 | [Additive Number](https://leetcode.com/problems/additive-number/) | [无] | [C++](0001-0500/0306-Additive-Number/cpp-0306/) | | |
| 307 | [Range Sum Query - Mutable](https://leetcode.com/problems/range-sum-query-mutable/description/) | [缺:BIT] | [C++](0001-0500/0307-Range-Sum-Query-Mutable/cpp-0307/) | | |
| 308 | [Range Sum Query 2D - Mutable](https://leetcode.com/problems/range-sum-query-2d-mutable/description/) | | [C++](0001-0500/0308-Range-Sum-Query-2D-Mutable/cpp-0308/) | | |
| 309 | [Best Time to Buy and Sell Stock with Cooldown](https://leetcode.com/problems/best-time-to-buy-and-sell-stock-with-cooldown/description/) | [solution](https://leetcode.com/problems/best-time-to-buy-and-sell-stock-with-cooldown/solution/) | [C++](0001-0500/0309-Best-Time-to-Buy-and-Sell-Stock-with-Cooldown/cpp-0309/) | | |
| 310 | [Minimum Height Trees](https://leetcode.com/problems/minimum-height-trees/) | [solution](https://leetcode.com/problems/minimum-height-trees/solution/) | [C++](0001-0500/0310-Minimum-Height-Trees/cpp-0310/) | | |
| 311 | [Sparse Matrix Multiplication](https://leetcode.com/problems/sparse-matrix-multiplication/) | [无] | [C++](0001-0500/0311-Sparse-Matrix-Multiplication/cpp-0311/) | | |
| 312 | [Burst Balloons](https://leetcode.com/problems/burst-balloons/) | [solution](https://leetcode.com/problems/burst-balloons/solution/) [题解](https://leetcode-cn.com/problems/burst-balloons/solution/chuo-qi-qiu-by-leetcode/) | [C++](0001-0500/0312-Burst-Balloons/cpp-0312/) | | |
| 313 | [Super Ugly Number](https://leetcode.com/problems/super-ugly-number/) | [无] | [C++](0001-0500/0313-Super-Ugly-Number/cpp-0313/) | | |
| 314 | [Binary Tree Vertical Order Traversal](https://leetcode.com/problems/binary-tree-vertical-order-traversal/) | [无] | [C++](0001-0500/0314-Binary-Tree-Vertical-Order-Traversal/cpp-0314/) | | |
| 315 | [Count of Smaller Numbers After Self](https://leetcode.com/problems/count-of-smaller-numbers-after-self/) | [无] | [C++](0001-0500/0315-Count-of-Smaller-Numbers-After-Self/cpp-0315/) | | |
| 316 | [Remove Duplicate Letters](https://leetcode.com/problems/remove-duplicate-letters/) | [solution](https://leetcode.com/problems/remove-duplicate-letters/solution/) | [C++](0001-0500/0316-Remove-Duplicate-Letters/cpp-0316/) | | |
| 317 | [Shortest Distance from All Buildings](https://leetcode.com/problems/shortest-distance-from-all-buildings/) | [solution](https://leetcode.com/problems/shortest-distance-from-all-buildings/solution/) | [C++](0001-0500/0317-Shortest-Distance-from-All-Buildings/cpp-0317/) | | |
| 318 | [Maximum Product of Word Lengths](https://leetcode.com/problems/maximum-product-of-word-lengths/) | [solution](https://leetcode.com/problems/maximum-product-of-word-lengths/solution/) | [C++](0001-0500/0318-Maximum-Product-of-Word-Lengths/cpp-0318/) | | |
| 319 | [Bulb Switcher](https://leetcode.com/problems/bulb-switcher/description/) | [无] | [C++](0001-0500/0319-Bulb-Switcher/cpp-0319/) | | |
| | | | | | |
| 321 | [Create Maximum Number](https://leetcode.com/problems/create-maximum-number/) | [无] | [C++](0001-0500/0321-Create-Maximum-Number/cpp-0321/) | | |
| 322 | [Coin Change](https://leetcode.com/problems/coin-change/description/) | [solution](https://leetcode.com/problems/coin-change/solution/) | [C++](0001-0500/0322-Coin-Change/cpp-0322/) | | |
| 323 | [Number of Connected Components in an Undirected Graph](https://leetcode.com/problems/number-of-connected-components-in-an-undirected-graph/) | [solution](https://leetcode.com/problems/number-of-connected-components-in-an-undirected-graph/solution/) | [C++](0001-0500/0323-Number-of-Connected-Components-in-an-Undirected-Graph/cpp-0323/) | | |
| 324 | [Wiggle Sort II](https://leetcode.com/problems/wiggle-sort-ii/) | [无] | [C++](0001-0500/0324-Wiggle-Sort-II/cpp-0324/) | | |
| 325 | [Maximum Size Subarray Sum Equals k](https://leetcode.com/problems/maximum-size-subarray-sum-equals-k/) | [solution](https://leetcode.com/problems/maximum-size-subarray-sum-equals-k/solution/) | [C++](0001-0500/0325-Maximum-Size-Subarray-Sum-Equals-k/cpp-0325/) | | |
| 326 | [Power of Three](https://leetcode.com/problems/power-of-three/) | [solution](https://leetcode.com/problems/power-of-three/solution/) | [C++](0001-0500/0326-Power-of-Three/cpp-0326/) | | |
| | | | | | |
| 328 | [Odd Even Linked List](https://leetcode.com/problems/odd-even-linked-list/description/) | [solution](https://leetcode.com/problems/odd-even-linked-list/solution/) | [C++](0001-0500/0328-Odd-Even-Linked-List/cpp-0328/) | | |
| 329 | [Longest Increasing Path in a Matrix](https://leetcode.com/problems/longest-increasing-path-in-a-matrix/) | [solution](https://leetcode.com/problems/longest-increasing-path-in-a-matrix/solution/) | [C++](0001-0500/0329-Longest-Increasing-Path-in-a-Matrix/cpp-0329/) | | |
| 330 | [Patching Array](https://leetcode.com/problems/patching-array/) | [无] | [C++](0001-0500/0330-Patching-Array/cpp-0330/) | | |
| 331 | [Verify Preorder Serialization of a Binary Tree](https://leetcode.com/problems/verify-preorder-serialization-of-a-binary-tree/) | [solution](https://leetcode.com/problems/verify-preorder-serialization-of-a-binary-tree/solution/) | [C++](0001-0500/0331-Verify-Preorder-Serialization-of-a-Binary-Tree/cpp-0331/) | | |
| 332 | [Reconstruct Itinerary](https://leetcode.com/problems/reconstruct-itinerary/) | [solution](https://leetcode.com/problems/reconstruct-itinerary/solution/) | [C++](0001-0500/0332-Reconstruct-Itinerary/cpp-0332/) | | |
| | | | | | |
| 334 | [Increasing Triplet Subsequence](https://leetcode.com/problems/increasing-triplet-subsequence/) | [solution](https://leetcode.com/problems/increasing-triplet-subsequence/solution/) | [C++](0001-0500/0334-Increasing-Triplet-Subsequence/cpp-0334/) | | |
| 335 | [Self Crossing](https://leetcode.com/problems/self-crossing/) | [无] | [C++](0001-0500/0335-Self-Crossing/cpp-0335/) | | |
| 336 | [Palindrome Pairs](https://leetcode.com/problems/palindrome-pairs/) | [solution](https://leetcode.com/problems/palindrome-pairs/solution/) | [C++](0001-0500/0336-Palindrome-Pairs/cpp-0336/)| | |
| 337 | [House Robber III](https://leetcode.com/problems/house-robber-iii/description/) | [无] | [C++](0001-0500/0337-House-Robber-III/cpp-0337/) | | |
| 338 | [Counting Bits](https://leetcode.com/problems/counting-bits/) | [solution](https://leetcode.com/problems/counting-bits/solution/) | [C++](0001-0500/0338-Counting-Bits/cpp-0338/) | | |
| 339 | [Nested List Weight Sum](https://leetcode.com/problems/nested-list-weight-sum/) | [无] | [C++](0001-0500/0339-Nested-List-Weight-Sum/cpp-0339/) | | |
| 340 | [Longest Substring with At Most K Distinct Characters](https://leetcode.com/problems/longest-substring-with-at-most-k-distinct-characters/) | [solution](https://leetcode.com/problems/longest-substring-with-at-most-k-distinct-characters/solution/) | [C++](0001-0500/0340-Longest-Substring-with-At-Most-K-Distinct-Characters/cpp-0340/) | | |
| 341 | [Flatten Nested List Iterator](https://leetcode.com/problems/flatten-nested-list-iterator/) | [无] | [C++](0001-0500/0341-Flatten-Nested-List-Iterator/cpp-0341/) | | |
| 342 | [Power of Four](https://leetcode.com/problems/power-of-four/) | [solution](https://leetcode.com/problems/power-of-four/solution/) | [C++](0001-0500/0342-Power-of-Four/cpp-0342/) | | |
| 343 | [Integer Break](https://leetcode.com/problems/integer-break/description/) | [无] | [C++](0001-0500/0343-Integer-Break/cpp-0343/) | [Java](0001-0500/0343-Integer-Break/java-0343/src/) | |
| 344 | [Reverse String](https://leetcode.com/problems/reverse-string/description/) | [无] | [C++](0001-0500/0344-Reverse-String/cpp-0344/) | | |
| 345 | [Reverse Vowels of a String](https://leetcode.com/problems/reverse-vowels-of-a-string/description/) | [无] | [C++](0001-0500/0345-Reverse-Vowels-of-a-String/cpp-0345/) | | |
| 346 | [Moving Average from Data Stream](https://leetcode.com/problems/moving-average-from-data-stream/solution/) | [无] | [C++](0001-0500/0346-Moving-Average-from-Data-Stream/cpp-0346/) | | |
| 347 | [Top K Frequent Elements](https://leetcode.com/problems/top-k-frequent-elements/description/) | [solution](https://leetcode.com/problems/top-k-frequent-elements/solution/) | [C++](0001-0500/0347-Top-K-Frequent-Elements/cpp-0347/) | [Java](0001-0500/0347-Top-K-Frequent-Elements/java-0347/src/) | |
| 348 | [Find Winner on a Tic Tac Toe Game](https://leetcode.com/problems/find-winner-on-a-tic-tac-toe-game/) | [无] | [C++](0001-0500/0348-Find-Winner-on-a-Tic-Tac-Toe-Game/cpp-0348/) | | |
| 349 | [Intersection of Two Arrays](https://leetcode.com/problems/intersection-of-two-arrays/description/) | [solution](https://leetcode.com/problems/intersection-of-two-arrays/solution/) | [C++](0001-0500/0349-Intersection-of-Two-Arrays/cpp-0349/) | [Java](0001-0500/0349-Intersection-of-Two-Arrays/java-0349/src/) | |
| 350 | [Intersection of Two Arrays II](https://leetcode.com/problems/intersection-of-two-arrays-ii/description/) | [无] | [C++](0001-0500/0350-Intersection-of-Two-Arrays-II/cpp-0350/) | [Java](0001-0500/0350-Intersection-of-Two-Arrays-II/java-0350/src/) | |
| | | | | | |
| 352 | [Data Stream as Disjoint Intervals](https://leetcode.com/problems/data-stream-as-disjoint-intervals/) | [无] | [C++](0001-0500/0352-Data-Stream-as-Disjoint-Intervals/cpp-0352/) | | |
| | | | | | |
| 354 | [Russian Doll Envelopes](https://leetcode.com/problems/russian-doll-envelopes/) | [solution](https://leetcode.com/problems/russian-doll-envelopes/solution/) | [C++](0001-0500/0354-Russian-Doll-Envelopes/cpp-0354/) | | |
| | | | | | |
| 357 | [Count Numbers with Unique Digits](https://leetcode.com/problems/count-numbers-with-unique-digits/) | [无] | [C++](0001-0500/0357-Count-Numbers-with-Unique-Digits/cpp-0357/) | | |
| | | | | | |
| 359 | [Logger Rate Limiter](https://leetcode.com/problems/logger-rate-limiter/description/) | [无] | [C++](0001-0500/0359-Logger-Rate-Limiter/cpp-0359/) | | |
| 360 | [Sort Transformed Array](https://leetcode.com/problems/sort-transformed-array/description/) | [无] | [C++](0001-0500/0360-Sort-Transformed-Array/cpp-0360/) | | |
| | | | | | |
| 362 | [Design Hit Counter](https://leetcode.com/problems/design-hit-counter/) | [无] | [C++](0001-0500/0362-Design-Hit-Counter/cpp-0362/) | | |
| 363 | [Max Sum of Rectangle No Larger Than K](https://leetcode.com/problems/max-sum-of-rectangle-no-larger-than-k/) | [无] | [C++](0001-0500/0363-Max-Sum-of-Rectangle-No-Larger-Than-K/cpp-0363/) | | |
| 364 | [Nested List Weight Sum II](https://leetcode.com/problems/nested-list-weight-sum-ii/) | [无] | [C++](0001-0500/0364-Nested-List-Weight-Sum-II/cpp-0364/) | | |
| 365 | [Water and Jug Problem](https://leetcode.com/problems/water-and-jug-problem/) | [题解](https://leetcode-cn.com/problems/water-and-jug-problem/solution/shui-hu-wen-ti-by-leetcode-solution/)
[缺:数学解法] | [C++](0001-0500/0365-Water-and-Jug-Problem/cpp-0365/) | | |
| 366 | [Find Leaves of Binary Tree](https://leetcode.com/problems/find-leaves-of-binary-tree/) | [solution](https://leetcode.com/problems/find-leaves-of-binary-tree/solution/) | [C++](0001-0500/0366-Find-Leaves-of-Binary-Tree/cpp-0366/) | | |
| 367 | [Valid Perfect Square](https://leetcode.com/problems/valid-perfect-square/) | [solution](https://leetcode.com/problems/valid-perfect-square/solution/) | [C++](0001-0500/0367-Valid-Perfect-Square/cpp-0367/) | | |
| 368 | [Largest Divisible Subset](https://leetcode.com/problems/largest-divisible-subset/) | [solution](https://leetcode.com/problems/largest-divisible-subset/solution/) | [C++](0001-0500/0368-Largest-Divisible-Subset/cpp-0368/) | | |
| 369 | [Plus One Linked List](https://leetcode.com/problems/plus-one-linked-list/) | [solution](https://leetcode.com/problems/plus-one-linked-list/solution/) | [C++](0001-0500/0369-Plus-One-Linked-List/cpp-0369/) | | |
| 370 | [Range Addition](https://leetcode.com/problems/range-addition/description/) | | [C++](0001-0500/0370-Range-Addition/cpp-0370/) | | |
| | | | | | |
| 372 | [Super Pow](https://leetcode.com/problems/super-pow/) | [无] | [C++](0001-0500/0372-Super-Pow/cpp-0372/) | | |
| 373 | [Find K Pairs with Smallest Sums](https://leetcode.com/problems/find-k-pairs-with-smallest-sums/) | [无] | [C++](0001-0500/0373-Find-K-Pairs-with-Smallest-Sums/cpp-0373/) | | |
| 374 | [Guess Number Higher or Lower](https://leetcode.com/problems/guess-number-higher-or-lower/description/) | [solution](https://leetcode.com/problems/guess-number-higher-or-lower/solution/) | [C++](0001-0500/0374-Guess-Number-Higher-or-Lower/cpp-0374/) | | |
| 375 | [Guess Number Higher or Lower II](https://leetcode.com/problems/guess-number-higher-or-lower-ii/) | [无] | [C++](0001-0500/0375-Guess-Number-Higher-or-Lower-II/cpp-0375/) | | |
| 376 | [Wiggle Subsequence](https://leetcode.com/problems/wiggle-subsequence/) | [solution](https://leetcode.com/problems/wiggle-subsequence/solution/) | [C++](0001-0500/0376-Wiggle-Subsequence/cpp-0376/)
[缺:DP;O(1) 空间贪心] | | |
| 377 | [Combination Sum IV](https://leetcode.com/problems/combination-sum-iv/description/) | [无] | [C++](0001-0500/0377-Combination-Sum-IV/cpp-0377/) | | |
| 378 | [Kth Smallest Element in a Sorted Matrix](https://leetcode.com/problems/kth-smallest-element-in-a-sorted-matrix/) | [无] | [C++](0001-0500/0378-Kth-Smallest-Element-in-a-Sorted-Matrix/cpp-0378/) | | |
| | | | | | |
| 380 | [Insert Delete GetRandom O(1)](https://leetcode.com/problems/insert-delete-getrandom-o1/description/) | [无] | [C++](0001-0500/0380-Insert-Delete-GetRandom-O(1)/cpp-0380/) | | |
| 381 | [Insert Delete GetRandom O(1) - Duplicates allowed](https://leetcode.com/problems/insert-delete-getrandom-o1-duplicates-allowed/description/) | [无] | [C++](0001-0500/0381-Insert-Delete-GetRandom-O(1)-Duplicates-allowed/cpp-0381/) | | |
| 382 | [Linked List Random Node](https://leetcode.com/problems/linked-list-random-node/description/) | [无] | [C++](0001-0500/0382-Linked-List-Random-Node/cpp-0382/) | | |
| 383 | [Ransom Note](https://leetcode.com/problems/ransom-note/) | [solution](https://leetcode.com/problems/ransom-note/solution/) | [C++](0001-0500/0383-Ransom-Note/cpp-0383/) | | |
| 384 | [Shuffle an Array](https://leetcode.com/problems/shuffle-an-array/description/) | [solution](https://leetcode.com/problems/shuffle-an-array/solution/) | [C++](0001-0500/0384-Shuffle-an-Array/cpp-0384/) | | |
| 385 | [Mini Parser](https://leetcode.com/problems/mini-parser/) | [无] | [C++](0001-0500/0385-Mini-Parser/cpp-0385/) | | |
| 386 | [Lexicographical Numbers](https://leetcode.com/problems/lexicographical-numbers/description/) | | [C++](0001-0500/0386-Lexicographical-Numbers/cpp-0386/) | | |
| 387 | [First Unique Character in a String](https://leetcode.com/problems/first-unique-character-in-a-string/description/) | [solution](https://leetcode.com/problems/first-unique-character-in-a-string/solution/) | [C++](0001-0500/0387-First-Unique-Character-in-a-String/cpp-0387/) | [Java](0001-0500/0387-First-Unique-Character-in-a-String/java-0387/src/) | |
| 388 | [Longest Absolute File Path](https://leetcode.com/problems/longest-absolute-file-path/description/) | | [C++](0001-0500/0388-Longest-Absolute-File-Path/cpp-0388/) | | |
| 389 | [Find the Difference](https://leetcode.com/problems/find-the-difference/description/) | | [C++](0001-0500/0389-Find-the-Difference/cpp-0389/) | | |
| 390 | [Elimination Game](https://leetcode.com/problems/elimination-game/description/) | | [C++](0001-0500/0390-Elimination-Game/cpp-0390/) | | |
| 391 | [Perfect Rectangle](https://leetcode.com/problems/perfect-rectangle/description/) | [缺:矩形求交] | [C++](0001-0500/0391-Perfect-Rectangle/cpp-0391/) | | |
| 392 | [Is Subsequence](https://leetcode.com/problems/is-subsequence/) | [无] | [C++](0001-0500/0392-Is-Subsequence/cpp-0392/) | | |
| 393 | [UTF-8 Validation](https://leetcode.com/problems/utf-8-validation/) | [solution](https://leetcode.com/problems/utf-8-validation/solution/) | [C++](0001-0500/0393-UTF-8-Validation/cpp-0393/) | | |
| 394 | [Decode String](https://leetcode.com/problems/decode-string/description/) | [无] | [C++](0001-0500/0394-Decode-String/cpp-0394/) | | |
| 395 | [Longest Substring with At Least K Repeating Characters](https://leetcode.com/problems/longest-substring-with-at-least-k-repeating-characters/) | [solution](https://leetcode.com/problems/longest-substring-with-at-least-k-repeating-characters/solution/)
[缺:滑动窗口] | [C++](0001-0500/0395-Longest-Substring-with-At-Least-K-Repeating-Characters/cpp-0395/) | | |
| 396 | [Rotate Function](https://leetcode.com/problems/rotate-function/) | [无] | [C++](0001-0500/0396-Rotate-Function/cpp-0396/) | | |
| 397 | [Integer Replacement](https://leetcode.com/problems/integer-replacement/) | [无] | [C++](0001-0500/0397-Integer-Replacement/cpp-0397/) | | |
| 398 | [Random Pick Index](https://leetcode.com/problems/random-pick-index/description/) | [无] | [C++](0001-0500/0398-Random-Pick-Index/cpp-0398/) | | |
| 399 | [Evaluate Division](https://leetcode.com/problems/evaluate-division/) | [solution](https://leetcode.com/problems/evaluate-division/solution/)
[缺:UF] | [C++](0001-0500/0399-Evaluate-Division/cpp-0399/) | | |
| 400 | [Nth Digit](https://leetcode.com/problems/nth-digit/) | [无] | [C++](0001-0500/0400-Nth-Digit/cpp-0400/) | | |
| 401 | [Binary Watch](https://leetcode.com/problems/binary-watch/) | [无] | [C++](0001-0500/0401-Binary-Watch/cpp-0401/) | | |
| 402 | [Remove K Digits](https://leetcode.com/problems/remove-k-digits/) | [solution](https://leetcode.com/problems/remove-k-digits/solution/) [题解](https://leetcode-cn.com/problems/remove-k-digits/solution/yi-diao-kwei-shu-zi-by-leetcode/) | [C++](0001-0500/0402-Remove-K-Digits/cpp-0402/) | | |
| 403 | [Frog Jump](https://leetcode.com/problems/Frog-Jump/) | [solution](https://leetcode.com/problems/Frog-Jump/)
[缺:dp] | [C++](0001-0500/0403-Frog-Jump/cpp-0403/) | | |
| 404 | [Sum of Left Leaves](https://leetcode.com/problems/sum-of-left-leaves/) | [无] | [C++](0001-0500/0404-Sum-of-Left-Leaves/cpp-0404/) | | |
| 405 | [Convert a Number to Hexadecimal](https://leetcode.com/problems/convert-a-number-to-hexadecimal/) | [无] | [C++](0001-0500/0405-Convert-a-Number-to-Hexadecimal/cpp-0405/) | | |
| 406 | [Queue Reconstruction by Height](https://leetcode.com/problems/queue-reconstruction-by-height/) | [无] | [C++](0001-0500/0406-Queue-Reconstruction-by-Height/cpp-0406/) | | |
| 407 | [Trapping Rain Water II](https://leetcode.com/problems/trapping-rain-water-ii/) | [无] | [C++](0001-0500/0407-Trapping-Rain-Water-II/cpp-0407/) | | |
| | | | | | |
| 410 | [Split Array Largest Sum](https://leetcode.com/problems/split-array-largest-sum/) | [solution](https://leetcode.com/problems/split-array-largest-sum/solution/) [题解](https://leetcode-cn.com/problems/split-array-largest-sum/solution/fen-ge-shu-zu-de-zui-da-zhi-by-leetcode/) | [C++](0001-0500/410-Split-Array-Largest-Sum/cpp-410/) | | |
| | | | | | |
| 412 | [Fizz Buzz](https://leetcode.com/problems/fizz-buzz/description/) | [solution](https://leetcode.com/problems/fizz-buzz/solution/) | [C++](0001-0500/0412-Fizz-Buzz/cpp-0412/) | | |
| 413 | [Arithmetic Slices](https://leetcode.com/problems/arithmetic-slices/) | [solution](https://leetcode.com/problems/arithmetic-slices/solution/) | [C++](0001-0500/0413-Arithmetic-Slices/cpp-0413/) | | |
| 414 | [Third Maximum Number](https://leetcode.com/problems/third-maximum-number/) | [无] | [C++](0001-0500/0414-Third-Maximum-Number/cpp-0414/) | | |
| 415 | [Add Strings](https://leetcode.com/problems/add-strings/) | [solution](https://leetcode.com/problems/add-strings/solution/) | [C++](0001-0500/0415-Add-Strings/cpp-0415/) | | |
| 416 | [Partition Equal Subset Sum](https://leetcode.com/problems/partition-equal-subset-sum/description/) | [无] | [C++](0001-0500/0416-Partition-Equal-Subset-Sum/cpp-0416/) | [Java](0001-0500/0416-Partition-Equal-Subset-Sum/java-0416/src/) | |
| 417 | [Pacific Atlantic Water Flow](https://leetcode.com/problems/pacific-atlantic-water-flow/description/) | | [C++](0001-0500/0417-Pacific-Atlantic-Water-Flow/cpp-0417/) | [Java](0001-0500/0417-Pacific-Atlantic-Water-Flow/java-0417/src/) | |
| | | | | | |
| 419 | [Battleships in a Board](https://leetcode.com/problems/battleships-in-a-board/) | [无] | [C++](0001-0500/0419-Battleships-in-a-Board/cpp-0419/) | | |
| 420 | [Strong Password Checker](https://leetcode.com/problems/strong-password-checker/) | [无] | [C++](0001-0500/0420-Strong-Password-Checker/cpp-0420/) | | |
| 421 | [Maximum XOR of Two Numbers in an Array](https://leetcode.com/problems/maximum-xor-of-two-numbers-in-an-array/) | [solution](https://leetcode.com/problems/maximum-xor-of-two-numbers-in-an-array/solution/) | [C++](0001-0500/0421-Maximum-XOR-of-Two-Numbers-in-an-Array/cpp-0421/) | | |
| 422 | [Valid Word Square](https://leetcode.com/problems/valid-word-square/description/) | [无] | [C++](0001-0500/0422-Valid-Word-Square/cpp-0422/) | | |
| 423 | [Reconstruct Original Digits from English](https://leetcode.com/problems/reconstruct-original-digits-from-english/) | [solution](https://leetcode.com/problems/reconstruct-original-digits-from-english/solution/) | [C++](0001-0500/0423-Reconstruct-Original-Digits-from-English/cpp-0423/) | | |
| 424 | [Longest Repeating Character Replacement](https://leetcode.com/problems/longest-repeating-character-replacement/) | [无] | [C++](0001-0500/0424-Longest-Repeating-Character-Replacement/cpp-0424/) | | |
| | | | | | |
| 426 | [Convert Binary Search Tree to Sorted Doubly Linked List](https://leetcode.com/problems/convert-binary-search-tree-to-sorted-doubly-linked-list/) | [solution](https://leetcode.com/problems/convert-binary-search-tree-to-sorted-doubly-linked-list/solution/) | [C++](0001-0500/0426-Convert-Binary-Search-Tree-to-Sorted-Doubly-Linked-List/cpp-0426/) | | |
| 427 | [Construct Quad Tree](https://leetcode.com/problems/construct-quad-tree/) | [无] | [C++](0001-0500/0427-Construct-Quad-Tree/cpp-0427/) | | |
| | | | | | |
| 429 | [N-ary Tree Level Order Traversal](https://leetcode.com/problems/n-ary-tree-level-order-traversal/) | [无] | [C++](0001-0500/0429-N-ary-Tree-Level-Order-Traversal/cpp-0429/) | | |
| 430 | [Flatten a Multilevel Doubly Linked List](https://leetcode.com/problems/flatten-a-multilevel-doubly-linked-list/description/) | [无] | [C++](0001-0500/0430-Flatten-a-Multilevel-Doubly-Linked-List/cpp-0430/) | | |
| 431 | [Encode N-ary Tree to Binary Tree](https://leetcode.com/problems/encode-n-ary-tree-to-binary-tree/) | [solution](https://leetcode.com/problems/encode-n-ary-tree-to-binary-tree/solution/) | [C++](0001-0500/0431-Encode-N-ary-Tree-to-Binary-Tree/cpp-0431/) | | |
| 432 | [All O one Data Structure](https://leetcode.com/problems/all-oone-data-structure/) | [无] [缺:O(1)] | [C++](0001-0500/0432-All-O-one-Data-Structure/cpp-0432/) | | |
| 433 | [Minimum Genetic Mutation](https://leetcode.com/problems/minimum-genetic-mutation/) | [无] | [C++](0001-0500/0433-Minimum-Genetic-Mutation/cpp-0433/) | | |
| 434 | [Number of Segments in a String](https://leetcode.com/problems/number-of-segments-in-a-string/description/) | [无] | [C++](0001-0500/0434-Number-of-Segments-in-a-String/cpp-0434/) | | |
| 435 | [Non-overlapping Intervals](https://leetcode.com/problems/non-overlapping-intervals/description/) | [solution](https://leetcode.com/problems/non-overlapping-intervals/solution/) | [C++](0001-0500/0435-Non-overlapping-Intervals/cpp-0435/) | [Java](0001-0500/0435-Non-overlapping-Intervals/java-0435/src/) | |
| 436 | [Find Right Interval](https://leetcode.com/problems/find-right-interval/) | [无] | [C++](0001-0500/0436-Find-Right-Interval/cpp-0436/) | | |
| 437 | [Path Sum III](https://leetcode.com/problems/path-sum-iii/description/) | [无] | [C++](0001-0500/0437-Path-Sum-III/cpp-0437/) | [Java](0001-0500/0437-Path-Sum-III/java-0437/src/) | |
| 438 | [Find All Anagrams in a String](https://leetcode.com/problems/find-all-anagrams-in-a-string/description/) | [无] | [C++](0001-0500/0438-Find-All-Anagrams-in-a-String/cpp-0438/) | | |
| 439 | [Ternary Expression Parser](https://leetcode.com/problems/ternary-expression-parser/) | [无] | [C++](0001-0500/0439-Ternary-Expression-Parser/cpp-0439/) | | |
| 440 | [K-th Smallest in Lexicographical Order](https://leetcode.com/problems/k-th-smallest-in-lexicographical-order/) | [无] [缺:更简单的实现] | [C++](0001-0500/0440-K-th-Smallest-in-Lexicographical-Order/cpp-0440/) | | |
| 441 | [Arranging Coins](https://leetcode.com/problems/arranging-coins/) | [solution](https://leetcode.com/problems/arranging-coins/solution/) | [C++](0001-0500/0441-Arranging-Coins/cpp-0441/) | | |
| 442 | [Find All Duplicates in an Array](https://leetcode.com/problems/find-all-duplicates-in-an-array/) | [solution](https://leetcode.com/problems/find-all-duplicates-in-an-array/solution/) | [C++](0001-0500/0442-Find-All-Duplicates-in-an-Array/cpp-0442/) | | |
| 443 | [String Compression](https://leetcode.com/problems/string-compression/description/) | | [C++](0001-0500/0443-String-Compression/cpp-0443/) | | |
| 444 | [Sequence Reconstruction](https://leetcode.com/problems/sequence-reconstruction/) | [无] | [C++](0001-0500/0444-Sequence-Reconstruction/cpp-0444/) | | |
| 445 | [Add Two Numbers II](https://leetcode.com/problems/add-two-numbers-ii/) | [无] | [C++](0001-0500/0445-Add-Two-Numbers-II/cpp-0445/) | | |
| 446 | [Arithmetic Slices II - Subsequence](https://leetcode.com/problems/arithmetic-slices-ii-subsequence/) | [solution](https://leetcode.com/problems/arithmetic-slices-ii-subsequence/solution/) | [C++](0001-0500/0446-Arithmetic-Slices-II-Subsequence/cpp-0446/) | | |
| 447 | [Number of Boomerangs](https://leetcode.com/problems/number-of-boomerangs/description/) | [无] | [C++](0001-0500/0447-Number-of-Boomerangs/cpp-0447/) | [Java](0001-0500/0447-Number-of-Boomerangs/java-0447/src/) | |
| 448 | [Find All Numbers Disappeared in an Array](https://leetcode.com/problems/find-all-numbers-disappeared-in-an-array/) | [solution](https://leetcode.com/problems/find-all-numbers-disappeared-in-an-array/solution/) | [C++](0001-0500/0448-Find-All-Numbers-Disappeared-in-an-Array/cpp-0448/) | | |
| 449 | [Serialize and Deserialize BST](https://leetcode.com/problems/serialize-and-deserialize-bst/) | [solution](https://leetcode.com/problems/serialize-and-deserialize-bst/solution/) | [C++](0001-0500/0449-Serialize-and-Deserialize-BST/cpp-0449/) | | |
| 450 | [Delete Node in a BST](https://leetcode.com/problems/delete-node-in-a-bst/) | [solution](https://leetcode.com/problems/delete-node-in-a-bst/solution/) | [C++](0001-0500/0450-Delete-Node-in-a-BST/cpp-0450/) | | |
| 451 | [Sort Characters By Frequency](https://leetcode.com/problems/sort-characters-by-frequency/description/) | [无] | [C++](0001-0500/0451-Sort-Characters-By-Frequency/cpp-0451/) | [Java](0001-0500/0451-Sort-Characters-By-Frequency/java-0451/) | |
| 452 | [Minimum Number of Arrows to Burst Balloons](https://leetcode.com/problems/minimum-number-of-arrows-to-burst-balloons/) | [solution](https://leetcode.com/problems/minimum-number-of-arrows-to-burst-balloons/solution/) | [C++](0001-0500/0452-Minimum-Number-of-Arrows-to-Burst-Balloons/cpp-0452/) | | |
| 453 | [Minimum Moves to Equal Array Elements](https://leetcode.com/problems/minimum-moves-to-equal-array-elements/) | [solution](https://leetcode.com/problems/minimum-moves-to-equal-array-elements/solution/) | [C++](0001-0500/0453-Minimum-Moves-to-Equal-Array-Elements/cpp-0453/) | | |
| 454 | [4Sum II](https://leetcode.com/problems/4sum-ii/description/) | [无] | [C++](0001-0500/0454-4Sum-II/cpp-0454/) | [Java](0001-0500/0454-4Sum-II/java-0454/src/) | |
| 455 | [Assign Cookies](https://leetcode.com/problems/assign-cookies/description/) | [无] | [C++](0001-0500/0455-Assign-Cookies/cpp-0455/) | [Java](0001-0500/0455-Assign-Cookies/java-0455/src/) | |
| 456 | [132 Pattern](https://leetcode.com/problems/132-pattern/) | [solution](https://leetcode.com/problems/132-pattern/solution/)
[缺:O(n) 单调栈算法] | [C++](0001-0500/0456-132-Pattern/cpp-0456/) | | |
| 457 | [Circular Array Loop](https://leetcode.com/problems/circular-array-loop/) | [无] | [C++](0001-0500/0457-Circular-Array-Loop/cpp-0457/) | | |
| 458 | [Poor Pigs](https://leetcode.com/problems/poor-pigs/) | [solution](https://leetcode.com/problems/poor-pigs/solution/) | [C++](0001-0500/0458-Poor-Pigs/) | | |
| 459 | [Repeated Substring Pattern](https://leetcode.com/problems/repeated-substring-pattern/description/) | [无] | [C++](0001-0500/0459-Repeated-Substring-Pattern/cpp-0459/) | | |
| 460 | [LFU Cache](https://leetcode.com/problems/lfu-cache/description/) | [solution](https://leetcode.com/problems/lfu-cache/solutions/2815229/lfu-cache/?orderBy=most_votes) | [C++](0001-0500/0460-LFU-Cache/) | | |
| 461 | [Hamming Distance](https://leetcode.com/problems/hamming-distance/) | [solution](https://leetcode.com/problems/hamming-distance/solution/) | [C++](0001-0500/0461-Hamming-Distance/cpp-0461/) | | |
| 462 | [Minimum Moves to Equal Array Elements II](https://leetcode.com/problems/minimum-moves-to-equal-array-elements-ii/) | [solution](https://leetcode.com/problems/minimum-moves-to-equal-array-elements-ii/solution/) | [C++](0001-0500/0462-Minimum-Moves-to-Equal-Array-Elements-II/cpp-0462/) | | |
| 463 | [Island Perimeter](https://leetcode.com/problems/island-perimeter/) | [solution](https://leetcode.com/problems/island-perimeter/solution/) | [C++](0001-0500/0463-Island-Perimeter/cpp-0463/) | | |
| 464 | [Can I Win](https://leetcode.com/problems/can-i-win/) | [无] | [C++](0001-0500/0464-Can-I-Win/cpp-0464/) | | |
| | | | | | |
| 467 | [Unique Substrings in Wraparound String](https://leetcode.com/problems/unique-substrings-in-wraparound-string/) | [无] | [C++](0001-0500/0467-Unique-Substrings-in-Wraparound-String/cpp-0467/) | | |
| 468 | [Validate IP Address](https://leetcode.com/problems/validate-ip-address/) | [无] | [C++](0001-0500/0468-Validate-IP-Address/cpp-0468/) | | |
| | | | | | |
| 470 | [Implement Rand10() Using Rand7()](https://leetcode.com/problems/implement-rand10-using-rand7/description/) | [solution](https://leetcode.com/problems/implement-rand10-using-rand7/solution/) | [C++](0001-0500/0470-Implement-Rand10-Using-Rand7/cpp-0470/) | | |
| | | | | | |
| 472 | [Concatenated Words](https://leetcode.com/problems/concatenated-words/) | [无] | [C++](0001-0500/0472-Matchsticks-to-Square/cpp-0472/) | | |
| 473 | [Matchsticks to Square](https://leetcode.com/problems/matchsticks-to-square/description/) | [solution](https://leetcode.com/problems/matchsticks-to-square/solution/) | [C++](0001-0500/0473-Matchsticks-to-Square/cpp-0473/) | | |
| 474 | [Ones and Zeroes](https://leetcode.com/problems/ones-and-zeroes/description/) | [solution](https://leetcode.com/problems/ones-and-zeroes/solution/) | [C++](0001-0500/0474-Ones-and-Zeroes/cpp-0474/) | | |
| 475 | [Heaters](https://leetcode.com/problems/heaters/) | [无] | [C++](0001-0500/0475-Heaters/cpp-0475/) | | |
| 476 | [Number Complement](https://leetcode.com/problems/number-complement/) | [solution](https://leetcode.com/problems/number-complement/solution/) | [C++](0001-0500/0476-Number-Complement/cpp-0476/) | | |
| 477 | [Total Hamming Distance](https://leetcode.com/problems/total-hamming-distance/) | [solution](https://leetcode.com/problems/total-hamming-distance/solution/) [题解](https://leetcode-cn.com/problems/total-hamming-distance/solution/yi-ming-ju-chi-zong-he-by-leetcode/) | [C++](0001-0500/477-Total-Hamming-Distance/cpp-477/) | | |
| 478 | [Generate Random Point in a Circle](https://leetcode.com/problems/generate-random-point-in-a-circle/description/) | [solution](https://leetcode.com/problems/generate-random-point-in-a-circle/solution/) | [C++](0001-0500/0478-Generate-Random-Point-in-a-Circle/cpp-0478/) | | |
| 479 | [Largest Palindrome Product](https://leetcode.com/problems/largest-palindrome-product/) | [无] | [C++](0001-0500/0479-Largest-Palindrome-Product/cpp-0479/) | | |
| 480 | [Sliding Window Median](https://leetcode.com/problems/sliding-window-median/) | [无]
[缺:双数据结构] | [C++](0001-0500/0480-Sliding-Window-Median/cpp-0480/) | | |
| 481 | [Magical String](https://leetcode.com/problems/magical-string/) | [无] | [C++](0001-0500/0481-Magical-String/cpp-0481/) | | |
| 482 | [License Key Formatting](https://leetcode.com/problems/license-key-formatting/) | [无] | [C++](0001-0500/0482-License-Key-Formatting/cpp-0482/) | | |
| 483 | [Smallest Good Base](https://leetcode.com/problems/smallest-good-base/) | [无] | [C++](0001-0500/0483-Smallest-Good-Base/cpp-0483/) | | |
| 484 | [Find Permutation](https://leetcode.com/problems/find-permutation/) | [solution](https://leetcode.com/problems/find-permutation/solution/) | [C++](0001-0500/0484-Find-Permutation/cpp-0484/) | | |
| 485 | [Max Consecutive Ones](https://leetcode.com/problems/max-consecutive-ones/description/) | [无] | [C++](0001-0500/0485-Max-Consecutive-Ones/cpp-0485/) | | |
| 486 | [Predict the Winner](https://leetcode.com/problems/predict-the-winner/) | [无] | [C++](0001-0500/0486-Predict-the-Winner/cpp-0486/) | | |
| 487 | [Max Consecutive Ones II](https://leetcode.com/problems/max-consecutive-ones-ii/) | [无] | [C++](0001-0500/0487-Max-Consecutive-Ones-II/cpp-0487/) | | |
| 488 | [Zuma Game](https://leetcode.com/problems/zuma-game/) | [无] | [C++](0001-0500/0488-Zuma-Game/cpp-0488/) | | |
| 489 | [Robot Room Cleaner](https://leetcode.com/problems/robot-room-cleaner/) | [solution](https://leetcode.com/problems/robot-room-cleaner/solution/) | [C++](0001-0500/0489-Robot-Room-Cleaner/cpp-0489/) | | |
| 490 | [The Maze](https://leetcode.com/problems/the-maze/description/) | [solution](https://leetcode.com/problems/the-maze/solution/) | [C++](0001-0500/0490-The-Maze/cpp-0490/) | | |
| 491 | [Non-decreasing Subsequences](https://leetcode.com/problems/non-decreasing-subsequences/description/) | [无] | [C++](0001-0500/0491-Non-decreasing-Subsequences/cpp-0491/) | | |
| 492 | [Construct the Rectangle](https://leetcode.com/problems/construct-the-rectangle/) | [无] | [C++](0001-0500/0492-Construct-the-Rectangle/cpp-0492/) | | |
| | | | | | |
| 494 | [Target Sum](https://leetcode.com/problems/target-sum/description/) | [solution](https://leetcode.com/problems/target-sum/solution/) | [C++](0001-0500/0494-Target-Sum/cpp-0494/) | | |
| 495 | [Teemo Attacking](https://leetcode.com/problems/teemo-attacking/) | [solution](https://leetcode.com/problems/teemo-attacking/solution/) | [C++](0001-0500/0495-Teemo-Attacking/cpp-0495/) | | |
| 496 | [Next Greater Element I](https://leetcode.com/problems/next-greater-element-i/) | [solution](https://leetcode.com/problems/next-greater-element-i/solution/) | [C++](0001-0500/0496-Next-Greater-Element-I/cpp-0496/) | | |
| 497 | [Random Point in Non-overlapping Rectangles](https://leetcode.com/problems/random-point-in-non-overlapping-rectangles/solution/) | [solution](https://leetcode.com/problems/random-point-in-non-overlapping-rectangles/solution/) | [C++](0001-0500/0497-Random-Point-in-Non-overlapping-Rectangles/cpp-0497/) | | |
| 498 | [Diagonal Traverse](https://leetcode.com/problems/diagonal-traverse/description/) | [无] | [C++](0001-0500/0498-Diagonal-Traverse/cpp-0498/) | | |
| | | | | | |
| 500 | [Keyboard Row](https://leetcode.com/problems/keyboard-row/) | [无] | [C++](0001-0500/0500-Keyboard-Row/cpp-0500/) | | |
| 501 | [Find Mode in Binary Search Tree](https://leetcode.com/problems/find-mode-in-binary-search-tree/) | [无] | [C++](0501-1000/0501-Find-Mode-in-Binary-Search-Tree/cpp-0501/) | | |
| 502 | [IPO](https://leetcode.com/problems/ipo/) | [solution](https://leetcode.com/problems/ipo/solution/) | [C++](0501-1000/0502-IPO/cpp-0502/) | | |
| 503 | [Next Greater Element II](https://leetcode.com/problems/next-greater-element-ii/) | [solution](https://leetcode.com/problems/next-greater-element-ii/solution/) | [C++](0501-1000/0503-Next-Greater-Element-II/cpp-0503/) | | |
| 504 | [Base 7](https://leetcode.com/problems/base-7/) | [无] | [C++](0501-1000/0504-Base-7/cpp-0504/) | | |
| 505 | [The Maze II](https://leetcode.com/problems/the-maze-ii/) | [solution](https://leetcode.com/problems/the-maze-ii/solution/) | [C++](0501-1000/0505-The-Maze-II/cpp-0505/) | | |
| 506 | [Relative Ranks](https://leetcode.com/problems/relative-ranks/) | [无] | [C++](0501-1000/0506-Relative-Ranks/cpp-0506/) | | |
| 507 | [Perfect Number](https://leetcode.com/problems/perfect-number/) | [solution](https://leetcode.com/problems/perfect-number/solution/) | [C++](0501-1000/0507-Perfect-Number/cpp-0507/) | | |
| 508 | [Most Frequent Subtree Sum](https://leetcode.com/problems/most-frequent-subtree-sum/) | [无] | [C++](0501-1000/0508-Most-Frequent-Subtree-Sum/cpp-0508/) | | |
| 509 | [Fibonacci Number](https://leetcode.com/problems/fibonacci-number/) | [无] | [C++](0501-1000/0509-Fibonacci-Number/cpp-0509/) | | |
| 510 | [Inorder Successor in BST II](https://leetcode.com/problems/inorder-successor-in-bst-ii/) | [无] | [C++](0501-1000/0510-Inorder-Successor-in-BST-II/cpp-0510/) | | |
| 511 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 513 | [Find Bottom Left Tree Value](https://leetcode.com/problems/find-bottom-left-tree-value/) | [无] | [C++](0501-1000/0513-Find-Bottom-Left-Tree-Value/cpp-0513/) | | |
| | | | | | |
| 515 | [Find Largest Value in Each Tree Row](https://leetcode.com/problems/find-largest-value-in-each-tree-row/) | [无] | [C++](0501-1000/0515-Find-Largest-Value-in-Each-Tree-Row/cpp-0515/) | | |
| 516 | [Longest Palindromic Subsequence](https://leetcode.com/problems/longest-palindromic-subsequence/) | [无] | [C++](0501-1000/0516-Longest-Palindromic-Subsequence/cpp-0516/) | | |
| 517 | [Super Washing Machines](https://leetcode.com/problems/super-washing-machines/) | [solution](https://leetcode.com/problems/super-washing-machines/solution/) | [C++](0501-1000/0517-Super-Washing-Machines/cpp-0517/) | | |
| 518 | [Coin Change 2](https://leetcode.com/problems/coin-change-2/description/) | [无] | [C++](0501-1000/0518-Coin-Change-2/cpp-0518/) | | |
| 519 | [Random Flip Matrix](https://leetcode.com/problems/random-flip-matrix/description/) | [solution](https://leetcode.com/problems/random-flip-matrix/solution/) | [C++](0501-1000/0519-Random-Flip-Matrix/cpp-0519/) | | |
| 520 | [Detect Capital](https://leetcode.com/problems/detect-capital/) | [solution](https://leetcode.com/problems/detect-capital/solution/) | [C++](0501-1000/0520-Detect-Capital/cpp-0520/) | | |
| 521 | [Longest Uncommon Subsequence I](https://leetcode.com/problems/longest-uncommon-subsequence-i/) | [solution](https://leetcode.com/problems/longest-uncommon-subsequence-i/solution/) | [C++](0501-1000/0521-Longest-Uncommon-Subsequence-I/cpp-0521/) | | |
| 522 | [Longest Uncommon Subsequence II](https://leetcode.com/problems/longest-uncommon-subsequence-ii/) | [solution](https://leetcode.com/problems/longest-uncommon-subsequence-ii/solution/) | [C++](0501-1000/0522-Longest-Uncommon-Subsequence-II/cpp-0522/) | | |
| 523 | [Continuous Subarray Sum](https://leetcode.com/problems/continuous-subarray-sum/) | [无] | [C++](0501-1000/0523-Continuous-Subarray-Sum/cpp-0523/) | | |
| 524 | [Longest Word in Dictionary through Deleting](https://leetcode.com/problems/longest-word-in-dictionary-through-deleting/) | [solution](https://leetcode.com/problems/longest-word-in-dictionary-through-deleting/solution/) | [C++](0501-1000/0524-Longest-Word-in-Dictionary-through-Deleting/cpp-0524/) | | |
| 525 | [Contiguous Array](https://leetcode.com/problems/contiguous-array/) | [solution](https://leetcode.com/problems/contiguous-array/solution/) [题解](https://leetcode-cn.com/problems/contiguous-array/solution/lian-xu-shu-zu-by-leetcode/) | [C++](0501-1000/0525-Contiguous-Array/cpp-0525/) | | |
| 526 | [Beautiful Arrangement](https://leetcode.com/problems/beautiful-arrangement/) | [solution](https://leetcode.com/problems/beautiful-arrangement/solution/) | [C++](0501-1000/0526-Beautiful-Arrangement/cpp-0526/) | | |
| 527 | [Word Abbreviation](https://leetcode.com/problems/word-abbreviation/) | [solution](https://leetcode.com/problems/word-abbreviation/solution/) | [C++](0501-1000/0527-Word-Abbreviation/cpp-0527/) | | |
| 528 | [Random Pick with Weight](https://leetcode.com/problems/random-pick-with-weight/description/) | [solution](https://leetcode.com/problems/random-pick-with-weight/solution/) | [C++](0501-1000/0528-Random-Pick-with-Weight/cpp-0528/) | | |
| 529 | [Minesweeper](https://leetcode.com/problems/minesweeper/) | [无] | [C++](0501-1000/0529-Minesweeper/cpp-0529/) | | |
| 530 | [Minimum Absolute Difference in BST](https://leetcode.com/problems/minimum-absolute-difference-in-bst/description/) | [无] | | [Java](0501-1000/0530-Minimum-Absolute-Difference-in-BST/java-0530/src/) | |
| 531 | [Lonely Pixel I](https://leetcode.com/problems/lonely-pixel-i/) | [无] | [C++](0501-1000/0531-Lonely-Pixel-I/cpp-0531/) | | |
| 532 | [K-diff Pairs in an Array](https://leetcode.com/problems/k-diff-pairs-in-an-array/) | [solution](https://leetcode.com/problems/k-diff-pairs-in-an-array/solution/) | [C++](0501-1000/0532-K-diff-Pairs-in-an-Array/cpp-0532/) | | |
| 533 | [Lonely Pixel II](https://leetcode.com/problems/lonely-pixel-ii/) | [无] | [C++](0501-1000/0533-Lonely-Pixel-II/cpp-0533/) | | |
| | | | | | |
| 536 | [Construct Binary Tree from String](https://leetcode.com/problems/construct-binary-tree-from-string/) | [solution](https://leetcode.com/problems/construct-binary-tree-from-string/solution/)
[缺:stack] | [C++](0501-1000/0536-Construct-Binary-Tree-from-String/cpp-0536/) | | |
| 537 | [Complex Number Multiplication](https://leetcode.com/problems/complex-number-multiplication/) | [solution](https://leetcode.com/problems/complex-number-multiplication/solution/) | [C++](0501-1000/0537-Complex-Number-Multiplication/cpp-0537/) | | |
| 538 | [Convert BST to Greater Tree](https://leetcode.com/problems/convert-bst-to-greater-tree/) | [solution](https://leetcode.com/problems/convert-bst-to-greater-tree/solution/) | [C++](0501-1000/0538-Convert-BST-to-Greater-Tree/cpp-0538/) | | |
| 539 | [Minimum Time Difference](https://leetcode.com/problems/minimum-time-difference/) | [无] | [C++](0501-1000/0539-Convert-BST-to-Greater-Tree/cpp-0539/) | | |
| 540 | [Single Element in a Sorted Array](https://leetcode.com/problems/single-element-in-a-sorted-array/) | [solution](https://leetcode.com/problems/single-element-in-a-sorted-array/solution/) | [C++](0501-1000/0540-Single-Element-in-a-Sorted-Array/cpp-0540/) | | |
| 541 | [Reverse String II](https://leetcode.com/problems/reverse-string-ii/description/) | [solution](https://leetcode.com/problems/reverse-string-ii/solution/) | [C++](0501-1000/0541-Reverse-String-II/cpp-0541/) | | |
| 542 | [01 Matrix](https://leetcode.com/problems/01-matrix/description/) | [solution](https://leetcode.com/problems/01-matrix/solution/) | [C++](0501-1000/0542-01-Matrix/cpp-0542/) | | |
| 543 | [Diameter of Binary Tree](https://leetcode.com/problems/diameter-of-binary-tree/) | [solution](https://leetcode.com/problems/diameter-of-binary-tree/solution/) | [C++](0501-1000/0543-Diameter-of-Binary-Tree/cpp-0543/) | | |
| | | | | | |
| 546 | [Remove Boxes](https://leetcode.com/problems/remove-boxes/) | [solution](https://leetcode.com/problems/remove-boxes/solution/) | [C++](0501-1000/0546-Remove-Boxes/cpp-0546/) | | |
| 547 | [Number of Provinces](https://leetcode.com/problems/number-of-provinces/) | [solution](https://leetcode.com/problems/number-of-provinces/solution/) | [C++](0501-1000/0547-Number-of-Provinces/cpp-0547/) | | |
| | | | | | |
| 549 | [Binary Tree Longest Consecutive Sequence II](https://leetcode.com/problems/binary-tree-longest-consecutive-sequence-ii/) | [solution](https://leetcode.com/problems/binary-tree-longest-consecutive-sequence-ii/solution/) | [C++](0501-1000/0549-Binary-Tree-Longest-Consecutive-Sequence-II/cpp-0549/) | | |
| | | | | | |
| 551 | [Student Attendance Record I](https://leetcode.com/problems/student-attendance-record-i/) | [solution](https://leetcode.com/problems/student-attendance-record-i/solution/) | [C++](0501-1000/0551-Student-Attendance-Record-I/cpp-0551/) | | |
| 552 | [Student Attendance Record II](https://leetcode.com/problems/student-attendance-record-ii/) | [solution](https://leetcode.com/problems/student-attendance-record-ii/solution/) | [C++](0501-1000/0552-Student-Attendance-Record-II/cpp-0552/) | | |
| 553 | [Optimal Division](https://leetcode.com/problems/optimal-division/) | [solution](https://leetcode.com/problems/optimal-division/solution/)
[缺:O(n) 解法] | [C++](0501-1000/0553-Optimal-Division/cpp-0553/) | | |
| 554 | [Brick Wall](https://leetcode.com/problems/brick-wall/) | [solution](https://leetcode.com/problems/brick-wall/solution/) | [C++](0501-1000/0554-Brick-Wall/cpp-0554/) | | |
| | | | | | |
| 556 | [Next Greater Element III](https://leetcode.com/problems/next-greater-element-iii/) | [solution](https://leetcode.com/problems/next-greater-element-iii/solution/)
[缺:底层实现] | [C++](0501-1000/0556-Next-Greater-Element-III/cpp-0556/) | | |
| 557 | [Reverse Words in a String III](https://leetcode.com/problems/reverse-words-in-a-string-iii/description/) | [solution](https://leetcode.com/problems/reverse-words-in-a-string-iii/solution/) | [C++](0501-1000/0557-Reverse-Words-in-a-String-III/cpp-0557/) | | |
| 558 | [Logical OR of Two Binary Grids Represented as Quad-Trees](https://leetcode.com/problems/logical-or-of-two-binary-grids-represented-as-quad-trees/) | [无] | [C++](0501-1000/0558-Logical-OR-of-Two-Binary-Grids-Represented-as-Quad-Trees/cpp-0558/) | | |
| 559 | [Maximum Depth of N-ary Tree](https://leetcode.com/problems/maximum-depth-of-n-ary-tree/description/) | [solution](https://leetcode.com/problems/maximum-depth-of-n-ary-tree/solution/) | [C++](0501-1000/0559-Maximum-Depth-of-N-ary-Tree/cpp-0559/) | | |
| 560 | [Subarray Sum Equals K](https://leetcode.com/problems/subarray-sum-equals-k/) | [solution](https://leetcode.com/problems/subarray-sum-equals-k/solution/) | [C++](0501-1000/0560-Subarray-Sum-Equals-K/cpp-0560/) | | |
| 561 | [Array Partition I](https://leetcode.com/problems/array-partition-i/description/) | [solution](https://leetcode.com/problems/array-partition-i/solution/) | [C++](0501-1000/0561-Array-Partition-I/cpp-0561/) | | |
| | | | | | |
| 563 | [Binary Tree Tilt](https://leetcode.com/problems/binary-tree-tilt/) | [solution](https://leetcode.com/problems/binary-tree-tilt/solution/) | [C++](0501-1000/0563-Binary-Tree-Tilt/cpp-0563/) | | |
| 564 | [Find the Closest Palindrome](https://leetcode.com/problems/find-the-closest-palindrome/) | [无] | [C++](0501-1000/0564-Find-the-Closest-Palindrome/cpp-0564/) | | |
| 565 | [Array Nesting](https://leetcode.com/problems/array-nesting/) | [solution](https://leetcode.com/problems/array-nesting/solution/) | [C++](0501-1000/0565-Array-Nesting/cpp-0565/) | | |
| 566 | [Reshape the Matrix](https://leetcode.com/problems/reshape-the-matrix/) | [solution](https://leetcode.com/problems/reshape-the-matrix/solution/) | [C++](0501-1000/0566-Reshape-the-Matrix/cpp-0566/) | | |
| 567 | [Permutation in String](https://leetcode.com/problems/permutation-in-string/) | [solution](https://leetcode.com/problems/permutation-in-string/solution/) [题解](https://leetcode-cn.com/problems/permutation-in-string/solution/zi-fu-chuan-de-pai-lie-by-leetcode/) | [C++](0501-1000/0567-Permutation-in-String/cpp-0567/) | | |
| | | | | | |
| 570 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 572 | [Subtree of Another Tree](https://leetcode.com/problems/subtree-of-another-tree/description/) | [solution](https://leetcode.com/problems/subtree-of-another-tree/solution/) | [C++](0501-1000/0572-Subtree-of-Another-Tree/cpp-0572/) | | |
| 573 | [Squirrel Simulation](https://leetcode.com/problems/squirrel-simulation/) |[solution](https://leetcode.com/problems/squirrel-simulation/solution/) | [C++](0501-1000/0573-Squirrel-Simulation/cpp-0573/) | | |
| | | | | | |
| 575 | [Distribute Candies](https://leetcode.com/problems/distribute-candies/) | [solution](https://leetcode.com/problems/distribute-candies/solution/) | [C++](0501-1000/0575-Distribute-Candies/cpp-0575/) | | |
| 576 | [Out of Boundary Paths](https://leetcode.com/problems/out-of-boundary-paths/) | [solution](https://leetcode.com/problems/out-of-boundary-paths/solution/) | [C++](0501-1000/0576-Out-of-Boundary-Paths/cpp-0576/) | | |
| | | | | | |
| 580 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 581 | [Shortest Unsorted Continuous Subarray](https://leetcode.com/problems/shortest-unsorted-continuous-subarray/) | [solution](https://leetcode.com/problems/shortest-unsorted-continuous-subarray/solution/)
[缺:Stack] | [C++](0501-1000/0581-Shortest-Unsorted-Continuous-Subarray/cpp-0581/) | | |
| 582 | [Kill Process](https://leetcode.com/problems/kill-process/) | [solution](https://leetcode.com/problems/kill-process/solution/) | [C++](0501-1000/0582-Kill-Process/cpp-0582/) | | |
| 583 | [Delete Operation for Two Strings](https://leetcode.com/problems/delete-operation-for-two-strings/description/) | [solution](https://leetcode.com/problems/delete-operation-for-two-strings/solution/) | [C++](0501-1000/0583-Delete-Operation-for-Two-Strings/cpp-0583/) | | |
| 584 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 586 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 587 | [Erect the Fence](https://leetcode.com/problems/erect-the-fence/) | [solution](https://leetcode.com/problems/erect-the-fence/solution/) [题解](https://leetcode-cn.com/problems/erect-the-fence/solution/an-zhuang-zha-lan-by-leetcode/)
[缺:凸包解法整理] | [C++](0501-1000/0587-Erect-the-Fence/cpp-0587/) | | |
| | | | | | |
| 589 | [N-ary Tree Preorder Traversal](https://leetcode.com/problems/n-ary-tree-preorder-traversal/) | [solution](https://leetcode.com/problems/n-ary-tree-preorder-traversal/solution/) | [C++](0501-1000/0589-N-ary-Tree-Preorder-Traversal/cpp-0589/) | | |
| 590 | [N-ary Tree Postorder Transversal](https://leetcode.com/problems/n-ary-tree-postorder-traversal/) | [solution](https://leetcode.com/problems/n-ary-tree-postorder-traversal/solution/) | [C++](0501-1000/0590-N-ary-Tree-Postorder-Transversal/cpp-0590/) | | |
| 591 | [Tag Validator](https://leetcode.com/problems/tag-validator/) | [solution](https://leetcode.com/problems/tag-validator/solution/) | [C++](0501-1000/0591-Tag-Validator/cpp-0591/) | | |
| 592 | [Fraction Addition and Subtraction](https://leetcode.com/problems/fraction-addition-and-subtraction/) | [无] | [C++](0501-1000/0592-Fraction-Addition-and-Subtraction/cpp-0592/) | | |
| 593 | [Valid Square](https://leetcode.com/problems/valid-square/) | [solution](https://leetcode.com/problems/valid-square/solution/) | [C++](0501-1000/0593-Valid-Square/cpp-0593/) | | |
| 594 | [Longest Harmonious Subsequence](https://leetcode.com/problems/longest-harmonious-subsequence/) | [solution](https://leetcode.com/problems/longest-harmonious-subsequence/solution/) | [C++](0501-1000/0594-Longest-Harmonious-Subsequence/cpp-0594/) | | |
| 595 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 598 | [Range Addition II](https://leetcode.com/problems/range-addition-ii/description/) | | [C++](0501-1000/0598-Range-Addition-II/cpp-0598/) | | |
| 599 | [Minimum Index Sum of Two Lists](https://leetcode.com/explore/learn/card/hash-table/184/comparison-with-other-data-structures/1177/) | [solution](https://leetcode.com/problems/minimum-index-sum-of-two-lists/solution/) | [C++](0501-1000/0599-Minimum-Index-Sum-of-Two-Lists/cpp-0599/) | | |
| 600 | [Non-negative Integers without Consecutive Ones](https://leetcode.com/problems/non-negative-integers-without-consecutive-ones/description/) | [solution](https://leetcode.com/problems/non-negative-integers-without-consecutive-ones/solution/)
[缺:Bit Manipulation]| [C++](0501-1000/0600-Non-negative-Integers-without-Consecutive-Ones/cpp-0600/) | | |
| | | | | | |
| 605 | [Can Place Flowers](https://leetcode.com/problems/can-place-flowers/) | [solution](https://leetcode.com/problems/can-place-flowers/solution/) | [C++](0501-1000/0605-Can-Place-Flowers/cpp-0605/) | | |
| 606 | [Construct String from Binary Tree](https://leetcode.com/problems/construct-string-from-binary-tree/) | [solution](https://leetcode.com/problems/construct-string-from-binary-tree/solution/) | [C++](0501-1000/0606-Construct-String-from-Binary-Tree/cpp-0606/) | | |
| 607 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 608 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 609 | [Find Duplicate File in System](https://leetcode.com/problems/find-duplicate-file-in-system/) | [solution](https://leetcode.com/problems/find-duplicate-file-in-system/solution/) | [C++](0501-1000/0609-Find-Duplicate-File-in-System/cpp-0609/) | | |
| | | | | | |
| 611 | [Valid Triangle Number](https://leetcode.com/problems/valid-triangle-number/) | [solution](https://leetcode.com/problems/valid-triangle-number/solution/) | [C++](0501-1000/0611-Valid-Triangle-Number/cpp-0611/) | | |
| | | | | | |
| 617 | [Merge Two Binary Trees](https://leetcode.com/problems/merge-two-binary-trees/) | [C++](0501-1000/0617-Merge-Two-Binary-Trees/cpp-0617/) | | | |
| | | | | | |
| 619 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 621 | [Task Scheduler](https://leetcode.com/problems/task-scheduler/) | [solution](https://leetcode.com/problems/task-scheduler/solution/) | [C++](0501-1000/0621-Task-Scheduler/cpp-0621/) | | |
| 622 | [Design Circular Queue](https://leetcode.com/problems/design-circular-queue/description/) | [无] | [C++](0501-1000/0622-Design-Circular-Queue/cpp-0622/) | | |
| 623 | [Add One Row to Tree](https://leetcode.com/problems/add-one-row-to-tree/) | [solution](https://leetcode.com/problems/add-one-row-to-tree/solution/) | [C++](0501-1000/0623-Add-One-Row-to-Tree/cpp-0623/) | | |
| | | | | | |
| 627 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 628 | [Maximum Product of Three Numbers](https://leetcode.com/problems/maximum-product-of-three-numbers/) | [solution](https://leetcode.com/problems/maximum-product-of-three-numbers/solution/) | [C++](0501-1000/0628-Maximum-Product-of-Three-Numbers/cpp-0628/) | | |
| 629 | [K-Inverse-Pairs-Array](https://leetcode.com/problems/k-inverse-pairs-array/) | [solution](https://leetcode.com/problems/k-inverse-pairs-array/solution/)
[缺:其他 dp 优化思路] | [C++](0501-1000/0629-K-Inverse-Pairs-Array/cpp-0629/) | | |
| 630 | [Course Schedule III](https://leetcode.com/problems/course-schedule-iii/) | [solution](https://leetcode.com/problems/course-schedule-iii/solution/) | [C++](0501-1000/0630-Course-Schedule-III/cpp-0630/) | | |
| | | | | | |
| 632 | [Smallest Range Covering Elements from K Lists](https://leetcode.com/problems/smallest-range-covering-elements-from-k-lists/) | [solution](https://leetcode.com/problems/smallest-range-covering-elements-from-k-lists/solution/) | [C++](0501-1000/0632-Smallest-Range-Covering-Elements-from-K-Lists/cpp-0632/) | | |
| 633 | [Sum of Square Numbers](https://leetcode.com/problems/sum-of-square-numbers/) | [C++](0501-1000/0633-Sum-of-Square-Numbers/cpp-0633/) | | | |
| | | | | | |
| 636 | [Exclusive Time of Functions](https://leetcode.com/problems/exclusive-time-of-functions/) | [无] | [C++](0501-1000/0636-Exclusive-Time-of-Functions/cpp-0636/) | | |
| 637 | [Average of Levels in Binary Tree](https://leetcode.com/problems/average-of-levels-in-binary-tree/description/) | [solution](https://leetcode.com/problems/average-of-levels-in-binary-tree/description/) | [C++](0501-1000/0637-Average-of-Levels-in-Binary-Tree/cpp-0637/) | | |
| 638 | [Shopping Offers](https://leetcode.com/problems/shopping-offers/) | [solution](https://leetcode.com/problems/shopping-offers/solution/) | [C++](0501-1000/0638-Shopping-Offers/cpp-0638/) | | |
| 639 | [Decode Ways II](https://leetcode.com/problems/decode-ways-ii/) | [solution](https://leetcode.com/problems/decode-ways-ii/solution/)
[缺:DP] | [C++](0501-1000/0639-Decode-Ways-II/cpp-0639/) | | |
| 640 | [Solve the Equation](https://leetcode.com/problems/solve-the-equation/) | [无] | [C++](0501-1000/0640-Solve-the-Equation/cpp-0640/) | | |
| | | | | | |
| 642 | [Design Search Autocomplete System](https://leetcode.com/problems/design-search-autocomplete-system/) | [无] | [C++](0501-1000/0642-Design-Search-Autocomplete-System/cpp-0642/) | | |
| 643 | [Maximum Average Subarray I](https://leetcode.com/problems/maximum-average-subarray-i/) | [solution](https://leetcode.com/problems/maximum-average-subarray-i/solution/) | [C++](0501-1000/0643-Maximum-Average-Subarray-I/cpp-0643/) | | |
| 644 | [Maximum Average Subarray II](https://leetcode.com/problems/maximum-average-subarray-ii/) | [solution](https://leetcode.com/problems/maximum-average-subarray-ii/solution/) | [C++](0501-1000/0644-Maximum-Average-Subarray-II/cpp-0644/) | | |
| 645 | [Set Mismatch](https://leetcode.com/problems/set-mismatch/) | [solution](https://leetcode.com/problems/set-mismatch/solution/)
[缺:空间 O(1) 解法] | [C++](0501-1000/0645-Set-Mismatch/cpp-0645/) | | |
| 646 | [Maximum Length of Pair Chain](https://leetcode.com/problems/maximum-length-of-pair-chain/) | [solution](https://leetcode.com/problems/maximum-length-of-pair-chain/solution/) | [C++](0501-1000/0646-Maximum-Length-of-Pair-Chain/cpp-0646/) | | |
| 647 | [Palindromic Substrings](https://leetcode.com/problems/palindromic-substrings/) | [solution](https://leetcode.com/problems/palindromic-substrings/solution/) | [C++](0501-1000/0647-Palindromic-Substrings/cpp-0647/) | | |
| 648 | [Replace Words](https://leetcode.com/problems/replace-words/description/) | [无] | [C++](0501-1000/0648-Replace-Words/cpp-0648/) | | |
| 649 | [Dota2 Senate](https://leetcode.com/problems/dota2-senate/) | [solution](https://leetcode.com/problems/dota2-senate/solution/)
[缺:队列] | [C++](0501-1000/0649-Dota2-Senate/cpp-0649/) | | |
| 650 | [2 Keys Keyboard](https://leetcode.com/problems/2-keys-keyboard/) | [solution](https://leetcode.com/problems/2-keys-keyboard/solution/) | [C++](0501-1000/0650-2-Keys-Keyboard/cpp-0650/) | | |
| | | | | | |
| 652 | [Find Duplicate Subtrees](https://leetcode.com/problems/find-duplicate-subtrees/description/) | [solution](https://leetcode.com/problems/find-duplicate-subtrees/solution/) | [C++](0501-1000/0652-Find-Duplicate-Subtrees/cpp-0652/) | | |
| 653 | [Two Sum IV - Input is a BST](https://leetcode.com/problems/two-sum-iv-input-is-a-bst/) | [无] | [C++](0501-1000/0653-Two-Sum-IV-Input-is-a-BST/cpp-0653/) | | |
| 654 | [Maximum Binary Tree](https://leetcode.com/problems/maximum-binary-tree/) | [solution](https://leetcode.com/problems/maximum-binary-tree/solution/) | [C++](0501-1000/0654-Maximum-Binary-Tree/cpp-0654/) | | |
| 655 | |[Print Binary Tree](https://leetcode.com/problems/print-binary-tree/) | [无] | [C++](0501-1000/0655-Print-Binary-Tree/cpp-0655/) | |
| | | | | | |
| 658 | [Find K Closest Elements](https://leetcode.com/problems/find-k-closest-elements/) | [solution](https://leetcode.com/problems/find-k-closest-elements/solution/)
[缺:二分] | [C++](0501-1000/0658-Find-K-Closest-Elements/cpp-0658/) | | |
| 659 | [Split Array into Consecutive Subsequences](https://leetcode.com/problems/split-array-into-consecutive-subsequences/) | [solution](https://leetcode.com/problems/split-array-into-consecutive-subsequences/solution/) | [C++](0501-1000/0659-Split-Array-into-Consecutive-Subsequences/cpp-0659/) | | |
| | | | | | |
| 661 | [Image Smoother](https://leetcode.com/problems/image-smoother/) | [无] | [C++](0501-1000/0658-Image-Smoother/cpp-0658/) | | |
| 662 | [Maximum Width of Binary Tree](https://leetcode.com/problems/maximum-width-of-binary-tree/) | [solution](https://leetcode.com/problems/maximum-width-of-binary-tree/solution/) | [C++](0501-1000/0662-Maximum-Width-of-Binary-Tree/cpp-0662/) | | |
| | | | | | |
| 664 | [Strange Printer](https://leetcode.com/problems/strange-printer/) | [solution](https://leetcode.com/problems/strange-printer/) | [C++](0501-1000/0664-Strange-Printer/cpp-0664/) | | |
| 665 | [Non-decreasing Array](https://leetcode.com/problems/non-decreasing-array/) | [solution](https://leetcode.com/problems/non-decreasing-array/solution/) | [C++](0501-1000/0665-Non-decreasing-Array/cpp-0665/) | | |
| 666 | [Path Sum IV](https://leetcode.com/problems/path-sum-iv/) | [solution](https://leetcode.com/problems/path-sum-iv/solution/) | [C++](0501-1000/0666-Path-Sum-IV/cpp-0666/) | | |
| 667 | [Beautiful Arrangement II](https://leetcode.com/problems/beautiful-arrangement-ii/) | [solution](https://leetcode.com/problems/beautiful-arrangement-ii/solution/) | [C++](0501-1000/0667-Beautiful-Arrangement-II/ccp-0667/) | | |
| 668 | [Kth Smallest Number in Multiplication Table](https://leetcode.com/problems/kth-smallest-number-in-multiplication-table/) | [solution](https://leetcode.com/problems/kth-smallest-number-in-multiplication-table/) | [C++](0501-1000/0668-Kth-Smallest-Number-in-Multiplication-Table/cpp-0668/) | | |
| 669 | [Trim a Binary Search Tree](https://leetcode.com/problems/trim-a-binary-search-tree/) | [solution](https://leetcode.com/problems/trim-a-binary-search-tree/solution/) | [C++](0501-1000/0669-Trim-a-Binary-Search-Tree/cpp-0669/) | | |
| 670 | [Maximum Swap](https://leetcode.com/problems/maximum-swap/) | [无] | [C++](0501-1000/0670-Maximum-Swap/cpp-0670/) | | |
| 671 | [Second Minimum Node In a Binary Tree](https://leetcode.com/problems/second-minimum-node-in-a-binary-tree/) | [solution](https://leetcode.com/problems/second-minimum-node-in-a-binary-tree/solution/) | [C++](0501-1000/0671-Second-Minimum-Node-In-a-Binary-Tree/cpp-0671/) | | |
| 672 | [Bulb Switcher II](https://leetcode.com/problems/bulb-switcher-ii/description/) | [solution](https://leetcode.com/problems/bulb-switcher-ii/solution/) | [C++](0501-1000/0672-Bulb-Switcher-II/cpp-0672/) | | |
| 673 | [Number of Longest Increasing Subsequence](https://leetcode.com/problems/number-of-longest-increasing-subsequence/description/) | [缺:BIT;线段树] | [C++](0501-1000/0673-Number-of-Longest-Increasing-Subsequence/cpp-0673/) | | |
| 674 | [Longest Continuous Increasing Subsequence](https://leetcode.com/problems/longest-continuous-increasing-subsequence/description/) | | [C++](0501-1000/0674-Longest-Continuous-Increasing-Subsequence/cpp-0674/) | | |
| 675 | [Cut Off Trees for Golf Event](https://leetcode.com/problems/cut-off-trees-for-golf-event/description/) | [缺:A*;Hadlock's Algo] | [C++](0501-1000/0675-Cut-Off-Trees-for-Golf-Event/cpp-0675/) | | |
| 676 | [Implement Magic Dictionary](https://leetcode.com/problems/implement-magic-dictionary/description/) | [solution](https://leetcode.com/problems/implement-magic-dictionary/solution/) | [C++](0501-1000/0676-Implement-Magic-Dictionary/cpp-0676/) | | |
| 677 | [Map Sum Pairs](https://leetcode.com/problems/map-sum-pairs/description/) | [solution](https://leetcode.com/problems/map-sum-pairs/solution/) | [C++](0501-1000/0677-Map-Sum-Pairs/cpp-0677/) | | |
| 678 | [Valid Parenthesis String](https://leetcode.com/problems/valid-parenthesis-string/) | [solution](https://leetcode.com/problems/valid-parenthesis-string/solution/) | [C++](0501-1000/0678-Valid-Parenthesis-String/cpp-0678/) | | |
| 679 | [24 Game](https://leetcode.com/problems/24-game/) | [solution](https://leetcode.com/problems/24-game/) | [C++](0501-1000/0679-24-Game/cpp-0679/) | | |
| 680 | [Valid Palindrome II](https://leetcode.com/problems/valid-palindrome-ii/) | [无] | [C++](0501-1000/0680-Valid-Palindrome-II/cpp-0680/) | | |
| | | | | | |
| 682 | [Baseball Game](https://leetcode.com/problems/baseball-game/) | [solution](https://leetcode.com/problems/baseball-game/solution/) | [C++](0501-1000/0682-Baseball-Game/cpp-0682/) | | |
| | | | | | |
| 684 | [Redundant Connection](https://leetcode.com/problems/redundant-connection/description/) | [solution](https://leetcode.com/problems/redundant-connection/solution/) | [C++](0501-1000/0684-Redundant-Connection/cpp-0684/) | | |
| 685 | [Redundant Connection II](https://leetcode.com/problems/redundant-connection-ii/description/) | [solution](https://leetcode.com/problems/redundant-connection-ii/solution/) | [C++](0501-1000/0685-Redundant-Connection-II/cpp-0685/) | | |
| 686 | [Repeated String Match](https://leetcode.com/problems/repeated-string-match/) |[无] | [C++](0501-1000/0686-Repeated-String-Match/cpp-0686/) | | |
| 687 | [Longest Univalue Path](https://leetcode.com/problems/longest-univalue-path/) | [solution](https://leetcode.com/problems/longest-univalue-path/solution/) | [C++](0501-1000/0687-Longest-Univalue-Path/cpp-0687/) | | |
| 688 | [Knight Probability in Chessboard](https://leetcode.com/problems/knight-probability-in-chessboard/) | [solution](https://leetcode.com/problems/knight-probability-in-chessboard/solution/) | [C++](0501-1000/0688-Knight-Probability-in-Chessboard/cpp-0688/) | | |
| 689 | [Maximum Sum of 3 Non-Overlapping Subarrays](https://leetcode.com/problems/maximum-sum-of-3-non-overlapping-subarrays/) | [solution](https://leetcode.com/problems/maximum-sum-of-3-non-overlapping-subarrays/solution/) | [C++](0501-1000/0689-Maximum-Sum-of-3-Non-Overlapping-Subarrays/cpp-0689/)| | |
| 690 | [Employee Importance](https://leetcode.com/problems/employee-importance/description/) | [solution](https://leetcode.com/problems/employee-importance/solution/) | [C++](0501-1000/0690-Employee-Importance/cpp-0690/) | | |
| 691 | [Stickers to Spell Word](https://leetcode.com/problems/stickers-to-spell-word/) | [无] | [C++](0501-1000/0691-Stickers-to-Spell-Word/cpp-0691/) | | |
| 692 | [Top K Frequent Words](https://leetcode.com/problems/top-k-frequent-words/description/) | [solution](https://leetcode.com/problems/top-k-frequent-words/solution/) | [C++](0501-1000/0692-Top-K-Frequent-Words/cpp-0692/) | | |
| 693 | [Binary Number with Alternating Bits](https://leetcode.com/problems/binary-number-with-alternating-bits/) | [无] | [C++](0501-1000/0693-Binary-Number-with-Alternating-Bits/cpp-0693/) | | |
| 694 | [Number of Distinct Islands](https://leetcode.com/problems/number-of-distinct-islands/description/) | [review: hash的方式] | [C++](0501-1000/0694-Number-of-Distinct-Islands/cpp-0694/) | | |
| 695 | [Max-Area-of-Island](https://leetcode.com/problems/max-area-of-island/description/) | | [C++](0501-1000/0695-Max-Area-of-Island/cpp-0695) | | |
| 696 | [Count Binary Substrings](https://leetcode.com/problems/count-binary-substrings/description/) | | [C++](0501-1000/0696-Count-Binary-Substrings/cpp-0696/) | | |
| 697 | [Degree of an Array](https://leetcode.com/problems/degree-of-an-array/description/) | | [C++](0501-1000/0697-Degree-of-an-Array/cpp-0697/) | | |
| 698 | [Partition to K Equal Sum Subsets](https://leetcode.com/problems/partition-to-k-equal-sum-subsets/description/) | | [C++](0501-1000/0698-Partition-to-K-Equal-Sum-Subsets/cpp-0698/) | [Java](0501-1000/0698-Partition-to-K-Equal-Sum-Subsets/java-0698/src/) | |
| 699 | [Falling Squares](https://leetcode.com/contest/leetcode-weekly-contest-54/problems/falling-squares/) | [缺:线段树;块状链表] | [C++](0501-1000/0699-Falling-Squares/cpp-0699/) | | |
| 700 | [Search in a Binary Search Tree](https://leetcode.com/problems/search-in-a-binary-search-tree/) | [solution](https://leetcode.com/problems/search-in-a-binary-search-tree/solution/) | [C++](0501-1000/0700-Search-in-a-Binary-Search-Tree/cpp-0700/) | | |
| 701 | [Insert into a Binary Search Tree](https://leetcode.com/problems/insert-into-a-binary-search-tree/) | [solution](https://leetcode.com/problems/insert-into-a-binary-search-tree/solution/) | [C++](0501-1000/0701-Insert-into-a-Binary-Search-Tree/cpp-0701/) | | |
| | | | | | |
| 703 | [Kth Largest Element in a Stream](https://leetcode.com/problems/kth-largest-element-in-a-stream/) | [无] | [C++](0501-1000/0703-Kth-Largest-Element-in-a-Stream/cpp-0703/) | | |
| 704 | [Binary Search](https://leetcode.com/problems/binary-search/description/) | [solution](https://leetcode.com/problems/binary-search/solution/) | [C++](0501-1000/0704-Binary-Search/cpp-0704/) | | |
| 705 | [Design HashSet](https://leetcode.com/problems/design-hashset/description/) | [无] | [C++](0501-1000/0705-Design-HashSet/cpp-0705/) | | |
| 706 | [Design HashMap](https://leetcode.com/problems/design-hashmap/description/) | [无] | [C++](0501-1000/0706-Design-HashMap/cpp-0706/) | | |
| 707 | [Design Linked List](https://leetcode.com/problems/design-linked-list/description/) | [无] | [C++](0501-1000/0707-Design-Linked-List/cpp-0707/) | | |
| 708 | [Insert into a Cyclic Sorted List](https://leetcode.com/problems/insert-into-a-cyclic-sorted-list/description/) | [无] | [C++](0501-1000/0708-Insert-into-a-Cyclic-Sorted-List/cpp-0708/) | | |
| 709 | [To Lower Case](https://leetcode.com/problems/to-lower-case/) | [solution](https://leetcode.com/problems/to-lower-case/solution/) | [C++](0501-1000/0709-To-Lower-Case/cpp-0709/) | | |
| 710 | [Random Pick with Blacklist](https://leetcode.com/problems/random-pick-with-blacklist/description/) | [solution](https://leetcode.com/problems/random-pick-with-blacklist/solution/) | [C++](0501-1000/0710-Random-Pick-with-Blacklist/cpp-0710/) | | |
| 711 | [Number of Distinct Islands II](https://leetcode.com/problems/number-of-distinct-islands-ii/description/) | [review: hash的方式] | [C++](0501-1000/0711-Number-of-Distinct-Islands-II/cpp-0711/) | | |
| 712 | [Minimum ASCII Delete Sum for Two Strings](https://leetcode.com/problems/minimum-ascii-delete-sum-for-two-strings/description/) | | [C++](0501-1000/0712-Minimum-ASCII-Delete-Sum-for-Two-Strings/cpp-0712/) | | |
| 713 | [Subarray Product Less Than K](https://leetcode.com/problems/subarray-product-less-than-k/description/) | | [C++](0501-1000/0713-Subarray-Product-Less-Than-K/cpp-0713/) | | |
| 714 | [Best Time to Buy and Sell Stock with Transaction Fee](https://leetcode.com/problems/best-time-to-buy-and-sell-stock-with-transaction-fee/description/) | | [C++](0501-1000/0714-Best-Time-to-Buy-and-Sell-Stock-with-Transaction-Fee/cpp-0714/) | | |
| 715 | [Range Module](https://leetcode.com/problems/range-module/description/) | [缺:set查找] | [C++](0501-1000/0715-Range-Module/cpp-0715/) | | |
| 716 | [Max Stack](https://leetcode.com/problems/max-stack/description/) | [solution](https://leetcode.com/problems/max-stack/solution/) | [C++](0501-1000/0716-Max-Stack/cpp-0716/) | | |
| 717 | [1-bit and 2-bit Characters](https://leetcode.com/problems/1-bit-and-2-bit-characters/description/) | | [C++](0501-1000/0717-1-bit-and-2-bit-Characters/cpp-0717/) | | |
| 718 | [Maximum Length of Repeated Subarray](https://leetcode.com/problems/maximum-length-of-repeated-subarray/description/) | [缺:Rolling Hash] | [C++](0501-1000/0718-Maximum-Length-of-Repeated-Subarray/cpp-0718/) | | |
| 719 | [Find K-th Smallest Pair Distance](https://leetcode.com/problems/find-k-th-smallest-pair-distance/description/) | [solution](https://leetcode.com/problems/find-k-th-smallest-pair-distance/solution/) | [C++](0501-1000/0719-Find-K-th-Smallest-Pair-Distance/cpp-0719/) | | |
| 720 | [Longest Word in Dictionary](https://leetcode.com/problems/longest-word-in-dictionary/description/) | [solution](https://leetcode.com/problems/longest-word-in-dictionary/solution/) | [C++](0501-1000/0720-Longest-Word-in-Dictionary/cpp-0720/) | | |
| 721 | [Accounts Merge](https://leetcode.com/problems/accounts-merge/description/) | [solution](https://leetcode.com/problems/accounts-merge/solution/) | [C++](0501-1000/0721-Accounts-Merge/cpp-0721/) | | |
| 722 | [Remove Comments](https://leetcode.com/problems/remove-comments/description/) | [solution](https://leetcode.com/problems/remove-comments/solution/) | [C++](0501-1000/0722-Remove-Comments/cpp-0722/) | | |
| 723 | [Candy Crush](https://leetcode.com/problems/candy-crush/description/) | [solution](https://leetcode.com/problems/candy-crush/solution/) | [C++](0501-1000/0723-Candy-Crush/cpp-0723/) | | |
| 724 | [Find Pivot Index](https://leetcode.com/problems/find-pivot-index/description/) | [solution](https://leetcode.com/problems/find-pivot-index/solution/) | [C++](0501-1000/0724-Find-Pivot-Index/cpp-0724/) | | |
| 725 | [Split Linked List in Parts](https://leetcode.com/problems/split-linked-list-in-parts/description/) | [solution](https://leetcode.com/problems/split-linked-list-in-parts/solution/) | [C++](0501-1000/0725-Split-Linked-List-in-Parts/cpp-0725/) | | |
| 726 | [Number of Atoms](https://leetcode.com/problems/number-of-atoms/) | [solution](https://leetcode.com/problems/number-of-atoms/solution/) | [C++](0501-1000/0726-Number-of-Atoms/cpp-0726/) | | |
| 727 | [Minimum Window Subsequence](https://leetcode.com/problems/minimum-window-subsequence/description/) | [solution](https://leetcode.com/problems/minimum-window-subsequence/solution/) | [C++](0501-1000/cpp-Minimum-Window-Subsequence/cpp-0727/) | | |
| 728 | [Self Dividing Numbers](https://leetcode.com/problems/self-dividing-numbers/description/) | [solution](https://leetcode.com/problems/self-dividing-numbers/solution/) | [C++](0501-1000/0728-Self-Dividing-Numbers/cpp-0728/) | | |
| 729 | [My Calendar I](https://leetcode.com/problems/my-calendar-i/description/) | [solution](https://leetcode.com/problems/my-calendar-i/solution/) | [C++](0501-1000/0729-My-Calendar-I/cpp-0729/) | | |
| 730 | [Count Different Palindromic Subsequences](https://leetcode.com/problems/count-different-palindromic-subsequences/) | [无] | [C++](0501-1000/0730-Count-Different-Palindromic-Subsequences/cpp-0730/) | | |
| 731 | [My Calendar II](https://leetcode.com/problems/my-calendar-ii/description/) | [solution](https://leetcode.com/problems/my-calendar-ii/solution/) | [C++](0501-1000/0731-My-Calendar-II/cpp-0731/) | | |
| 732 | [My Calendar III](https://leetcode.com/problems/my-calendar-iii/description/) | [solution](https://leetcode.com/problems/my-calendar-iii/solution/) | [C++](0501-1000/0732-My-Calendar-III/cpp-0732/) | | |
| 733 | [Flood Fill](https://leetcode.com/problems/flood-fill/description/) | [solution](https://leetcode.com/problems/flood-fill/solution/) | [C++](0501-1000/0733-Flood-Fill/cpp-0733/) | | |
| 734 | [Sentence Similarity](https://leetcode.com/problems/sentence-similarity/description/) | [solution](https://leetcode.com/problems/sentence-similarity/solution/) | [C++](0501-1000/0734-Sentence-Similarity/cpp-0734/) | | |
| 735 | [Asteroid Collision](https://leetcode.com/problems/asteroid-collision/description/) | [solution](https://leetcode.com/problems/asteroid-collision/solution/) | [C++](0501-1000/0735-Asteroid-Collision/cpp-0735/) | | |
| 736 | [Parse Lisp Expression](https://leetcode.com/problems/parse-lisp-expression/description/) | [solution](https://leetcode.com/problems/parse-lisp-expression/solution/) | [C++](0501-1000/0736-Parse-Lisp-Expression/cpp-0736/) | | |
| 737 | [Sentence Similarity II](https://leetcode.com/problems/sentence-similarity-ii/description/) | [solution](https://leetcode.com/problems/sentence-similarity-ii/solution/) | [C++](0501-1000/0737-Sentence-Similarity-II/cpp-0737/) | | |
| | | | | | |
| 739 | [Daily Temperatures](https://leetcode.com/problems/daily-temperatures/description/) | [solution](https://leetcode.com/problems/daily-temperatures/solution/) | [C++](0501-1000/0739-Daily-Temperatures/cpp-0739/) | | |
| 740 | [Delete and Earn](https://leetcode.com/problems/delete-and-earn/description/) | [solution](https://leetcode.com/problems/delete-and-earn/solution/) | [C++](0501-1000/0740-Delete-and-Earn/cpp-0740/) | | |
| 741 | [Cherry Pickup](https://leetcode.com/problems/cherry-pickup/description/) | [solution](https://leetcode.com/problems/cherry-pickup/solution/)
[缺:自底向上的动态规划] | [C++](0501-1000/0741-Cherry-Pickup/cpp-0741/) | | |
| | | | | | |
| 745 | [Prefix and Suffix Search](https://leetcode.com/problems/prefix-and-suffix-search/) | [solution](https://leetcode.com/problems/prefix-and-suffix-search/solution/) | [C++](0501-1000/0745-Prefix-and-Suffix-Search/cpp-0745/) | | |
| 746 | [Min Cost Climbing Stairs](https://leetcode.com/problems/min-cost-climbing-stairs/) | [solution](https://leetcode.com/problems/min-cost-climbing-stairs/solution/) | [C++](0501-1000/0746-Min-Cost-Climbing-Stairs/cpp-0746/) | | |
| 747 | [Largest Number At Least Twice of Others](https://leetcode.com/problems/largest-number-at-least-twice-of-others/description/) | [solution](https://leetcode.com/problems/largest-number-at-least-twice-of-others/solution/) | [C++](0501-1000/0747-Largest-Number-At-Least-Twice-of-Others/cpp-0747/) | | |
| | | | | | |
| 749 | [Contain Virus](https://leetcode.com/problems/contain-virus/) | [无] | [C++](0501-1000/0749-Contain-Virus/cpp-0749/)| | |
| | | | | | |
| 752 | [Open the Lock](https://leetcode.com/problems/open-the-lock/description/) | [solution](https://leetcode.com/problems/open-the-lock/solution/) | [C++](0501-1000/0752-Open-the-Lock/cpp-0752/) | | |
| 753 | [Cracking the Safe](https://leetcode.com/problems/cracking-the-safe/) | [无] | [C++](0501-1000/0753-Cracking-the-Safe/cpp-0753/) | | |
| 754 | [Reach a Number](https://leetcode.com/problems/reach-a-number/) | [Solution](https://leetcode.com/problems/reach-a-number/solution/) | [C++](0501-1000/0754-Reach-a-Number/cpp-0754/) | | |
| | | | | | |
| 757 | [Set Intersection Size At Least Two](https://leetcode.com/problems/set-intersection-size-at-least-two/) | [无] | [C++](0501-1000/0757-Set-Intersection-Size-At-Least-Two/cpp-0757/) | | |
| | | | | | |
| 761 | [Special Binary String](https://leetcode.com/problems/special-binary-string/) | [solution](https://leetcode.com/problems/special-binary-string/solution/) | [C++](0501-1000/0761-Special-Binary-String/cpp-0761/) | | |
| 762 | [Prime Number of Set Bits in Binary Representation](https://leetcode.com/problems/prime-number-of-set-bits-in-binary-representation/) | [无] | [C++](0501-1000/0762-Prime-Number-of-Set-Bits-in-Binary-Representation/cpp-0762/) | | |
| 763 | [Partition Labels](https://leetcode.com/problems/partition-labels/) | [无] | [C++](0501-1000/0763-Partition-Labels/cpp-0763/) | | |
| 764 | [Largest Plus Sign](https://leetcode.com/problems/largest-plus-sign/) | [C++](0501-1000/0764-Largest-Plus-Sign/cpp-0764/) | | | |
| 765 | [Couples Holding Hands](https://leetcode.com/problems/couples-holding-hands/description/) | [solution](https://leetcode.com/problems/couples-holding-hands/solution/) | [C++](0501-1000/0765-Couples-Holding-Hands/cpp-0765/) | | |
| 766 | [Toeplitz Matrix](https://leetcode.com/problems/toeplitz-matrix/description/) | [solution](https://leetcode.com/problems/toeplitz-matrix/solution/) | [C++](0501-1000/0766-Toeplitz-Matrix/cpp-0766/) | | |
| | | | | | |
| 771 | [Jewels and Stones](https://leetcode.com/problems/jewels-and-stones/description/) | [solution](https://leetcode.com/problems/jewels-and-stones/solution/) | [C++](0501-1000/0771-Jewels-and-Stones/cpp-0771/) | | |
| 772 | [Basic Calculator III](https://leetcode.com/problems/basic-calculator-iii/description/) | [无] | [C++](0501-1000/0772-Basic-Calculator-III/cpp-0772/) | | |
| | | | | | |
| 774 | [Minimize Max Distance to Gas Station](https://leetcode.com/problems/minimize-max-distance-to-gas-station/) | [solution](https://leetcode.com/problems/minimize-max-distance-to-gas-station/) | [C++](0501-1000/0774-Minimize-Max-Distance-to-Gas-Station/cpp-0774/) | | |
| 775 | [Global and Local Inversions](https://leetcode.com/problems/global-and-local-inversions/) | [C++](0501-1000/0775-Global-and-Local-Inversions/cpp-0775/) | | | |
| | | | | | |
| 779 | [K-th Symbol in Grammar](https://leetcode.com/problems/k-th-symbol-in-grammar/) | [无] | [C++](0501-1000/0779-K-th-Symbol-in-Grammar/cpp-0779/) | | |
| 780 | [Reaching Points](https://leetcode.com/problems/reaching-points/description/) | [solution](https://leetcode.com/problems/reaching-points/solution/) | [C++](0501-1000/0780-Reaching-Points/cpp-0780/) | | |
| 781 | [Rabbits in Forest](https://leetcode.com/problems/rabbits-in-forest/description/) | [solution](https://leetcode.com/problems/rabbits-in-forest/solution/) | [C++](0501-1000/0781-Rabbits-in-Forest/cpp-0781/) | | |
| 782 | [Transform to Chessboard](https://leetcode.com/problems/transform-to-chessboard/) | [solution](https://leetcode.com/problems/transform-to-chessboard/solution/) | [C++](0501-1000/0782-Transform-to-Chessboard/cpp-0782/) | | |
| 783 | [Minimum Distance Between BST Nodes](https://leetcode.com/problems/minimum-distance-between-bst-nodes/description/) | [solution](https://leetcode.com/problems/minimum-distance-between-bst-nodes/solution/) | [C++](0501-1000/0783-Minimum-Distance-Between-BST-Nodes/cpp-0783/) | | |
| 784 | [Letter Case Permutation](https://leetcode.com/problems/letter-case-permutation/description/) | [solution](https://leetcode.com/problems/letter-case-permutation/solution/) | [C++](0501-1000/0784-Letter-Case-Permutation/cpp-0784/) | | |
| 785 | [Is Graph Bipartite?](https://leetcode.com/problems/is-graph-bipartite/description/) | [solution](https://leetcode.com/problems/is-graph-bipartite/description/) | [C++](0501-1000/0785-Is-Graph-Bipartite/cpp-0785/) | | |
| 786 | [K-th Smallest Prime Fraction](https://leetcode.com/problems/k-th-smallest-prime-fraction/description/) | [solution](https://leetcode.com/problems/k-th-smallest-prime-fraction/solution/)
[缺:分治算法] | [C++](0501-1000/0786-K-th-Smallest-Prime-Fraction/cpp-0786/) | | |
| 787 | [Cheapest Flights Within K Stops](https://leetcode.com/problems/cheapest-flights-within-k-stops/description/) | [solution](https://leetcode.com/problems/cheapest-flights-within-k-stops/solution/)
[缺:使用Heap] | [C++](0501-1000/0787-Cheapest-Flights-Within-K-Stops/cpp-0787/) | | |
| 788 | [Rotated Digits](https://leetcode.com/problems/rotated-digits/description/) | [solution](https://leetcode.com/problems/rotated-digits/solution/) | [C++](0501-1000/0788-Rotated-Digits/cpp-0788/) | | |
| 789 | [Escape The Ghosts](https://leetcode.com/problems/escape-the-ghosts/description/) | [solution](https://leetcode.com/problems/escape-the-ghosts/solution/) | [C++](0501-1000/0789-Escape-The-Ghosts/cpp-0789/) | | |
| 790 | [Domino and Tromino Tiling](https://leetcode.com/problems/domino-and-tromino-tiling/description/) | [solution](https://leetcode.com/problems/domino-and-tromino-tiling/solution/)
[缺:转移矩阵求幂解法] | [C++](0501-1000/0790-Domino-and-Tromino-Tiling/cpp-0790/) | | |
| 791 | [Custom Sort String](https://leetcode.com/problems/custom-sort-string/description/) | [solution](https://leetcode.com/problems/custom-sort-string/solution/) | [C++](0501-1000/0791-Custom-Sort-String/cpp-0791/) | | |
| 792 | [Number of Matching Subsequences](https://leetcode.com/problems/number-of-matching-subsequences/description/) | [solution](https://leetcode.com/problems/number-of-matching-subsequences/solution/) | [C++](0501-1000/0792-Number-of-Matching-Subsequences/cpp-0792/) | | |
| 793 | [Preimage Size of Factorial Zeroes Function](https://leetcode.com/problems/preimage-size-of-factorial-zeroes-function/description/) | [solution](https://leetcode.com/problems/preimage-size-of-factorial-zeroes-function/solution/) | [C++](0501-1000/0793-Preimage-Size-of-Factorial-Zeroes-Function/cpp-0793/) | | |
| 794 | [Valid Tic-Tac-Toe State](https://leetcode.com/problems/valid-tic-tac-toe-state/description/) | [solution](https://leetcode.com/problems/valid-tic-tac-toe-state/solution/) | [C++](0501-1000/0794-Valid-Tic-Tac-Toe-State/cpp-0794/) | | |
| 795 | [Number of Subarrays with Bounded Maximum](https://leetcode.com/problems/number-of-subarrays-with-bounded-maximum/description/) | [solution](https://leetcode.com/problems/number-of-subarrays-with-bounded-maximum/solution/) | [C++](0501-1000/0795-Number-of-Subarrays-with-Bounded-Maximum/cpp-0795/) | | |
| 796 | [Rotate String](https://leetcode.com/problems/rotate-string/description/) | [solution](https://leetcode.com/problems/rotate-string/solution/)
[缺:Rolling Hash] | [C++](0501-1000/0796-Rotate-String/cpp-0796/) | | |
| 797 | [All Paths From Source to Target](https://leetcode.com/problems/all-paths-from-source-to-target/description/) | [solution](https://leetcode.com/problems/all-paths-from-source-to-target/solution/) | [C++](0501-1000/0797-All-Paths-From-Source-to-Target/cpp-0797/) | | |
| 798 | [Smallest Rotation with Highest Score](https://leetcode.com/problems/smallest-rotation-with-highest-score/) | [solution](https://leetcode.com/problems/smallest-rotation-with-highest-score/solution/)
[缺:O(n) 解法] | [C++](0501-1000/0798-Smallest-Rotation-with-Highest-Score/cpp-0798/) | | |
| 799 | [Champagne Tower](https://leetcode.com/problems/champagne-tower/description/) | [solution](https://leetcode.com/problems/champagne-tower/solution/) | [C++](0501-1000/0799-Champagne-Tower/cpp-0799/) | | |
| 800 | [Similar RGB Color](https://leetcode.com/problems/similar-rgb-color/description/) | [solution](https://leetcode.com/problems/similar-rgb-color/solution/) | [C++](0501-1000/0800-Similar-RGB-Color/cpp-0800/) | | |
| | | | | | |
| 802 | [Find Eventual Safe States](https://leetcode.com/problems/find-eventual-safe-states/) | [solution](https://leetcode.com/problems/find-eventual-safe-states/solution/) | [C++](0501-1000/0802-Find-Eventual-Safe-States/cpp-0802/) | | |
| 803 | [Bricks Falling When Hit](https://leetcode.com/problems/bricks-falling-when-hit/) | [无] | [C++](0501-1000/0803-Bricks-Falling-When-Hit/cpp-0803/) | | |
| 804 | [Unique Morse Code Words](https://leetcode.com/problems/unique-morse-code-words/description/) | [solution](https://leetcode.com/problems/unique-morse-code-words/solution/) | [C++](0501-1000/0804-Unique-Morse-Code-Words/cpp-0804/) | | |
| 805 | [Split Array With Same Average](https://leetcode.com/problems/split-array-with-same-average/description/) | [solution](https://leetcode.com/problems/split-array-with-same-average/solution/) | [C++](0501-1000/0805-Split-Array-With-Same-Average/cpp-0805/) | | |
| 806 | [Number of Lines To Write String](https://leetcode.com/problems/number-of-lines-to-write-string/description/) | [solution](https://leetcode.com/problems/number-of-lines-to-write-string/solution/) | [C++](0501-1000/0806-Number-of-Lines-To-Write-String/cpp-0806/) | | |
| 807 | [Max Increase to Keep City Skyline](https://leetcode.com/problems/max-increase-to-keep-city-skyline/description/) | [solution](https://leetcode.com/problems/max-increase-to-keep-city-skyline/solution/) | [C++](0807-Max-Increase-to-Keep-City-Skyline/cpp-0807/) | | |
| | | | | | |
| 809 | [Expressive Words](https://leetcode.com/problems/expressive-words/description/) | [solution](https://leetcode.com/problems/expressive-words/solution/) | [C++](0501-1000/0809-Expressive-Words/cpp-0809/) | | |
| 810 | [Chalkboard XOR Game](https://leetcode.com/problems/chalkboard-xor-game/) | [solution](https://leetcode.com/problems/chalkboard-xor-game/solution/) | [C++](0501-1000/0810-Chalkboard-XOR-Game/cpp-0810/) | | |
| 811 | [Subdomain Visit Count](https://leetcode.com/problems/subdomain-visit-count/description/) | [solution](https://leetcode.com/problems/subdomain-visit-count/solution/) | [C++](0501-1000/0811-Subdomain-Visit-Count/cpp-0811/) | | |
| | | | | | |
| 813 | [Largest Sum of Averages](https://leetcode.com/problems/largest-sum-of-averages/description/) | [solution](https://leetcode.com/problems/largest-sum-of-averages/solutions/) | [C++](0501-1000/0813-Largest-Sum-of-Averages/cpp-0813/) | | |
| 814 | [Binary Tree Pruning](https://leetcode.com/problems/binary-tree-pruning/) | [solution](https://leetcode.com/problems/binary-tree-pruning/solution/) | [C++](0501-1000/0814-Binary-Tree-Pruning/cpp-0814/) | | |
| 815 | [Bus Routes](https://leetcode.com/problems/bus-routes/) | [solution](https://leetcode.com/problems/bus-routes/solution/) | [C++](0501-1000/0815-Bus-Routes/cpp-0815/) | | |
| | | | | | |
| 817 | [Linked List Components](https://leetcode.com/problems/linked-list-components/description/) | [solution](https://leetcode.com/problems/linked-list-components/solution/) | [C++](0501-1000/0817-Linked-List-Components/cpp-0817/) | | |
| | | | | | |
| 819 | [Most Common Word](https://leetcode.com/problems/most-common-word/description/) | [solution](https://leetcode.com/problems/most-common-word/solution/) | [C++](0501-1000/0819-Most-Common-Word/cpp-0819/) | | |
| | | | | | |
| 822 | [Card Flipping Game](https://leetcode.com/problems/card-flipping-game/description/) | [无] | [C++](0501-1000/0822-Card-Flipping-Game/cpp-0822/) | | |
| 823 | [Binary Trees With Factors](https://leetcode.com/problems/binary-trees-with-factors/) | [solution](https://leetcode.com/problems/binary-trees-with-factors/solution/) | [C++](0501-1000/0823-Binary-Trees-With-Factors/cpp-0823/) | | |
| 824 | [Goat Latin](https://leetcode.com/problems/goat-latin/) | [无] | [C++](0501-1000/0824-Goat-Latin/cpp-0824/) | | |
| 825 | [Friends Of Appropriate Ages](https://leetcode.com/problems/friends-of-appropriate-ages/) | [无] | [C++](0501-1000/0825-Friends-Of-Appropriate-Ages/cpp-0825/) | | |
| | | | | | |
| 827 | [Making A Large Island](https://leetcode.com/problems/making-a-large-island/) | [无] | [C++](0501-1000/0827-Making-A-Large-Island/cpp-0827/) | | |
| 828 | [Count Unique Characters of All Substrings of a Given String](https://leetcode.com/problems/count-unique-characters-of-all-substrings-of-a-given-string/) | [无] | [C++](0501-1000/0828-Count-Unique-Characters-of-All-Substrings-of-a-Given-String/cpp-0828/) | | |
| 829 | [Consecutive Numbers Sum](https://leetcode.com/problems/consecutive-numbers-sum/) | [无] | [C++](0501-1000/0829-Consecutive-Numbers-Sum/cpp-0829/) | | |
| 830 | [Positions of Large Groups](https://leetcode.com/problems/positions-of-large-groups/) | [solution](https://leetcode.com/problems/positions-of-large-groups/solution/) | [C++](0501-1000/0830-Positions-of-Large-Groups/cpp-0830/) | | |
| 831 | [Masking Personal Information](https://leetcode.com/problems/masking-personal-information/) | [无] | [C++](0501-1000/0831-Masking-Personal-Information/cpp-0831/) | | |
| 832 | [Flipping an Image](https://leetcode.com/problems/flipping-an-image/) | [solution](https://leetcode.com/problems/flipping-an-image/solution/) | [C++](0501-1000/0832-Flipping-an-Image/cpp-0832/) | | |
| 833 | [Find And Replace in String](https://leetcode.com/problems/find-and-replace-in-string/) | [无] | [C++](https://leetcode.com/problems/find-and-replace-in-string/) | | |
| 834 | [Sum of Distances in Tree](https://leetcode.com/problems/sum-of-distances-in-tree/) | [solution](https://leetcode.com/problems/sum-of-distances-in-tree/solution/) | [C++](0501-1000/0834-Sum-of-Distances-in-Tree/cpp-0834/) | | |
| 835 | [Image Overlap](https://leetcode.com/problems/image-overlap/) | [无] | [C++](0501-1000/0835-Image-Overlap/cpp-0835/) | | |
| | | | | | |
| 837 | [New 21 Game](https://leetcode.com/problems/new-21-game/) | [无] | [C++](0501-1000/0837-New-21-Game/cpp-0837/) | | |
| 838 | [Push Dominoes](https://leetcode.com/problems/push-dominoes/) | [solution](https://leetcode.com/problems/push-dominoes/solution/) | [C++](0501-1000/0838-Push-Dominoes/cpp-0838/) | | |
| 839 | [Similar String Groups](https://leetcode.com/problems/similar-string-groups/) | [solution](https://leetcode.com/problems/similar-string-groups/solution/) |
[C++](0501-1000/0839-Similar-String-Groups/cpp-0839/) | | |
| | | | | | |
| 841 | [Keys and Rooms](https://leetcode.com/problems/keys-and-rooms/description/) | [solution](https://leetcode.com/problems/keys-and-rooms/solution/) | [C++](0501-1000/0841-Keys-and-Rooms/cpp-0841/) | | |
| 842 | [Split Array into Fibonacci Sequence](https://leetcode.com/problems/split-array-into-fibonacci-sequence/) | [solution](https://leetcode.com/problems/split-array-into-fibonacci-sequence/solution/) | [C++](0501-1000/0842-Split-Array-into-Fibonacci-Sequence/cpp-0842/) | | |
| | | | | | |
| 844 | [Backspace String Compare](https://leetcode.com/problems/backspace-string-compare/) | [solution](https://leetcode.com/problems/backspace-string-compare/solution/) | [C++](0501-1000/0844-Backspace-String-Compare/cpp-0844/) | | |
| | | | | | |
| 846 | [Hand of Straights](https://leetcode.com/problems/hand-of-straights/) | [无] | [C++](0501-1000/0846-Hand-of-Straights/cpp-0846/) | | |
| 847 | [Shortest Path Visiting All Nodes](https://leetcode.com/problems/shortest-path-visiting-all-nodes/) | [无] | [C++](0501-1000/0847-Shortest-Path-Visiting-All-Nodes/cpp-0847/) | | |
| 848 | [Shifting Letters](https://leetcode.com/problems/shifting-letters/) | [无] | [C++](0501-1000/0848-Shifting-Letters/cpp-0848/) | | |
| 849 | [Maximize Distance to Closest Person](https://leetcode.com/problems/maximize-distance-to-closest-person/) | [无] | [C++](0501-1000/0849-Maximize-Distance-to-Closest-Person/cpp-0849/) | | |
| 850 | [Rectangle Area II](https://leetcode.com/problems/rectangle-area-ii/) | [solution](https://leetcode.com/problems/rectangle-area-ii/solution/) | [C++](0501-1000/0850-Rectangle-Area-II/cpp-0850/) | | |
| 851 | [Loud and Rich](https://leetcode.com/problems/loud-and-rich/) | [solution](https://leetcode.com/problems/loud-and-rich/solution/) | [C++](0501-1000/0851-Loud-and-Rich/cpp-0851/) | | |
| 852 | [Peak Index in a Mountain Array](https://leetcode.com/problems/peak-index-in-a-mountain-array/description/) | [solution](https://leetcode.com/problems/peak-index-in-a-mountain-array/solution/) | [C++](0501-1000/0852-Peak-Index-in-a-Mountain-Array/cpp-0852/) | | |
| 853 | [Car Fleet](https://leetcode.com/problems/car-fleet/description/) | [solution](https://leetcode.com/problems/car-fleet/solution/) | [C++](0501-1000/0853-Car-Fleet/cpp-0853/) | | |
| 854 | [K-Similar Strings](https://leetcode.com/problems/k-similar-strings/description/) | [solution](https://leetcode.com/problems/k-similar-strings/solution/) | [C++](0501-1000/0854-K-Similar-Strings/cpp-0854/) | | |
| 855 | [Exam Room](https://leetcode.com/problems/exam-room/description/) | [solution](https://leetcode.com/problems/exam-room/solution/) | [C++](0501-1000/0855-Exam-Room/cpp-0855/) | | |
| 856 | [Score of Parentheses](https://leetcode.com/problems/score-of-parentheses/description/) | [solution](https://leetcode.com/problems/score-of-parentheses/solution/) | [C++](0501-1000/0856-Score-of-Parentheses/cpp-0856/) | | |
| 857 | [Minimum Cost to Hire K Workers](https://leetcode.com/problems/minimum-cost-to-hire-k-workers/description/) | [solution](https://leetcode.com/problems/minimum-cost-to-hire-k-workers/solution/)
[缺:二分搜索] | [C++](0501-1000/0857-Minimum-Cost-to-Hire-K-Workers/cpp-0857/) | | |
| 858 | [Mirror Reflection](https://leetcode.com/problems/mirror-reflection/description/) | [solution](https://leetcode.com/problems/mirror-reflection/solution/) | [C++](0501-1000/0858-Mirror-Reflection/cpp-0858/) | | |
| 859 | [Buddy Strings](https://leetcode.com/problems/buddy-strings/description/) | [solution](https://leetcode.com/problems/buddy-strings/solution/) | [C++](0501-1000/0859-Buddy-Strings/cpp-0859/) | | |
| 860 | [Lemonade Change](https://leetcode.com/problems/lemonade-change/description/) | [solution](https://leetcode.com/problems/lemonade-change/solution/) | [C++](0501-1000/0860-Lemonade-Change/cpp-0860/) | | |
| 861 | [Score After Flipping Matrix](https://leetcode.com/problems/score-after-flipping-matrix/description/) | [solution](https://leetcode.com/problems/score-after-flipping-matrix/solution/) | [C++](0501-1000/0861-Score-After-Flipping-Matrix/cpp-0861/) | | |
| | | | | | |
| 863 | [All Nodes Distance K in Binary Tree](https://leetcode.com/problems/all-nodes-distance-k-in-binary-tree/description/) | [solution](https://leetcode.com/problems/all-nodes-distance-k-in-binary-tree/solution/) | [C++](0501-1000/0863-All-Nodes-Distance-K-in-Binary-Tree/cpp-0863/) | | |
| 864 | [Shortest Path to Get All Keys](https://leetcode.com/problems/shortest-path-to-get-all-keys/description/) | [solution](https://leetcode.com/problems/shortest-path-to-get-all-keys/solution/)
[缺:Dijkstra] | [C++](0501-1000/0864-Shortest-Path-to-Get-All-Keys/cpp-0864/) | | |
| 865 | [Smallest Subtree with all the Deepest Nodes](https://leetcode.com/problems/smallest-subtree-with-all-the-deepest-nodes/description/) | [solution](https://leetcode.com/problems/smallest-subtree-with-all-the-deepest-nodes/solution/) | [C++](0501-1000/0865-Smallest-Subtree-with-all-the-Deepest-Nodes/cpp-0865/) | | |
| 866 | [Prime Palindrome](https://leetcode.com/problems/prime-palindrome/description/) | [solution](https://leetcode.com/problems/prime-palindrome/solution/) | [C++](0501-1000/0866-Prime-Palindrome/cpp-0866/) | | |
| 867 | [Transpose Matrix](https://leetcode.com/problems/transpose-matrix/description/) | [solution](https://leetcode.com/problems/transpose-matrix/solution/) | [C++](0501-1000/0867-Transpose-Matrix/cpp-0867/) | | |
| 868 | [Binary Gap](https://leetcode.com/problems/binary-gap/description/) | [solution](https://leetcode.com/problems/binary-gap/solution/) | [C++](0501-1000/0868-Binary-Gap/cpp-0868/) | | |
| 869 | [Reordered Power of 2](https://leetcode.com/problems/reordered-power-of-2/description/) | [solution](https://leetcode.com/problems/reordered-power-of-2/solution/) | [C++](0501-1000/0869-Reordered-Power-of-2/cpp-0869/) | | |
| 870 | [Advantage Shuffle](https://leetcode.com/problems/advantage-shuffle/description/) | [solution](https://leetcode.com/problems/advantage-shuffle/solution/) | [C++](0501-1000/0870-Advantage-Shuffle/cpp-0870/) | | |
| 871 | [Minimum Number of Refueling Stops](https://leetcode.com/problems/minimum-number-of-refueling-stops/description/) | [solution](https://leetcode.com/problems/minimum-number-of-refueling-stops/solution/) [题解](https://leetcode-cn.com/problems/minimum-number-of-refueling-stops/solution/zui-di-jia-you-ci-shu-by-leetcode/) | [C++](0501-1000/0871-Minimum-Number-of-Refueling-Stops/cpp-0871/) | | |
| 872 | [Leaf-Similar Trees](https://leetcode.com/problems/leaf-similar-trees/description/) | [solution](https://leetcode.com/problems/leaf-similar-trees/solution/) | [C++](0501-1000/0872-Leaf-Similar-Trees/cpp-0872/) | | |
| 873 | [Length of Longest Fibonacci Subsequence](https://leetcode.com/problems/length-of-longest-fibonacci-subsequence/description/) | [solution](https://leetcode.com/problems/length-of-longest-fibonacci-subsequence/solution/) | [C++](0501-1000/0873-Length-of-Longest-Fibonacci-Subsequence/cpp-0873/) | | |
| 874 | [Walking-Robot-Simulation](https://leetcode.com/problems/walking-robot-simulation/description/) | [solution](https://leetcode.com/problems/walking-robot-simulation/solution/) | [C++](0501-1000/0874-Walking-Robot-Simulation/cpp-0874/) | | |
| 875 | [Koko Eating Bananas](https://leetcode.com/problems/koko-eating-bananas/description/) | [solution](https://leetcode.com/problems/koko-eating-bananas/solution/) | [C++](0501-1000/0875-Koko-Eating-Bananas/cpp-0875/) | | |
| 876 | [Middle of the Linked List](https://leetcode.com/problems/middle-of-the-linked-list/description/) | [solution](https://leetcode.com/problems/middle-of-the-linked-list/solution/) | [C++](0501-1000/0876-Middle-of-the-Linked-List/cpp-0876/) | | |
| 877 | [Stone Game](https://leetcode.com/problems/stone-game/description/) | [solution](https://leetcode.com/problems/stone-game/solution/) | [C++](0501-1000/0877-Stone-Game/cpp-0877/) | | |
| 878 | [Nth Magical Number](https://leetcode.com/problems/nth-magical-number/description/) | [solution](https://leetcode.com/problems/nth-magical-number/solution/) | [C++](0501-1000/0878-Nth-Magical-Number/cpp-0878/) | | |
| 879 | [Profitable Schemes](https://leetcode.com/problems/profitable-schemes/description/) | [solution](https://leetcode.com/problems/profitable-schemes/solution/) | [C++](0501-1000/0879-Profitable-Schemes/cpp-0879/) | | |
| 880 | [Decoded String at Index](https://leetcode.com/problems/decoded-string-at-index/description/) | [solution](https://leetcode.com/problems/decoded-string-at-index/solution/) | [C++](0501-1000/0880-Decoded-String-at-Index/cpp-0880/) | | |
| 881 | [Boats to Save People](https://leetcode.com/problems/boats-to-save-people/description/) | [solution](https://leetcode.com/problems/boats-to-save-people/solution/) | [C++](0501-1000/0881-Boats-to-Save-People/cpp-0881/) | | |
| 882 | [Reachable Nodes In Subdivided Graph](https://leetcode.com/problems/reachable-nodes-in-subdivided-graph/description/) | [solution](https://leetcode.com/problems/reachable-nodes-in-subdivided-graph/solution/) | [C++](0501-1000/0882-Reachable-Nodes-In-Subdivided-Graph/cpp-0882/) | | |
| 883 | [Projection Area of 3D Shapes](https://leetcode.com/problems/projection-area-of-3d-shapes/description/) | [solution](https://leetcode.com/problems/projection-area-of-3d-shapes/solution/) | [C++](0501-1000/0883-Projection-Area-of-3D-Shapes/cpp-0883/) | | |
| 884 | [Uncommon Words from Two Sentences](https://leetcode.com/problems/uncommon-words-from-two-sentences/description/) | [solution](https://leetcode.com/problems/uncommon-words-from-two-sentences/solution/) | [C++](0501-1000/0884-Uncommon-Words-from-Two-Sentences/cpp-0884/) | | |
| 885 | [Spiral Matrix III](https://leetcode.com/problems/spiral-matrix-iii/description/) | [solution](https://leetcode.com/problems/spiral-matrix-iii/solution/) | [C++](0885-Spiral-Matrix-III/cpp-0885/) | | |
| 886 | [Possible Bipartition](https://leetcode.com/problems/possible-bipartition/description/) | [solution](https://leetcode.com/problems/possible-bipartition/solution/) | [C++](0501-1000/0886-Possible-Bipartition/cpp-0886/) | | |
| | | | | | |
| 888 | [Fair Candy Swap](https://leetcode.com/problems/fair-candy-swap/description/) | [solution](https://leetcode.com/problems/fair-candy-swap/solution/) | [C++](0501-1000/0888-Fair-Candy-Swap/cpp-0888/) | | |
| 889 | [Construct Binary Tree from Preorder and Postorder Traversal](https://leetcode.com/problems/construct-binary-tree-from-preorder-and-postorder-traversal/description/) | [solution](https://leetcode.com/problems/construct-binary-tree-from-preorder-and-postorder-traversal/solution/) | [C++](0501-1000/0889-Construct-Binary-Tree-from-Preorder-and-Postorder-Traversal/cpp-0889/) | | |
| 890 | [Find and Replace Pattern](https://leetcode.com/problems/find-and-replace-pattern/description/) | [solution](https://leetcode.com/problems/find-and-replace-pattern/solution/) | [C++](0501-1000/0890-Find-and-Replace-Pattern/cpp-0890/) | | |
| 891 | [Sum of Subsequence Widths](https://leetcode.com/problems/sum-of-subsequence-widths/description/) | [solution](https://leetcode.com/problems/sum-of-subsequence-widths/solution/) | [C++](0501-1000/0891-Sum-of-Subsequence-Widths/cpp-0891/) | | |
| 892 | [Surface Area of 3D Shapes](https://leetcode.com/problems/surface-area-of-3d-shapes/description/) | [solution](https://leetcode.com/problems/surface-area-of-3d-shapes/solution/) | [C++](0501-1000/0892-Surface-Area-of-3D-Shapes/cpp-0892/) | | |
| 893 | [Groups of Special-Equivalent Strings](https://leetcode.com/problems/groups-of-special-equivalent-strings/description/) | [solution](https://leetcode.com/problems/groups-of-special-equivalent-strings/solution/) | [C++](0501-1000/0893-Groups-of-Special-Equivalent-Strings/cpp-0893/) | | |
| 894 | [All Possible Full Binary Trees](https://leetcode.com/problems/all-possible-full-binary-trees/description/) | [solution](https://leetcode.com/problems/all-possible-full-binary-trees/solution/) | [C++](0501-1000/0894-All-Possible-Full-Binary-Trees/cpp-0894/) | | |
| 895 | [Maximum Frequency Stack](https://leetcode.com/problems/maximum-frequency-stack/description/) | [solution](https://leetcode.com/problems/maximum-frequency-stack/solution/) | [C++](0501-1000/0895-Maximum-Frequency-Stack/cpp-0895/) | | |
| 896 | [Monotonic Array](https://leetcode.com/problems/monotonic-array/description/) | [solution](https://leetcode.com/problems/monotonic-array/solution/) | [C++](0501-1000/0896-Monotonic-Array/cpp-0896/) | | [Python](0501-1000/0896-Monotonic-Array/py-0896/) |
| 897 | [Increasing Order Search Tree](https://leetcode.com/problems/increasing-order-search-tree/description/) | [solution](https://leetcode.com/problems/increasing-order-search-tree/solution/) | [C++](0501-1000/0897-Increasing-Order-Search-Tree/cpp-0897/) | | |
| 898 | [Bitwise ORs of Subarrays](https://leetcode.com/problems/bitwise-ors-of-subarrays/description/) | [solution](https://leetcode.com/problems/bitwise-ors-of-subarrays/solution/) | [C++](0501-1000/0898-Bitwise-ORs-of-Subarrays/cpp-0898/) | | |
| 899 | [Orderly Queue](https://leetcode.com/problems/orderly-queue/description/) | [solution](https://leetcode.com/problems/orderly-queue/solution/) | [C++](0501-1000/0899-Orderly-Queue/cpp-0899/) | | |
| 900 | [RLE Iterator](https://leetcode.com/problems/rle-iterator/description/) | [solution](https://leetcode.com/problems/rle-iterator/solution/) | [C++](0501-1000/0900-RLE-Iterator/cpp-0900/) | | |
| 901 | [Online Stock Span](https://leetcode.com/problems/online-stock-span/description/) | [solution](https://leetcode.com/problems/online-stock-span/solution/) | [C++](0501-1000/0901-Online-Stock-Span/cpp-0901/) | | |
| 902 | [Numbers At Most N Given Digit Set](https://leetcode.com/problems/numbers-at-most-n-given-digit-set/description/) | [solution](https://leetcode.com/problems/numbers-at-most-n-given-digit-set/solution/) | [C++](0501-1000/0902-Numbers-At-Most-N-Given-Digit-Set/cpp-0902/) | | |
| 903 | [Valid Permutations for DI Sequence](https://leetcode.com/problems/valid-permutations-for-di-sequence/description/) | [solution](https://leetcode.com/problems/valid-permutations-for-di-sequence/solution/)
[缺:O(n^2) DP] | [C++](0501-1000/0903-Valid-Permutations-for-DI-Sequence/cpp-0903/) | | |
| 904 | [Fruit Into Baskets](https://leetcode.com/problems/fruit-into-baskets/description/) | [solution](https://leetcode.com/problems/fruit-into-baskets/solution/) | [C++](0501-1000/0904-Fruit-Into-Baskets/cpp-0904/) | | |
| 905 | [Sort Array By Parity](https://leetcode.com/problems/sort-array-by-parity/description/) | [solution](https://leetcode.com/problems/sort-array-by-parity/solution/) | [C++](0501-1000/0905-Sort-Array-By-Parity/cpp-0905/) | | |
| 906 | [Super Palindromes](https://leetcode.com/problems/super-palindromes/description/) | [solution](https://leetcode.com/problems/super-palindromes/solution/) | [C++](0501-1000/0906-Super-Palindromes/cpp-0906/) | | |
| 907 | [Sum of Subarray Minimums](https://leetcode.com/problems/sum-of-subarray-minimums/description/) | [solution](https://leetcode.com/problems/sum-of-subarray-minimums/solution/) | [C++](0501-1000/0907-Sum-of-Subarray-Minimums/cpp-0907/) | | |
| 908 | [Smallest Range I](https://leetcode.com/problems/smallest-range-i/description/) | [solution](https://leetcode.com/problems/smallest-range-i/solution/) | [C++](0501-1000/0908-Smallest-Range-I/cpp-0908/) | | |
| 909 | [Snakes and Ladders](https://leetcode.com/problems/snakes-and-ladders/description/) | [solution](https://leetcode.com/problems/snakes-and-ladders/solution/) | [C++](0501-1000/0909-Snakes-and-Ladders/cpp-0909/) | | |
| 910 | [Smallest Range II](https://leetcode.com/problems/smallest-range-ii/description/) | [solution](https://leetcode.com/problems/smallest-range-ii/solution/) | [C++](0501-1000/0910-Smallest-Range-II/cpp-0910/) | | |
| 911 | [Online Election](https://leetcode.com/problems/online-election/description/) | [solution](https://leetcode.com/problems/online-election/solution/) | [C++](0501-1000/0911-Online-Election/cpp-0911/) | | |
| 912 | [Sort an Array](https://leetcode.com/problems/sort-an-array/) | [无] | [C++](0501-1000/0912-Sort-an-Array/cpp-0912/) | | |
| 913 | [Cat and Mouse Game](https://leetcode.com/problems/cat-and-mouse/) | [solution](https://leetcode.com/problems/cat-and-mouse/solution/)
[缺:DFS拓扑排序;DP] | [C++](0501-1000/0913-Cat-and-Mouse-Game/cpp-0913/) | | |
| 914 | [X of a Kind in a Deck of Cards](https://leetcode.com/problems/x-of-a-kind-in-a-deck-of-cards/description/) | [solution](https://leetcode.com/problems/x-of-a-kind-in-a-deck-of-cards/solution/) | [C++](0501-1000/0914-X-of-a-Kind-in-a-Deck-of-Cards/cpp-0914/) | | |
| 915 | [Partition Array into Disjoint Intervals](https://leetcode.com/problems/partition-array-into-disjoint-intervals/description/) | [solution](https://leetcode.com/problems/partition-array-into-disjoint-intervals/solution/) | [C++](0501-1000/0915-Partition-Array-into-Disjoint-Intervals/cpp-0915/) | | |
| 916 | [Word Subsets](https://leetcode.com/problems/word-subsets/description/) | [solution](https://leetcode.com/problems/word-subsets/solution/) | [C++](0501-1000/0916-Word-Subsets/cpp-0916/) | | |
| 917 | [Reverse Only Letters](https://leetcode.com/problems/reverse-only-letters/description/) | [solution](https://leetcode.com/problems/reverse-only-letters/solution/) | [C++](0501-1000/0917-Reverse-Only-Letters/cpp-0917/) | | |
| 918 | [Maximum Sum Circular Subarray](https://leetcode.com/problems/maximum-sum-circular-subarray/description/) | [solution](https://leetcode.com/problems/maximum-sum-circular-subarray/solution/) | [C++](0501-1000/0918-Maximum-Sum-Circular-Subarray/cpp-0918/) | | |
| 919 | [Complete Binary Tree Inserter](https://leetcode.com/problems/complete-binary-tree-inserter/description/) | [solution](https://leetcode.com/problems/complete-binary-tree-inserter/solution/) | [C++](0501-1000/0919-Complete-Binary-Tree-Inserter/cpp-0919/) | | |
| 920 | [Number of Music Playlists](https://leetcode.com/problems/number-of-music-playlists/description/) | [solution](https://leetcode.com/problems/number-of-music-playlists/solution/)
[缺:生成函数] | [C++](0501-1000/0920-Number-of-Music-Playlists/cpp-0920/) | | |
| 921 | [Minimum Add to Make Parentheses Valid](https://leetcode.com/problems/minimum-add-to-make-parentheses-valid/description/) | [solution](https://leetcode.com/problems/minimum-add-to-make-parentheses-valid/solution/) | [C++](0501-1000/0921-Minimum-Add-to-Make-Parentheses-Valid/cpp-0921/) | | |
| 922 | [Sort Array By Parity II](https://leetcode.com/problems/sort-array-by-parity-ii/description/) | [solution](https://leetcode.com/problems/sort-array-by-parity-ii/solution/) | [C++](0501-1000/0922-Sort-Array-By-Parity-II/cpp-0922/) | | |
| 923 | [3Sum With Multiplicity](https://leetcode.com/problems/3sum-with-multiplicity/description/) | [solution](https://leetcode.com/problems/3sum-with-multiplicity/solution/) | [C++](0501-1000/0923-3Sum-With-Multiplicity/cpp-0923/) | | |
| 924 | [Minimize Malware Spread](https://leetcode.com/problems/minimize-malware-spread/description/) | [solution](https://leetcode.com/problems/minimize-malware-spread/solution/) | [C++](0501-1000/0924-Minimize-Malware-Spread/cpp-0924/) | | |
| 925 | [Long Pressed Name](https://leetcode.com/problems/long-pressed-name/submissions/) | [solution](https://leetcode.com/problems/long-pressed-name/solution/) | [C++](0501-1000/0925-Long-Pressed-Name/cpp-0925/) | | |
| 926 | [Flip String to Monotone Increasing](https://leetcode.com/problems/flip-string-to-monotone-increasing/) | [solution](https://leetcode.com/problems/flip-string-to-monotone-increasing/solution/) | [C++](0501-1000/0926-Flip-String-to-Monotone-Increasing/cpp-0926/) | | |
| 927 | [Three Equal Parts](https://leetcode.com/problems/three-equal-parts/) | [solution](https://leetcode.com/problems/three-equal-parts/solution/) | [C++](0501-1000/0927-Three-Equal-Parts/cpp-0927/) | | |
| 928 | [Minimize Malware Spread II](https://leetcode.com/problems/minimize-malware-spread-ii/description/) | [solution](https://leetcode.com/problems/minimize-malware-spread-ii/solution/) | [C++](0501-1000/0928-Minimize-Malware-Spread-II/cpp-0928/) | | |
| 929 | [Unique Email Addresses](https://leetcode.com/problems/unique-email-addresses/solution/) | [solution](https://leetcode.com/problems/unique-email-addresses/) | [C++](0501-1000/0929-Unique-Email-Addresses/cpp-0929/) | | |
| 930 | [Binary Subarrays With Sum](https://leetcode.com/problems/binary-subarrays-with-sum/) | [solution](https://leetcode.com/problems/binary-subarrays-with-sum/solution/) | [C++](0501-1000/0930-Binary-Subarrays-With-Sum/cpp-0930/) | | |
| 931 | [Minimum Path Falling Sum](https://leetcode.com/problems/minimum-falling-path-sum/) | [solution](https://leetcode.com/problems/minimum-falling-path-sum/solution/) | [C++](0501-1000/0931-Minimum-Path-Falling-Sum/cpp-0931/) | | |
| 932 | [Beautiful Array](https://leetcode.com/problems/beautiful-array/description/) | [solution](https://leetcode.com/problems/beautiful-array/solution/) | [C++](0501-1000/0932-Beautiful-Array/cpp-0932/) | | |
| 933 | [Number of Recent Calls](https://leetcode.com/problems/number-of-recent-calls/) | [solution](https://leetcode.com/problems/number-of-recent-calls/solution/) | [C++](0501-1000/0933-Number-of-Recent-Calls/cpp-0933/) | | |
| 934 | [Shortest Bridge](https://leetcode.com/problems/shortest-bridge/) | [solution](https://leetcode.com/problems/shortest-bridge/solution/) | [C++](0501-1000/0934-Shortest-Bridge/cpp-0934/) | | |
| 935 | [Knight Dialer](https://leetcode.com/problems/knight-dialer/) | [solution](https://leetcode.com/problems/knight-dialer/solution/) | [C++](0501-1000/0935-Knight-Dialer/cpp-0935/) | | |
| 936 | [Stamping The Sequence](https://leetcode.com/problems/stamping-the-sequence/) | [solution](https://leetcode.com/problems/stamping-the-sequence/solution/) | [C++](0501-1000/0936-Stamping-The-Sequence/cpp-0936/) | | |
| 937 | [Reorder Log Files](https://leetcode.com/problems/reorder-log-files/) | [solution](https://leetcode.com/problems/reorder-log-files/solution/) | [C++](0501-1000/0937-Reorder-Log-Files/cpp-0937/) | | |
| 938 | [Range Sum of BST](https://leetcode.com/problems/range-sum-of-bst/) | [solution](https://leetcode.com/problems/range-sum-of-bst/solution/) | [C++](0501-1000/0938-Range-Sum-of-BST/cpp-0938/) | | |
| 939 | [Minimum Area Rectangle](https://leetcode.com/problems/minimum-area-rectangle/) | [solution](https://leetcode.com/problems/minimum-area-rectangle/solution/) | [C++](0501-1000/0939-Minimum-Area-Rectangle/cpp-0939/) | | |
| 940 | [Distinct Subsequences II](https://leetcode.com/problems/distinct-subsequences-ii/) | [solution](https://leetcode.com/problems/distinct-subsequences-ii/solution/) | [C++](0501-1000/0940-Distinct-Subsequences-II/cpp-0940/) | | |
| 941 | [Valid Mountain Array](https://leetcode.com/problems/valid-mountain-array/) | [solution](https://leetcode.com/problems/valid-mountain-array/solution/) | [C++](0501-1000/0941-Valid-Mountain-Array/cpp-0941/) | | |
| 942 | [DI String Match](https://leetcode.com/problems/di-string-match/) | [solution](https://leetcode.com/problems/di-string-match/solution/) | [C++](0501-1000/0942-DI-String-Match/cpp-0942/) | | |
| 943 | [Find the Shortest Superstring](https://leetcode.com/problems/find-the-shortest-superstring/) | [solution](https://leetcode.com/problems/find-the-shortest-superstring/solution/)
[缺:动态规划] | [C++](0501-1000/0943-Find-the-Shortest-Superstring/cpp-0943/) | | |
| 944 | [Delete Columns to Make Sorted](https://leetcode.com/problems/delete-columns-to-make-sorted/) | [solution](https://leetcode.com/problems/delete-columns-to-make-sorted/solution/) | [C++](0501-1000/0944-Delete-Columns-to-Make-Sorted/cpp-0944/) | | |
| 945 | [Minimum Increment to Make Array Unique](https://leetcode.com/problems/minimum-increment-to-make-array-unique/) | [solution](https://leetcode.com/problems/minimum-increment-to-make-array-unique/solution/) | [C++](0501-1000/0945-Minimum-Increment-to-Make-Array-Unique/cpp-0945/) | | |
| 946 | [Validate Stack Sequences](https://leetcode.com/problems/validate-stack-sequences/) | [solution](https://leetcode.com/problems/validate-stack-sequences/solution/) | [C++](0501-1000/0946-Validate-Stack-Sequences/cpp-0946/) | | |
| 947 | [Most Stones Removed with Same Row or Column](https://leetcode.com/problems/most-stones-removed-with-same-row-or-column/) | [solution](https://leetcode.com/problems/most-stones-removed-with-same-row-or-column/solution/) | [C++](0501-1000/0947-Most-Stones-Removed-with-Same-Row-or-Column/cpp-0947/) | | |
| 948 | [Bag of Tokens](https://leetcode.com/problems/bag-of-tokens/) | [solution](https://leetcode.com/problems/bag-of-tokens/solution/) | [C++](0501-1000/0948-Bag-of-Tokens/cpp-0948/) | | |
| 949 | [Largest Time for Given Digits](https://leetcode.com/problems/largest-time-for-given-digits/) | [solution](https://leetcode.com/problems/largest-time-for-given-digits/solution/) | [C++](0501-1000/0949-Largest-Time-for-Given-Digits/cpp-0949/) | | |
| 950 | [Reveal Cards In Increasing Order](https://leetcode.com/problems/reveal-cards-in-increasing-order/) | [solution](https://leetcode.com/problems/reveal-cards-in-increasing-order/solution/) | [C++](0501-1000/0950-Reveal-Cards-In-Increasing-Order/cpp-0950/) | | |
| 951 | [Flip Equivalent Binary Trees](https://leetcode.com/problems/flip-equivalent-binary-trees/) | [solution](https://leetcode.com/problems/flip-equivalent-binary-trees/solution/) | [C++](0501-1000/0951-Flip-Equivalent-Binary-Trees/cpp-0951/) | | |
| 952 | [Largest Component Size by Common Factor](https://leetcode.com/problems/largest-component-size-by-common-factor/) | [solution](https://leetcode.com/problems/largest-component-size-by-common-factor/solution/) | [C++](0501-1000/0952-Largest-Component-Size-by-Common-Factor/cpp-0952/) | | |
| 953 | [isAlienSorted](https://leetcode.com/problems/verifying-an-alien-dictionary/) | [solution](https://leetcode.com/problems/verifying-an-alien-dictionary/solution/) | [C++](0501-1000/0953-isAlienSorted/cpp-0953/) | | |
| 954 | [Array of Doubled Pairs](https://leetcode.com/problems/array-of-doubled-pairs/) | [solution](https://leetcode.com/problems/array-of-doubled-pairs/solution/) | [C++](0501-1000/0954-Array-of-Doubled-Pairs/cpp-0954/) | | |
| 955 | [Delete Columns to Make Sorted II](https://leetcode.com/problems/delete-columns-to-make-sorted-ii/) | [solution](https://leetcode.com/problems/delete-columns-to-make-sorted-ii/solution/) | [C++](0501-1000/0955-Delete-Columns-to-Make-Sorted-II/cpp-0955/) | | |
| 956 | [Tallest Billboard](https://leetcode.com/problems/tallest-billboard/) | [solution](https://leetcode.com/problems/tallest-billboard/solution/) | [C++](0501-1000/0956-Tallest-Billboard/cpp-0956/) | | |
| 957 | [Prison Cells After N Days](https://leetcode.com/problems/prison-cells-after-n-days/) | [solution](https://leetcode.com/problems/prison-cells-after-n-days/solution/) | [C++](0501-1000/0957-Prison-Cells-After-N-Days/cpp-0957/) | | |
| 958 | [Check Completeness of a Binary Tree](https://leetcode.com/problems/check-completeness-of-a-binary-tree/) | [solution](https://leetcode.com/problems/check-completeness-of-a-binary-tree/solution/) | [C++](0501-1000/0958-Check-Completeness-of-a-Binary-Tree/cpp-0958/) | | |
| 959 | [Regions Cut By Slashes](https://leetcode.com/problems/regions-cut-by-slashes/) | [solution](https://leetcode.com/problems/regions-cut-by-slashes/solution/) | [C++](0501-1000/0959-Regions-Cut-By-Slashes/cpp-0959/) | | |
| 960 | [Delete Columns to Make Sorted III](https://leetcode.com/problems/delete-columns-to-make-sorted-iii/) | [solution](https://leetcode.com/problems/delete-columns-to-make-sorted-iii/solution/) | [C++](0501-1000/0960-Delete-Columns-to-Make-Sorted-III/cpp-0960/) | | |
| 961 | [N-Repeated Element in Size 2N Array](https://leetcode.com/problems/n-repeated-element-in-size-2n-array/) | [solution](https://leetcode.com/problems/n-repeated-element-in-size-2n-array/solution/) | [C++](0501-1000/0961-N-Repeated-Element-in-Size-2N-Array/cpp-0961/) | | |
| | | | | | |
| 965 | [Univalued Binary Tree](https://leetcode.com/problems/univalued-binary-tree/) | [solution](https://leetcode.com/problems/univalued-binary-tree/solution/) | [C++](0501-1000/0965-Univalued-Binary-Tree/cpp-0965/) | | |
| 966 | [Vowel Spellchecker](https://leetcode.com/problems/vowel-spellchecker/) | [solution](https://leetcode.com/problems/vowel-spellchecker/solution/) | [C++](0501-1000/0966-Vowel-Spellchecker/cpp-0966/) | | |
| 967 | [Numbers With Same Consecutive Differences](https://leetcode.com/problems/numbers-with-same-consecutive-differences/) | [solution](https://leetcode.com/problems/numbers-with-same-consecutive-differences/solution/) | [C++](0501-1000/0967-Numbers-With-Same-Consecutive-Differences/cpp-0967/) | | |
| 968 | [Binary Tree Cameras](https://leetcode.com/problems/binary-tree-cameras/) | [solution](https://leetcode.com/problems/binary-tree-cameras/solution/) | [C++](0501-1000/0968-Binary-Tree-Cameras/cpp-0968/) | | |
| 969 | [Pancake Sorting](https://leetcode.com/problems/pancake-sorting/) | [solution](https://leetcode.com/problems/pancake-sorting/solution/) | [C++](0501-1000/0969-Pancake-Sorting/cpp-0969/) | | |
| 970 | [Powerful Integers](https://leetcode.com/problems/powerful-integers/) | [solution](https://leetcode.com/problems/powerful-integers/solution/) | [C++](0501-1000/0970-Powerful-Integers/cpp-0970/) | | |
| 971 | [Flip Binary Tree To Match Preorder Traversal](https://leetcode.com/problems/flip-binary-tree-to-match-preorder-traversal/) | [solution](https://leetcode.com/problems/flip-binary-tree-to-match-preorder-traversal/solution/) | [C++](0501-1000/0971-Flip-Binary-Tree-To-Match-Preorder-Traversal/cpp-0971/) | | |
| 972 | [Equal Rational Numbers](https://leetcode.com/problems/equal-rational-numbers/) | [solution](https://leetcode.com/problems/equal-rational-numbers/solution/) | [C++](0501-1000/0972-Equal-Rational-Numbers/cpp-0972/) | | |
| 973 | [K Closest Points to Origin](https://leetcode.com/problems/k-closest-points-to-origin/) | [solution](https://leetcode.com/problems/k-closest-points-to-origin/solution/) | [C++](0501-1000/0973-K-Closest-Points-to-Origin/cpp-0973/) | | |
| 974 | [Subarray Sums Divisible by K](https://leetcode.com/problems/subarray-sums-divisible-by-k/) | [solution](https://leetcode.com/problems/subarray-sums-divisible-by-k/solution/) | [C++](0501-1000/0974-Subarray-Sums-Divisible-by-K/cpp-0974/) | | |
| 975 | [Odd Even Jump](https://leetcode.com/problems/odd-even-jump/) | [solution](https://leetcode.com/problems/odd-even-jump/solution/) | [C++](0501-1000/0975-Odd-Even-Jump/cpp-0975/) | | |
| 976 | [Largest Perimeter Triangle](https://leetcode.com/problems/largest-perimeter-triangle/) | [solution](https://leetcode.com/problems/largest-perimeter-triangle/solution/) | [C++](0501-1000/0976-Largest-Perimeter-Triangle/cpp-0976/) | | |
| 977 | [Squares of a Sorted Array](https://leetcode.com/problems/squares-of-a-sorted-array/) | [solution](https://leetcode.com/problems/squares-of-a-sorted-array/solution/) | [C++](0501-1000/0977-Squares-of-a-Sorted-Array/cpp-0977/) | | |
| 978 | [Longest Turbulent Subarray](https://leetcode.com/problems/longest-turbulent-subarray/) | [solution](https://leetcode.com/problems/longest-turbulent-subarray/solution/)
[缺:滑动窗口 & dp] | [C++](0501-1000/0978-Longest-Turbulent-Subarray/cpp-0978/) | | |
| 979 | [Distribute Coins in Binary Tree](https://leetcode.com/problems/distribute-coins-in-binary-tree/) | [solution](https://leetcode.com/problems/distribute-coins-in-binary-tree/solution/) | [C++](0501-1000/0979-Distribute-Coins-in-Binary-Tree/cpp-0979/) | | |
| 980 | [Unique Paths III](https://leetcode.com/problems/unique-paths-iii/) | [solution](https://leetcode.com/problems/unique-paths-iii/solution/)
[缺:记忆化搜索] | [C++](0501-1000/0980-Unique-Paths-III/cpp-0980/) | [Java](0980-Unique-Paths-III/java-0980/)| |
| 981 | [Time Based Key-Value Store](https://leetcode.com/problems/time-based-key-value-store/) | [solution](https://leetcode.com/problems/time-based-key-value-store/solution/) | [C++](0501-1000/0981-Time-Based-Key-Value-Store/cpp-0981/) | | |
| 982 | [Triples with Bitwise AND Equal To Zero](https://leetcode.com/problems/triples-with-bitwise-and-equal-to-zero/) | [无] | [C++](0501-1000/0982-Triples-with-Bitwise-AND-Equal-To-Zero/cpp-0982/) | | |
| 983 | [Minimum Cost For Tickets](https://leetcode.com/problems/minimum-cost-for-tickets/) | [solution](https://leetcode.com/problems/minimum-cost-for-tickets/solution/) | [C++](0501-1000/0983-Minimum-Cost-For-Tickets/cpp-0983/) | | |
| 984 | [String Without AAA or BBB](https://leetcode.com/problems/string-without-aaa-or-bbb/) | [solution](https://leetcode.com/problems/string-without-aaa-or-bbb/solution/) | [C++](0501-1000/0984-String-Without-AAA-or-BBB/cpp-0984/) | | |
| 985 | [Sum of Even Numbers After Queries](https://leetcode.com/problems/sum-of-even-numbers-after-queries/) | [solution](https://leetcode.com/problems/sum-of-even-numbers-after-queries/) | [C++](0501-1000/0985-Sum-of-Even-Numbers-After-Queries/cpp-0985/) | | |
| 986 | [Interval List Intersections](https://leetcode.com/problems/interval-list-intersections/) | [solution](https://leetcode.com/problems/interval-list-intersections/solution/) | [C++](0501-1000/0986-Interval-List-Intersections/cpp-0986/) | | |
| 987 | [Vertical Order Traversal of a Binary Tree](https://leetcode.com/problems/vertical-order-traversal-of-a-binary-tree/) | [solution](https://leetcode.com/problems/vertical-order-traversal-of-a-binary-tree/solution/) | [C++](0501-1000/0987-Vertical-Order-Traversal-of-a-Binary-Tree/cpp-0987/) | | |
| 988 | [Smallest String Starting From Leaf](https://leetcode.com/problems/smallest-string-starting-from-leaf/) | [solution](https://leetcode.com/problems/smallest-string-starting-from-leaf/solution/) | [C++](0501-1000/0988-Smallest-String-Starting-From-Leaf/cpp-0988/) | | |
| 989 | [Add to Array-Form of Integer](https://leetcode.com/problems/add-to-array-form-of-integer/) | [solution](https://leetcode.com/problems/add-to-array-form-of-integer/solution/) | [C++](0501-1000/0989-Add-to-Array-Form-of-Integer/cpp-0989/) | | |
| 990 | [Satisfiability of Equality Equations](https://leetcode.com/problems/satisfiability-of-equality-equations/) | [solution](https://leetcode.com/problems/satisfiability-of-equality-equations/solution/) | [C++](0501-1000/0990-Satisfiability-of-Equality-Equations/cpp-0990/) | | |
| 991 | [Broken Calculator](https://leetcode.com/problems/broken-calculator/) | [solution](https://leetcode.com/problems/broken-calculator/solution/) | [C++](0501-1000/0991-Broken-Calculator/cpp-0991/) | | |
| 992 | [Subarrays with K Different Integers](https://leetcode.com/problems/subarrays-with-k-different-integers/) | [solution](https://leetcode.com/problems/subarrays-with-k-different-integers/solution/) | [C++](0501-1000/0992-Subarrays-with-K-Different-Integers/cpp-0992/) | | |
| 993 | [Cousins in Binary Tree](https://leetcode.com/problems/cousins-in-binary-tree/) | [solution](https://leetcode.com/problems/cousins-in-binary-tree/solution/) | [C++](0501-1000/0993-Cousins-in-Binary-Tree/cpp-0993/) | | |
| 994 | [Rotting Oranges](https://leetcode.com/problems/rotting-oranges/) | [solution](https://leetcode.com/problems/rotting-oranges/solution/) | [C++](0501-1000/0994-Rotting-Oranges/cpp-0994/) | | |
| 995 | [Minimum Number of K Consecutive Bit Flips](https://leetcode.com/problems/minimum-number-of-k-consecutive-bit-flips/) | [solution](https://leetcode.com/problems/minimum-number-of-k-consecutive-bit-flips/solution/) | [C++](0501-1000/0995-Minimum-Number-of-K-Consecutive-Bit-Flips/cpp-0995/) | | |
| 996 | [Number of Squareful Arrays](https://leetcode.com/problems/number-of-squareful-arrays/) | [solution](https://leetcode.com/problems/number-of-squareful-arrays/solution/) | [C++](0501-1000/0996-Number-of-Squareful-Arrays/cpp-0996/) | | |
| 997 | [Find the Town Judge](https://leetcode.com/problems/find-the-town-judge/) | [无] | [C++](0501-1000/0997-Find-the-Town-Judge/cpp-0997/) | | |
| 998 | [Maximum Binary Tree II](https://leetcode.com/problems/maximum-binary-tree-ii/) | [无] | [C++](0501-1000/0998-Maximum-Binary-Tree-II/cpp-0998/) | | |
| 999 | [Available Captures for Rook](https://leetcode.com/problems/available-captures-for-rook/) | [无] | [C++](0501-1000/0999-Available-Captures-for-Rook/cpp-0999/) | | |
| 1000 | [Minimum Cost to Merge Stones](https://leetcode.com/problems/minimum-cost-to-merge-stones/) | [无] | [C++](0501-1000/1000-Minimum-Cost-to-Merge-Stones/cpp-1000/) | | |
| 1001 | [Grid Illumination](https://leetcode.com/problems/grid-illumination/) | [无] | [C++](1001-1500/1001-Grid-Illumination/cpp-1001/) | | |
| 1002 | [Find Common Characters](https://leetcode.com/problems/find-common-characters/) | [无] | [C++](1001-1500/1002-Find-Common-Characters/cpp-1002/) | | |
| 1003 | [Check If Word Is Valid After Substitutions](https://leetcode.com/problems/check-if-word-is-valid-after-substitutions/) | [无] | [C++](1001-1500/1003-Check-If-Word-Is-Valid-After-Substitutions/cpp-1003/) | | |
| 1004 | [Max Consecutive Ones III](https://leetcode.com/problems/max-consecutive-ones-iii/) | [无] | [C++](1001-1500/1004-Max-Consecutive-Ones-III/cpp-1004/) | | |
| 1005 | [Maximize Sum Of Array After K Negations](https://leetcode.com/problems/maximize-sum-of-array-after-k-negations/) | [无] | [C++](1001-1500/1005-Maximize-Sum-Of-Array-After-K-Negations/cpp-1005/) | | |
| 1006 | [Clumsy Factorial](https://leetcode.com/problems/clumsy-factorial/) | [无] | [C++](1001-1500/1006-Clumsy-Factorial/cpp-1006/) | | |
| 1007 | [Minimum Domino Rotations For Equal Row](https://leetcode.com/problems/minimum-domino-rotations-for-equal-row/) | [无] | [C++](1001-1500/1007-Minimum-Domino-Rotations-For-Equal-Row/cpp-1007/) | | |
| 1008 | [Construct Binary Search Tree from Preorder Traversal](https://leetcode.com/problems/construct-binary-search-tree-from-preorder-traversal/) | [无] | [C++](1001-1500/1008-Construct-Binary-Search-Tree-from-Preorder-Traversal/cpp-1008/) | | |
| 1009 | [Complement of Base 10 Integer](https://leetcode.com/problems/complement-of-base-10-integer/) | [无] | [C++](1001-1500/1009-Complement-of-Base-10-Integer/cpp-1009/) | | |
| 1010 | [Pairs of Songs With Total Durations Divisible by 60](https://leetcode.com/problems/pairs-of-songs-with-total-durations-divisible-by-60/) | [无] | [C++](1001-1500/1010-Pairs-of-Songs-With-Total-Durations-Divisible-by-60/cpp-1010/) | | |
| 1011 | [Capacity To Ship Packages Within D Days](https://leetcode.com/problems/capacity-to-ship-packages-within-d-days/) | [无] | [C++](1001-1500/1011-Capacity-To-Ship-Packages-Within-D-Days/cpp-1011/) | | |
| 1012 | [Numbers With 1 Repeated Digit](https://leetcode.com/problems/numbers-with-1-repeated-digit/) | [无] | [C++](1001-1500/1012-Numbers-With-1-Repeated-Digit/cpp-1012/) | | |
| 1013 | [Partition Array Into Three Parts With Equal Sum](https://leetcode.com/problems/partition-array-into-three-parts-with-equal-sum/) | [无] | [C++](1001-1500/1013-Partition-Array-Into-Three-Parts-With-Equal-Sum/cpp-1013/) | | |
| 1014 | [Best Sightseeing Pair](https://leetcode.com/problems/best-sightseeing-pair/) | [无] | [C++](1001-1500/1014-Best-Sightseeing-Pair/cpp-1014/) | | |
| 1015 | [Smallest Integer Divisible by K](https://leetcode.com/problems/smallest-integer-divisible-by-k/) | [无] | [C++](1001-1500/1015-Smallest-Integer-Divisible-by-K/cpp-1015/) | | |
| 1016 | [Binary String With Substrings Representing 1 To N](https://leetcode.com/problems/binary-string-with-substrings-representing-1-to-n/) | [无] | [C++](1001-1500/1016-Binary-String-With-Substrings-Representing-1-To-N/cpp-10`6/) | | |
| 1017 | [Convert to Base -2](https://leetcode.com/problems/convert-to-base-2/) | [无] | [C++](1001-1500/1017-Convert-to-Base--2/cpp-1017/) | | |
| 1018 | [Binary Prefix Divisible By 5](https://leetcode.com/problems/binary-prefix-divisible-by-5/) | [无] | [C++](1001-1500/1018-Binary-Prefix-Divisible-By-5/cpp-1018/) | | |
| 1019 | [Next Greater Node In Linked List](https://leetcode.com/problems/next-greater-node-in-linked-list/) | [无] | [C++](1001-1500/1019-Next-Greater-Node-In-Linked-List/cpp-1019/) | | |
| 1020 | [Number of Enclaves](https://leetcode.com/problems/number-of-enclaves/) | [无] | [C++](1001-1500/1020-Number-of-Enclaves/cpp-1020/) | | |
| 1021 | [Remove Outermost Parentheses](https://leetcode.com/problems/remove-outermost-parentheses/) | [无] | [C++](1001-1500/1021-Remove-Outermost-Parentheses/cpp-1021/) | | |
| 1022 | [Sum of Root To Leaf Binary Numbers](https://leetcode.com/problems/sum-of-root-to-leaf-binary-numbers/) | [无] | [C++](1001-1500/1022-Sum-of-Root-To-Leaf-Binary-Numbers/cpp-1022/) | | |
| 1023 | [Camelcase Matching](https://leetcode.com/problems/camelcase-matching/) | [无] | [C++](1001-1500/1023-Camelcase-Matching/cpp-1023/) | | |
| 1024 | [Video Stitching](https://leetcode.com/problems/video-stitching/) | [无] | [C++](1001-1500/1024-Video-Stitching/cpp-1024/) | | |
| 1025 | [Divisor Game](https://leetcode.com/problems/divisor-game/) | [无] | [C++](1001-1500/1025-Divisor-Game/cpp-1025/) | | |
| 1026 | [Maximum Difference Between Node and Ancestor](https://leetcode.com/problems/maximum-difference-between-node-and-ancestor/) | [无] | [C++](1001-1500/1026-Maximum-Difference-Between-Node-and-Ancestor/cpp-1026/) | | |
| 1027 | [Longest Arithmetic Sequence](https://leetcode.com/problems/longest-arithmetic-sequence/) | [无] | [C++](1001-1500/1027-Longest-Arithmetic-Sequence/cpp-1027/) | | |
| 1028 | [Recover a Tree From Preorder Traversal](https://leetcode.com/problems/recover-a-tree-from-preorder-traversal/) | [无] | [C++](1001-1500/1028-Recover-a-Tree-From-Preorder-Traversal/cpp-1028/) | | |
| 1029 | [Two City Scheduling](https://leetcode.com/problems/two-city-scheduling/) | [无] | [C++](1001-1500/1029-Two-City-Scheduling/cpp-1029/) | | |
| 1030 | [Matrix Cells in Distance Order](https://leetcode.com/problems/matrix-cells-in-distance-order/) | [无] | [C++](1001-1500/1030-Matrix-Cells-in-Distance-Order/cpp-1030/) | | |
| 1031 | [Maximum Sum of Two Non-Overlapping Subarrays](https://leetcode.com/problems/maximum-sum-of-two-non-overlapping-subarrays/) | [无] | [C++](1001-1500/1031-Maximum-Sum-of-Two-Non-Overlapping-Subarrays/cpp-1031/) | | |
| 1032 | [Stream of Characters](https://leetcode.com/problems/stream-of-characters/) | [无] | [C++](1001-1500/1032-Stream-of-Characters/cpp-1032/) | | |
| 1033 | [Moving Stones Until Consecutive](https://leetcode.com/problems/moving-stones-until-consecutive/) | [无] | [C++](1001-1500/1033-Moving-Stones-Until-Consecutive/cpp-1033/) | | |
| 1034 | [Coloring A Border](https://leetcode.com/problems/coloring-a-border/) | [无] | [C++](1001-1500/1034-Coloring-A-Border/cpp-1034/) | | |
| 1035 | [Uncrossed Lines](https://leetcode.com/problems/uncrossed-lines/) | [无] | [C++](1001-1500/1035-Uncrossed-Lines/cpp-1035/) | | |
| 1036 | [Escape a Large Maze](https://leetcode.com/problems/escape-a-large-maze/) | [无] | [C++](1001-1500/1036-Escape-a-Large-Maze/cpp-1036/) | | |
| 1037 | [Valid Boomerang](https://leetcode.com/problems/valid-boomerang/) | [无] | [C++](1001-1500/1037-Valid-Boomerang/cpp-1037/) | | |
| 1038 | [Binary Search Tree to Greater Sum Tree](https://leetcode.com/problems/binary-search-tree-to-greater-sum-tree/) | [无] | [C++](1001-1500/1038-Binary-Search-Tree-to-Greater-Sum-Tree/cpp-1038/) | | |
| 1039 | [Minimum Score Triangulation of Polygon](https://leetcode.com/problems/minimum-score-triangulation-of-polygon/) | [无] | [C++](1001-1500/1039-Minimum-Score-Triangulation-of-Polygon/cpp-1039/) | | |
| 1040 | [Moving Stones Until Consecutive II](https://leetcode.com/problems/moving-stones-until-consecutive-ii/) | [无] | [C++](1001-1500/1040-Moving-Stones-Until-Consecutive-II/cpp-1040/) | | |
| 1041 | [Robot Bounded In Circle](https://leetcode.com/problems/robot-bounded-in-circle/) | [无] | [C++](1001-1500/1041-Robot-Bounded-In-Circle/cpp-1041/) | | |
| 1042 | [Flower Planting With No Adjacent](https://leetcode.com/problems/flower-planting-with-no-adjacent/) | [无] | [C++](1001-1500/1042-Flower-Planting-With-No-Adjacent/cpp-1042/) | | |
| 1043 | [Partition Array for Maximum Sum](https://leetcode.com/problems/partition-array-for-maximum-sum/) | [无] | [C++](1001-1500/1043-Partition-Array-for-Maximum-Sum/cpp-1043/) | | |
| 1044 | [Longest Duplicate Substring](https://leetcode.com/problems/longest-duplicate-substring/) | [无]
[缺:后缀数组] | [C++](1001-1500/1044-Longest-Duplicate-Substring/cpp-1044/) | | |
| | | | | | |
| 1046 | [Last Stone Weight](https://leetcode.com/problems/last-stone-weight/) | [无] | [C++](1001-1500/1046-Last-Stone-Weight/cpp-1046/) | | |
| 1047 | [Remove All Adjacent Duplicates In String](https://leetcode.com/problems/remove-all-adjacent-duplicates-in-string/) | [无] | [C++](1001-1500/1047-Remove-All-Adjacent-Duplicates-In-String/cpp-1047/) | | |
| | | | | | |
| 1049 | [Last Stone Weight II](https://leetcode.com/problems/last-stone-weight-ii/) | [无] | [C++](1001-1500/1049-Last-Stone-Weight-II/cpp-1049/) | | |
| 1050 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1051 | [Height Checker](https://leetcode.com/problems/height-checker/) | [无] | [C++](1001-1500/1051-Height-Checker/cpp-1051/) | | |
| 1052 | [Grumpy Bookstore Owner](https://leetcode.com/problems/grumpy-bookstore-owner/) | [无] | [C++](1001-1500/1052-Grumpy-Bookstore-Owner/cpp-1052/) | | |
| 1053 | [Previous Permutation With One Swap](https://leetcode.com/problems/previous-permutation-with-one-swap/description/) | [无] | [C++](1001-1500/1053-Previous-Permutation-With-One-Swap/cpp-1053/) | | |
| 1054 | [Distant Barcodes](https://leetcode.com/problems/distant-barcodes/description/) | [无] | [C++](1001-1500/1054-Distant-Barcodes/cpp-1054/) | | |
| 1055 | [Shortest Way to Form String](https://leetcode.com/problems/shortest-way-to-form-string/description/) | [无] | [C++](1001-1500/1055-Shortest-Way-to-Form-String/cpp-1055/) | | |
| 1056 | [Confusing Number](https://leetcode.com/problems/confusing-number/description/) | [无] | [C++](1001-1500/1056-Confusing-Number/cpp-1056/) | | |
| | | | | | |
| 1059 | [All Paths from Source Lead to Destination](https://leetcode.com/problems/all-paths-from-source-lead-to-destination/) | [solution](https://leetcode.com/problems/all-paths-from-source-lead-to-destination/solution/) | [C++](1001-1500/1059-All-Paths-from-Source-Lead-to-Destination/cpp-1059/) | | |
| | | | | | |
| 1061 | [Lexicographically Smallest Equivalent String](https://leetcode.com/problems/lexicographically-smallest-equivalent-string/description/) | [无] | [C++](1001-1500/1061-Lexicographically-Smallest-Equivalent-String/cpp-1061/) | | |
| 1062 | [Longest Repeating Substring](https://leetcode.com/problems/longest-repeating-substring/) | [无] | [C++](1001-1500/1062-Longest-Repeating-Substring/cpp-1062/) | | |
| | | | | | |
| 1065 | [Index Pairs of a String](https://leetcode.com/problems/index-pairs-of-a-string/description/) | [无] | [C++](1001-1500/1065-Index-Pairs-of-a-String/cpp-1065/) | | |
| 1066 | [Campus Bikes II](https://leetcode.com/problems/campus-bikes-ii/) | [solution](https://leetcode.com/problems/campus-bikes-ii/solutions/1451959/campus-bikes-ii/) | [C++](1001-1500/1066-Campus-Bikes-II/cpp-1066/) | | |
| | | | | | |
| 1072 | [Flip Columns For Maximum Number of Equal Rows](https://leetcode.com/problems/flip-columns-for-maximum-number-of-equal-rows/) | [无] | [C++](1001-1500/1072-Flip-Columns-For-Maximum-Number-of-Equal-Rows/cpp-1072/) | | |
| | | | | | |
| 1074 | [Number of Submatrices That Sum to Target](https://leetcode.com/problems/number-of-submatrices-that-sum-to-target/) | [无] | [C++](1001-1500/1074-Number-of-Submatrices-That-Sum-to-Target/cpp-1074/) | | |
| | | | | | |
| 1078 | [Occurrences After Bigram](https://leetcode.com/problems/occurrences-after-bigram/) | [无] | [C++](1001-1500/1078-Occurrences-After-Bigram/cpp-1078/) | | |
| 1079 | [Letter Tile Possibilities](https://leetcode.com/problems/letter-tile-possibilities/) | [无] | [C++](1001-1500/1079-Letter-Tile-Possibilities/cpp-1079/) | | |
| 1080 | [Insufficient Nodes in Root to Leaf Paths](https://leetcode.com/problems/insufficient-nodes-in-root-to-leaf-paths/) | [无] | [C++](1001-1500/1080-Insufficient-Nodes-in-Root-to-Leaf-Paths/cpp-1080/) | | |
| 1081 | [Smallest Subsequence of Distinct Characters](https://leetcode.com/problems/smallest-subsequence-of-distinct-characters/) | [无] | [C++](1001-1500/1081-Smallest-Subsequence-of-Distinct-Characters/cpp-1081/) | | |
| | | | | | |
| 1084 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 1087 | [Brace Expansion](https://leetcode.com/problems/brace-expansion/) | [无] | [C++](1001-1500/1087-Brace-Expansion/cpp-1087/) | | |
| 1088 | [Confusing Number II](https://leetcode.com/problems/confusing-number-ii/description/) | [无] | [C++](1001-1500/1088-Confusing-Number-II/cpp-1088/) | | |
| 1089 | [Duplicate Zeros](https://leetcode.com/problems/duplicate-zeros/) | [无] | [C++](1001-1500/1089-Duplicate-Zeros/cpp-1089/) | | |
| 1090 | [Largest Values From Labels](https://leetcode.com/problems/largest-values-from-labels/) | [无] | [C++](1001-1500/1090-Largest-Values-From-Labels/cpp-1090/) | | |
| 1091 | [Shortest Path in Binary Matrix](https://leetcode.com/problems/shortest-path-in-binary-matrix/) | [无] | [C++](1001-1500/1091-Shortest-Path-in-Binary-Matrix/cpp-1091/) | | |
| 1092 | [Shortest Common Supersequence](https://leetcode.com/problems/shortest-common-supersequence/) | [无] | [C++](1001-1500/1092-Shortest-Common-Supersequence/cpp-1092/) | | |
| 1093 | [Statistics from a Large Sample](https://leetcode.com/problems/statistics-from-a-large-sample/) | [无] | [C++](1001-1500/1093-Statistics-from-a-Large-Sample/cpp-1093/) | | |
| 1094 | [Car Pooling](https://leetcode.com/problems/car-pooling/) | [无] | [C++](1001-1500/1094-Car-Pooling/cpp-1094/) | | |
| 1095 | [Find in Mountain Array](https://leetcode.com/problems/find-in-mountain-array/) | [无] | [C++](1001-1500/1095-Find-in-Mountain-Array/cpp-1095/) | | |
| 1096 | [Brace Expansion II](https://leetcode.com/problems/brace-expansion-ii/) | [无]
[缺:非递归算法] | [C++](1001-1500/1096-Brace-Expansion-II/cpp-1096/) | | |
| | | | | | |
| 1099 | [Two Sum Less Than K](https://leetcode.com/problems/two-sum-less-than-k/) | [无] | [C++](1001-1500/1099-Two-Sum-Less-Than-K/cpp-1099/) | | |
| 1100 | [Find K-Length Substrings With No Repeated Characters](https://leetcode.com/problems/find-k-length-substrings-with-no-repeated-characters/) | [无] | [C++](1001-1500/1100-Find-K-Length-Substrings-With-No-Repeated-Characters/cpp-1100/) | | |
| 1101 | [The Earliest Moment When Everyone Become Friends](https://leetcode.com/problems/the-earliest-moment-when-everyone-become-friends/) | [无] | [C++](1001-1500/1101-The-Earliest-Moment-When-Everyone-Become-Friends/cpp-1101/) | | |
| 1102 | [Path With Maximum Minimum Value](https://leetcode.com/problems/path-with-maximum-minimum-value/) | [无]
[缺:并查集] | [C++](1001-1500/1102-Path-With-Maximum-Minimum-Value/cpp-1102/) | | |
| 1103 | [Distribute Candies to People](https://leetcode.com/problems/distribute-candies-to-people/) | [solution](https://leetcode.com/problems/distribute-candies-to-people/solution/) | [C++](1001-1500/1103-Distribute-Candies-to-People/cpp-1103/) | | |
| 1104 | [Path In Zigzag Labelled Binary Tree](https://leetcode.com/problems/path-in-zigzag-labelled-binary-tree/) | [无] | [C++](1001-1500/1104-Path-In-Zigzag-Labelled-Binary-Tree/cpp-1104/) | | |
| 1105 | [Filling Bookcase Shelves](https://leetcode.com/problems/filling-bookcase-shelves/) | [无] | [C++](1001-1500/1105-Filling-Bookcase-Shelves/cpp-1105/) | | |
| 1106 | [Parsing A Boolean Expression](https://leetcode.com/problems/parsing-a-boolean-expression/) | [无]
[缺:非递归算法] | [C++](1001-1500/1106-Parsing-A-Boolean-Expression/cpp-1106/) | | |
| | | | | | |
| 1108 | [Defanging an IP Address](https://leetcode.com/problems/defanging-an-ip-address/) | [无] | [C++](1001-1500/1108-Defanging-an-IP-Address/cpp-1108/) | | |
| 1109 | [Corporate Flight Bookings](https://leetcode.com/problems/corporate-flight-bookings/) | [无] | [C++](1001-1500/1109-Corporate-Flight-Bookings/cpp-1009/) | | |
| 1110 | [Delete Nodes And Return Forest](https://leetcode.com/problems/delete-nodes-and-return-forest/) | [无] | [C++](1001-1500/1110-Delete-Nodes-And-Return-Forest/cpp-1110/) | | |
| 1111 | [Maximum Nesting Depth of Two Valid Parentheses Strings](https://leetcode.com/problems/maximum-nesting-depth-of-two-valid-parentheses-strings/) | [无] | [C++](1001-1500/1111-Maximum-Nesting-Depth-of-Two-Valid-Parentheses-Strings/cpp-1111/) | | |
| 1112 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 1118 | [Number of Days in a Month](https://leetcode.com/problems/number-of-days-in-a-month/) | [无] | [C++](1001-1500/1118-Number-of-Days-in-a-Month/cpp-1118/) | | |
| 1119 | [Remove Vowels from a String](https://leetcode.com/problems/remove-vowels-from-a-string/) | [无] | [C++](1001-1500/1119-Remove-Vowels-from-a-String/cpp-1119/) | | |
| 1120 | [Maximum Average Subtree](https://leetcode.com/problems/maximum-average-subtree/) | [无] | [C++](1001-1500/1120-Maximum-Average-Subtree/cpp-1120/) | | |
| 1121 | [Divide Array Into Increasing Sequences](https://leetcode.com/problems/divide-array-into-increasing-sequences/) | [无] | [C++](1001-1500/1121-Divide-Array-Into-Increasing-Sequences/cpp-1121/) | | |
| | | | | | |
| 1124 | [Longest Well-Performing Interval](https://leetcode.com/problems/longest-well-performing-interval/) | [无] | [C++](1001-1500/1124-Longest-Well-Performing-Interval/cpp-1124/) | | |
| | | | | | |
| 1128 | [Number of Equivalent Domino Pairs](https://leetcode.com/problems/number-of-equivalent-domino-pairs/) | [无] | [C++](1001-1500/1128-Number-of-Equivalent-Domino-Pairs/cpp-1128/) | | |
| 1129 | [Shortest Path with Alternating Colors](https://leetcode.com/problems/shortest-path-with-alternating-colors/) | [无] | [C++](1001-1500/1129-Shortest-Path-with-Alternating-Colors/cpp-1129/) | | |
| 1130 | [Minimum Cost Tree From Leaf Values](https://leetcode.com/problems/minimum-cost-tree-from-leaf-values/) | [无] | [C++](1001-1500/1130-Minimum-Cost-Tree-From-Leaf-Values/cpp-1130/) | | |
| 1131 | [Maximum of Absolute Value Expression](https://leetcode.com/problems/maximum-of-absolute-value-expression/) | [无] | [C++](1001-1500/1131-Maximum-of-Absolute-Value-Expression/cpp-1131/) | | |
| | | | | | |
| 1133 | [Largest Unique Number](https://leetcode.com/problems/largest-unique-number/) | [无] | [C++](1001-1500/1133-Largest-Unique-Number/cpp-1133/) | | |
| 1134 | [Armstrong Number](https://leetcode.com/problems/armstrong-number/) | [无] | [C++](1001-1500/1134-Armstrong-Number/cpp-1134/) | | |
| 1135 | [Connecting Cities With Minimum Cost](https://leetcode.com/problems/connecting-cities-with-minimum-cost/) | [无] | [C++](1001-1500/1135-Connecting-Cities-With-Minimum-Cost/cpp-1135/) | | |
| 1136 | [Parallel Courses](https://leetcode.com/problems/parallel-courses/) | [无]
[缺:后序遍历拓扑排序] | [C++](1001-1500/1136-Parallel-Courses/cpp-1136/) | | |
| 1137 | [N-th Tribonacci Number](https://leetcode.com/problems/n-th-tribonacci-number/) | [无] | [C++](1001-1500/1137-N-th-Tribonacci-Number/cpp-1137/) | | |
| 1138 | [Alphabet Board Path](https://leetcode.com/problems/alphabet-board-path/) | [无] | [C++](1001-1500/1138-Alphabet-Board-Path/cpp-1138/) | | |
| 1139 | [Largest 1-Bordered Square](https://leetcode.com/problems/largest-1-bordered-square/) | [无] | [C++](1001-1500/1139-Largest-1-Bordered-Square/cpp-1139/) | | |
| 1140 | [Stone Game II](https://leetcode.com/problems/stone-game-ii/) | [无] | [C++](1001-1500/1140-Stone-Game-II/cpp-1140/) | | |
| 1141 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 1143 | [Longest Common Subsequence](https://leetcode.com/problems/longest-common-subsequence/) | [无] | [C++](1001-1500/1143-Longest-Common-Subsequence/cpp-1143/) | | |
| 1144 | [Decrease Elements To Make Array Zigzag](https://leetcode.com/problems/decrease-elements-to-make-array-zigzag/) | [无] | [C++](1001-1500/1144-Decrease-Elements-To-Make-Array-Zigzag/cpp-1144/) | | |
| 1145 | [Binary Tree Coloring Game](https://leetcode.com/problems/binary-tree-coloring-game/) | [无] | [C++](1001-1500/1145-Binary-Tree-Coloring-Game/cpp-1145/) | | |
| 1146 | [Snapshot Array](https://leetcode.com/problems/snapshot-array/) | [无] | [C++](1001-1500/1146-Snapshot-Array/cpp-1146/) | | |
| 1147 | [Longest Chunked Palindrome Decomposition](https://leetcode.com/problems/longest-chunked-palindrome-decomposition/) | [无] | [C++](1001-1500/1147-Longest-Chunked-Palindrome-Decomposition/cpp-1147/) | | |
| 1148 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 1150 | [Check If a Number Is Majority Element in a Sorted Array](https://leetcode.com/problems/is-a-a-majority-element/) | [无] | [C++](1001-1500/1150-Check-If-a-Number-Is-Majority-Element-in-a-Sorted-Array/cpp-1150/) | | |
| 1151 | [Minimum Swaps to Group All 1's Together](https://leetcode.com/problems/minimum-swaps-to-group-all-1s-together/) | [无] | [C++](1001-1500/1151-Minimum-Swaps-to-Group-All-1s-Together/cpp-1151/) | | |
| 1152 | [Analyze User Website Visit Pattern](https://leetcode.com/problems/analyse-user-website-visit-pattern/) | [无] | [C++](1001-1500/1152-Analyze-User-Website-Visit-Pattern/cpp-1152/) | | |
| 1153 | [String Transforms Into Another String](https://leetcode.com/problems/string-transforms-into-another-string/) | [无] | [C++](1001-1500/1153-String-Transforms-Into-Another-String/cpp-1153/) | | |
| 1154 | [Day of the Year](https://leetcode.com/problems/ordinal-number-of-date/) | [无] | [C++](1001-1500/1154-Day-of-the-Year/cpp-1154/) | | |
| 1155 | [Number of Dice Rolls With Target Sum](https://leetcode.com/problems/number-of-dice-rolls-with-target-sum/) | [无]
[缺:空间优化] | [C++](1001-1500/1155-Number-of-Dice-Rolls-With-Target-Sum/cpp-1155/) | | |
| 1156 | [Swap For Longest Repeated Character Substring](https://leetcode.com/problems/swap-for-maximum-repeated-substring/) | [无] | [C++](1001-1500/1156-Swap-For-Longest-Repeated-Character-Substring/cpp-1156/) | | |
| 1157 | [Online Majority Element In Subarray](https://leetcode.com/problems/online-majority-element-in-subarray/) | [无] | [C++](1001-1500/1157-Online-Majority-Element-In-Subarray/cpp-1157/) | | |
| 1158 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 1160 | [Find Words That Can Be Formed by Characters](https://leetcode.com/problems/find-words-that-can-be-formed-by-characters/) | [无] | [C++](1001-1500/1160-Find-Words-That-Can-Be-Formed-by-Characters/cpp-1160/) | | |
| 1161 | [Maximum Level Sum of a Binary Tree](https://leetcode.com/problems/maximum-level-sum-of-a-binary-tree/) | [无] | [C++](1001-1500/1161-Maximum-Level-Sum-of-a-Binary-Tree/cpp-1161/) | | |
| 1162 | [As Far from Land as Possible](https://leetcode.com/problems/as-far-from-land-as-possible/) | [无] | [C++](1001-1500/1162-As-Far-from-Land-as-Possible/cpp-1162/) | | |
| 1163 | [Last Substring in Lexicographical Order](https://leetcode.com/problems/last-substring-in-lexicographical-order/) | [无] | [C++](1001-1500/1163-Last-Substring-in-Lexicographical-Order/cpp-1163/) | | |
| | | | | | |
| 1165 | [Single-Row Keyboard](https://leetcode.com/problems/single-row-keyboard/) | [无] | [C++](1001-1500/1165-Single-Row-Keyboard/cpp-1165/) | | |
| 1166 | [Design File System](https://leetcode.com/problems/design-file-system/) | [无] | [C++](1001-1500/1166-Design-File-System/cpp-1166/) | | |
| 1167 | [Minimum Cost to Connect Sticks](https://leetcode.com/problems/minimum-cost-to-connect-sticks/) | [无] | [C++](1001-1500/1167-Minimum-Cost-to-Connect-Sticks/cpp-1167/) | | |
| 1168 | [Optimize Water Distribution in a Village](https://leetcode.com/problems/optimize-water-distribution-in-a-village/) | [无] | [C++](1001-1500/1168-Optimize-Water-Distribution-in-a-Village/cpp-1168/) | | |
| 1169 | [Invalid Transactions](https://leetcode.com/problems/invalid-transactions/) | [无] | [C++](1001-1500/1169-Invalid-Transactions/cpp-1169/) | | |
| 1170 | [Compare Strings by Frequency of the Smallest Character](https://leetcode.com/problems/compare-strings-by-frequency-of-the-smallest-character/) | [无] | [C++](1001-1500/1170-Compare-Strings-by-Frequency-of-the-Smallest-Character/cpp-1170/) | | |
| 1171 | [Remove Zero Sum Consecutive Nodes from Linked List](https://leetcode.com/problems/remove-zero-sum-consecutive-nodes-from-linked-list/) | [无] | [C++](1001-1500/1171-Remove-Zero-Sum-Consecutive-Nodes-from-Linked-List/cpp-1171/) | | |
| 1172 | [Dinner Plate Stacks](https://leetcode.com/problems/dinner-plate-stacks/) | [无] | [C++](1001-1500/1172-Dinner-Plate-Stacks/cpp-1172/) | | |
| 1173 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 1175 | [Prime Arrangements](https://leetcode.com/problems/prime-arrangements/) | [无] | [C++](1001-1500/1175-Prime-Arrangements/) | | |
| 1176 | [Diet Plan Performance](https://leetcode.com/problems/diet-plan-performance/) | [无] | [C++](1001-1500/1176-Diet-Plan-Performance/cpp-1176/) | | |
| 1177 | [Can Make Palindrome from Substring](https://leetcode.com/problems/can-make-palindrome-from-substring/) | [无] | [C++](1001-1500/1177-Can-Make-Palindrome-from-Substring/cpp-1177/) | | |
| 1178 | [Number of Valid Words for Each Puzzle](https://leetcode.com/problems/number-of-valid-words-for-each-puzzle/) | [无] | [C++](1001-1500/1178-Number-of-Valid-Words-for-Each-Puzzle/cpp-1178/) | | |
| | | | | | |
| 1180 | [Count Substrings with Only One Distinct Letter](https://leetcode.com/problems/count-substrings-with-only-one-distinct-letter/) | [无] | [C++](1001-1500/1180-Count-Substrings-with-Only-One-Distinct-Letter/cpp-1180/) | | |
| 1181 | [Before and After Puzzle](https://leetcode.com/problems/before-and-after-puzzle/) | [无] | [C++](1001-1500/1181-Before-and-After-Puzzle/cpp-1181/) | | |
| 1182 | [Shortest Distance to Target Color](https://leetcode.com/problems/shortest-distance-to-target-color/) | [无] | [C++](1001-1500/1182-Shortest-Distance-to-Target-Color/cpp-1182/) | | |
| 1183 | [Maximum Number of Ones](https://leetcode.com/problems/maximum-number-of-ones/) | [无] | [C++](1001-1500/1183-Maximum-Number-of-Ones/cpp-1183/) | | |
| 1184 | [Distance Between Bus Stops](https://leetcode.com/problems/distance-between-bus-stops/) | [无] | [C++](1001-1500/1184-Distance-Between-Bus-Stops/cpp-1184/) | | |
| 1185 | [Day of the Week](https://leetcode.com/problems/day-of-the-week/) | [无] | [C++](1001-1500/1185-Day-of-the-Week/cpp-1185/) | | |
| 1186 | [Maximum Subarray Sum with One Deletion](https://leetcode.com/problems/maximum-subarray-sum-with-one-deletion/) | [无] | [C++](1001-1500/1186-Maximum-Subarray-Sum-with-One-Deletion/cpp-1186/) | | |
| 1187 | [Make Array Strictly Increasing](https://leetcode.com/problems/make-array-strictly-increasing/) | [无]
[缺:动态规划] | [C++](1001-1500/1187-Make-Array-Strictly-Increasing/cpp-1187/) | | |
| | | | | | |
| 1189 | [Maximum Number of Balloons](https://leetcode.com/problems/maximum-number-of-balloons/) | [无] | [C++](1001-1500/1189-Maximum-Number-of-Balloons/cpp-1189/) | | |
| 1190 | [Reverse Substrings Between Each Pair of Parentheses](https://leetcode.com/problems/reverse-substrings-between-each-pair-of-parentheses/) | [无] | [C++](1001-1500/1190-Reverse-Substrings-Between-Each-Pair-of-Parentheses/cpp-1190/) | | |
| 1191 | [K-Concatenation Maximum Sum](https://leetcode.com/problems/k-concatenation-maximum-sum/) | [无] | [C++](1001-1500/1191-K-Concatenation-Maximum-Sum/cpp-1191/) | | |
| 1192 | [Critical Connections in a Network](https://leetcode.com/problems/critical-connections-in-a-network/) | [无] | [C++](1001-1500/1192-Critical-Connections-in-a-Network/cpp-1192/) | | |
| | | | | | |
| 1196 | [How Many Apples Can You Put into the Basket](https://leetcode.com/problems/how-many-apples-can-you-put-into-the-basket/) | [无] | [C++](1001-1500/1196-How-Many-Apples-Can-You-Put-into-the-Basket/cpp-1196/) | | |
| 1197 | [Minimum Knight Moves](https://leetcode.com/problems/minimum-knight-moves/) | [无] | [C++](1001-1500/1197-Minimum-Knight-Moves/cpp-1197/cpp-1197/) | | |
| 1198 | [Find Smallest Common Element in All Rows](https://leetcode.com/problems/find-smallest-common-element-in-all-rows/) | [无] | [C++](1001-1500/1198-Find-Smallest-Common-Element-in-All-Rows/cpp-1198/) | | |
| 1199 | [Minimum Time to Build Blocks](https://leetcode.com/problems/minimum-time-to-build-blocks/) | [无] | [C++](1001-1500/1199-Minimum-Time-to-Build-Blocks/cpp-1199/) | | |
| 1200 | [Minimum Absolute Difference](https://leetcode.com/problems/minimum-absolute-difference/) | [无] | [C++](1001-1500/1200-Minimum-Absolute-Difference/cpp-1200/) | | |
| 1201 | [Ugly Number III](https://leetcode.com/problems/ugly-number-iii/) | [无] | [C++](1001-1500/1201-Ugly-Number-III/cpp-1201/) | | |
| 1202 | [Smallest String With Swaps](https://leetcode.com/problems/smallest-string-with-swaps/) | [无] | [C++](1001-1500/1202-Smallest-String-With-Swaps/cpp-1202/) | | |
| 1203 | [Sort Items by Groups Respecting Dependencies](https://leetcode.com/problems/sort-items-by-groups-respecting-dependencies/) | [无] | [C++](1001-1500/1203-Sort-Items-by-Groups-Respecting-Dependencies/cpp-1203/) | | |
| | | | | | |
| 1207 | [Unique Number of Occurrences](https://leetcode.com/problems/unique-number-of-occurrences/) | [无] | [C++](1001-1500/1207-Unique-Number-of-Occurrences/cpp-1207/) | | |
| 1208 | [Get Equal Substrings Within Budget](https://leetcode.com/problems/get-equal-substrings-within-budget/) | [无] | [C++](1001-1500/1208-Get-Equal-Substrings-Within-Budget/cpp-1208/) | | |
| 1209 | [Remove All Adjacent Duplicates in String II](https://leetcode.com/problems/remove-all-adjacent-duplicates-in-string-ii/) | [无] | [C++](1001-1500/1209-Remove-All-Adjacent-Duplicates-in-String-II/cpp-1209/) | | |
| 1210 | [Minimum Moves to Reach Target with Rotations](https://leetcode.com/problems/minimum-moves-to-reach-target-with-rotations/) | [无] | [C++](1001-1500/1210-Minimum-Moves-to-Reach-Target-with-Rotations/cpp-1210/) | | |
| 1211 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 1213 | [Intersection of Three Sorted Arrays](https://leetcode.com/problems/intersection-of-three-sorted-arrays/) | [无] | [C++](1001-1500/1213-Intersection-of-Three-Sorted-Arrays/cpp-1213/) | | |
| 1214 | [Two Sum BSTs](https://leetcode.com/problems/two-sum-bsts/) | [无] | [C++](1001-1500/1214-Two-Sum-BSTs/cpp-1214/) | | |
| 1215 | [Stepping Numbers](https://leetcode.com/problems/stepping-numbers/) | [无] | [C++](1001-1500/1215-Stepping-Numbers/cpp-1215/) | | |
| 1216 | [Valid Palindrome III](https://leetcode.com/problems/valid-palindrome-iii/) | [无] | [C++](1001-1500/1216-Valid-Palindrome-III/cpp-1216/) | | |
| 1217 | [Play with Chips](https://leetcode.com/problems/play-with-chips/) | [无] | [C++](1001-1500/1217-Play-with-Chips/cpp-1217/) | | |
| 1218 | [Longest Arithmetic Subsequence of Given Difference](https://leetcode.com/problems/longest-arithmetic-subsequence-of-given-difference/) | [无] | [C++](1001-1500/1218-Longest-Arithmetic-Subsequence-of-Given-Difference/cpp-1218/) | | |
| 1219 | [Path with Maximum Gold](https://leetcode.com/problems/path-with-maximum-gold/) | [无] | [C++](1001-1500/1219-Path-with-Maximum-Gold/cpp-1219/) | | |
| 1220 | [Count Vowels Permutation](https://leetcode.com/problems/count-vowels-permutation/) | [无] | [C++](1001-1500/1220-Count-Vowels-Permutation/cpp-1220/) | | |
| 1221 | [Split a String in Balanced Strings](https://leetcode.com/problems/split-a-string-in-balanced-strings/) | [无] | [C++](1001-1500/1221-Split-a-String-in-Balanced-Strings/cpp-1221/) | | |
| 1222 | [Queens That Can Attack the King](https://leetcode.com/problems/queens-that-can-attack-the-king/) | [无] | [C++](1001-1500/1222-Queens-That-Can-Attack-the-King/cpp-1222/) | | |
| 1223 | [Dice Roll Simulation](https://leetcode.com/problems/dice-roll-simulation/) | [无] | [C++](1001-1500/1223-Dice-Roll-Simulation/cpp-1223/) | | |
| 1224 | [Maximum Equal Frequency](https://leetcode.com/problems/maximum-equal-frequency/) | [无] | [C++](1001-1500/1224-Maximum-Equal-Frequency/cpp-1224/) | | |
| | | | | | |
| 1228 | [Missing Number In Arithmetic Progression](https://leetcode.com/problems/missing-number-in-arithmetic-progression/) | [无] | [C++](1001-1500/1228-Missing-Number-In-Arithmetic-Progression/cpp-1228/) | | |
| 1229 | [Meeting Scheduler](https://leetcode.com/problems/meeting-scheduler/) | [无] | [C++](1001-1500/1229-Meeting-Scheduler/cpp-1229/) | | |
| 1230 | [Toss Strange Coins](https://leetcode.com/problems/toss-strange-coins/) | [无] | [C++](1001-1500/1230-Toss-Strange-Coins/cpp-1230/) | | |
| 1231 | [Divide Chocolate](https://leetcode.com/problems/divide-chocolate/) | [无] | [C++](1001-1500/1231-Divide-Chocolate/cpp-1231/) | | |
| 1232 | [Check If It Is a Straight Line](https://leetcode.com/problems/check-if-it-is-a-straight-line/) | [无] | [C++](1001-1500/1232-Check-If-It-Is-a-Straight-Line/cpp-1232/) | | |
| 1233 | [Remove Sub-Folders from the Filesystem](https://leetcode.com/problems/remove-sub-folders-from-the-filesystem/) | [无] | [C++](1001-1500/1233-Remove-Sub-Folders-from-the-Filesystem/cpp-1233/) | | |
| 1234 | [Replace the Substring for Balanced String](https://leetcode.com/problems/replace-the-substring-for-balanced-string/) | [无] | [C++](1001-1500/1234-Replace-the-Substring-for-Balanced-String/cpp-1234/) | | |
| 1235 | [Maximum Profit in Job Scheduling](https://leetcode.com/problems/maximum-profit-in-job-scheduling/) | [无] | [C++](1001-1500/1235-Maximum-Profit-in-Job-Scheduling/cpp-1235/) | | |
| 1236 | [Web Crawler](https://leetcode.com/problems/web-crawler/description/) | [无] | [C++](1001-1500/1236-Web-Crawler/cpp-1236/) | | |
| 1237 | [Find Positive Integer Solution for a Given Equation](https://leetcode.com/problems/find-positive-integer-solution-for-a-given-equation/) | [无] | [C++](1001-1500/1237-Find-Positive-Integer-Solution-for-a-Given-Equation/cpp-1237/) | | |
| 1238 | [Circular Permutation in Binary Representation](https://leetcode.com/problems/circular-permutation-in-binary-representation/) | [无] | [C++](1001-1500/1238-Circular-Permutation-in-Binary-Representation/cpp-1238/) | | |
| 1239 | [Maximum Length of a Concatenated String with Unique Characters](https://leetcode.com/problems/maximum-length-of-a-concatenated-string-with-unique-characters/) | [无] | [C++](1001-1500/1239-Maximum-Length-of-a-Concatenated-String-with-Unique-Characters/cpp-1239/) | | |
| 1240 | [Tiling a Rectangle with the Fewest Squares](https://leetcode.com/problems/tiling-a-rectangle-with-the-fewest-squares/) | [无] | [C++](1001-1500/1240-Tiling-a-Rectangle-with-the-Fewest-Squares/cpp-1240/) | | |
| | | | | | |
| 1243 | [Array Transformation](https://leetcode.com/problems/array-transformation/) | [无] | [C++](1001-1500/1243-Array-Transformation/cpp-1243/) | | |
| 1244 | [Design A Leaderboard](https://leetcode.com/problems/design-a-leaderboard/) | [无] | [C++](1001-1500/1244-Design-A-Leaderboard/cpp-1244/) | | |
| 1245 | [Tree Diameter](https://leetcode.com/problems/tree-diameter/) | [无] | [C++](1001-1500/1245-Tree-Diameter/cpp-1245/) | | |
| | | | | | |
| 1247 | [Minimum Swaps to Make Strings Equal](https://leetcode.com/problems/minimum-swaps-to-make-strings-equal/) | [无] | [C++](1001-1500/1247-Minimum-Swaps-to-Make-Strings-Equal/cpp-1247/) | | |
| 1248 | [Count Number of Nice Subarrays](https://leetcode.com/problems/count-number-of-nice-subarrays/) | [无] | [C++](1001-1500/1248-Count-Number-of-Nice-Subarrays/cpp-1248/) | [Java](1001-1500/1248-Count-Number-of-Nice-Subarrays/java-1248/) | |
| 1249 | [Minimum Remove to Make Valid Parentheses](https://leetcode.com/problems/minimum-remove-to-make-valid-parentheses/) | [solution](https://leetcode.com/problems/minimum-remove-to-make-valid-parentheses/solution/) | [C++](1001-1500/1249-Minimum-Remove-to-Make-Valid-Parentheses/cpp-1249/) | | |
| 1250 | [Check If It Is a Good Array](https://leetcode.com/problems/check-if-it-is-a-good-array/description/) | [无] | [C++](1001-1500/1250-Check-If-It-Is-a-Good-Array/cpp-1250/) | | |
| 1251 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1252 | [Cells with Odd Values in a Matrix](https://leetcode.com/problems/cells-with-odd-values-in-a-matrix/) | [无] | [C++](1001-1500/1252-Cells-with-Odd-Values-in-a-Matrix/cpp-1252/) | | |
| 1253 | [Reconstruct a 2-Row Binary Matrix](https://leetcode.com/problems/reconstruct-a-2-row-binary-matrix/description/) | [无] | [C++](1001-1500/1253-Reconstruct-a-2-Row-Binary-Matrix/cpp-1253/) | | |
| 1254 | [Number of Closed Islands](https://leetcode.com/problems/number-of-closed-islands/description/) | [无] | [C++](1001-1500/1254-Number-of-Closed-Islands/cpp-1254/) | | |
| 1255 | [Maximum Score Words Formed by Letters](https://leetcode.com/problems/maximum-score-words-formed-by-letters/description/) | [无] | [C++](1001-1500/1255-Maximum-Score-Words-Formed-by-Letters/cpp-1255/) | | |
| | | | | | |
| 1259 | [Handshakes That Don't Cross](https://leetcode.com/problems/handshakes-that-dont-cross/description/) | [无] | [C++](1001-1500/1259-Handshakes-That-Dont-Cross/cpp-1259/) | | |
| 1260 | [Shift 2D Grid](https://leetcode.com/problems/shift-2d-grid/) | [solution](https://leetcode.com/problems/shift-2d-grid/solution/) | [C++](1001-1500/1260-Shift-2D-Grid/cpp-1260/) | | |
| 1261 | [Find Elements in a Contaminated Binary Tree](https://leetcode.com/contest/weekly-contest-163/problems/find-elements-in-a-contaminated-binary-tree/) | [C++](1001-1500/1261-Find-Elements-in-a-Contaminated-Binary-Tree/cpp-1261/) | | | |
| 1262 | [Greatest Sum Divisible by Three](https://leetcode.com/problems/greatest-sum-divisible-by-three/) | [无] | [C++](1001-1500/1262-Greatest-Sum-Divisible-by-Three/cpp-1262/) | | |
| 1263 | [Minimum Moves to Move a Box to Their Target Location](https://leetcode.com/problems/minimum-moves-to-move-a-box-to-their-target-location/) | [无] | [C++](1001-1500/1263-Minimum-Moves-to-Move-a-Box-to-Their-Target-Location/cpp-1263/) | | |
| 1264 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 1272 | [Remove Interval](https://leetcode.com/problems/remove-interval/) | [无] | [C++](1001-1500/1272-Remove-Interval/cpp-1272/) | | |
| | | | | | |
| 1275 | [Find Winner on a Tic Tac Toe Game](https://leetcode.com/problems/find-winner-on-a-tic-tac-toe-game/) | [无] | [C++](1001-1500/1275-Find-Winner-on-a-Tic-Tac-Toe-Game/cpp-1275/) | | |
| | | | | | |
| 1277 | [Count Square Submatrices with All Ones](https://leetcode.com/problems/count-square-submatrices-with-all-ones/) | [题解](https://leetcode-cn.com/problems/count-square-submatrices-with-all-ones/solution/tong-ji-quan-wei-1-de-zheng-fang-xing-zi-ju-zhen-2/) | [C++](1001-1500/1277-Count-Square-Submatrices-with-All-Ones/cpp-1277/) | | |
| 1278 | [Palindrome Partitioning III](https://leetcode.com/problems/palindrome-partitioning-iii/) | [无] | [C++](1001-1500/1278-Palindrome-Partitioning-III/cpp-1278/) | | |
| | | | | | |
| 1280 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1281 | [Subtract the Product and Sum of Digits of an Integer](https://leetcode.com/problems/subtract-the-product-and-sum-of-digits-of-an-integer/) | [无] | [C++](1001-1500/1281-Subtract-the-Product-and-Sum-of-Digits-of-an-Integer/cpp-1281/) | | |
| 1282 | [Group the People Given the Group Size They Belong To](https://leetcode.com/problems/group-the-people-given-the-group-size-they-belong-to/) | [无] | [C++](1001-1500/1282-Group-the-People-Given-the-Group-Size-They-Belong-To/cpp-1282/) | | |
| | | | | | |
| 1286 | [Iterator for Combination](https://leetcode.com/problems/iterator-for-combination/) | [solution](https://leetcode.com/problems/iterator-for-combination/solution/) | [C++](1001-1500/1286-Iterator-for-Combination/cpp-1286/) | | |
| | | | | | |
| 1288 | [Remove Covered Intervals](https://leetcode.com/problems/remove-covered-intervals/) | [solution](https://leetcode.com/problems/remove-covered-intervals/solution/) | [C++](1001-1500/1288-Remove-Covered-Intervals/cpp-1288/) | | |
| 1289 | [Minimum Falling Path Sum II](https://leetcode.com/problems/minimum-falling-path-sum-ii/) | [无] | [C++](1001-1500/1289-Minimum-Falling-Path-Sum-II/cpp-1289/) | | |
| 1290 | [Convert Binary Number in a Linked List to Integer](https://leetcode.com/problems/convert-binary-number-in-a-linked-list-to-integer/) | [solution](https://leetcode.com/problems/convert-binary-number-in-a-linked-list-to-integer/solution/) | [C++](1001-1500/1290-Convert-Binary-Number-in-a-Linked-List-to-Integer/cpp-1290/) | | |
| 1291 | [Sequential Digits](https://leetcode.com/problems/sequential-digits/) | [solution](https://leetcode.com/problems/sequential-digits/solution/) | [C++](1001-1500/1291-Sequential-Digits/cpp-1291/) | | |
| | | | | | |
| 1293 | [Shortest Path in a Grid with Obstacles Elimination](https://leetcode.com/problems/shortest-path-in-a-grid-with-obstacles-elimination/) | [solution](https://leetcode.com/problems/shortest-path-in-a-grid-with-obstacles-elimination/) | [C++](1001-1500/1293-Shortest-Path-in-a-Grid-with-Obstacles-Elimination/cpp-1293/) | | |
| | | | | | |
| 1302 | [Deepest Leaves Sum](https://leetcode.com/problems/deepest-leaves-sum/) | [solution](https://leetcode.com/problems/deepest-leaves-sum/solution/) | [C++](1302-Deepest-Leaves-Sum/cpp-1302/) | | |
| 1303 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1304 | [Find N Unique Integers Sum up to Zero](https://leetcode.com/problems/find-n-unique-integers-sum-up-to-zero/) | [无] | [C++](1001-1500/1304-Find-N-Unique-Integers-Sum-up-to-Zero/cpp-1304/) | | |
| 1305 | [All Elements in Two Binary Search Trees](https://leetcode.com/problems/all-elements-in-two-binary-search-trees/) | [无] | [C++](1001-1500/1305-All-Elements-in-Two-Binary-Search-Trees/cpp-1305/) | | |
| 1306 | [Jump Game III](https://leetcode.com/problems/jump-game-iii/) | [无] | [C++](1001-1500/1306-Jump-Game-III/cpp-1306/) | | |
| 1307 | [Verbal Arithmetic Puzzle](https://leetcode.com/problems/verbal-arithmetic-puzzle/) | [无] | [C++](1001-1500/1307-Verbal-Arithmetic-Puzzle/cpp-1307/) | | |
| | | | | | |
| 1309 | [Decrypt String from Alphabet to Integer Mapping](https://leetcode.com/problems/decrypt-string-from-alphabet-to-integer-mapping/) | [无] | [C++](1001-1500/1309-Decrypt-String-from-Alphabet-to-Integer-Mapping/cpp-1309/) | | |
| 1310 | [XOR Queries of a Subarray](https://leetcode.com/problems/xor-queries-of-a-subarray/) | [无] | [C++](1001-1500/1310-XOR-Queries-of-a-Subarray/cpp-1310/) | | |
| 1311 | [Get Watched Videos by Your Friends](https://leetcode.com/problems/get-watched-videos-by-your-friends/) | [无] | [C++](1001-1500/1311-Get-Watched-Videos-by-Your-Friends/cpp-1311/) | | |
| 1312 | [Minimum Insertion Steps to Make a String Palindrome](https://leetcode.com/problems/minimum-insertion-steps-to-make-a-string-palindrome/) | [无] | [C++](1001-1500/1312-Minimum-Insertion-Steps-to-Make-a-String-Palindrome/cpp-1312/) | | |
| | | | | | |
| 1317 | [Convert Integer to the Sum of Two No-Zero Integers](https://leetcode.com/problems/convert-integer-to-the-sum-of-two-no-zero-integers/) | [无] | [C++](1001-1500/1317-Convert-Integer-to-the-Sum-of-Two-No-Zero-Integers/cpp-1317/) | | |
| 1318 | [Minimum Flips to Make a OR b Equal to c](https://leetcode.com/problems/minimum-flips-to-make-a-or-b-equal-to-c/) | [无] | [C++](1001-1500/1318-Minimum-Flips-to-Make-a-OR-b-Equal-to-c/cpp-1318/) | | |
| 1319 | [Number of Operations to Make Network Connected](https://leetcode.com/problems/number-of-operations-to-make-network-connected/) | [无] | [C++](1001-1500/1319-Number-of-Operations-to-Make-Network-Connected/cpp-1319/) | | |
| | | | | | |
| 1323 | [Maximum 69 Number](https://leetcode.com/problems/maximum-69-number/description/) | [无] | [C++](1001-1500/1323-Maximum-69-Number/cpp-1323/) | | |
| | | | | | |
| 1326 | [Minimum Number of Taps to Open to Water a Garden](https://leetcode.com/problems/minimum-number-of-taps-to-open-to-water-a-garden/description/) | [无] | [C++](1001-1500/1326-Minimum-Number-of-Taps-to-Open-to-Water-a-Garden/cpp-1326/) | | |
| | | | | | |
| 1328 | [Break a Palindrome](https://leetcode.com/problems/break-a-palindrome/) | [solution](https://leetcode.com/problems/break-a-palindrome/solution/) | [C++](1001-1500/1328-Break-a-Palindrome/cpp-1328/) | | |
| 1329 | [Sort the Matrix Diagonally](https://leetcode.com/problems/sort-the-matrix-diagonally/) | [solution](https://leetcode.com/problems/sort-the-matrix-diagonally/solution/) | [C++](1001-1500/1329-Sort-the-Matrix-Diagonally/cpp-1329/) | | |
| 1330 | [Reverse Subarray To Maximize Array Value](https://leetcode.com/problems/reverse-subarray-to-maximize-array-value/description/) | [无] | [C++](1001-1500/1330-Reverse-Subarray-To-Maximize-Array-Value/cpp-1330/) | | |
| 1331 | [Rank Transform of an Array](https://leetcode.com/problems/rank-transform-of-an-array/) | [无] | [C++](1001-1500/1331-Rank-Transform-of-an-Array/cpp-1331/) | | |
| 1332 | [Remove Palindromic Subsequences](https://leetcode.com/problems/remove-palindromic-subsequences/) | [solution](https://leetcode.com/problems/remove-palindromic-subsequences/solution/) | [C++](1001-1500/1332-Remove-Palindromic-Subsequences/cpp-1332/) | | |
| 1333 | [Filter Restaurants by Vegan-Friendly, Price and Distance](https://leetcode.com/problems/filter-restaurants-by-vegan-friendly-price-and-distance/) | [无] | [C++](1001-1500/1333-Filter-Restaurants-by-Vegan-Friendly-Price-and-Distance/cpp-1333/) | | |
| 1334 | [Find the City With the Smallest Number of Neighbors at a Threshold Distance](https://leetcode.com/problems/find-the-city-with-the-smallest-number-of-neighbors-at-a-threshold-distance/) | [无] | [C++](1001-1500/1334-Find-the-City-With-the-Smallest-Number-of-Neighbors-at-a-Threshold-Distance/cpp-1334/) | | |
| 1335 | [Minimum Difficulty of a Job Schedule](https://leetcode.com/problems/minimum-difficulty-of-a-job-schedule/) | [无] | [C++](1001-1500/1335-Minimum-Difficulty-of-a-Job-Schedule/cpp-1335/) | | |
| | | | | | |
| 1337 | [The K Weakest Rows in a Matrix](https://leetcode.com/problems/the-k-weakest-rows-in-a-matrix/) | [solution](https://leetcode.com/problems/the-k-weakest-rows-in-a-matrix/solution/) | [C++](1001-1500/1337-The-K-Weakest-Rows-in-a-Matrix/cpp-1337/) | | |
| 1338 | [Reduce Array Size to The Half](https://leetcode.com/problems/reduce-array-size-to-the-half/) | [solution](https://leetcode.com/problems/reduce-array-size-to-the-half/solution/) | [C++](1001-1500/1338-Reduce-Array-Size-to-The-Half/cpp-1338/) | | |
| 1339 | [Maximum Product of Splitted Binary Tree](https://leetcode.com/problems/maximum-product-of-splitted-binary-tree/) | [solution](https://leetcode.com/problems/maximum-product-of-splitted-binary-tree/solution/) | [C++](1001-1500/1339-Maximum-Product-of-Splitted-Binary-Tree/cpp-1339/) | | |
| 1340 | [Jump Game V](https://leetcode.com/problems/jump-game-v/) | [无] | [C++](1001-1500/1340-Jump-Game-V/cpp-1340/) | | |
| 1341 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1342 | [Number of Steps to Reduce a Number to Zero](https://leetcode.com/problems/number-of-steps-to-reduce-a-number-to-zero/) | [无] | [C++](1001-1500/1342-Number-of-Steps-to-Reduce-a-Number-to-Zero/cpp-1342/) | | |
| 1343 | [Number of Sub-arrays of Size K and Average Greater than or Equal to Threshold](https://leetcode.com/problems/number-of-sub-arrays-of-size-k-and-average-greater-than-or-equal-to-threshold/) | [无] | [C++](1001-1500/1343-Number-of-Sub-arrays-of-Size-K-and-Average-Greater-than-or-Equal-to-Threshold/cpp-1343/) | | |
| 1344 | [Angle Between Hands of a Clock](https://leetcode.com/problems/angle-between-hands-of-a-clock/) | [C++](1001-1500/1344-Angle-Between-Hands-of-a-Clock/cpp-1344/) | | | |
| 1345 | [Jump Game IV](https://leetcode.com/problems/jump-game-iv/) | [无] | [C++](1001-1500/1345-Jump-Game-IV/cpp-1345/) | | |
| 1346 | [Check If N and Its Double Exist](https://leetcode.com/problems/check-if-n-and-its-double-exist/) | [无] | [C++](1001-1500/1346-Check-If-N-and-Its-Double-Exist/cpp-1346/) | | |
| 1347 | [Minimum Number of Steps to Make Two Strings Anagram](https://leetcode.com/problems/minimum-number-of-steps-to-make-two-strings-anagram/) | [无] | [C++](1001-1500/1347-Minimum-Number-of-Steps-to-Make-Two-Strings-Anagram/cpp-1347/) | | |
| 1348 | [Tweet Counts Per Frequency](https://leetcode.com/problems/tweet-counts-per-frequency/) | [无] | [C++](1001-1500/1348-Tweet-Counts-Per-Frequency/cpp-1348/) | | |
| 1349 | [Maximum Students Taking Exam](https://leetcode.com/problems/maximum-students-taking-exam/) | [无] | [C++](1001-1500/1349-Maximum-Students-Taking-Exam/cpp-1349/) | | |
| 1350 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1351 | [Count Negative Numbers in a Sorted Matrix](https://leetcode.com/problems/count-negative-numbers-in-a-sorted-matrix/) | [无] | [C++](1001-1500/1351-Count-Negative-Numbers-in-a-Sorted-Matrix/cpp-1351/) | | |
| 1352 | [Product of the Last K Numbers](https://leetcode.com/problems/product-of-the-last-k-numbers/) | [无] | [C++](1001-1500/1352-Product-of-the-Last-K-Numbers/cpp-1352/) | | |
| 1353 | [Maximum Number of Events That Can Be Attended](https://leetcode.com/problems/maximum-number-of-events-that-can-be-attended/) | [无] | [C++](1001-1500/1353-Maximum-Number-of-Events-That-Can-Be-Attended/cpp-1353/) | | |
| 1354 | [Construct Target Array With Multiple Sums](https://leetcode.com/problems/construct-target-array-with-multiple-sums/) | [solution](https://leetcode.com/problems/construct-target-array-with-multiple-sums/solution/) | [C++](1001-1500/1354-Construct-Target-Array-With-Multiple-Sums/cpp-1354/) | | |
| 1355 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1356 | [Sort Integers by The Number of 1 Bits](https://leetcode.com/problems/sort-integers-by-the-number-of-1-bits/) | [无] | [C++](1001-1500/1356-Sort-Integers-by-The-Number-of-1-Bits/cpp-1356/) | | |
| 1357 | [Apply Discount Every n Orders](https://leetcode.com/problems/apply-discount-every-n-orders/) | [无] | [C++](1001-1500/1357-Apply-Discount-Every-n-Orders/cpp-1357/) | | |
| 1358 | [Number of Substrings Containing All Three Characters](1358-Number-of-Substrings-Containing-All-Three-Characters/cpp-1358/) | [无] | [C++](1001-1500/1358-Number-of-Substrings-Containing-All-Three-Characters/cpp-1358/) | | |
| 1359 | [Count All Valid Pickup and Delivery Options](https://leetcode.com/problems/count-all-valid-pickup-and-delivery-options/) | [无] | [C++](1001-1500/1359-Count-All-Valid-Pickup-and-Delivery-Options/cpp-1359/) | | |
| 1360 | [Number of Days Between Two Dates](https://leetcode.com/problems/number-of-days-between-two-dates/) | [无] | [C++](1001-1500/1360-Number-of-Days-Between-Two-Dates/cpp-1360/) | | |
| 1361 | [Validate Binary Tree Nodes](https://leetcode.com/problems/validate-binary-tree-nodes/) | [无] | [C++](1001-1500/1361-Validate-Binary-Tree-Nodes/cpp-1361/) | | |
| 1362 | [Closest Divisors](https://leetcode.com/problems/closest-divisors/) | [无] | [C++](1001-1500/1362-Closest-Divisors/cpp-1362/) | | |
| 1363 | [Largest Multiple of Three](https://leetcode.com/problems/largest-multiple-of-three/) | [无] | [C++](1001-1500/1363-Largest-Multiple-of-Three/cpp-1363/) | | |
| 1364 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1365 | [How Many Numbers Are Smaller Than the Current Number](https://leetcode.com/problems/how-many-numbers-are-smaller-than-the-current-number/) | [无] | [C++](1001-1500/1365-How-Many-Numbers-Are-Smaller-Than-the-Current-Number/cpp-1365/) | | |
| 1366 | [Rank Teams by Votes](https://leetcode.com/problems/rank-teams-by-votes/) | [无] | [C++](1001-1500/1366-Rank-Teams-by-Votes/cpp-1366/) | | |
| 1367 | [Linked List in Binary Tree](https://leetcode.com/problems/linked-list-in-binary-tree/) | [无] | [C++](1001-1500/1367-Linked-List-in-Binary-Tree/cpp-1367/) | | |
| 1368 | [Minimum Cost to Make at Least One Valid Path in a Grid](https://leetcode.com/problems/minimum-cost-to-make-at-least-one-valid-path-in-a-grid/) | [无] | [C++](1001-1500/1368-Minimum-Cost-to-Make-at-Least-One-Valid-Path-in-a-Grid/cpp-1368/) | | |
| 1369 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1370 | [Increasing Decreasing String](https://leetcode.com/problems/increasing-decreasing-string/) | [无] | [C++](1001-1500/1370-Increasing-Decreasing-String/cpp-1370/) | | |
| 1371 | [Find the Longest Substring Containing Vowels in Even Counts](https://leetcode.com/problems/find-the-longest-substring-containing-vowels-in-even-counts/) | [无] | [C++](1001-1500/1371-Find-the-Longest-Substring-Containing-Vowels-in-Even-Counts/cpp-1371/) | | |
| 1372 | [Longest ZigZag Path in a Binary Tree](https://leetcode.com/problems/longest-zigzag-path-in-a-binary-tree/) | [题解](https://leetcode-cn.com/problems/longest-zigzag-path-in-a-binary-tree/solution/er-cha-shu-zhong-de-zui-chang-jiao-cuo-lu-jing-b-2/)
[缺:dp,返回值DFS] | [C++](1001-1500/1372-Longest-ZigZag-Path-in-a-Binary-Tree/cpp-1372/) | | |
| 1373 | [Maximum Sum BST in Binary Tree](https://leetcode.com/problems/maximum-sum-bst-in-binary-tree/) | [无] | [C++](1001-1500/1373-Maximum-Sum-BST-in-Binary-Tree/cpp-1373/) | | |
| 1374 | [Generate a String With Characters That Have Odd Counts](https://leetcode.com/problems/generate-a-string-with-characters-that-have-odd-counts/) | [无] | [C++](1001-1500/1374-Generate-a-String-With-Characters-That-Have-Odd-Counts/cpp-1374/) | | |
| 1375 | [Bulb Switcher III](https://leetcode.com/problems/bulb-switcher-iii/) | [无] | [C++](1001-1500/1375-Bulb-Switcher-III/cpp-1375/) | | |
| 1376 | [Time Needed to Inform All Employees](https://leetcode.com/problems/time-needed-to-inform-all-employees/) | [无] | [C++](1001-1500/1376-Time-Needed-to-Inform-All-Employees/cpp-1376/) | | |
| 1377 | [Frog Position After T Seconds](https://leetcode.com/problems/frog-position-after-t-seconds/) | [无] | [C++](1001-1500/1377-Frog-Position-After-T-Seconds/cpp-1377/) | | |
| 1378 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1379 | [Find a Corresponding Node of a Binary Tree in a Clone of That Tree](https://leetcode.com/problems/find-a-corresponding-node-of-a-binary-tree-in-a-clone-of-that-tree/) | [无] | [C++](1001-1500/1379-Find-a-Corresponding-Node-of-a-Binary-Tree-in-a-Clone-of-That-Tree/cpp-1379/) | | |
| | | | | | |
| 1383 | [Maximum Performance of a Team](https://leetcode.com/problems/maximum-performance-of-a-team/) | [无] | [C++](1001-1500/1383-Maximum-Performance-of-a-Team/cpp-1383/) | | |
| 1384 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 1389 | [Create Target Array in the Given Order](https://leetcode.com/problems/create-target-array-in-the-given-order/) | [无] | [C++](1001-1500/1389-Create-Target-Array-in-the-Given-Order/cpp-1389/) | | |
| 1390 | [Four Divisors](https://leetcode.com/problems/four-divisors/) | [无] | [C++](1001-1500/1390-Four-Divisors/cpp-1390/) | | |
| 1391 | [Check if There is a Valid Path in a Grid](https://leetcode.com/problems/check-if-there-is-a-valid-path-in-a-grid/) | [无] | [C++](1001-1500/1391-Check-if-There-is-a-Valid-Path-in-a-Grid/cpp-1391/) | | |
| 1392 | [Longest Happy Prefix](https://leetcode.com/problems/longest-happy-prefix/) | [无] | [C++](1001-1500/1392-Longest-Happy-Prefix/cpp-1392/) | | |
| 1393 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1394 | [Find Lucky Integer in an Array](https://leetcode.com/problems/find-lucky-integer-in-an-array/) | [无] | [C++](1001-1500/1394-Find-Lucky-Integer-in-an-Array/cpp-1394/) | | |
| 1395 | [Count Number of Teams](https://leetcode.com/problems/count-number-of-teams/) | [无]
[缺:线段树] | [C++](1001-1500/1395-Count-Number-of-Teams/cpp-1395/) | | |
| 1396 | [Design Underground System](https://leetcode.com/problems/design-underground-system/) | [solution](https://leetcode.com/problems/design-underground-system/solution/) | [C++](1001-1500/1396-Design-Underground-System/cpp-1396/) | | |
| 1397 | [Find All Good Strings](https://leetcode.com/problems/find-all-good-strings/) | [无]
[缺:双端数位 DP] | [C++](1001-1500/1397-Find-All-Good-Strings/cpp-1397/) | | |
| 1398 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1399 | [Count Largest Group](https://leetcode.com/problems/count-largest-group/) | [无] | [C++](1001-1500/1399-Count-Largest-Group/cpp-1399/) | | |
| 1400 | [Construct K Palindrome Strings](https://leetcode.com/problems/construct-k-palindrome-strings/) | [无] | [C++](1001-1500/1400-Construct-K-Palindrome-Strings/cpp-1400/) | | |
| 1401 | [Circle and Rectangle Overlapping](https://leetcode.com/problems/circle-and-rectangle-overlapping/) | [无] | [C++](1001-1500/1401-Circle-and-Rectangle-Overlapping/cpp-1401/) | | |
| 1402 | [Reducing Dishes](https://leetcode.com/problems/reducing-dishes/) | [无] | [C++](1001-1500/1402-Reducing-Dishes/cpp-1402/) | | |
| 1403 | [Minimum Subsequence in Non Increasing Order](https://leetcode.com/problems/minimum-subsequence-in-non-increasing-order/) | [无] | [C++](1001-1500/1403-Minimum-Subsequence-in-Non-Increasing-Order/cpp-1403/) | | |
| 1404 | [Number of Steps to Reduce a Number in Binary Representation to One](https://leetcode.com/problems/number-of-steps-to-reduce-a-number-in-binary-representation-to-one/) | [无] | [C++](1001-1500/1404-Number-of-Steps-to-Reduce-a-Number-in-Binary-Representation-to-One/cpp-1404/) | | |
| 1405 | [Longest Happy String](https://leetcode.com/problems/longest-happy-string/) | [无] | [C++](1001-1500/1405-Longest-Happy-String/cpp-1405/) | | |
| 1406 | [Stone Game III](https://leetcode.com/problems/stone-game-iii/) | [无] | [C++](1001-1500/1406-Stone-Game-III/cpp-1406/) | | |
| 1407 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1408 | [String Matching in an Array](https://leetcode.com/problems/string-matching-in-an-array/) | [无] | [C++](1001-1500/1408-String-Matching-in-an-Array/cpp-1408/) | | |
| 1409 | [Queries on a Permutation With Key](https://leetcode.com/problems/queries-on-a-permutation-with-key/) | [无]
[缺:BIT] | [C++](1001-1500/1409-Queries-on-a-Permutation-With-Key/cpp-1409/) | | |
| 1410 | [HTML Entity Parser](https://leetcode.com/problems/html-entity-parser/) | [无] | [C++](1001-1500/1410-HTML-Entity-Parser/cpp-1410/) | | |
| 1411 | [Number of Ways to Paint N × 3 Grid](https://leetcode.com/problems/number-of-ways-to-paint-n-3-grid/) | [无] | [C++](1001-1500/1411-Number-of-Ways-to-Paint-N×3-Grid/cpp-1411/) | | |
| 1412 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1413 | [Minimum Value to Get Positive Step by Step Sum](https://leetcode.com/problems/minimum-value-to-get-positive-step-by-step-sum/) | [无] | [C++](1001-1500/1413-Minimum-Value-to-Get-Positive-Step-by-Step-Sum/cpp-1413/) | | |
| 1414 | [Find the Minimum Number of Fibonacci Numbers Whose Sum Is K](https://leetcode.com/problems/find-the-minimum-number-of-fibonacci-numbers-whose-sum-is-k/) | [无] | [C++](1001-1500/1414-Find-the-Minimum-Number-of-Fibonacci-Numbers-Whose-Sum-Is-K/cpp-1414/) | | |
| 1415 | [The k-th Lexicographical String of All Happy Strings of Length n](https://leetcode.com/problems/the-k-th-lexicographical-string-of-all-happy-strings-of-length-n/) | [无] | [C++](1001-1500/1415-The-k-th-Lexicographical-String-of-All-Happy-Strings-of-Length-n/cpp-1415/) | | |
| 1416 | [Restore The Array](https://leetcode.com/problems/restore-the-array/) | [无] | [C++](1001-1500/1416-Restore-The-Array/cpp-1416/) | | |
| 1417 | [Reformat The String](https://leetcode.com/problems/reformat-the-string/) | [无] | [C++](1001-1500/1417-Reformat-The-String/cpp-1417/) | | |
| 1418 | [Display Table of Food Orders in a Restaurant](https://leetcode.com/problems/display-table-of-food-orders-in-a-restaurant/) | [无] | [C++](1001-1500/1418-Display-Table-of-Food-Orders-in-a-Restaurant/cpp-1418/) | | |
| 1419 | [Minimum Number of Frogs Croaking](https://leetcode.com/problems/minimum-number-of-frogs-croaking/) | [无] | [C++](1001-1500/1419-Minimum-Number-of-Frogs-Croaking/cpp-1419/) | | |
| 1420 | [Build Array Where You Can Find The Maximum Exactly K Comparisons](https://leetcode.com/problems/build-array-where-you-can-find-the-maximum-exactly-k-comparisons/) | [无] | [C++](1001-1500/1420-Build-Array-Where-You-Can-Find-The-Maximum-Exactly-K-Comparisons/cpp-1420/) | | |
| 1421 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1422 | [Maximum Score After Splitting a String](https://leetcode.com/problems/maximum-score-after-splitting-a-string/) | [无] | [C++](1001-1500/1422-Maximum-Score-After-Splitting-a-String/cpp-1422/) | | |
| 1423 | [Maximum Points You Can Obtain from Cards](https://leetcode.com/problems/maximum-points-you-can-obtain-from-cards/) | [无] | [C++](1001-1500/1423-Maximum-Points-You-Can-Obtain-from-Cards/cpp-1423/) | | |
| 1424 | [Diagonal Traverse II](https://leetcode.com/problems/diagonal-traverse-ii/) | [无] | [C++](1001-1500/1424-Diagonal-Traverse-II/cpp-1424/) | | |
| 1425 | [Constrained Subset Sum](https://leetcode.com/problems/constrained-subset-sum/) | [无] | [C++](1001-1500/1425-Constrained-Subset-Sum/cpp-1425/) | | |
| 1426 | [Counting Elements](https://leetcode.com/problems/counting-elements/) | [solution](https://leetcode.com/problems/counting-elements/solution/) | [C++](1001-1500/1426-Counting-Elements/cpp-1426/) | | |
| 1427 | [Perform String Shifts](https://leetcode.com/problems/perform-string-shifts/) | [solution](https://leetcode.com/problems/perform-string-shifts/solution/) | [C++](1001-1500/1427-Perform-String-Shifts/cpp-1427/) | | |
| 1428 | [Leftmost Column with at Least a One](https://leetcode.com/problems/leftmost-column-with-at-least-a-one/) | [solution](https://leetcode.com/problems/leftmost-column-with-at-least-a-one/solution/) | [C++](1001-1500/1428-Leftmost-Column-with-at-Least-a-One/cpp-1428/) | | |
| 1429 | [First Unique Number](https://leetcode.com/problems/first-unique-number/) | [solution](https://leetcode.com/problems/first-unique-number/) | [C++](1001-1500/1429-First-Unique-Number/cpp-1429/) | | |
| 1430 | [Check If a String Is a Valid Sequence from Root to Leaves Path in a Binary Tree](https://leetcode.com/problems/check-if-a-string-is-a-valid-sequence-from-root-to-leaves-path-in-a-binary-tree/) | [无] | [C++](1001-1500/1430-Check-If-a-String-Is-a-Valid-Sequence-from-Root-to-Leaves-Path-in-a-Binary-Tree/cpp-1430/) | | |
| 1431 | [Kids With the Greatest Number of Candies](https://leetcode.com/problems/kids-with-the-greatest-number-of-candies/) | [无] | [C++](1001-1500/1431-Kids-With-the-Greatest-Number-of-Candies/cpp-1431/) | | |
| 1432 | [Max Difference You Can Get From Changing an Integer](https://leetcode.com/problems/max-difference-you-can-get-from-changing-an-integer/) | [无] | [C++](1001-1500/1432-Max-Difference-You-Can-Get-From-Changing-an-Integer/cpp-1432/) | | |
| 1433 | [Check If a String Can Break Another String](https://leetcode.com/problems/check-if-a-string-can-break-another-string/) | [无] | [C++](1001-1500/1433-Check-If-a-String-Can-Break-Another-String/cpp-1433/) | | |
| 1434 | [Number of Ways to Wear Different Hats to Each Other](https://leetcode.com/problems/number-of-ways-to-wear-different-hats-to-each-other/) | [无] | [C++](1001-1500/1434-Number-of-Ways-to-Wear-Different-Hats-to-Each-Other/cpp-1434/) | | |
| 1435 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1436 | [Destination City](https://leetcode.com/problems/destination-city/) | [无] | [C++](1001-1500/1436-Destination-City/cpp-1436/) | | |
| 1437 | [Check If All 1's Are at Least Length K Places Away](https://leetcode.com/problems/check-if-all-1s-are-at-least-length-k-places-away/) | [无] | [C++](1001-1500/1437-Check-If-All-1s-Are-at-Least-Length-K-Places-Away/cpp-1437/)| | |
| 1438 | [Longest Continuous Subarray With Absolute Diff Less Than or Equal to Limit](https://leetcode.com/problems/longest-continuous-subarray-with-absolute-diff-less-than-or-equal-to-limit/) | [无] | [C++](1001-1500/1438-Longest-Continuous-Subarray-With-Absolute-Diff-Less-Than-or-Equal-to-Limit/cpp-1438/) | | |
| 1439 | [Find the Kth Smallest Sum of a Matrix With Sorted Rows](https://leetcode.com/problems/find-the-kth-smallest-sum-of-a-matrix-with-sorted-rows/) | [无] | [C++](1001-1500/1439-Find-the-Kth-Smallest-Sum-of-a-Matrix-With-Sorted-Rows/cpp-1439/) | | |
| 1440 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1441 | [Build an Array With Stack Operations](https://leetcode.com/problems/build-an-array-with-stack-operations/) | [无] | [C++](1001-1500/1441-Build-an-Array-With-Stack-Operations/cpp-1441/) | | |
| 1442 | [Count Triplets That Can Form Two Arrays of Equal XOR](https://leetcode.com/problems/count-triplets-that-can-form-two-arrays-of-equal-xor/) | [无]
[缺:O(n)] | [C++](1001-1500/1442-Count-Triplets-That-Can-Form-Two-Arrays-of-Equal-XOR/cpp-1442/) | | |
| 1443 | [Minimum Time to Collect All Apples in a Tree](https://leetcode.com/problems/minimum-time-to-collect-all-apples-in-a-tree/) | [无] | [C++](1001-1500/1443-Minimum-Time-to-Collect-All-Apples-in-a-Tree/cpp-1443/) | | |
| 1444 | [Number of Ways of Cutting a Pizza](https://leetcode.com/problems/number-of-ways-of-cutting-a-pizza/) | [无] | [C++](1001-1500/1444-Number-of-Ways-of-Cutting-a-Pizza/cpp-1444/) | | |
| 1445 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1446 | [Consecutive Characters](https://leetcode.com/problems/consecutive-characters/) | [无] | [C++](1001-1500/1446-Consecutive-Characters/cpp-1446/) | | |
| 1447 | [Simplified Fractions](https://leetcode.com/problems/simplified-fractions/) | [无] | [C++](1001-1500/1447-Simplified-Fractions/cpp-1447/) | | |
| 1448 | [Count Good Nodes in Binary Tree](https://leetcode.com/problems/count-good-nodes-in-binary-tree/) | [无] | [C++](1001-1500/1448-Count-Good-Nodes-in-Binary-Tree/cpp-1448/) | | |
| 1449 | [Form Largest Integer With Digits That Add up to Target](https://leetcode.com/problems/form-largest-integer-with-digits-that-add-up-to-target/) | [无] | [C++](1001-1500/1449-Form-Largest-Integer-With-Digits-That-Add-up-to-Target/cpp-1449/) | | |
| 1450 | [Number of Students Doing Homework at a Given Time](https://leetcode.com/problems/number-of-students-doing-homework-at-a-given-time/) | [无] | [C++](1001-1500/1450-Number-of-Students-Doing-Homework-at-a-Given-Time/cpp-1450/) | | |
| 1451 | [Rearrange Words in a Sentence](https://leetcode.com/problems/rearrange-words-in-a-sentence/) | [无] | [C++](1001-1500/1451-Rearrange-Words-in-a-Sentence/cpp-1451/) | | |
| 1452 | [People Whose List of Favorite Companies Is Not a Subset of Another List](https://leetcode.com/problems/people-whose-list-of-favorite-companies-is-not-a-subset-of-another-list/) | [无] | [C++](1001-1500/1452-People-Whose-List-of-Favorite-Companies-Is-Not-a-Subset-of-Another-List/cpp-1452/) | | |
| 1453 | [Maximum Number of Darts Inside of a Circular Dartboard](https://leetcode.com/problems/maximum-number-of-darts-inside-of-a-circular-dartboard/) | [无]
[缺:[Angular Sweep](https://www.geeksforgeeks.org/angular-sweep-maximum-points-can-enclosed-circle-given-radius/)] | [C++](1001-1500/1453-Maximum-Number-of-Darts-Inside-of-a-Circular-Dartboard/cpp-1453/) | | |
| 1454 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1455 | [Check If a Word Occurs As a Prefix of Any Word in a Sentence](https://leetcode.com/problems/check-if-a-word-occurs-as-a-prefix-of-any-word-in-a-sentence/) | [无] | [C++](1001-1500/1455-Check-If-a-Word-Occurs-As-a-Prefix-of-Any-Word-in-a-Sentence/cpp-1455/) | | |
| 1456 | [Maximum Number of Vowels in a Substring of Given Length](https://leetcode.com/problems/maximum-number-of-vowels-in-a-substring-of-given-length/) | [无] | [C++](1001-1500/1456-Maximum-Number-of-Vowels-in-a-Substring-of-Given-Length/cpp-1456/) | | |
| 1457 | [Pseudo Palindromic Paths in a Binary Tree](https://leetcode.com/problems/pseudo-palindromic-paths-in-a-binary-tree/) | [无] | [C++](1001-1500/1457-Pseudo-Palindromic-Paths-in-a-Binary-Tree/) | | |
| 1458 | [Max Dot Product of Two Subsequences](https://leetcode.com/problems/max-dot-product-of-two-subsequences/) | [无] | [C++](1001-1500/1458-Max-Dot-Product-of-Two-Subsequences/cpp-1458/) | | |
| 1459 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1460 | [Make Two Arrays Equal by Reversing Sub-arrays](https://leetcode.com/problems/make-two-arrays-equal-by-reversing-sub-arrays/) | [无] | [C++](1001-1500/1460-Make-Two-Arrays-Equal-by-Reversing-Sub-arrays/cpp-1460/) | | |
| 1461 | [Check If a String Contains All Binary Codes of Size K](https://leetcode.com/problems/check-if-a-string-contains-all-binary-codes-of-size-k/) | [无] | [C++](1001-1500/1461-Check-If-a-String-Contains-All-Binary-Codes-of-Size-K/cpp-1461/) | | |
| 1462 | [Course Schedule IV](https://leetcode.com/problems/course-schedule-iv/) | [无] | [C++](1001-1500/1462-Course-Schedule-IV/cpp-1462/) | | |
| 1463 | [Cherry Pickup II](https://leetcode.com/problems/cherry-pickup-ii/) | [无] | [C++](1001-1500/1463-Cherry-Pickup-II/cpp-1463/) | | |
| 1464 | [Maximum Product of Two Elements in an Array](https://leetcode.com/problems/maximum-product-of-two-elements-in-an-array/) | [无] | [C++](1001-1500/1464-Maximum-Product-of-Two-Elements-in-an-Array/cpp-1464/) | | |
| 1465 | [Maximum Area of a Piece of Cake After Horizontal and Vertical Cuts](https://leetcode.com/problems/maximum-area-of-a-piece-of-cake-after-horizontal-and-vertical-cuts/) | [无] | [C++](1001-1500/1465-Maximum-Area-of-a-Piece-of-Cake-After-Horizontal-and-Vertical-Cuts/cpp-1465/) | | |
| 1466 | [Reorder Routes to Make All Paths Lead to the City Zero](https://leetcode.com/problems/reorder-routes-to-make-all-paths-lead-to-the-city-zero/) | [无] | [C++](1001-1500/1466-Reorder-Routes-to-Make-All-Paths-Lead-to-the-City-Zero/cpp-1466/) | | |
| 1467 | [Probability of a Two Boxes Having The Same Number of Distinct Balls](https://leetcode.com/problems/probability-of-a-two-boxes-having-the-same-number-of-distinct-balls/) | [无] | [C++](1001-1500/1467-Probability-of-a-Two-Boxes-Having-The-Same-Number-of-Distinct-Balls/cpp-1467/) | | |
| 1468 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1469 | [Find All the Lonely Nodes](https://leetcode.com/problems/find-all-the-lonely-nodes/) | [无] | [C++](1001-1500/1469-Find-All-the-Lonely-Nodes/cpp-1469/) | | |
| 1470 | [Shuffle the Array](https://leetcode.com/problems/shuffle-the-array/) | [无] | [C++](1001-1500/1470-Shuffle-the-Array/cpp-1470/) | | |
| 1471 | [The k Strongest Values in an Array](https://leetcode.com/problems/the-k-strongest-values-in-an-array/) | [无] | [C++](1001-1500/1471-The-k-Strongest-Values-in-an-Array/cpp-1471/) | | |
| 1472 | [Design Browser History](https://leetcode.com/problems/design-browser-history/) | [无] | [C++](1001-1500/1472-Design-Browser-History/cpp-1472/) | | |
| 1473 | [Paint House III](https://leetcode.com/problems/paint-house-iii/) | [无] | [C++](1001-1500/1473-Paint-House-III/cpp-1473/) | | |
| 1474 | [Delete N Nodes After M Nodes of a Linked List](https://leetcode.com/problems/delete-n-nodes-after-m-nodes-of-a-linked-list/) | [无] | [C++](1001-1500/1474-Delete-N-Nodes-After-M-Nodes-of-a-Linked-List/cpp-1474/) | | |
| 1475 | [Final Prices With a Special Discount in a Shop](https://leetcode.com/problems/final-prices-with-a-special-discount-in-a-shop/) | [无] | [C++](1001-1500/1475-Final-Prices-With-a-Special-Discount-in-a-Shop/cpp-1475/) | | |
| 1476 | [Subrectangle Queries](https://leetcode.com/problems/subrectangle-queries/) | [无] | [C++](1001-1500/1476-Subrectangle-Queries/cpp-1476/) | | |
| 1477 | [Find Two Non-overlapping Sub-arrays Each With Target Sum](https://leetcode.com/problems/find-two-non-overlapping-sub-arrays-each-with-target-sum/) | [无] | [C++](1001-1500/1477-Find-Two-Non-overlapping-Sub-arrays-Each-With-Target-Sum/cpp-1477/) | | |
| 1478 | [Allocate Mailboxes](https://leetcode.com/problems/allocate-mailboxes/) | [无] | [C++](1001-1500/1478-Allocate-Mailboxes/cpp-1478/) | | |
| 1479 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1480 | [Running Sum of 1d Array](https://leetcode.com/problems/running-sum-of-1d-array/) | [无] | [C++](1001-1500/1480-Running-Sum-of-1d-Array/cpp-1480/) | | |
| 1481 | [Least Number of Unique Integers after K Removals](https://leetcode.com/problems/least-number-of-unique-integers-after-k-removals/) | [无] | [C++](1001-1500/1481-Least-Number-of-Unique-Integers-after-K-Removals/cpp-1481/) | | |
| 1482 | [Minimum Number of Days to Make m Bouquets](https://leetcode.com/problems/minimum-number-of-days-to-make-m-bouquets/) | [无] | [C++](1001-1500/1482-Minimum-Number-of-Days-to-Make-m-Bouquets/cpp-1482/) | | |
| 1483 | [Kth Ancestor of a Tree Node](https://leetcode.com/problems/kth-ancestor-of-a-tree-node/) | [无] | [C++](1001-1500/1483-Kth-Ancestor-of-a-Tree-Node/cpp-1483/) | | |
| 1484 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1485 | [Clone Binary Tree With Random Pointer](https://leetcode.com/problems/clone-binary-tree-with-random-pointer/) | [无] | [C++](1001-1500/1485-Clone-Binary-Tree-With-Random-Pointer/cpp-1485/) | | |
| 1486 | [XOR Operation in an Array](https://leetcode.com/problems/xor-operation-in-an-array/) | [无] | [C++](1001-1500/1486-XOR-Operation-in-an-Array/cpp-1486/) | | |
| 1487 | [Making File Names Unique](https://leetcode.com/problems/making-file-names-unique/) | [无] | [C++](1001-1500/1487-Making-File-Names-Unique/cpp-1487/) | | |
| 1488 | [Avoid Flood in The City](https://leetcode.com/problems/avoid-flood-in-the-city/) | [无] | [C++](1001-1500/1488-Avoid-Flood-in-The-City/cpp-1488/) | | |
| 1489 | [Find Critical and Pseudo-Critical Edges in Minimum Spanning Tree](https://leetcode.com/problems/find-critical-and-pseudo-critical-edges-in-minimum-spanning-tree/) | [无]
[缺:O(ElogE) 的解] | [C++](1001-1500/1489-Find-Critical-and-Pseudo-Critical-Edges-in-Minimum-Spanning-Tree/cpp-1489/) | | |
| 1490 | [Clone N-ary Tree](https://leetcode.com/problems/clone-n-ary-tree/) | [无] | [C++](1001-1500/1490-Clone-N-ary-Tree/cpp-1490/) | | |
| 1491 | [Average Salary Excluding the Minimum and Maximum Salary](https://leetcode.com/problems/average-salary-excluding-the-minimum-and-maximum-salary/) | [无] | [C++](1001-1500/1491-Average-Salary-Excluding-the-Minimum-and-Maximum-Salary/cpp-1491/) | | |
| 1492 | [The kth Factor of n](https://leetcode.com/problems/the-kth-factor-of-n/) | [无] | [C++](1001-1500/1492-The-kth-Factor-of-n/cpp-1492/) | | |
| 1493 | [Longest Subarray of 1's After Deleting One Element](https://leetcode.com/problems/longest-subarray-of-1s-after-deleting-one-element/) | [无] | [C++](1001-1500/1493-Longest-Subarray-of-1's-After-Deleting-One-Element/cpp-1493/) | | |
| 1494 | [Parallel Courses II](https://leetcode.com/problems/parallel-courses-ii/) | [无] | [C++](1001-1500/1494-Parallel-Courses-II/cpp-1494/) | | |
| 1495 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1496 | [Path Crossing](https://leetcode.com/problems/path-crossing/) | [无] | [C++](1001-1500/1496-Path-Crossing/cpp-1496/) | | |
| 1497 | [Check If Array Pairs Are Divisible by k](https://leetcode.com/problems/check-if-array-pairs-are-divisible-by-k/) | [无] | [C++](1001-1500/1497-Check-If-Array-Pairs-Are-Divisible-by-k/cpp-1497/) | | |
| 1498 | [Number of Subsequences That Satisfy the Given Sum Condition](https://leetcode.com/problems/number-of-subsequences-that-satisfy-the-given-sum-condition/) | [无] | [C++](1001-1500/1498-Number-of-Subsequences-That-Satisfy-the-Given-Sum-Condition/cpp-1498/) | | |
| 1499 | [Max Value of Equation](https://leetcode.com/problems/max-value-of-equation/) | [无] | [C++](1001-1500/1499-Max-Value-of-Equation/cpp-1499/) | | |
| | | | | | |
| 1506 | [Find Root of N-Ary Tree](https://leetcode.com/problems/find-root-of-n-ary-tree/) | [solution](https://leetcode.com/problems/find-root-of-n-ary-tree/solution/) | [C++](1501-2000/1506-Find-Root-of-N-Ary-Tree/cpp-1506/) | | |
| | | | | | |
| 1519 | [Number of Nodes in the Sub-Tree With the Same Label](https://leetcode.com/problems/number-of-nodes-in-the-sub-tree-with-the-same-label/description/) | [solution](https://leetcode.com/problems/number-of-nodes-in-the-sub-tree-with-the-same-label/solutions/2864718/number-of-nodes-in-the-sub-tree-with-the-same-label/?orderBy=most_votes) | [C++](1501-2000/1519-Number-of-Nodes-in-the-Sub-Tree-With-the-Same-Label/cpp-1519/) | | |
| | | | | | |
| 1522 | [Diameter of N-Ary Tree](https://leetcode.com/problems/diameter-of-n-ary-tree/) | [无] | [C++](1501-2000/1522-Diameter-of-N-Ary-Tree/cpp-1522/) | | |
| 1523 | [Count Odd Numbers in an Interval Range](https://leetcode.com/problems/count-odd-numbers-in-an-interval-range/description/) | [无] | [C++](1501-2000/1523-Count-Odd-Numbers-in-an-Interval-Range/cpp-1523/) | | |
| | | | | | |
| 1527 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 1531 | [String Compression II](https://leetcode.com/problems/string-compression-ii/) | [无][缺:其他解法] | [C++](1501-2000/1531-String-Compression-II/cpp-1531/) | | |
| | | | | | |
| 1533 | [Find the Index of the Large Integer](https://leetcode.com/problems/find-the-index-of-the-large-integer/) | [solution](https://leetcode.com/problems/find-the-index-of-the-large-integer/solutions/2885830/find-the-index-of-the-large-integer/?orderBy=most_votes) | [C++](1501-2000/1533-Find-the-Index-of-the-Large-Integer/cpp-1533/) | | |
| | | | | | |
| 1539 | [Kth Missing Positive Number](https://leetcode.com/problems/kth-missing-positive-number/) | [solution](https://leetcode.com/problems/kth-missing-positive-number/solution/) | [C++](1501-2000/1539-Kth-Missing-Positive-Number/cpp-1539/) | | |
| | | | | | |
| 1557 | [Minimum Number of Vertices to Reach All Nodes](https://leetcode.com/problems/minimum-number-of-vertices-to-reach-all-nodes/description/) | [无] | [C++](1501-2000/1557-Minimum-Number-of-Vertices-to-Reach-All-Nodes/cpp-1557/) | | |
| | | | | | |
| 1559 | [Detect Cycles in 2D Grid](https://leetcode.com/problems/detect-cycles-in-2d-grid/) | [无] | [C++](1501-2000/1559-Detect-Cycles-in-2D-Grid/cpp-1559/) | | |
| | | | | | |
| 1564 | [Put Boxes Into the Warehouse I](https://leetcode.com/problems/put-boxes-into-the-warehouse-i/) | [无] | [C++](1501-2000/1564-Put-Boxes-Into-the-Warehouse-I/cpp-1564/) | | |
| | | | | | |
| 1570 | [Dot Product of Two Sparse Vectors](https://leetcode.com/problems/dot-product-of-two-sparse-vectors/) | [solution](https://leetcode.com/problems/dot-product-of-two-sparse-vectors/) | [C++](1501-2000/1570-Dot-Product-of-Two-Sparse-Vectors/cpp-1570/) | | |
| 1571 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1572 | [Matrix Diagonal Sum](https://leetcode.com/problems/matrix-diagonal-sum/) | [无] | [C++](1501-2000/1572-Matrix-Diagonal-Sum/cpp-1572/) | | |
| | | | | | |
| 1574 | [Shortest Subarray to be Removed to Make Array Sorted](https://leetcode.com/problems/shortest-subarray-to-be-removed-to-make-array-sorted/description/) | [无] | [C++](1501-2000/1574-Shortest-Subarray-to-be-Removed-to-Make-Array-Sorted/cpp-1574/) | | |
| 1575 | [Count All Possible Routes](https://leetcode.com/problems/count-all-possible-routes/description/) | [无] | [C++](1501-2000/1575-Count-All-Possible-Routes/cpp-1575/) | | |
| 1576 | [Replace All ?'s to Avoid Consecutive Repeating Characters](https://leetcode.com/problems/replace-all-s-to-avoid-consecutive-repeating-characters/) | [无] | [C++](1501-2000/1576-Replace-All-Question-Marks-to-Avoid-Consecutive-Repeating-Characters/cpp-1576/) | | |
| 1577 | [Number of Ways Where Square of Number Is Equal to Product of Two Numbers](https://leetcode.com/problems/number-of-ways-where-square-of-number-is-equal-to-product-of-two-numbers/) | [无] | [C++](1501-2000/1577-Number-of-Ways-Where-Square-of-Number-Is-Equal-to-Product-of-Two-Numbers/cpp-1577/) | | |
| 1578 | [Minimum Deletion Cost to Avoid Repeating Letters](https://leetcode.com/problems/minimum-deletion-cost-to-avoid-repeating-letters/) | [无] | [C++](1501-2000/1578-Minimum-Deletion-Cost-to-Avoid-Repeating-Letters/cpp-1578/) | | |
| 1579 | [Remove Max Number of Edges to Keep Graph Fully Traversable](https://leetcode.com/problems/remove-max-number-of-edges-to-keep-graph-fully-traversable/) | [无] | [C++](1501-2000/1579-Remove-Max-Number-of-Edges-to-Keep-Graph-Fully-Traversable/cpp-1579/) | | |
| 1580 | [Put Boxes Into the Warehouse II](https://leetcode.com/problems/put-boxes-into-the-warehouse-ii/) | [无] | [C++](1501-2000/1580-Put-Boxes-Into-the-Warehouse-II/cpp-1580/) | | |
| 1581 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1582 | [Special Positions in a Binary Matrix](https://leetcode.com/problems/special-positions-in-a-binary-matrix/) | [无] | [C++](1501-2000/1582-Special-Positions-in-a-Binary-Matrix/cpp-1582/) | | |
| 1583 | [Count Unhappy Friends](https://leetcode.com/problems/count-unhappy-friends/) | [无] | [C++](1501-2000/1583-Count-Unhappy-Friends/cpp-1583/) | | |
| 1584 | [Min Cost to Connect All Points](https://leetcode.com/problems/min-cost-to-connect-all-points/) | [无]
[缺:prim 和 ] | [C++](1501-2000/1584-Min-Cost-to-Connect-All-Points/cpp-1584/) | | |
| 1585 | [Check If String Is Transformable With Substring Sort Operations](https://leetcode.com/problems/check-if-string-is-transformable-with-substring-sort-operations/) | [无] | [C++](1501-2000/1585-Check-If-String-Is-Transformable-With-Substring-Sort-Operations/cpp-1585/) | | |
| 1586 | [Binary Search Tree Iterator II](https://leetcode.com/problems/binary-search-tree-iterator-ii/) | [无]
[缺:用栈模拟] | [C++](1501-2000/1586-Binary-Search-Tree-Iterator-II/cpp-1586/) | | |
| 1587 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1588 | [Sum of All Odd Length Subarrays](https://leetcode.com/problems/sum-of-all-odd-length-subarrays/) | [无] | [C++](1501-2000/1588-Sum-of-All-Odd-Length-Subarrays/cpp-1588/) | | |
| 1589 | [Maximum Sum Obtained of Any Permutation](https://leetcode.com/problems/maximum-sum-obtained-of-any-permutation/) | [无] | [C++](1501-2000/1589-Maximum-Sum-Obtained-of-Any-Permutation/cpp-1589/) | | |
| 1590 | [Make Sum Divisible by P](https://leetcode.com/problems/make-sum-divisible-by-p/) | [无] | [C++](1501-2000/1590-Make-Sum-Divisible-by-P/cpp-1590/) | | |
| 1591 | [Strange Printer II](https://leetcode.com/problems/strange-printer-ii/) | [无] | [C++](1501-2000/1591-Strange-Printer-II/cpp-1591/) | | |
| 1592 | [Rearrange Spaces Between Words](https://leetcode.com/problems/rearrange-spaces-between-words/) | [无] | [C++](1501-2000/1592-Rearrange-Spaces-Between-Words/cpp-1592/) | | |
| 1593 | [Split a String Into the Max Number of Unique Substrings](https://leetcode.com/problems/split-a-string-into-the-max-number-of-unique-substrings/) | [无] | [C++](1501-2000/1593-Split-a-String-Into-the-Max-Number-of-Unique-Substrings/cpp-1593/) | | |
| 1594 | [Maximum Non Negative Product in a Matrix](https://leetcode.com/problems/maximum-non-negative-product-in-a-matrix/) | [无] | [C++](1501-2000/1594-Maximum-Non-Negative-Product-in-a-Matrix/cpp-1594/) | | |
| 1595 | [Minimum Cost to Connect Two Groups of Points](https://leetcode.com/problems/minimum-cost-to-connect-two-groups-of-points/) | [无] | [C++](1501-2000/1595-Minimum-Cost-to-Connect-Two-Groups-of-Points/cpp-1595/) | | |
| 1596 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1597 | [Build Binary Expression Tree From Infix Expression](https://leetcode.com/problems/build-binary-expression-tree-from-infix-expression/) | [无] | [C++](1501-2000/1597-Build-Binary-Expression-Tree-From-Infix-Expression/cpp-1597/) | | |
| 1598 | [Crawler Log Folder](https://leetcode.com/problems/crawler-log-folder/) | [无] | [C++](1501-2000/1598-Crawler-Log-Folder/cpp-1598/) | | |
| 1599 | [Maximum Profit of Operating a Centennial Wheel](https://leetcode.com/problems/maximum-profit-of-operating-a-centennial-wheel/) | [无] | [C++](1501-2000/1599-Maximum-Profit-of-Operating-a-Centennial-Wheel/cpp-1599/) | | |
| 1600 | [Throne Inheritance](https://leetcode.com/problems/throne-inheritance/) | [无] | [C++](1501-2000/1600-Throne-Inheritance/cpp-1600/) | | |
| 1601 | [Maximum Number of Achievable Transfer Requests](https://leetcode.com/problems/maximum-number-of-achievable-transfer-requests/) | [无]
[缺:网络流解法] | [C++](1501-2000/1601-Maximum-Number-of-Achievable-Transfer-Requests/cpp-1601/) | | |
| 1602 | [Find Nearest Right Node in Binary Tree](https://leetcode.com/problems/find-nearest-right-node-in-binary-tree/) | [solution](https://leetcode.com/problems/find-nearest-right-node-in-binary-tree/solution/) | [C++](1501-2000/1602-Find-Nearest-Right-Node-in-Binary-Tree/cpp-1602/) | | |
| 1603 | [Design Parking System](https://leetcode.com/problems/design-parking-system/) | [无] | [C++](1501-2000/1603-Design-Parking-System/cpp-1603/) | | |
| 1604 | [Alert Using Same Key-Card Three or More Times in a One Hour Period](https://leetcode.com/problems/alert-using-same-key-card-three-or-more-times-in-a-one-hour-period/) | [无] | [C++](1501-2000/1604-Alert-Using-Same-Key-Card-Three-or-More-Times-in-a-One-Hour-Period/cpp-1604/) | | |
| 1605 | [Find Valid Matrix Given Row and Column Sums](https://leetcode.com/problems/find-valid-matrix-given-row-and-column-sums/) | [无] | [C++](1501-2000/1605-Find-Valid-Matrix-Given-Row-and-Column-Sums/cpp-1605/) | | |
| 1606 | [Find Servers That Handled Most Number of Requests](https://leetcode.com/problems/find-servers-that-handled-most-number-of-requests/) | [无] | [C++](1501-2000/1606-Find-Servers-That-Handled-Most-Number-of-Requests/cpp-1606/) | | |
| 1607 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1608 | [Special Array With X Elements Greater Than or Equal X](https://leetcode.com/problems/special-array-with-x-elements-greater-than-or-equal-x/) | [无] | [C++](1501-2000/1608-Special-Array-With-X-Elements-Greater-Than-or-Equal-X/cpp-1608/) | | |
| 1609 | [Even Odd Tree](https://leetcode.com/problems/even-odd-tree/) | [无] | [C++](1501-2000/1609-Even-Odd-Tree/cpp-1609/) | | |
| 1610 | [Maximum Number of Visible Points](https://leetcode.com/problems/maximum-number-of-visible-points/) | [无] | [C++](1501-2000/1610-Maximum-Number-of-Visible-Points/cpp-1610/) | | |
| 1611 | [Minimum One Bit Operations to Make Integers Zero](https://leetcode.com/problems/minimum-one-bit-operations-to-make-integers-zero/) | [无] | [C++](1501-2000/1611-Minimum-One-Bit-Operations-to-Make-Integers-Zero/cpp-1611/) | | |
| 1612 | [Check If Two Expression Trees are Equivalent](https://leetcode.com/problems/check-if-two-expression-trees-are-equivalent/) | [无] | [C++](1501-2000/1612-Check-If-Two-Expression-Trees-are-Equivalent/cpp-1612/) | | |
| 1613 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1614 | [Maximum Nesting Depth of the Parentheses](https://leetcode.com/problems/maximum-nesting-depth-of-the-parentheses/) | [无] | [C++](1501-2000/1614-Maximum-Nesting-Depth-of-the-Parentheses/cpp-1614/) | | |
| 1615 | [Maximal Network Rank](https://leetcode.com/problems/maximal-network-rank/) | [无] | [C++](1501-2000/1615-Maximal-Network-Rank/cpp-1615/) | | |
| 1616 | [Split Two Strings to Make Palindrome](https://leetcode.com/problems/split-two-strings-to-make-palindrome/) | [无] | [C++](1501-2000/1616-Split-Two-Strings-to-Make-Palindrome/cpp-1616/) | | |
| 1617 | [Count Subtrees With Max Distance Between Cities](https://leetcode.com/problems/count-subtrees-with-max-distance-between-cities/) | [无] | [C++](1501-2000/1617-Count-Subtrees-With-Max-Distance-Between-Cities/cpp-1617/) | | |
| 1618 | [Maximum Font to Fit a Sentence in a Screen](https://leetcode.com/problems/maximum-font-to-fit-a-sentence-in-a-screen/) | [无] | [C++](1501-2000/1618-Maximum-Font-to-Fit-a-Sentence-in-a-Screen/cpp-1618/) | | |
| 1619 | [Mean of Array After Removing Some Elements](https://leetcode.com/problems/mean-of-array-after-removing-some-elements/) | [无] | [C++](1501-2000/1619-Mean-of-Array-After-Removing-Some-Elements/cpp-1619/) | | |
| 1620 | [Coordinate With Maximum Network Quality](https://leetcode.com/problems/coordinate-with-maximum-network-quality/) | [无] | [C++](1501-2000/1620-Coordinate-With-Maximum-Network-Quality/cpp-1620/) | | |
| 1621 | [Number of Sets of K Non-Overlapping Line Segments](https://leetcode.com/problems/number-of-sets-of-k-non-overlapping-line-segments/) | [无] | [C++](1501-2000/1621-Number-of-Sets-of-K-Non-Overlapping-Line-Segments/cpp-1621/) | | |
| 1622 | [Fancy Sequence](https://leetcode.com/problems/fancy-sequence/) | [无] | [C++](1501-2000/1622-Fancy-Sequence/cpp-1622/) | | |
| 1623 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1624 | [Largest Substring Between Two Equal Characters](https://leetcode.com/problems/largest-substring-between-two-equal-characters/) | [无] | [C++](1501-2000/1624-Largest-Substring-Between-Two-Equal-Characters/cpp-1624/) | | |
| 1625 | [Lexicographically Smallest String After Applying Operations](https://leetcode.com/problems/lexicographically-smallest-string-after-applying-operations/) | [无] | [C++](1501-2000/1625-Lexicographically-Smallest-String-After-Applying-Operations/cpp-1625/) | | |
| 1626 | [Best Team With No Conflicts](https://leetcode.com/problems/best-team-with-no-conflicts/) | [无]
[缺:nlogn 算法] | [C++](1501-2000/1626-Best-Team-With-No-Conflicts/cpp-1626/) | | |
| 1627 | [Graph Connectivity With Threshold](https://leetcode.com/problems/graph-connectivity-with-threshold/) | [无] | [C++](1501-2000/1627-Graph-Connectivity-With-Threshold/cpp-1627/) | | |
| 1628 | [Design an Expression Tree With Evaluate Function](https://leetcode.com/problems/design-an-expression-tree-with-evaluate-function/) | [无] | [C++](1501-2000/1628-Design-an-Expression-Tree-With-Evaluate-Function/cpp-1628/) | | |
| 1629 | [Slowest Key](https://leetcode.com/problems/slowest-key/) | [无] | [C++](1501-2000/1629-Slowest-Key/cpp-1629/) | |
| 1630 | [Arithmetic Subarrays](https://leetcode.com/problems/arithmetic-subarrays/) | [无] | [C++](1501-2000/1630-Arithmetic-Subarrays/cpp-1630/) | | |
| 1631 | [Path With Minimum Effort](https://leetcode.com/problems/path-with-minimum-effort/) | [solution](https://leetcode.com/problems/path-with-minimum-effort/solution/) | [C++](1501-2000/1631-Path-With-Minimum-Effort/cpp-1631/) | | |
| 1632 | [Rank Transform of a Matrix](https://leetcode.com/problems/rank-transform-of-a-matrix/) | [solution](https://leetcode.com/problems/rank-transform-of-a-matrix/solution/) | [C++](1501-2000/1632-Rank-Transform-of-a-Matrix/cpp-1632/) | | |
| 1633 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1634 | [Add Two Polynomials Represented as Linked Lists](https://leetcode.com/problems/add-two-polynomials-represented-as-linked-lists/) | [无] | [C++](1501-2000/1634-Add-Two-Polynomials-Represented-as-Linked-Lists/cpp-1634/) | | |
| 1635 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1636 | [Sort Array by Increasing Frequency](https://leetcode.com/problems/sort-array-by-increasing-frequency/) | [无] | [C++](1501-2000/1636-Sort-Array-by-Increasing-Frequency/cpp-1636/) | | |
| 1637 | [Widest Vertical Area Between Two Points Containing No Points](https://leetcode.com/problems/widest-vertical-area-between-two-points-containing-no-points/) | [无] | [C++](1501-2000/1637-Widest-Vertical-Area-Between-Two-Points-Containing-No-Points/cpp-1637/) | | |
| 1638 | [Count Substrings That Differ by One Character](https://leetcode.com/problems/count-substrings-that-differ-by-one-character/) | [无] | [C++](1501-2000/1638-Count-Substrings-That-Differ-by-One-Character/cpp-1638/) | | |
| 1639 | [Number of Ways to Form a Target String Given a Dictionary](https://leetcode.com/problems/number-of-ways-to-form-a-target-string-given-a-dictionary/) | [无] | [C++](1501-2000/1639-Number-of-Ways-to-Form-a-Target-String-Given-a-Dictionary/cpp-1639/) | | |
| 1640 | [Check Array Formation Through Concatenation](https://leetcode.com/problems/check-array-formation-through-concatenation/) | [solution](https://leetcode.com/problems/check-array-formation-through-concatenation/solution/) | [C++](1501-2000/1640-Check-Array-Formation-Through-Concatenation/cpp-1640/) | | |
| 1641 | [Count Sorted Vowel Strings](https://leetcode.com/problems/count-sorted-vowel-strings/) | [solution](https://leetcode.com/problems/count-sorted-vowel-strings/solution/) | [C++](1501-2000/1641-Count-Sorted-Vowel-Strings/cpp-1641/) | | |
| 1642 | [Furthest Building You Can Reach](https://leetcode.com/problems/furthest-building-you-can-reach/) | [无] | [C++](1501-2000/1642-Furthest-Building-You-Can-Reach/cpp-1642/) | | |
| 1643 | [Kth Smallest Instructions](https://leetcode.com/problems/kth-smallest-instructions/) | [无] | [C++](1501-2000/1643-Kth-Smallest-Instructions/cpp-1643/) | | |
| 1644 | [Lowest Common Ancestor of a Binary Tree II](https://leetcode.com/problems/lowest-common-ancestor-of-a-binary-tree-ii/) | [无] | [C++](1501-2000/1644-Lowest-Common-Ancestor-of-a-Binary-Tree-II/cpp-1644/) | | |
| 1645 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1646 | [Get Maximum in Generated Array](https://leetcode.com/problems/get-maximum-in-generated-array/) | [solution](https://leetcode.com/problems/get-maximum-in-generated-array/) | [C++](1501-2000/1646-Get-Maximum-in-Generated-Array/cpp-1646/) | | |
| 1647 | [Minimum Deletions to Make Character Frequencies Unique](https://leetcode.com/problems/minimum-deletions-to-make-character-frequencies-unique/) | [无] | [C++](1501-2000/1647-Minimum-Deletions-to-Make-Character-Frequencies-Unique/cpp-1647/) | | |
| 1648 | [Sell Diminishing-Valued Colored Balls](https://leetcode.com/problems/sell-diminishing-valued-colored-balls/) | [无] | [C++](1501-2000/1648-Sell-Diminishing-Valued-Colored-Balls/cpp-1648/) | | |
| 1649 | [Create Sorted Array through Instructions](https://leetcode.com/problems/create-sorted-array-through-instructions/) | [solution](https://leetcode.com/problems/create-sorted-array-through-instructions/solution/)
[缺:树状数组;归并] | [C++](1501-2000/1649-Create-Sorted-Array-through-Instructions/cpp-1649/) | | |
| 1650 | [Lowest Common Ancestor of a Binary Tree III](https://leetcode.com/problems/lowest-common-ancestor-of-a-binary-tree-iii/) | [无] | [C++](1501-2000/1650-Lowest-Common-Ancestor-of-a-Binary-Tree-III/cpp-1650/) | | |
| 1651 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1652 | [Defuse the Bomb](https://leetcode.com/problems/defuse-the-bomb/) | [无] | [C++](1501-2000/1652-Defuse-the-Bomb/cpp-1652/) | | |
| 1653 | [Minimum Deletions to Make String Balanced](https://leetcode.com/problems/minimum-deletions-to-make-string-balanced/) | [无] | [C++](1501-2000/1653-Minimum-Deletions-to-Make-String-Balanced/cpp-1653/) | | |
| 1654 | [Minimum Jumps to Reach Home](https://leetcode.com/problems/minimum-jumps-to-reach-home/) | [无] | [C++](1501-2000/1654-Minimum-Jumps-to-Reach-Home/cpp-1654/) | | |
| 1655 | [Distribute Repeating Integers](https://leetcode.com/problems/distribute-repeating-integers/) | [无] | [C++](1501-2000/1655-Distribute-Repeating-Integers/cpp-1655/) | | |
| 1656 | [Design an Ordered Stream](https://leetcode.com/problems/design-an-ordered-stream/) | [无] | [C++](1501-2000/1656-Design-an-Ordered-Stream/cpp-1656/) | | |
| 1657 | [Determine if Two Strings Are Close](https://leetcode.com/problems/determine-if-two-strings-are-close/) | [solution](https://leetcode.com/problems/determine-if-two-strings-are-close/solution/) | [C++](1501-2000/1657-Determine-if-Two-Strings-Are-Close/cpp-1657/) | | |
| 1658 | [Minimum Operations to Reduce X to Zero](https://leetcode.com/problems/minimum-operations-to-reduce-x-to-zero/) | [solution](https://leetcode.com/problems/minimum-operations-to-reduce-x-to-zero/solution/) | [C++](1501-2000/1658-Minimum-Operations-to-Reduce-X-to-Zero/cpp-1658/) | | |
| 1659 | [Maximize Grid Happiness](https://leetcode.com/problems/maximize-grid-happiness/) | [无] | [C++](1501-2000/1659-Maximize-Grid-Happiness/cpp-1659/) | [Java](1501-2000/1659-Maximize-Grid-Happiness/java-1659/) | |
| 1660 | [Correct a Binary Tree](https://leetcode.com/problems/correct-a-binary-tree/) | [无] | [C++](1501-2000/1660-Correct-a-Binary-Tree/cpp-1660/) | | |
| 1661 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1662 | [Check If Two String Arrays are Equivalent](https://leetcode.com/problems/check-if-two-string-arrays-are-equivalent/) | [solution](https://leetcode.com/problems/check-if-two-string-arrays-are-equivalent/) | [C++](1501-2000/1662-Check-If-Two-String-Arrays-are-Equivalent/cpp-1662/) | | |
| 1663 | [Smallest String With A Given Numeric Value](https://leetcode.com/problems/smallest-string-with-a-given-numeric-value/) | [solution](https://leetcode.com/problems/smallest-string-with-a-given-numeric-value/solution/) | [C++](1501-2000/1663-Smallest-String-With-A-Given-Numeric-Value/cpp-1663/) | | |
| 1664 | [Ways to Make a Fair Array](https://leetcode.com/problems/ways-to-make-a-fair-array/) | [无] | [C++](1501-2000/1664-Ways-to-Make-a-Fair-Array/cpp-1664/) | | |
| 1665 | [Minimum Initial Energy to Finish Tasks](https://leetcode.com/problems/minimum-initial-energy-to-finish-tasks/) | [无] | [C++](1501-2000/1665-Minimum-Initial-Energy-to-Finish-Tasks/cpp-1665/) | | |
| 1666 | [Change the Root of a Binary Tree](https://leetcode.com/problems/change-the-root-of-a-binary-tree/) | [无] | [C++](1501-2000/1666-Change-the-Root-of-a-Binary-Tree/cpp-1666/) | | |
| 1667 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1668 | [Maximum Repeating Substring](https://leetcode.com/problems/maximum-repeating-substring/) | [无] | [C++](1501-2000/1668-Maximum-Repeating-Substring/cpp-1668/) | | |
| 1669 | [Merge In Between Linked Lists](https://leetcode.com/problems/merge-in-between-linked-lists/) | [无] | [C++](1501-2000/1669-Merge-In-Between-Linked-Lists/cpp-1669/) | | |
| 1670 | [Design Front Middle Back Queue](https://leetcode.com/problems/design-front-middle-back-queue/) | [无] | [C++](1501-2000/1670-Design-Front-Middle-Back-Queue/cpp-1670/) | | |
| 1671 | [Minimum Number of Removals to Make Mountain Array](https://leetcode.com/problems/minimum-number-of-removals-to-make-mountain-array/) | [无] | [C++](1501-2000/1671-Minimum-Number-of-Removals-to-Make-Mountain-Array/cpp-1671/) | | |
| 1672 | [Richest Customer Wealth](https://leetcode.com/problems/richest-customer-wealth/) | [无] | [C++](1501-2000/1672-Richest-Customer-Wealth/cpp-1672/) | | |
| 1673 | [Find the Most Competitive Subsequence](https://leetcode.com/problems/find-the-most-competitive-subsequence/) | [solution](https://leetcode.com/problems/find-the-most-competitive-subsequence/solution/) | [C++](1501-2000/1673-Find-the-Most-Competitive-Subsequence/cpp-1673/) | | |
| 1674 | [Minimum Moves to Make Array Complementary](https://leetcode.com/problems/minimum-moves-to-make-array-complementary/) | [无] | [C++](1501-2000/1674-Minimum-Moves-to-Make-Array-Complementary/cpp-1674/) | | |
| 1675 | [Minimize Deviation in Array](https://leetcode.com/problems/minimize-deviation-in-array/) | [solution](https://leetcode.com/problems/minimize-deviation-in-array/) | [C++](1501-2000/1675-Minimize-Deviation-in-Array/cpp-1675/) | | |
| 1676 | [Lowest Common Ancestor of a Binary Tree IV](https://leetcode.com/problems/lowest-common-ancestor-of-a-binary-tree-iv/) | [无] | [C++](1501-2000/1676-Lowest-Common-Ancestor-of-a-Binary-Tree-IV/cpp-1676/) | | |
| 1677 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1678 | [Goal Parser Interpretation](https://leetcode.com/problems/goal-parser-interpretation/) | [无] | [C++](1501-2000/1678-Goal-Parser-Interpretation/cpp-1678/) | | |
| 1679 | [Max Number of K-Sum Pairs](https://leetcode.com/problems/max-number-of-k-sum-pairs/) | [solution](https://leetcode.com/problems/max-number-of-k-sum-pairs/solution/) | [C++](1501-2000/1679-Max-Number-of-K-Sum-Pairs/cpp-1679/) | | |
| 1680 | [Concatenation of Consecutive Binary Numbers](https://leetcode.com/problems/concatenation-of-consecutive-binary-numbers/) | [solution](https://leetcode.com/problems/concatenation-of-consecutive-binary-numbers/solution/) | [C++](1501-2000/1680-Concatenation-of-Consecutive-Binary-Numbers/cpp-1680/) | | |
| 1681 | [Minimum Incompatibility](https://leetcode.com/problems/minimum-incompatibility/) | [无] | [C++](1501-2000/1681-Minimum-Incompatibility/cpp-1681/) | | |
| 1682 | [Longest Palindromic Subsequence II](https://leetcode.com/problems/longest-palindromic-subsequence-ii/) | [无] | [C++](1501-2000/1682-Longest-Palindromic-Subsequence-II/cpp-1682/) | | |
| 1683 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1684 | [Count the Number of Consistent Strings](https://leetcode.com/problems/count-the-number-of-consistent-strings/) | [无] | [C++](1501-2000/1684-Count-the-Number-of-Consistent-Strings/cpp-1684/) | | |
| 1685 | [Sum of Absolute Differences in a Sorted Array](https://leetcode.com/problems/sum-of-absolute-differences-in-a-sorted-array/) | [无] | [C++](1501-2000/1685-Sum-of-Absolute-Differences-in-a-Sorted-Array/cpp-1685/) | | |
| 1686 | [Stone Game VI](https://leetcode.com/problems/stone-game-vi/) | [无] | [C++](1501-2000/1686-Stone-Game-VI/cpp-1686/) | | |
| 1687 | [Delivering Boxes from Storage to Ports](https://leetcode.com/problems/delivering-boxes-from-storage-to-ports/) | [无]
[缺:dp + 优化] | [C++](1501-2000/1687-Delivering-Boxes-from-Storage-to-Ports/cpp-1687/) | | |
| 1688 | [Count of Matches in Tournament](https://leetcode.com/problems/count-of-matches-in-tournament/) | [C++](1501-2000/1688-Count-of-Matches-in-Tournament/cpp-1688/) | | | |
| 1689 | [Partitioning Into Minimum Number Of Deci-Binary Numbers](https://leetcode.com/problems/partitioning-into-minimum-number-of-deci-binary-numbers/) | [solution](https://leetcode.com/problems/partitioning-into-minimum-number-of-deci-binary-numbers/solution/) | [C++](1501-2000/1689-Partitioning-Into-Minimum-Number-Of-Deci-Binary-Numbers/cpp-1689/) | | |
| 1690 | [Stone Game VII](https://leetcode.com/problems/stone-game-vii/) | [solution](https://leetcode.com/problems/stone-game-vii/solution/)
[缺:记忆化搜索;DP 空间优化] | [C++](1501-2000/1690-Stone-Game-VII/cpp-1690/) | | |
| 1691 | [Maximum Height by Stacking Cuboids](https://leetcode.com/problems/maximum-height-by-stacking-cuboids/) | [无] | [C++](1501-2000/1691-Maximum-Height-by-Stacking-Cuboids/cpp-1691/) | | |
| 1692 | [Count Ways to Distribute Candies](https://leetcode.com/problems/count-ways-to-distribute-candies/) | [无] | [C++](1501-2000/1692-Count-Ways-to-Distribute-Candies/cpp-1692/) | | |
| 1693 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1694 | [Reformat Phone Number](https://leetcode.com/problems/reformat-phone-number/) | [无] | [C++](1501-2000/1694-Reformat-Phone-Number/cpp-1694/) | | |
| 1695 | [Maximum Erasure Value](https://leetcode.com/problems/maximum-erasure-value/) | [无] | [C++](1501-2000/1695-Maximum-Erasure-Value/cpp-1695/) | | |
| 1696 | [Jump Game VI](https://leetcode.com/problems/jump-game-vi/) | [无] | [C++](1501-2000/1696-Jump-Game-VI/cpp-1696/) | | |
| 1697 | [Checking Existence of Edge Length Limited Paths](https://leetcode.com/problems/checking-existence-of-edge-length-limited-paths/) | [无] | [C++](1501-2000/1697-Checking-Existence-of-Edge-Length-Limited-Paths/cpp-1697/) | | |
| 1698 | [Number of Distinct Substrings in a String](https://leetcode.com/problems/number-of-distinct-substrings-in-a-string/) | [无] | [C++](1501-2000/1698-Number-of-Distinct-Substrings-in-a-String/cpp-1698/) | | |
| 1699 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1700 | [Number of Students Unable to Eat Lunch](https://leetcode.com/problems/number-of-students-unable-to-eat-lunch/) | [无] | [C++](1501-2000/1700-Number-of-Students-Unable-to-Eat-Lunch/cpp-1700/) | | |
| 1701 | [Average Waiting Time](https://leetcode.com/problems/average-waiting-time/) | [无] | [C++](1501-2000/1701-Average-Waiting-Time/cpp-1701/) | | |
| 1702 | [Maximum Binary String After Change](https://leetcode.com/problems/maximum-binary-string-after-change/) | [无] | [C++](1501-2000/1702-Maximum-Binary-String-After-Change/cpp-1702/) | | |
| 1703 | [Minimum Adjacent Swaps for K Consecutive Ones](https://leetcode.com/problems/minimum-adjacent-swaps-for-k-consecutive-ones/) | [无] | [C++](1501-2000/1703-Minimum-Adjacent-Swaps-for-K-Consecutive-Ones/cpp-1703/) | | |
| 1704 | [Determine if String Halves Are Alike](https://leetcode.com/problems/determine-if-string-halves-are-alike/) | [solution](https://leetcode.com/problems/determine-if-string-halves-are-alike/solution/) | [C++](1501-2000/1704-Determine-if-String-Halves-Are-Alike/cpp-1704/) | | |
| 1705 | [Maximum Number of Eaten Apples](https://leetcode.com/problems/maximum-number-of-eaten-apples/) | [solution](https://leetcode.com/problems/maximum-number-of-eaten-apples/solution/) | [C++](1501-2000/1705-Maximum-Number-of-Eaten-Apples/cpp-1705/) | | |
| 1706 | [Where Will the Ball Fall](https://leetcode.com/problems/where-will-the-ball-fall/) | [无] | [C++](1501-2000/1706-Where-Will-the-Ball-Fall/cpp-1706/) | | |
| 1707 | [Maximum XOR With an Element From Array](https://leetcode.com/problems/maximum-xor-with-an-element-from-array/) | [无] | [C++](1501-2000/1707-Maximum-XOR-With-an-Element-From-Array/cpp-1707/) | | |
| 1708 | [Largest Subarray Length K](https://leetcode.com/problems/largest-subarray-length-k/) | [无] | [C++](1708-Largest-Subarray-Length-K/cpp-1708/) | | |
| 1709 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1710 | [Maximum Units on a Truck](https://leetcode.com/problems/maximum-units-on-a-truck/) | [solution](https://leetcode.com/problems/maximum-units-on-a-truck/solution/) | [C++](1501-2000/1710-Maximum-Units-on-a-Truck/cpp-1710/) | | |
| 1711 | [Count Good Meals](https://leetcode.com/problems/count-good-meals/) | [无] | [C++](1711-Count-Good-Meals/cpp-1711/) | | |
| 1712 | [Ways to Split Array Into Three Subarrays](https://leetcode.com/problems/ways-to-split-array-into-three-subarrays/) | [solution](https://leetcode.com/problems/ways-to-split-array-into-three-subarrays/solution/) | [C++](1501-2000/1712-Ways-to-Split-Array-Into-Three-Subarrays/cpp-1712/) | | |
| 1713 | [Minimum Operations to Make a Subsequence](https://leetcode.com/problems/minimum-operations-to-make-a-subsequence/) | [无] | [C++](1501-2000/1713-Minimum-Operations-to-Make-a-Subsequence/cpp-1713/) | | |
| 1714 | [Sum Of Special Evenly-Spaced Elements In Array](https://leetcode.com/problems/sum-of-special-evenly-spaced-elements-in-array/) | [无] | [C++](1501-2000/1714-Sum-Of-Special-Evenly-Spaced-Elements-In-Array/cpp-1714/) | | |
| 1715 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1716 | [Calculate Money in Leetcode Bank](https://leetcode.com/problems/calculate-money-in-leetcode-bank/) | [无] | [C++](1501-2000/1716-Calculate-Money-in-Leetcode-Bank/cpp-1716/) | | |
| 1717 | [Maximum Score From Removing Substrings](https://leetcode.com/problems/maximum-score-from-removing-substrings/) | [无] | [C++](1501-2000/1717-Maximum-Score-From-Removing-Substrings/cpp-1717/) | | |
| 1718 | [Construct the Lexicographically Largest Valid Sequence](https://leetcode.com/problems/construct-the-lexicographically-largest-valid-sequence/) | [无] | [C++](1501-2000/1718-Construct-the-Lexicographically-Largest-Valid-Sequence/cpp-1718/) | | |
| 1719 | [Number Of Ways To Reconstruct A Tree](https://leetcode.com/problems/number-of-ways-to-reconstruct-a-tree/) | [无] | [C++](1501-2000/1719-Number-Of-Ways-To-Reconstruct-A-Tree/cpp-1719/) | | |
| 1720 | [Decode XORed Array](https://leetcode.com/problems/decode-xored-array/) | [无] | [C++](1501-2000/1720-Decode-XORed-Array/cpp-1720/) | | |
| 1721 | [Swapping Nodes in a Linked List](https://leetcode.com/problems/swapping-nodes-in-a-linked-list/) | [无] | [C++](1501-2000/1721-Swapping-Nodes-in-a-Linked-List/cpp-1721/) | | |
| 1722 | [Minimize Hamming Distance After Swap Operations](https://leetcode.com/problems/minimize-hamming-distance-after-swap-operations/) | [无] | [C++](1501-2000/1722-Minimize-Hamming-Distance-After-Swap-Operations/cpp-1722/) | | |
| 1723 | [Find Minimum Time to Finish All Jobs](https://leetcode.com/problems/find-minimum-time-to-finish-all-jobs/) | [无] | [C++](1501-2000/1723-Find-Minimum-Time-to-Finish-All-Jobs/cpp-1723/) | | |
| 1724 | [Checking Existence of Edge Length Limited Paths II](https://leetcode.com/problems/checking-existence-of-edge-length-limited-paths-ii/) | [无] | [C++](1501-2000/1724-Checking-Existence-of-Edge-Length-Limited-Paths-II/cpp-1724/) | | |
| 1725 | [Number Of Rectangles That Can Form The Largest Square](https://leetcode.com/problems/number-of-rectangles-that-can-form-the-largest-square/) | [无] | [C++](1501-2000/1725-Number-Of-Rectangles-That-Can-Form-The-Largest-Square/cpp-1725/) | | |
| 1726 | [Tuple with Same Product](https://leetcode.com/problems/tuple-with-same-product/) | [无] | [C++](1501-2000/1726-Tuple-with-Same-Product/cpp-1726/)| | |
| 1727 | [Largest Submatrix With Rearrangements](https://leetcode.com/problems/largest-submatrix-with-rearrangements/) | [无] | [C++](1501-2000/1727-Largest-Submatrix-With-Rearrangements/cpp-1727/) | | |
| 1728 | [Cat and Mouse II](https://leetcode.com/problems/cat-and-mouse-ii/) | [无] | [C++](1501-2000/1728-Cat-and-Mouse-II/cpp-1728/) | | |
| 1729 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1730 | [Shortest Path to Get Food](https://leetcode.com/problems/shortest-path-to-get-food/) | [无] | [C++](1501-2000/1730-Shortest-Path-to-Get-Food/cpp-1730/) | | |
| 1731 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1732 | [Find the Highest Altitude](https://leetcode.com/problems/find-the-highest-altitude/) | [无] | [C++](1501-2000/1732-Find-the-Highest-Altitude/cpp-1732/) | | |
| 1733 | [Minimum Number of People to Teach](https://leetcode.com/problems/minimum-number-of-people-to-teach/) | [无] | [C++](1501-2000/1733-Minimum-Number-of-People-to-Teach/cpp-1733/) | | |
| 1734 | [Decode XORed Permutation](https://leetcode.com/problems/decode-xored-permutation/) | [无] | [C++](1501-2000/1734-Decode-XORed-Permutation/cpp-1734/) | | |
| 1735 | [Count Ways to Make Array With Product](https://leetcode.com/problems/count-ways-to-make-array-with-product/) | [无] | [C++](1501-2000/1735-Count-Ways-to-Make-Array-With-Product/cpp-1735/) | | |
| 1736 | [Latest Time by Replacing Hidden Digits](https://leetcode.com/problems/latest-time-by-replacing-hidden-digits/) | [无] | [C++](1501-2000/1736-Latest-Time-by-Replacing-Hidden-Digits/cpp-1736/) | | |
| 1737 | [Change Minimum Characters to Satisfy One of Three Conditions](https://leetcode.com/problems/change-minimum-characters-to-satisfy-one-of-three-conditions/) | [无] | [C++](1501-2000/1737-Change-Minimum-Characters-to-Satisfy-One-of-Three-Conditions/cpp-1737/) | | |
| 1738 | [Find Kth Largest XOR Coordinate Value](https://leetcode.com/problems/find-kth-largest-xor-coordinate-value/) | [无] | [C++](1501-2000/1738-Find-Kth-Largest-XOR-Coordinate-Value/cpp-1738/) | | |
| 1739 | [Building Boxes](https://leetcode.com/problems/building-boxes/) | [无]
[缺:二分;数学] | [C++](1501-2000/1739-Building-Boxes/cpp-1739/) | | |
| 1740 | [Find Distance in a Binary Tree](https://leetcode.com/problems/find-distance-in-a-binary-tree/) | [无]
[缺:LCA] | [C++](1501-2000/1740-Find-Distance-in-a-Binary-Tree/cpp-1740/) | | |
| 1741 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1742 | [Maximum Number of Balls in a Box](https://leetcode.com/problems/maximum-number-of-balls-in-a-box/) | [无] | [C++](1501-2000/1742-Maximum-Number-of-Balls-in-a-Box/cpp-1742/) | | |
| 1743 | [Restore the Array From Adjacent Pairs](https://leetcode.com/problems/restore-the-array-from-adjacent-pairs/) | [无] | [C++](1501-2000/1743-Restore-the-Array-From-Adjacent-Pairs/cpp-1743/) | | |
| 1744 | [Can You Eat Your Favorite Candy on Your Favorite Day?](https://leetcode.com/problems/can-you-eat-your-favorite-candy-on-your-favorite-day/) | [无] | [C++](1501-2000/1744-Can-You-Eat-Your-Favorite-Candy-on-Your-Favorite-Day/cpp-1744/) | | |
| 1745 | [Palindrome Partitioning IV](https://leetcode.com/problems/palindrome-partitioning-iv/) | [无] | [C++](1501-2000/1745-Palindrome-Partitioning-IV/cpp-1745/) | | |
| 1746 | [Maximum Subarray Sum After One Operation](https://leetcode.com/problems/maximum-subarray-sum-after-one-operation/) | [无] | [C++](1501-2000/1746-Maximum-Subarray-Sum-After-One-Operation/cpp-1746/) | | |
| 1747 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1748 | [Sum of Unique Elements](https://leetcode.com/problems/sum-of-unique-elements/) | [无] | [C++](1501-2000/1748-Sum-of-Unique-Elements/cpp-1748/) | | |
| 1749 | [Maximum Absolute Sum of Any Subarray](https://leetcode.com/problems/maximum-absolute-sum-of-any-subarray/) | [无] | [C++](1501-2000/1749-Maximum-Absolute-Sum-of-Any-Subarray/cpp-1749/) | | |
| 1750 | [Minimum Length of String After Deleting Similar Ends](https://leetcode.com/problems/minimum-length-of-string-after-deleting-similar-ends/) | [无] | [C++](1501-2000/1750-Minimum-Length-of-String-After-Deleting-Similar-Ends/cpp-1750/) | | |
| 1751 | [Maximum Number of Events That Can Be Attended II](https://leetcode.com/problems/maximum-number-of-events-that-can-be-attended-ii/) | [无] | [C++](1501-2000/1751-Maximum-Number-of-Events-That-Can-Be-Attended-II/cpp-1751/) | | |
| 1752 | [Check if Array Is Sorted and Rotated](https://leetcode.com/problems/check-if-array-is-sorted-and-rotated/) | [无] | [C++](1501-2000/1752-Check-if-Array-Is-Sorted-and-Rotated/cpp-1752/) | | |
| 1753 | [Maximum Score From Removing Stones](https://leetcode.com/problems/maximum-score-from-removing-stones/) | [无] | [C++](1501-2000/1753-Maximum-Score-From-Removing-Stones/cpp-1753/) | | |
| 1754 | [Largest Merge Of Two Strings](https://leetcode.com/problems/largest-merge-of-two-strings/) | [无] | [C++](1501-2000/1754-Largest-Merge-Of-Two-Strings/cpp-1754/) | | |
| 1755 | [Closest Subsequence Sum](https://leetcode.com/problems/closest-subsequence-sum/) | [无] | [C++](1501-2000/1755-Closest-Subsequence-Sum/cpp-1755/) | | |
| 1756 | [Design Most Recently Used Queue](https://leetcode.com/problems/design-most-recently-used-queue/) | [无]
[缺:线段树,sqrt 分解] | [C++](1501-2000/1756-Design-Most-Recently-Used-Queue/cpp-1756/) | | |
| 1757 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1758 | [Minimum Changes To Make Alternating Binary String](https://leetcode.com/problems/minimum-changes-to-make-alternating-binary-string/) | [无] | [C++](1501-2000/1758-Minimum-Changes-To-Make-Alternating-Binary-String/cpp-1758/) | | |
| 1759 | [Count Number of Homogenous Substrings](https://leetcode.com/problems/count-number-of-homogenous-substrings/) | [无] | [C++](1501-2000/1759-Count-Number-of-Homogenous-Substrings/cpp-1759/) | | |
| 1760 | [Minimum Limit of Balls in a Bag](https://leetcode.com/problems/minimum-limit-of-balls-in-a-bag/) | [无] | [C++](1501-2000/1760-Minimum-Limit-of-Balls-in-a-Bag/cpp-1760/) | | |
| 1761 | [Minimum Degree of a Connected Trio in a Graph](https://leetcode.com/problems/minimum-degree-of-a-connected-trio-in-a-graph/) | [无] | [C++](1501-2000/1761-Minimum-Degree-of-a-Connected-Trio-in-a-Graph/cpp-1761/) | | |
| 1762 | [Buildings With an Ocean View](https://leetcode.com/problems/buildings-with-an-ocean-view/) | [无] | [C++](1501-2000/1762-Buildings-With-an-Ocean-View/cpp-1762/) | | |
| 1763 | [Longest Nice Substring](https://leetcode.com/problems/longest-nice-substring/) | [无] | [C++](1501-2000/1763-Longest-Nice-Substring/cpp-1763/) | | |
| 1764 | [Form Array by Concatenating Subarrays of Another Array](1501-2000/1764-Form-Array-by-Concatenating-Subarrays-of-Another-Array/cpp-1764/) | | | | |
| 1765 | [Map of Highest Peak](https://leetcode.com/problems/map-of-highest-peak/) | [无] | [C++](1501-2000/1765-Map-of-Highest-Peak/cpp-1765/) | | |
| 1766 | [Tree of Coprimes](https://leetcode.com/problems/tree-of-coprimes/) | [无] | [C++](1501-2000/1766-Tree-of-Coprimes/cpp-1766/) | | |
| 1767 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1768 | [Merge Strings Alternately](https://leetcode.com/problems/merge-strings-alternately/) | [无] | [C++](1501-2000/1768-Merge-Strings-Alternately/cpp-1768/) | | |
| 1769 | [Minimum Number of Operations to Move All Balls to Each Box](https://leetcode.com/problems/minimum-number-of-operations-to-move-all-balls-to-each-box/) | [无] | [C++](1501-2000/1769-Minimum-Number-of-Operations-to-Move-All-Balls-to-Each-Box/cpp-1769/) | | |
| 1770 | [Maximum Score from Performing Multiplication Operations](https://leetcode.com/problems/maximum-score-from-performing-multiplication-operations/) | [无] | [C++](1501-2000/1770-Maximum-Score-from-Performing-Multiplication-Operations/cpp-1770/) | | |
| 1771 | [Maximize Palindrome Length From Subsequences](https://leetcode.com/problems/maximize-palindrome-length-from-subsequences/) | [无] | [C++](1501-2000/1771-Maximize-Palindrome-Length-From-Subsequences/cpp-1771/) | | |
| 1772 | [Sort Features by Popularity](https://leetcode.com/problems/sort-features-by-popularity/) | [无] | [C++](1501-2000/1772-Sort-Features-by-Popularity/cpp-1772/) | | |
| 1773 | [Count Items Matching a Rule](https://leetcode.com/problems/count-items-matching-a-rule/) | [无] | [C++](1501-2000/1773-Count-Items-Matching-a-Rule/cpp-1773/) | | |
| 1774 | [Closest Dessert Cost](https://leetcode.com/problems/closest-dessert-cost/) | [无] | [C++](1501-2000/1774-Closest-Dessert-Cost/cpp-1774/) | | |
| 1775 | [Equal Sum Arrays With Minimum Number of Operations](https://leetcode.com/problems/equal-sum-arrays-with-minimum-number-of-operations/) | [无] | [C++](1501-2000/1775-Equal-Sum-Arrays-With-Minimum-Number-of-Operations/cpp-1775/) | | |
| 1776 | [Car Fleet II](https://leetcode.com/problems/car-fleet-ii/) | [无]
[缺:stack] | [C++](1501-2000/1776-Car-Fleet-II/cpp-1776/) | | |
| 1777 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1778 | [Shortest Path in a Hidden Grid](https://leetcode.com/problems/shortest-path-in-a-hidden-grid/) | [无] | [C++](1501-2000/1778-Shortest-Path-in-a-Hidden-Grid/cpp-1778/) | | |
| 1779 | [Find Nearest Point That Has the Same X or Y Coordinate](https://leetcode.com/problems/find-nearest-point-that-has-the-same-x-or-y-coordinate/) | [无] | [C++](1501-2000/1779-Find-Nearest-Point-That-Has-the-Same-X-or-Y-Coordinate/cpp-1779/) | | |
| 1780 | [Check if Number is a Sum of Powers of Three](https://leetcode.com/problems/check-if-number-is-a-sum-of-powers-of-three/) | [无] | [C++](1501-2000/1780-Check-if-Number-is-a-Sum-of-Powers-of-Three/cpp-1780/) | | |
| 1781 | [Sum of Beauty of All Substrings](https://leetcode.com/problems/sum-of-beauty-of-all-substrings/) | [无] | [C++](1501-2000/1781-Sum-of-Beauty-of-All-Substrings/cpp-1781/) | | |
| 1782 | [Count Pairs Of Nodes](https://leetcode.com/problems/count-pairs-of-nodes/) | [无] | [C++](1501-2000/1782-Count-Pairs-Of-Nodes/cpp-1782/) | | |
| 1783 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1784 | [Check if Binary String Has at Most One Segment of Ones](https://leetcode.com/problems/check-if-binary-string-has-at-most-one-segment-of-ones/) | [无] | [C++](1501-2000/1784-Check-if-Binary-String-Has-at-Most-One-Segment-of-Ones/cpp-1784/) | | |
| 1785 | [Minimum Elements to Add to Form a Given Sum](https://leetcode.com/problems/minimum-elements-to-add-to-form-a-given-sum/) | [无] | [C++](1501-2000/1785-Minimum-Elements-to-Add-to-Form-a-Given-Sum/cpp-1785/) | | |
| 1786 | [Number of Restricted Paths From First to Last Node](https://leetcode.com/problems/number-of-restricted-paths-from-first-to-last-node/) | [无] | [C++](1501-2000/1786-Number-of-Restricted-Paths-From-First-to-Last-Node/cpp-1786/) | | |
| 1787 | [Make the XOR of All Segments Equal to Zero](https://leetcode.com/problems/make-the-xor-of-all-segments-equal-to-zero/) | [无] | [C++](1501-2000/1787-Make-the-XOR-of-All-Segments-Equal-to-Zero/cpp-1787/) | | |
| 1788 | [Maximize the Beauty of the Garden](https://leetcode.com/problems/maximize-the-beauty-of-the-garden/) | [无] | [C++](1501-2000/1788-Maximize-the-Beauty-of-the-Garden/cpp-1788/) | | |
| 1789 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1790 | [Check if One String Swap Can Make Strings Equal](https://leetcode.com/problems/check-if-one-string-swap-can-make-strings-equal/) | [无] | [C++](1501-2000/1790-Check-if-One-String-Swap-Can-Make-Strings-Equal/cpp-1790/) | | |
| 1791 | [Find Center of Star Graph](https://leetcode.com/problems/find-center-of-star-graph/) | [无] | [C++](1501-2000/1791-Find-Center-of-Star-Graph/cpp-1791/) | | |
| 1792 | [Maximum Average Pass Ratio](https://leetcode.com/problems/maximum-average-pass-ratio/) | [无] | [C++](1501-2000/1792-Maximum-Average-Pass-Ratio/cpp-1792/) | | |
| 1793 | [Maximum Score of a Good Subarray](https://leetcode.com/problems/maximum-score-of-a-good-subarray/) | [无] | [C++](1501-2000/1793-Maximum-Score-of-a-Good-Subarray/cpp-1793/) | | |
| 1794 | [Count Pairs of Equal Substrings With Minimum Difference](https://leetcode.com/problems/count-pairs-of-equal-substrings-with-minimum-difference/) | [无] | [C++](1501-2000/1794-Count-Pairs-of-Equal-Substrings-With-Minimum-Difference/cpp-1794/) | | |
| 1795 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1796 | [Second Largest Digit in a String](https://leetcode.com/problems/second-largest-digit-in-a-string/) | [无] | [C++](1501-2000/1796-Second-Largest-Digit-in-a-String/cpp-1796/) | | |
| 1797 | [Design Authentication Manager](https://leetcode.com/problems/design-authentication-manager/) | [无] | [C++](1501-2000/1797-Design-Authentication-Manager/cpp-1797/) | | |
| 1798 | [Maximum Number of Consecutive Values You Can Make](https://leetcode.com/problems/maximum-number-of-consecutive-values-you-can-make/) | [无] | [C++](1501-2000/1798-Maximum-Number-of-Consecutive-Values-You-Can-Make/cpp-1798/) | | |
| 1799 | [Maximize Score After N Operations](https://leetcode.com/problems/maximize-score-after-n-operations/) | [无] | [C++](1501-2000/1799-Maximize-Score-After-N-Operations/cpp-1799/) | | |
| 1800 | [Maximum Ascending Subarray Sum](https://leetcode.com/problems/maximum-ascending-subarray-sum/) | [无] | [C++](1501-2000/1800-Maximum-Ascending-Subarray-Sum/cpp-1800/) | | |
| 1801 | [Number of Orders in the Backlog](https://leetcode.com/problems/number-of-orders-in-the-backlog/) | [无] | [C++](1501-2000/1801-Number-of-Orders-in-the-Backlog/cpp-1801/) | | |
| 1802 | [Maximum Value at a Given Index in a Bounded Array](https://leetcode.com/problems/maximum-value-at-a-given-index-in-a-bounded-array/) | [无] | [C++](1501-2000/1802-Maximum-Value-at-a-Given-Index-in-a-Bounded-Array/cpp-1802/) | | |
| 1803 | [Count Pairs With XOR in a Range](https://leetcode.com/problems/count-pairs-with-xor-in-a-range/) | [无] | [C++](1501-2000/1803-Count-Pairs-With-XOR-in-a-Range/cpp-1803/) | | |
| 1804 | [Implement Trie II (Prefix Tree)](https://leetcode.com/problems/implement-trie-ii-prefix-tree/) | [无] | [C++](1501-2000/Implement-Trie-II/cpp-1804/) | | |
| 1805 | [Number of Different Integers in a String](https://leetcode.com/problems/number-of-different-integers-in-a-string/) | [无] | [C++](1501-2000/1805-Number-of-Different-Integers-in-a-String/cpp-1805/) | | |
| 1806 | [Minimum Number of Operations to Reinitialize a Permutation](https://leetcode.com/problems/minimum-number-of-operations-to-reinitialize-a-permutation/) | [无]
[缺:数学方法] | [C++](1501-2000/1806-Minimum-Number-of-Operations-to-Reinitialize-a-Permutation/cpp-1806/) | | |
| 1807 | [Evaluate the Bracket Pairs of a String](https://leetcode.com/problems/evaluate-the-bracket-pairs-of-a-string/) | [无] | [C++](1501-2000/1807-Evaluate-the-Bracket-Pairs-of-a-String/cpp-1807/) | | |
| 1808 | [Maximize Number of Nice Divisors](https://leetcode.com/problems/maximize-number-of-nice-divisors/) | [无] | [C++](1501-2000/1808-Maximize-Number-of-Nice-Divisors/cpp-1808/) | | |
| 1809 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1810 | [Minimum Path Cost in a Hidden Grid](https://leetcode-cn.com/problems/minimum-path-cost-in-a-hidden-grid/) | [无] | [C++](1501-2000/1810-Minimum-Path-Cost-in-a-Hidden-Grid/cpp-1810/) | | |
| 1811 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1812 | [Determine Color of a Chessboard Square](https://leetcode.com/problems/determine-color-of-a-chessboard-square/) | [无] | [C++](1501-2000/1812-Determine-Color-of-a-Chessboard-Square/cpp-1812/) | | |
| 1813 | [Sentence Similarity III](https://leetcode.com/problems/sentence-similarity-iii/) | [无] | [C++](1501-2000/1813-Sentence-Similarity-III/cpp-1813/) | | |
| 1814 | [Count Nice Pairs in an Array](https://leetcode.com/problems/count-nice-pairs-in-an-array/) | [无] | [C++](1501-2000/1814-Count-Nice-Pairs-in-an-Array/cpp-1814/) | | |
| 1815 | [Maximum Number of Groups Getting Fresh Donuts](https://leetcode.com/problems/maximum-number-of-groups-getting-fresh-donuts/) | [无] | [C++](1501-2000/1815-Maximum-Number-of-Groups-Getting-Fresh-Donuts/cpp-1815/) | | |
| 1816 | [Truncate Sentence](https://leetcode.com/problems/truncate-sentence/) | [无] | [C++](1501-2000/1816-Truncate-Sentence/cpp-1816/) | | |
| 1817 | [Finding the Users Active Minutes](https://leetcode.com/problems/finding-the-users-active-minutes/) | [无] | [C++](1501-2000/1817-Finding-the-Users-Active-Minutes/cpp-1817/) | | |
| 1818 | [Minimum Absolute Sum Difference](https://leetcode.com/problems/minimum-absolute-sum-difference/) | [无] | [C++](1501-2000/1818-Minimum-Absolute-Sum-Difference/cpp-1818/) | | |
| 1819 | [Number of Different Subsequences GCDs](https://leetcode.com/problems/number-of-different-subsequences-gcds/) | [无] | [C++](1501-2000/1819-Number-of-Different-Subsequences-GCDs/cpp-1819/) | | |
| 1820 | [Maximum Number of Accepted Invitations](https://leetcode.com/problems/maximum-number-of-accepted-invitations/) | [无] | [C++](1501-2000/1820-Maximum-Number-of-Accepted-Invitations/cpp-1820/) | | |
| 1821 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1822 | [Sign of the Product of an Array](https://leetcode.com/problems/sign-of-the-product-of-an-array/) | [无] | [C++](1501-2000/1822-Sign-of-the-Product-of-an-Array/cpp-1822/) | | |
| 1823 | [Find the Winner of the Circular Game](https://leetcode.com/problems/find-the-winner-of-the-circular-game/) | [无] | [C++](1501-2000/1823-Find-the-Winner-of-the-Circular-Game/cpp-1823/) | | |
| 1824 | [Minimum Sideway Jumps](https://leetcode.com/problems/minimum-sideway-jumps/) | [无]
[缺:DP] | [C++](1501-2000/1824-Minimum-Sideway-Jumps/cpp-1824/) | | |
| 1825 | [Finding MK Average](https://leetcode.com/problems/finding-mk-average/)| [无]
[缺:线段树,AVL] | [C++](1501-2000/1825-Finding-MK-Average/cpp-1825/) | | |
| 1826 | [Faulty Sensor](https://leetcode.com/problems/faulty-sensor/) | [无] | [C++](1501-2000/1826-Faulty-Sensor/cpp-1826/) | | |
| 1827 | [Minimum Operations to Make the Array Increasing](https://leetcode.com/problems/minimum-operations-to-make-the-array-increasing/) | [无] | [C++](1501-2000/1827-Minimum-Operations-to-Make-the-Array-Increasing/cpp-1827/) | | |
| 1828 | [Queries on Number of Points Inside a Circle](https://leetcode.com/problems/queries-on-number-of-points-inside-a-circle/) | [无] | [C++](1501-2000/1828-Queries-on-Number-of-Points-Inside-a-Circle/cpp-1828/)| | |
| 1829 | [Maximum XOR for Each Query](https://leetcode.com/problems/maximum-xor-for-each-query/) | [无] | [C++](1501-2000/1829-Maximum-XOR-for-Each-Query/cpp-1829/) | | |
| 1830 | [Minimum Number of Operations to Make String Sorted](https://leetcode.com/problems/minimum-number-of-operations-to-make-string-sorted/) | [无] | [C++](1501-2000/1830-Minimum-Number-of-Operations-to-Make-String-Sorted/cpp-1830/) | | |
| 1831 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1832 | [Check if the Sentence Is Pangram](https://leetcode.com/problems/check-if-the-sentence-is-pangram/) | [无] | [C++](1501-2000/1832-Check-if-the-Sentence-Is-Pangram/cpp-1832/) | | |
| 1833 | [Maximum Ice Cream Bars](https://leetcode.com/problems/maximum-ice-cream-bars/) | [无] | [C++](1501-2000/1833-Maximum-Ice-Cream-Bars/cpp-1833/) | | |
| 1834 | [Single-Threaded CPU](https://leetcode.com/problems/single-threaded-cpu/) | [无] | [C++](1501-2000/1834-Single-Threaded-CPU/cpp-1834/) | | |
| 1835 | [Find XOR Sum of All Pairs Bitwise AND](https://leetcode.com/problems/find-xor-sum-of-all-pairs-bitwise-and/) | [无]
[缺:数学方法] | [C++](1501-2000/1835-Find-XOR-Sum-of-All-Pairs-Bitwise-AND/cpp-1835/) | | |
| 1836 | [Remove Duplicates From an Unsorted Linked List](https://leetcode.com/problems/remove-duplicates-from-an-unsorted-linked-list/) | [无] | [C++](1501-2000/1836-Remove-Duplicates-From-an-Unsorted-Linked-List/cpp-1836/) | | |
| 1837 | [Sum of Digits in Base K](https://leetcode.com/problems/sum-of-digits-in-base-k/) | [无] | [C++](1501-2000/1837-Sum-of-Digits-in-Base-K/cpp-1837/) | | |
| 1838 | [Frequency of the Most Frequent Element](https://leetcode.com/problems/frequency-of-the-most-frequent-element/) | [无] | [C++](1501-2000/1838-Frequency-of-the-Most-Frequent-Element/cpp-1838/) | | |
| 1839 | [Longest Substring Of All Vowels in Order](https://leetcode.com/problems/longest-substring-of-all-vowels-in-order/) | [无] | [C++](1501-2000/1839-Longest-Substring-Of-All-Vowels-in-Order/cpp-1839/) | | |
| 1840 | [Maximum Building Height](https://leetcode.com/problems/maximum-building-height/) | [无] | [C++](1501-2000/1840-Maximum-Building-Height/cpp-1840/) | | |
| 1841 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1842 | [Next Palindrome Using Same Digits](https://leetcode.com/problems/next-palindrome-using-same-digits/) | [无] | [C++](1501-2000/1842-Next-Palindrome-Using-Same-Digits/cpp-1842/) | | |
| 1843 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1844 | [Replace All Digits with Characters](https://leetcode.com/problems/replace-all-digits-with-characters/) | [无] | [C++](1501-2000/1844-Replace-All-Digits-with-Characters/cpp-1844/) | | |
| 1845 | [Seat Reservation Manager](https://leetcode.com/problems/seat-reservation-manager/) | [无] | [C++](1501-2000/1845-Seat-Reservation-Manager/cpp-1845/) | | |
| 1846 | [Maximum Element After Decreasing and Rearranging](https://leetcode.com/problems/maximum-element-after-decreasing-and-rearranging/) | [无] | [C++](1501-2000/1846-Maximum-Element-After-Decreasing-and-Rearranging/cpp-1846/) | | |
| 1847 | [Closest Room](https://leetcode.com/problems/closest-room/) | [无] | [C++](1501-2000/1847-Closest-Room/cpp-1847/) | | |
| 1848 | [Minimum Distance to the Target Element](https://leetcode.com/problems/minimum-distance-to-the-target-element/) | [无] | [C++](1501-2000/1848-Minimum-Distance-to-the-Target-Element/cpp-1848/) | | |
| 1849 | [Splitting a String Into Descending Consecutive Values](https://leetcode.com/problems/splitting-a-string-into-descending-consecutive-values/) | [无] | [C++](1501-2000/1849-Splitting-a-String-Into-Descending-Consecutive-Values/cpp-1849/) | | |
| 1850 | [Minimum Adjacent Swaps to Reach the Kth Smallest Number](https://leetcode.com/problems/minimum-adjacent-swaps-to-reach-the-kth-smallest-number/) | [无] | [C++](1501-2000/1850-Minimum-Adjacent-Swaps-to-Reach-the-Kth-Smallest-Number/cpp-1850/) | | |
| 1851 | [Minimum Interval to Include Each Query](https://leetcode.com/problems/minimum-interval-to-include-each-query/) | [无] | [C++](1501-2000/1851-Minimum-Interval-to-Include-Each-Query/cpp=1851/) | | |
| 1852 | [Distinct Numbers in Each Subarray](https://leetcode.com/problems/distinct-numbers-in-each-subarray/) | [无] | [C++](1501-2000/1852-Distinct-Numbers-in-Each-Subarray/cpp-1852/) | | |
| 1853 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1854 | [Maximum Population Year](https://leetcode.com/problems/maximum-population-year/) | [无] | [C++](1501-2000/1854-Maximum-Population-Year/cpp-1854/) | | |
| 1855 | [Maximum Distance Between a Pair of Values](https://leetcode.com/problems/maximum-distance-between-a-pair-of-values/) | [无] | [C++](1501-2000/1855-Maximum-Distance-Between-a-Pair-of-Values/cpp-1855/) | | |
| 1856 | [Maximum Subarray Min-Product](https://leetcode.com/problems/maximum-subarray-min-product/) | [无] | [C++](1501-2000/1856-Maximum-Subarray-Min-Product/cpp-1856/) | | |
| 1857 | [Largest Color Value in a Directed Graph](https://leetcode.com/problems/largest-color-value-in-a-directed-graph/) | [无] | [C++](1501-2000/1857-Largest-Color-Value-in-a-Directed-Graph/cpp-1857/) | | |
| 1858 | [Longest Word With All Prefixes](https://leetcode.com/problems/longest-word-with-all-prefixes/) | [无] | [C++](1501-2000/1858-Longest-Word-With-All-Prefixes/cpp-1858/) | | |
| 1859 | [Sorting the Sentence](https://leetcode.com/problems/sorting-the-sentence/) | [无] | [C++](1501-2000/1859-Sorting-the-Sentence/cpp-1859/) | | |
| 1860 | [Incremental Memory Leak](https://leetcode.com/problems/incremental-memory-leak/) | [无] | [C++](1501-2000/1860-Incremental-Memory-Leak/cpp-1860/) | | |
| 1861 | [Rotating the Box](https://leetcode.com/problems/rotating-the-box/) | [无] | [C++](1501-2000/1861-Rotating-the-Box/cpp-1861/) | | |
| 1862 | [Sum of Floored Pairs](https://leetcode.com/problems/sum-of-floored-pairs/) | [无] | [C++](1501-2000/1862-Sum-of-Floored-Pairs/cpp-1862/) | | |
| 1863 | [Sum of All Subset XOR Totals](https://leetcode.com/problems/sum-of-all-subset-xor-totals/) | [无]
[缺:数学解] | [C++](1501-2000/1863-Sum-of-All-Subset-XOR-Totals/cpp-1863/) | | |
| 1864 | [Minimum Number of Swaps to Make the Binary String Alternating](https://leetcode.com/problems/minimum-number-of-swaps-to-make-the-binary-string-alternating/) | [无] | [C++](1501-2000/1864-Minimum-Number-of-Swaps-to-Make-the-Binary-String-Alternating/cpp-1864/) | | |
| 1865 | [Finding Pairs With a Certain Sum](https://leetcode.com/problems/finding-pairs-with-a-certain-sum/) | [无] | [C++](1501-2000/1865-Finding-Pairs-With-a-Certain-Sum/cpp-1865/) | | |
| 1866 | [Number of Ways to Rearrange Sticks With K Sticks Visible](https://leetcode.com/problems/number-of-ways-to-rearrange-sticks-with-k-sticks-visible/) | [无] | [C++](1501-2000/1866-Number-of-Ways-to-Rearrange-Sticks-With-K-Sticks-Visible/cpp-1866/) | | |
| 1867 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1868 | [Product of Two Run-Length Encoded Arrays](https://leetcode.com/problems/product-of-two-run-length-encoded-arrays/) | [无] | [C++](1501-2000/1868-Product-of-Two-Run-Length-Encoded-Arrays/cpp-1868/) | | |
| 1869 | [Longer Contiguous Segments of Ones than Zeros](https://leetcode.com/problems/longer-contiguous-segments-of-ones-than-zeros/) | [无] | [C++](1501-2000/1869-Longer-Contiguous-Segments-of-Ones-than-Zeros/cpp-1869/) | | |
| 1870 | [Minimum Speed to Arrive on Time](https://leetcode.com/problems/minimum-speed-to-arrive-on-time/) | [无] | [C++](1501-2000/1870-Minimum-Speed-to-Arrive-on-Time/cpp-1870/) | | |
| 1871 | [Jump Game VII](https://leetcode.com/problems/jump-game-vii/) | [无] | [C++](1501-2000/1871-Jump-Game-VII/cpp-1871/) | | |
| 1872 | [Stone Game VIII](https://leetcode.com/problems/stone-game-viii/) | [solution](1501-2000/1872-Stone-Game-VIII/cpp-1872/) | | | |
| 1873 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1874 | [Minimize Product Sum of Two Arrays](https://leetcode.com/problems/minimize-product-sum-of-two-arrays/) | [无] | [C++](1501-2000/1874-Minimize-Product-Sum-of-Two-Arrays/cpp-1874/) | | |
| 1875 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1876 | [Substrings of Size Three with Distinct Characters](https://leetcode.com/problems/substrings-of-size-three-with-distinct-characters/) | [无] | [C++](1501-2000/1876-Substrings-of-Size-Three-with-Distinct-Characters/cpp-1876/) | | |
| 1877 | [Minimize Maximum Pair Sum in Array](https://leetcode.com/problems/minimize-maximum-pair-sum-in-array/) | [无] | [C++](1501-2000/1877-Minimize-Maximum-Pair-Sum-in-Array/cpp-1877/) | | |
| 1878 | [Get Biggest Three Rhombus Sums in a Grid](https://leetcode.com/problems/get-biggest-three-rhombus-sums-in-a-grid/) | [无] | [C++](1501-2000/1878-Get-Biggest-Three-Rhombus-Sums-in-a-Grid/cpp-1878/) | | |
| 1879 | [Minimum XOR Sum of Two Arrays](https://leetcode.com/problems/minimum-xor-sum-of-two-arrays/) | [无]
[缺:DP] | [C++](1501-2000/1879-Minimum-XOR-Sum-of-Two-Arrays/cpp-1879/) | | |
| 1880 | [Check if Word Equals Summation of Two Words](https://leetcode.com/problems/check-if-word-equals-summation-of-two-words/) | [无] | [C++](1501-2000/1880-Check-if-Word-Equals-Summation-of-Two-Words/cpp-1880/) | | |
| 1881 | [Maximum Value after Insertion](https://leetcode.com/problems/maximum-value-after-insertion/) | [无] | [C++](1501-2000/1881-Maximum-Value-after-Insertion/cpp-1881/) | | |
| 1882 | [Process Tasks Using Servers](https://leetcode.com/problems/process-tasks-using-servers/) | [无] | [C++](1501-2000/1882-Process-Tasks-Using-Servers/cpp-1882/) | | |
| 1883 | [Minimum Skips to Arrive at Meeting On Time](https://leetcode.com/problems/minimum-skips-to-arrive-at-meeting-on-time/) | [无]
[缺:DP] | [C++](1501-2000/1883-Minimum-Skips-to-Arrive-at-Meeting-On-Time/cpp-1883/) | | |
| 1884 | [Egg Drop With 2 Eggs and N Floors](https://leetcode.com/problems/egg-drop-with-2-eggs-and-n-floors/) | [无]
[缺:O(1) 数学] | [C++](1501-2000/1884-Egg-Drop-With-2-Eggs-and-N-Floors/cpp-1884/) | | |
| 1885 | [Count Pairs in Two Arrays](https://leetcode.com/problems/count-pairs-in-two-arrays/) | [无] | [C++](1501-2000/1885-Count-Pairs-in-Two-Arrays/cpp-1885/) | | |
| 1886 | [Determine Whether Matrix Can Be Obtained By Rotation](https://leetcode.com/problems/determine-whether-matrix-can-be-obtained-by-rotation/) | [无] | [C++](1501-2000/1886-Determine-Whether-Matrix-Can-Be-Obtained-By-Rotation/cpp-1886/) | | |
| 1887 | [Reduction Operations to Make the Array Elements Equal](https://leetcode.com/problems/reduction-operations-to-make-the-array-elements-equal/) | [无] | [C++](1501-2000/1887-Reduction-Operations-to-Make-the-Array-Elements-Equal/cpp-1887/) | | |
| 1888 | [Minimum Number of Flips to Make the Binary String Alternating](https://leetcode.com/problems/minimum-number-of-flips-to-make-the-binary-string-alternating/) | [无] | [C++](1501-2000/1888-Minimum-Number-of-Flips-to-Make-the-Binary-String-Alternating/cpp-1888/) | | |
| 1889 | [Minimum Space Wasted From Packaging](https://leetcode.com/problems/minimum-space-wasted-from-packaging/) | [无] | [C++](1501-2000/1889-Minimum-Space-Wasted-From-Packaging/cpp-1889/) | | |
| 1890 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1891 | [Cutting Ribbons](https://leetcode.com/problems/cutting-ribbons/) | [无] | [C++](1501-2000/1891-Cutting-Ribbons/cpp-1891/) | | |
| 1892 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1893 | [Check if All the Integers in a Range Are Covered](https://leetcode.com/problems/check-if-all-the-integers-in-a-range-are-covered/) | [无] | [C++](1501-2000/1893-Check-if-All-the-Integers-in-a-Range-Are-Covered/cpp-1893/) | | |
| 1894 | [Find the Student that Will Replace the Chalk](https://leetcode.com/problems/find-the-student-that-will-replace-the-chalk/) | [无] | [C++](1501-2000/1894-Find-the-Student-that-Will-Replace-the-Chalk/cpp-1894/) | | |
| 1895 | [Largest Magic Square](https://leetcode.com/problems/largest-magic-square/) | [无] | [C++](1501-2000/1895-Largest-Magic-Square/cpp-1895/) | | |
| 1896 | [Minimum Cost to Change the Final Value of Expression](https://leetcode.com/problems/minimum-cost-to-change-the-final-value-of-expression/) | [无] | [C++](1501-2000/1896-Minimum-Cost-to-Change-the-Final-Value-of-Expression/cpp-1896/) | | |
| 1897 | [Redistribute Characters to Make All Strings Equal](https://leetcode.com/problems/redistribute-characters-to-make-all-strings-equal/) | [无] | [C++](1501-2000/1897-Redistribute-Characters-to-Make-All-Strings-Equal/cpp-1897/) | | |
| 1898 | [Maximum Number of Removable Characters](https://leetcode.com/problems/maximum-number-of-removable-characters/) | [无] | [C++](1501-2000/1898-Maximum-Number-of-Removable-Characters/cpp-1898/) | | |
| 1899 | [Merge Triplets to Form Target Triplet](https://leetcode.com/problems/merge-triplets-to-form-target-triplet/) | [无] | [C++](1501-2000/1899-Merge-Triplets-to-Form-Target-Triplet/cpp-1899/) | | |
| 1900 | [The Earliest and Latest Rounds Where Players Compete](https://leetcode.com/problems/the-earliest-and-latest-rounds-where-players-compete/) | [无] | [C++](1501-2000/1900-The-Earliest-and-Latest-Rounds-Where-Players-Compete/cpp-1900/) | | |
| 1901 | [Find a Peak Element II](https://leetcode.com/problems/find-a-peak-element-ii/) | [无] | [C++](1501-2000/1901-Find-a-Peak-Element-II/cpp-1901/) | | |
| 1902 | [Depth of BST Given Insertion Order](https://leetcode.com/problems/depth-of-bst-given-insertion-order/) | [无] | [C++](1501-2000/1902-Depth-of-BST-Given-Insertion-Order/cpp-1902/) | | |
| 1903 | [Largest Odd Number in String](https://leetcode.com/problems/largest-odd-number-in-string/) | [无] | [C++](1501-2000/1903-Largest-Odd-Number-in-String/cpp-1903/) | | |
| 1904 | [The Number of Full Rounds You Have Played](https://leetcode.com/problems/the-number-of-full-rounds-you-have-played/) | [无] | [C++](1501-2000/1904-The-Number-of-Full-Rounds-You-Have-Played/cpp-1904/) | | |
| 1905 | [Count Sub Islands](https://leetcode.com/problems/count-sub-islands/) | [无] | [C++](1501-2000/1905-Count-Sub-Islands/cpp-1905/) | | |
| 1906 | [Minimum Absolute Difference Queries](https://leetcode.com/problems/minimum-absolute-difference-queries/) | [无]
[缺:二分] | [C++](1501-2000/1906-Minimum-Absolute-Difference-Queries/cpp-1906/) | | |
| 1907 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1908 | [Game of Nim](https://leetcode.com/problems/game-of-nim/) | [无]
[缺:dp] | [C++](1501-2000/1908-Game-of-Nim/cpp-1908/) | | |
| 1909 | [Remove One Element to Make the Array Strictly Increasing](https://leetcode.com/problems/remove-one-element-to-make-the-array-strictly-increasing/) | [无] | [C++](1501-2000/1909-Remove-One-Element-to-Make-the-Array-Strictly-Increasing/cpp-1909/) | | |
| 1910 | [Remove All Occurrences of a Substring](https://leetcode.com/problems/remove-all-occurrences-of-a-substring/) | [无] | [C++](1501-2000/1910-Remove-All-Occurrences-of-a-Substring/cpp-1910/) | | |
| 1911 | [Maximum Alternating Subsequence Sum](https://leetcode.com/problems/maximum-alternating-subsequence-sum/) | [无]
[缺:dp] | [C++](1501-2000/1911-Maximum-Alternating-Subsequence-Sum/cpp-1911/) | | |
| 1912 | [Design Movie Rental System](https://leetcode.com/problems/design-movie-rental-system/) | [无] | [C++](1501-2000/1912-Design-Movie-Rental-System/cpp-1912/) | | |
| 1913 | [Maximum Product Difference Between Two Pairs](https://leetcode.com/problems/maximum-product-difference-between-two-pairs/) | [无] | [C++](1501-2000/1913-Maximum-Product-Difference-Between-Two-Pairs/cpp-1913/) | | |
| 1914 | [Cyclically Rotating a Grid](https://leetcode.com/problems/cyclically-rotating-a-grid/) | [无] | [C++](1501-2000/1914-Cyclically-Rotating-a-Grid/cpp-1914/) | | |
| 1915 | [Number of Wonderful Substrings](https://leetcode.com/problems/number-of-wonderful-substrings/) | [无] | [C++](1501-2000/1915-Number-of-Wonderful-Substrings/cpp-1915/) | | |
| 1916 | [Count Ways to Build Rooms in an Ant Colony](https://leetcode.com/problems/count-ways-to-build-rooms-in-an-ant-colony/) | [无] | [C++](1501-2000/1916-Count-Ways-to-Build-Rooms-in-an-Ant-Colony/cpp-1916/) | | |
| 1917 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1918 | [Kth Smallest Subarray Sum](https://leetcode.com/problems/kth-smallest-subarray-sum/) | [无] | [C++](1501-2000/1918-Kth-Smallest-Subarray-Sum/cpp-1918/) | | |
| 1919 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1920 | [Build Array from Permutation](https://leetcode.com/problems/build-array-from-permutation/) | [无] | [C++](1501-2000/1920-Build-Array-from-Permutation/cpp-1920/) | | |
| 1921 | [Eliminate Maximum Number of Monsters](https://leetcode.com/problems/eliminate-maximum-number-of-monsters/) | [无] | [C++](1501-2000/1921-Eliminate-Maximum-Number-of-Monsters/cpp-1921/) | | |
| 1922 | [Count Good Numbers](https://leetcode.com/problems/count-good-numbers/) | [无] | [C++](1501-2000/1922-Count-Good-Numbers/cpp-1922/) | | |
| 1923 | [Longest Common Subpath](https://leetcode.com/problems/longest-common-subpath/) | [无]
[缺:后缀树组+LCP
滚动哈希两次碰撞] | [C++](1501-2000/1923-Longest-Common-Subpath/cpp-1923/) | | |
| 1924 | [Erect the Fence II](https://leetcode.com/problems/erect-the-fence-ii/) | [无] | [C++](1501-2000/1924-Erect-the-Fence-II/cpp-1924/) | | |
| 1925 | [Count Square Sum Triples](https://leetcode.com/problems/count-square-sum-triples/) | [无] | [C++](1501-2000/1925-Count-Square-Sum-Triples/cpp-1925/) | | |
| 1926 | [Nearest Exit from Entrance in Maze](https://leetcode.com/problems/nearest-exit-from-entrance-in-maze/) | [无] | [C++](1501-2000/1926-Nearest-Exit-from-Entrance-in-Maze/cpp-1926/) | | |
| 1927 | [Sum Game](https://leetcode.com/problems/sum-game/) | [无] | [C++](1501-2000/1927-Sum-Game/cpp-1927/) | | |
| 1928 | [Minimum Cost to Reach Destination in Time](https://leetcode.com/problems/minimum-cost-to-reach-destination-in-time/) | [无] | [C++](1501-2000/1928-Minimum-Cost-to-Reach-Destination-in-Time/cpp-1928/) | | |
| 1929 | [Concatenation of Array](https://leetcode.com/problems/concatenation-of-array/) | [无] | [C++](1501-2000/1929-Concatenation-of-Array/cpp-1929/) | | |
| 1930 | [Unique Length-3 Palindromic Subsequences](https://leetcode.com/problems/unique-length-3-palindromic-subsequences/) | [无] | [C++](1501-2000/1930-Unique-Length-3-Palindromic-Subsequences/cpp-1930/) | | |
| 1931 | [Painting a Grid With Three Different Colors](https://leetcode.com/problems/painting-a-grid-with-three-different-colors/) | [无] | [C++](1501-2000/1931-Painting-a-Grid-With-Three-Different-Colors/cpp-1931/) | | |
| 1932 | [Merge BSTs to Create Single BST](https://leetcode.com/problems/merge-bsts-to-create-single-bst/) | [无] | [C++](1501-2000/1932-Merge-BSTs-to-Create-Single-BST/cpp-1932/) | | |
| 1933 | [Check if String Is Decomposable Into Value-Equal Substrings](https://leetcode.com/problems/check-if-string-is-decomposable-into-value-equal-substrings/) | [无] | [C++](1501-2000/1933-Check-if-String-Is-Decomposable-Into-Value-Equal-Substrings/cpp-1933/) | | |
| 1934 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1935 | [Maximum Number of Words You Can Type](https://leetcode.com/problems/maximum-number-of-words-you-can-type/) | [无] | [C++](1501-2000/1935-Maximum-Number-of-Words-You-Can-Type/cpp-1935/) | | |
| 1936 | [Add Minimum Number of Rungs](https://leetcode.com/problems/add-minimum-number-of-rungs/) | [无] | [C++](1501-2000/1936-Add-Minimum-Number-of-Rungs/cpp-1936/) | | |
| 1937 | [Maximum Number of Points with Cost](https://leetcode.com/problems/maximum-number-of-points-with-cost/) | [无] | [C++](1501-2000/1937-Maximum-Number-of-Points-with-Cost/cpp-1937/) | | |
| 1938 | [Maximum Genetic Difference Query](https://leetcode.com/problems/maximum-genetic-difference-query/) | [无] | [C++](1501-2000/1938-Maximum-Genetic-Difference-Query/cpp-1938/) | | |
| 1939 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1940 | [Longest Common Subsequence Between Sorted Arrays](https://leetcode.com/problems/longest-common-subsequence-between-sorted-arrays/) | [无] | [C++](1501-2000/1940-Longest-Common-Subsequence-Between-Sorted-Arrays/cpp-1940/) | | |
| 1941 | [Check if All Characters Have Equal Number of Occurrences](https://leetcode.com/problems/check-if-all-characters-have-equal-number-of-occurrences/) | [无] | [C++](1501-2000/1941-Check-if-All-Characters-Have-Equal-Number-of-Occurrences/cpp-1941/) | | |
| 1942 | [The Number of the Smallest Unoccupied Chair](https://leetcode.com/problems/the-number-of-the-smallest-unoccupied-chair/) | [无] | [C++](1501-2000/1942-The-Number-of-the-Smallest-Unoccupied-Chair/cpp-1942/) | | |
| 1943 | [Describe the Painting](https://leetcode.com/problems/describe-the-painting/) | [无] | [C++](1501-2000/1943-Describe-the-Painting/cpp-1943/) | | |
| 1944 | [Number of Visible People in a Queue](https://leetcode.com/problems/number-of-visible-people-in-a-queue/) | [无] | [C++](1501-2000/1944-Number-of-Visible-People-in-a-Queue/cpp-1944/) | | |
| 1945 | [Sum of Digits of String After Convert](https://leetcode.com/problems/sum-of-digits-of-string-after-convert/) | [无] | [C++](1501-2000/1945-Sum-of-Digits-of-String-After-Convert/cpp-1945/) | | |
| 1946 | [Largest Number After Mutating Substring](https://leetcode.com/problems/largest-number-after-mutating-substring/) | [无] | [C++](1501-2000/1946-Largest-Number-After-Mutating-Substring/cpp-1946/) | | |
| 1947 | [Maximum Compatibility Score Sum](https://leetcode.com/problems/maximum-compatibility-score-sum/) | [无] | [C++](1501-2000/1947-Maximum-Compatibility-Score-Sum/cpp-1947/) | | |
| 1948 | [Delete Duplicate Folders in System](https://leetcode.com/problems/delete-duplicate-folders-in-system/) | [无] | [C++](1501-2000/1948-Delete-Duplicate-Folders-in-System/cpp-1948/) | | |
| 1949 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1950 | [Maximum of Minimum Values in All Subarrays](https://leetcode.com/problems/maximum-of-minimum-values-in-all-subarrays/) | [无] | [C++](1501-2000/1950-Maximum-of-Minimum-Values-in-All-Subarrays/cpp-1950/) | | |
| 1951 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1952 | [Three Divisors](https://leetcode.com/problems/three-divisors/) | [无] | [C++](1501-2000/1952-Three-Divisors/cpp-1952/) | | |
| 1953 | [Maximum Number of Weeks for Which You Can Work](https://leetcode.com/problems/maximum-number-of-weeks-for-which-you-can-work/) | [无] | [C++](1501-2000/1953-Maximum-Number-of-Weeks-for-Which-You-Can-Work/cpp-1953/) | | |
| 1954 | [Minimum Garden Perimeter to Collect Enough Apples](https://leetcode.com/problems/minimum-garden-perimeter-to-collect-enough-apples/) | [无] | [C++](1501-2000/1954-Minimum-Garden-Perimeter-to-Collect-Enough-Apples/cpp-1954/) | | |
| 1955 | [Count Number of Special Subsequences](https://leetcode.com/problems/count-number-of-special-subsequences/) | [无] | [C++](1501-2000/1955-Count-Number-of-Special-Subsequences/cpp-1955/) | | |
| 1956 | [Minimum Time For K Virus Variants to Spread](https://leetcode.com/problems/minimum-time-for-k-virus-variants-to-spread/) | [无] | [C++](1501-2000/1956-Minimum-Time-For-K-Virus-Variants-to-Spread/cpp-1956/) | | |
| 1957 | [Delete Characters to Make Fancy String](https://leetcode.com/problems/delete-characters-to-make-fancy-string/) | [无] | [C++](1501-2000/1957-Delete-Characters-to-Make-Fancy-String/cpp-1957/) | | |
| 1958 | [Check if Move is Legal](https://leetcode.com/problems/check-if-move-is-legal/) | [无] | [C++](1501-2000/1958-Check-if-Move-is-Legal/cpp-1958/) | | |
| 1959 | [Minimum Total Space Wasted With K Resizing Operations](https://leetcode.com/problems/minimum-total-space-wasted-with-k-resizing-operations/) | [无] | [C++](1501-2000/1959-Minimum-Total-Space-Wasted-With-K-Resizing-Operations/cpp-1959/) | | |
| 1960 | [Maximum Product of the Length of Two Palindromic Substrings](https://leetcode.com/problems/maximum-product-of-the-length-of-two-palindromic-substrings/) | [无] | [C++](1501-2000/1960-Maximum-Product-of-the-Length-of-Two-Palindromic-Substrings/cpp-1960/) | | |
| 1961 | [Check If String Is a Prefix of Array](https://leetcode.com/problems/check-if-string-is-a-prefix-of-array/) | [无] | [C++](1501-2000/1961-Check-If-String-Is-a-Prefix-of-Array/cpp-1961/) | | |
| 1962 | [Remove Stones to Minimize the Total](https://leetcode.com/problems/remove-stones-to-minimize-the-total/) | [无] | [C++](1501-2000/1962-Remove-Stones-to-Minimize-the-Total/cpp-1962/) | | |
| 1963 | [Minimum Number of Swaps to Make the String Balanced](https://leetcode.com/problems/minimum-number-of-swaps-to-make-the-string-balanced/) | [无] | [C++](1501-2000/1963-Minimum-Number-of-Swaps-to-Make-the-String-Balanced/cpp-1963/) | | |
| 1964 | [Find the Longest Valid Obstacle Course at Each Position](https://leetcode.com/problems/find-the-longest-valid-obstacle-course-at-each-position/) | [无] | [C++](1501-2000/1964-Find-the-Longest-Valid-Obstacle-Course-at-Each-Position/cpp-1964/) | | |
| 1965 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1966 | [Binary Searchable Numbers in an Unsorted Array](https://leetcode.com/problems/binary-searchable-numbers-in-an-unsorted-array/) | [无] | [C++](1501-2000/1966-Binary-Searchable-Numbers-in-an-Unsorted-Array/cpp-1966/) | | |
| 1967 | [Number of Strings That Appear as Substrings in Word](https://leetcode.com/problems/number-of-strings-that-appear-as-substrings-in-word/) | [无] | [C++](1501-2000/1967-Number-of-Strings-That-Appear-as-Substrings-in-Word/cpp-1967/) | | |
| 1968 | [Array With Elements Not Equal to Average of Neighbors](https://leetcode.com/problems/array-with-elements-not-equal-to-average-of-neighbors/) | [无] | [C++](1501-2000/1968-Array-With-Elements-Not-Equal-to-Average-of-Neighbors/cpp-1968/) | | |
| 1969 | [Minimum Non-Zero Product of the Array Elements](https://leetcode.com/problems/minimum-non-zero-product-of-the-array-elements/) | [无] | [C++](1501-2000/1969-Minimum-Non-Zero-Product-of-the-Array-Elements/cpp-1969/) | | |
| 1970 | [Last Day Where You Can Still Cross](https://leetcode.com/problems/last-day-where-you-can-still-cross/) | [无] | [C++](1501-2000/1970-Last-Day-Where-You-Can-Still-Cross/cpp-1970/) | | |
| 1971 | [Find if Path Exists in Graph](https://leetcode.com/problems/find-if-path-exists-in-graph/) | [无] | [C++](1501-2000/1971-Find-if-Path-Exists-in-Graph/cpp-1971/) | | |
| 1972 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1973 | [Count Nodes Equal to Sum of Descendants](https://leetcode.com/problems/count-nodes-equal-to-sum-of-descendants/) | [无] | [C++](1501-2000/1973-Count-Nodes-Equal-to-Sum-of-Descendants/cpp-1973/) | | |
| 1974 | [Minimum Time to Type Word Using Special Typewriter](https://leetcode.com/problems/minimum-time-to-type-word-using-special-typewriter/) | [无] | [C++](1501-2000/1974-Minimum-Time-to-Type-Word-Using-Special-Typewriter/cpp-1974/) | | |
| 1975 | [Maximum Matrix Sum](https://leetcode.com/problems/maximum-matrix-sum/) | [无] | [C++](1501-2000/1975-Maximum-Matrix-Sum/cpp-1975/) | | |
| 1976 | [Number of Ways to Arrive at Destination](https://leetcode.com/problems/number-of-ways-to-arrive-at-destination/) | [无] | [C++](1501-2000/1976-Number-of-Ways-to-Arrive-at-Destination/cpp-1976/) | | |
| 1977 | [Number of Ways to Separate Numbers](https://leetcode.com/problems/number-of-ways-to-separate-numbers/) | [无] | [C++](1501-2000/1977-Number-of-Ways-to-Separate-Numbers/cpp-1977/) | | |
| 1978 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1979 | [Find Greatest Common Divisor of Array](https://leetcode.com/problems/find-greatest-common-divisor-of-array/) | [无] | [C++](1501-2000/1979-Number-of-Ways-to-Separate-Numbers/cpp-1979/) | | |
| 1980 | [Find Unique Binary String](https://leetcode.com/problems/find-unique-binary-string/) | [无] | [C++](1501-2000/1980-Find-Unique-Binary-String/cpp-1980/) | | |
| 1981 | [Minimize the Difference Between Target and Chosen Elements](https://leetcode.com/problems/minimize-the-difference-between-target-and-chosen-elements/) | [无] | [C++](1501-2000/1981-Minimize-the-Difference-Between-Target-and-Chosen-Elements/cpp-1981/) | | |
| 1982 | [Find Array Given Subset Sums](https://leetcode.com/problems/find-array-given-subset-sums/) | [无] | [C++](1501-2000/1982-Find-Array-Given-Subset-Sums/cpp-1982/) | | |
| 1983 | [Widest Pair of Indices With Equal Range Sum](https://leetcode.com/problems/widest-pair-of-indices-with-equal-range-sum/) | [无] | [C++](1501-2000/1983-Widest-Pair-of-Indices-With-Equal-Range-Sum/cpp-1983/) | | |
| 1984 | [Minimum Difference Between Highest and Lowest of K Scores](https://leetcode.com/problems/minimum-difference-between-highest-and-lowest-of-k-scores/) | [无] | [C++](1501-2000/1984-Minimum-Difference-Between-Highest-and-Lowest-of-K-Scores/cpp-1984/) | | |
| 1985 | [Find the Kth Largest Integer in the Array](https://leetcode.com/problems/find-the-kth-largest-integer-in-the-array/) | [无] | [C++](1501-2000/1985-Find-the-Kth-Largest-Integer-in-the-Array/cpp-1985/) | | |
| 1986 | [Minimum Number of Work Sessions to Finish the Tasks](https://leetcode.com/problems/minimum-number-of-work-sessions-to-finish-the-tasks/) | [无] | [C++](1501-2000/1986-Minimum-Number-of-Work-Sessions-to-Finish-the-Tasks/cpp-1986/) | | |
| 1987 | [Number of Unique Good Subsequences](https://leetcode.com/problems/number-of-unique-good-subsequences/) | [无] | [C++](1501-2000/1987-Number-of-Unique-Good-Subsequences/cpp-1987/) | | |
| 1988 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1989 | [Maximum Number of People That Can Be Caught in Tag](https://leetcode.com/problems/maximum-number-of-people-that-can-be-caught-in-tag/) | [无] | [C++](1501-2000/1989-Maximum-Number-of-People-That-Can-Be-Caught-in-Tag/cpp-1989/) | | |
| 1990 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 1991 | [Find the Middle Index in Array](https://leetcode.com/problems/find-the-middle-index-in-array/) | [无] | [C++](1501-2000/1991-Find-the-Middle-Index-in-Array/cpp-1991/) | | |
| 1992 | [Find All Groups of Farmland](https://leetcode.com/problems/find-all-groups-of-farmland/) | [无] | [C++](1501-2000/1992-Find-All-Groups-of-Farmland/cpp-1992/) | | |
| 1993 | [Operations on Tree](https://leetcode.com/problems/operations-on-tree/) | [无] | [C++](1501-2000/1993-Operations-on-Tree/cpp-1993/) | | |
| 1994 | [The Number of Good Subsets](https://leetcode.com/problems/the-number-of-good-subsets/) | [无] | [C++](1501-2000/1994-The-Number-of-Good-Subsets/cpp-1994/) | | |
| 1995 | [Count Special Quadruplets](https://leetcode.com/problems/count-special-quadruplets/) | [无] | [C++](1501-2000/1995-Count-Special-Quadruplets/cpp-1995/) | | |
| 1996 | [The Number of Weak Characters in the Game](https://leetcode.com/problems/the-number-of-weak-characters-in-the-game/) | [无] | [C++](1501-2000/1996-The-Number-of-Weak-Characters-in-the-Game/cpp-1996/) | | |
| 1997 | [First Day Where You Have Been in All the Rooms](https://leetcode.com/problems/first-day-where-you-have-been-in-all-the-rooms/) | [无] | [C++](1501-2000/1997-First-Day-Where-You-Have-Been-in-All-the-Rooms/cpp-1997/) | | |
| 1998 | [GCD Sort of an Array](https://leetcode.com/problems/gcd-sort-of-an-array/) | [无] | [C++](1501-2000/1998-GCD-Sort-of-an-Array/cpp-1998/) | | |
| 1999 | [Smallest Greater Multiple Made of Two Digits](https://leetcode.com/problems/smallest-greater-multiple-made-of-two-digits/) | [无] | [C++](1501-2000/1999-Smallest-Greater-Multiple-Made-of-Two-Digits/cpp-1999/) | | |
| 2000 | [Reverse Prefix of Word](https://leetcode.com/problems/reverse-prefix-of-word/) | [无] | [C++](1501-2000/2000-Reverse-Prefix-of-Word/cpp-2000/) | | |
| 2001 | [Number of Pairs of Interchangeable Rectangles](https://leetcode.com/problems/number-of-pairs-of-interchangeable-rectangles/) | [无] | [C++](2001-2500/2001-Number-of-Pairs-of-Interchangeable-Rectangles/cpp-2001/) | | |
| 2002 | [Maximum Product of the Length of Two Palindromic Subsequences](https://leetcode.com/problems/maximum-product-of-the-length-of-two-palindromic-subsequences/) | [无] | [C++](2001-2500/2002-Maximum-Product-of-the-Length-of-Two-Palindromic-Subsequences/cpp-2002/) | | |
| 2003 | [Smallest Missing Genetic Value in Each Subtree](https://leetcode.com/problems/smallest-missing-genetic-value-in-each-subtree/) | [无] | [C++](2001-2500/2003-Smallest-Missing-Genetic-Value-in-Each-Subtree/cpp-2003/) | | |
| 2004 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2005 | [Subtree Removal Game with Fibonacci Tree](https://leetcode.com/problems/subtree-removal-game-with-fibonacci-tree/) | [无] | [C++](2001-2500/2005-Subtree-Removal-Game-with-Fibonacci-Tree/cpp-2005/) | | |
| 2006 | [Count Number of Pairs With Absolute Difference K](https://leetcode.com/problems/count-number-of-pairs-with-absolute-difference-k/) | [无] | [C++](2001-2500/2006-Count-Number-of-Pairs-With-Absolute-Difference-K/cpp-2006/) | | |
| 2007 | [Find Original Array From Doubled Array](https://leetcode.com/problems/find-original-array-from-doubled-array/) | [无] | [C++](2001-2500/2007-Find-Original-Array-From-Doubled-Array/cpp-2007/) | | |
| 2008 | [Maximum Earnings From Taxi](https://leetcode.com/problems/maximum-earnings-from-taxi/) | [无] | [C++](2001-2500/2008-Maximum-Earnings-From-Taxi/cpp-2008/) | | |
| 2009 | [Minimum Number of Operations to Make Array Continuous](https://leetcode.com/problems/minimum-number-of-operations-to-make-array-continuous/) | [无] | [C++](2001-2500/2009-Minimum-Number-of-Operations-to-Make-Array-Continuous/cpp-2009/) | | |
| 2010 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2011 | [Final Value of Variable After Performing Operations](https://leetcode.com/problems/final-value-of-variable-after-performing-operations/) | [无] | [C++](2001-2500/2011-Final-Value-of-Variable-After-Performing-Operations/cpp-2011/) | | |
| 2012 | [Sum of Beauty in the Array](https://leetcode.com/problems/sum-of-beauty-in-the-array/) | [无] | [C++](2001-2500/2012-Sum-of-Beauty-in-the-Array/cpp-2012/) | | |
| 2013 | [Detect Squares](https://leetcode.com/problems/detect-squares/) | [无] | [C++](2001-2500/2013-Detect-Squares/cpp-2013/) | | |
| 2014 | [Longest Subsequence Repeated k Times](https://leetcode.com/problems/longest-subsequence-repeated-k-times/) | [无] | [C++](2001-2500/2014-Longest-Subsequence-Repeated-k-Times/cpp-2014/) | | |
| 2015 | [Average Height of Buildings in Each Segment](https://leetcode.com/problems/average-height-of-buildings-in-each-segment/) | [无] | [C++](2001-2500/2015-Average-Height-of-Buildings-in-Each-Segment/cpp-2015/) | | |
| 2016 | [Maximum Difference Between Increasing Elements](https://leetcode.com/problems/maximum-difference-between-increasing-elements/) | [无] | [C++](2001-2500/2016-Maximum-Difference-Between-Increasing-Elements/cpp-2016/) | | |
| 2017 | [Grid Game](https://leetcode.com/problems/grid-game/) | [无] | [C++](2001-2500/2017-Grid-Game/cpp-2017/) | | |
| 2018 | [Check if Word Can Be Placed In Crossword](https://leetcode.com/problems/check-if-word-can-be-placed-in-crossword/) | [无] | [C++](2001-2500/2018-Check-if-Word-Can-Be-Placed-In-Crossword/cpp-2018/) | | |
| 2019 | [The Score of Students Solving Math Expression](https://leetcode.com/problems/the-score-of-students-solving-math-expression/) | [无] | [C++](2001-2500/2019-The-Score-of-Students-Solving-Math-Expression/cpp-2019/) | | |
| 2020 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2021 | [Brightest Position on Street](https://leetcode.com/problems/brightest-position-on-street/) | [无] | [C++](2001-2500/2021-Brightest-Position-on-Street/cpp-2021/) | | |
| 2022 | [Convert 1D Array Into 2D Array](https://leetcode.com/problems/convert-1d-array-into-2d-array/) | [无] | [C++](2001-2500/2022-Convert-1D-Array-Into-2D-Array/cpp-2022/) | | |
| 2023 | [Number of Pairs of Strings With Concatenation Equal to Target](https://leetcode.com/problems/number-of-pairs-of-strings-with-concatenation-equal-to-target/) | [无] | [C++](2001-2500/2023-Number-of-Pairs-of-Strings-With-Concatenation-Equal-to-Target/cpp-2023/) | | |
| 2024 | [Maximize the Confusion of an Exam](https://leetcode.com/problems/maximize-the-confusion-of-an-exam/) | [无] | [C++](2001-2500/2024-Maximize-the-Confusion-of-an-Exam/cpp-2024/) | | |
| 2025 | [Maximum Number of Ways to Partition an Array](https://leetcode.com/problems/maximum-number-of-ways-to-partition-an-array/) | [无] | [C++](2001-2500/2025-Maximum-Number-of-Ways-to-Partition-an-Array/cpp-2025/) | | |
| 2026 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2027 | [Minimum Moves to Convert String](https://leetcode.com/problems/minimum-moves-to-convert-string/) | [无] | [C++](2001-2500/2027-Minimum-Moves-to-Convert-String/cpp-2027/) | | |
| 2028 | [Find Missing Observations](https://leetcode.com/problems/find-missing-observations/) | [无] | [C++](2001-2500/2028-Find-Missing-Observations/cpp-2028/) | | |
| 2029 | [Stone Game IX](https://leetcode.com/problems/stone-game-ix/) | [无] | [C++](2001-2500/2029-Stone-Game-IX/cpp-2029/) | | |
| 2030 | [Smallest K-Length Subsequence With Occurrences of a Letter](https://leetcode.com/problems/smallest-k-length-subsequence-with-occurrences-of-a-letter/) | [无] | [C++](2001-2500/2030-Smallest-K-Length-Subsequence-With-Occurrences-of-a-Letter/cpp-2030/) | | |
| 2031 | [Count Subarrays With More Ones Than Zeros](https://leetcode.com/problems/count-subarrays-with-more-ones-than-zeros/) | [缺:更简单的解法] | [C++](2001-2500/2031-Count-Subarrays-With-More-Ones-Than-Zeros/cpp-2031/) | | |
| 2032 | [Two Out of Three](https://leetcode.com/problems/two-out-of-three/) | [无] | [C++](2001-2500/2032-Two-Out-of-Three/cpp-2032/) | | |
| 2033 | [Minimum Operations to Make a Uni-Value Grid](https://leetcode.com/problems/minimum-operations-to-make-a-uni-value-grid/) | [无] | [C++](2001-2500/2033-Minimum-Operations-to-Make-a-Uni-Value-Grid/cpp-2033/) | | |
| 2034 | [Stock Price Fluctuation](https://leetcode.com/problems/stock-price-fluctuation/) | [无] | [C++](2001-2500/2034-Stock-Price-Fluctuation/cpp-2034/) | | |
| 2035 | [Partition Array Into Two Arrays to Minimize Sum Difference](https://leetcode.com/problems/partition-array-into-two-arrays-to-minimize-sum-difference/) | [无] | [C++](2001-2500/2035-Partition-Array-Into-Two-Arrays-to-Minimize-Sum-Difference/cpp-2035/) | | |
| 2036 | [Maximum Alternating Subarray Sum](https://leetcode.com/problems/maximum-alternating-subarray-sum/) | [无] | [c++](2001-2500/2036-Maximum-Alternating-Subarray-Sum/cpp-2036/) | | |
| 2037 | [Minimum Number of Moves to Seat Everyone](https://leetcode.com/problems/minimum-number-of-moves-to-seat-everyone/) | [无] | [C++](2001-2500/2037-Minimum-Number-of-Moves-to-Seat-Everyone/cpp-2037/) | | |
| 2038 | [Remove Colored Pieces if Both Neighbors are the Same Color](https://leetcode.com/problems/remove-colored-pieces-if-both-neighbors-are-the-same-color/) | [无] | [C++](2001-2500/2038-Remove-Colored-Pieces-if-Both-Neighbors-are-the-Same-Color/cpp-2038/) | | |
| 2039 | [The Time When the Network Becomes Idle](https://leetcode.com/problems/the-time-when-the-network-becomes-idle/) | [无] | [C++](2001-2500/2039-The-Time-When-the-Network-Becomes-Idle/cpp-2039/) | | |
| 2040 | [Kth Smallest Product of Two Sorted Arrays](https://leetcode.com/problems/kth-smallest-product-of-two-sorted-arrays/) | [无] | [C++](2001-2500/2040-Kth-Smallest-Product-of-Two-Sorted-Arrays/cpp-2040/) | | |
| 2041 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2042 | [Check if Numbers Are Ascending in a Sentence](https://leetcode.com/problems/check-if-numbers-are-ascending-in-a-sentence/) | [无] | [C++](2001-2500/2042-Check-if-Numbers-Are-Ascending-in-a-Sentence/cpp-2042/) | | |
| 2043 | [Simple Bank System](https://leetcode.com/problems/simple-bank-system/) | [无] | [C++](2001-2500/2043-Simple-Bank-System/cpp-02043/) | | |
| 2044 | [Count Number of Maximum Bitwise-OR Subsets](https://leetcode.com/problems/count-number-of-maximum-bitwise-or-subsets/) | [无] | [C++](2001-2500/2044-Count-Number-of-Maximum-Bitwise-OR-Subsets/cpp-2044/) | | |
| 2045 | [Second Minimum Time to Reach Destination](https://leetcode.com/problems/second-minimum-time-to-reach-destination/) | [无] | [C++](2001-2500/2045-Second-Minimum-Time-to-Reach-Destination/cpp-2045/) | | |
| 2046 | [Sort Linked List Already Sorted Using Absolute Values](https://leetcode.com/problems/sort-linked-list-already-sorted-using-absolute-values/) | [无] | [C++](2001-2500/2046-Sort-Linked-List-Already-Sorted-Using-Absolute-Values/cpp-2046/) | | |
| 2047 | [Number of Valid Words in a Sentence](https://leetcode.com/problems/number-of-valid-words-in-a-sentence/) | [无] | [C++](2001-2500/2047-Number-of-Valid-Words-in-a-Sentence/cpp-2047/) | | |
| 2048 | [Next Greater Numerically Balanced Number](https://leetcode.com/problems/next-greater-numerically-balanced-number/) | [无] | [C++](2001-2500/2048-Next-Greater-Numerically-Balanced-Number/cpp-2048/) | | |
| 2049 | [Count Nodes With the Highest Score](https://leetcode.com/problems/count-nodes-with-the-highest-score/) | [无] | [C++](2001-2500/2049-Count-Nodes-With-the-Highest-Score/cpp-2049/) | | |
| 2050 | [Parallel Courses III](https://leetcode.com/problems/parallel-courses-iii/) | [无] | [C++](2001-2500/2050-Parallel-Courses-III/cpp-2050/) | | |
| 2051 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2052 | [Minimum Cost to Separate Sentence Into Rows](https://leetcode.com/problems/minimum-cost-to-separate-sentence-into-rows/) | [无] | [C++](2001-2500/2052-Minimum-Cost-to-Separate-Sentence-Into-Rows/cpp-2052/) | | |
| 2053 | [Kth Distinct String in an Array](https://leetcode.com/problems/kth-distinct-string-in-an-array/) | [无] | [C++](2001-2500/2053-Kth-Distinct-String-in-an-Array/cpp-2053/) | | |
| 2054 | [Two Best Non-Overlapping Events](https://leetcode.com/problems/two-best-non-overlapping-events/) | [无] | [C++](2001-2500/2054-Two-Best-Non-Overlapping-Events/cpp-2054/) | | |
| 2055 | [Plates Between Candles](https://leetcode.com/problems/plates-between-candles/) | [无] | [C++](2001-2500/2055-Plates-Between-Candles/cpp-2055/) | | |
| 2056 | [Number of Valid Move Combinations On Chessboard](https://leetcode.com/problems/number-of-valid-move-combinations-on-chessboard/) | [无] | [C++](2001-2500/2056-Number-of-Valid-Move-Combinations-On-Chessboard/cpp-2056/) | | |
| 2057 | [Smallest Index With Equal Value](https://leetcode.com/problems/smallest-index-with-equal-value/) | [无] | [C++](2001-2500/2057-Smallest-Index-With-Equal-Value/cpp-2057/) | | |
| 2058 | [Find the Minimum and Maximum Number of Nodes Between Critical Points](https://leetcode.com/problems/find-the-minimum-and-maximum-number-of-nodes-between-critical-points/) | [无] | [C++](2001-2500/2058-Find-the-Minimum-and-Maximum-Number-of-Nodes-Between-Critical-Points/cpp-2058/) | | |
| 2059 | [Minimum Operations to Convert Number](https://leetcode.com/problems/minimum-operations-to-convert-number/) | [无] | [C++](2001-2500/2059-Minimum-Operations-to-Convert-Number/cpp-2059/) | | |
| 2060 | [Check if an Original String Exists Given Two Encoded Strings](https://leetcode.com/problems/check-if-an-original-string-exists-given-two-encoded-strings/) | [无] | [C++](2001-2500/2060-Check-if-an-Original-String-Exists-Given-Two-Encoded-Strings/cpp-2060/) | | |
| 2061 | [Number of Spaces Cleaning Robot Cleaned](https://leetcode.com/problems/number-of-spaces-cleaning-robot-cleaned/) | [无] | [C++](2001-2500/2061-Number-of-Spaces-Cleaning-Robot-Cleaned/cpp-2061/) | | |
| 2062 | [Count Vowel Substrings of a String](https://leetcode.com/problems/count-vowel-substrings-of-a-string/) | [无] | [C++](2001-2500/2062-Count-Vowel-Substrings-of-a-String/cpp-2062/) | | |
| 2063 | [Vowels of All Substrings](https://leetcode.com/problems/vowels-of-all-substrings/) | [无] | [C++](2001-2500/2063-Vowels-of-All-Substrings/cpp-2063/) | | |
| 2064 | [Minimized Maximum of Products Distributed to Any Store](https://leetcode.com/problems/minimized-maximum-of-products-distributed-to-any-store/) | [无] | [C++](2001-2500/2064-Minimized-Maximum-of-Products-Distributed-to-Any-Store/cpp-2064/) | | |
| 2065 | [Maximum Path Quality of a Graph](https://leetcode.com/problems/maximum-path-quality-of-a-graph/) | [无] | [C++](2001-2500/2065-Maximum-Path-Quality-of-a-Graph/cpp-2065/) | | |
| 2066 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2067 | [Number of Equal Count Substrings](https://leetcode.com/problems/number-of-equal-count-substrings/) | [无] | [C++](2001-2500/2067-Number-of-Equal-Count-Substrings/cpp-2067/) | | |
| 2068 | [Check Whether Two Strings are Almost Equivalent](https://leetcode.com/problems/check-whether-two-strings-are-almost-equivalent/) | [无] | [C++](2001-2500/2068-Check-Whether-Two-Strings-are-Almost-Equivalent/cpp-2068/) | | |
| 2069 | [Walking Robot Simulation II](https://leetcode.com/problems/walking-robot-simulation-ii/) | [无] | [C++](2001-2500/2069-Walking-Robot-Simulation-II/cpp-2069/) | | |
| 2070 | [Most Beautiful Item for Each Query](https://leetcode.com/problems/most-beautiful-item-for-each-query/) | [无] | [C++](2001-2500/2070-Most-Beautiful-Item-for-Each-Query/cpp-2070/) | | |
| 2071 | [Maximum Number of Tasks You Can Assign](https://leetcode.com/problems/maximum-number-of-tasks-you-can-assign/) | [无] | [C++](2001-2500/2071-Maximum-Number-of-Tasks-You-Can-Assign/cpp-2071/) | | |
| 2072 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2073 | [Time Needed to Buy Tickets](https://leetcode.com/problems/time-needed-to-buy-tickets/) | [无] | [C++](2001-2500/2073-Time-Needed-to-Buy-Tickets/cpp-2073/) | | |
| 2074 | [Reverse Nodes in Even Length Groups](https://leetcode.com/problems/reverse-nodes-in-even-length-groups/) | [无] | [C++](2001-2500/2074-Reverse-Nodes-in-Even-Length-Groups/cpp-2074/) | | |
| 2075 | [Decode the Slanted Ciphertext](https://leetcode.com/problems/decode-the-slanted-ciphertext/) | [无] | [C++](2001-2500/2075-Decode-the-Slanted-Ciphertext/cpp-2075/) | | |
| 2076 | [Process Restricted Friend Requests](https://leetcode.com/problems/process-restricted-friend-requests/) | [无] | [C++](2001-2500/2076-Process-Restricted-Friend-Requests/cpp-2076/) | | |
| 2077 | [Paths in Maze That Lead to Same Room](https://leetcode.com/problems/paths-in-maze-that-lead-to-same-room/) | [无] | [C++](2001-2500/2077-Paths-in-Maze-That-Lead-to-Same-Room/cpp-2077/) | | |
| 2078 | [Two Furthest Houses With Different Colors](https://leetcode.com/problems/two-furthest-houses-with-different-colors/) | [无] | [C++](2001-2500/2078-Two-Furthest-Houses-With-Different-Colors/cpp-2078/) | | |
| 2079 | [Watering Plants](https://leetcode.com/problems/watering-plants/) | [无] | [C++](2001-2500/2079-Watering-Plants/cpp-2079/) | | |
| 2080 | [Range Frequency Queries](https://leetcode.com/problems/range-frequency-queries/) | [无] | [C++](2001-2500/2080-Range-Frequency-Queries/cpp-2080/) | | |
| 2081 | [Sum of k-Mirror Numbers](https://leetcode.com/problems/sum-of-k-mirror-numbers/) | [无] | [C++](2001-2500/2081-Sum-of-k-Mirror-Numbers/cpp-2081/) | | |
| 2082 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2083 | [Substrings That Begin and End With the Same Letter](https://leetcode.com/problems/substrings-that-begin-and-end-with-the-same-letter/) | [无] | [C++](2001-2500/2083-Substrings-That-Begin-and-End-With-the-Same-Letter/cpp-2083/) | | |
| 2084 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2085 | [Count Common Words With One Occurrence](https://leetcode.com/problems/count-common-words-with-one-occurrence/) | [无] | [C++](2001-2500/2085-Count-Common-Words-With-One-Occurrence/cpp-2085/) | | |
| 2086 | [Minimum Number of Buckets Required to Collect Rainwater from Houses](https://leetcode.com/problems/minimum-number-of-buckets-required-to-collect-rainwater-from-houses/) | [无] | [C++](2001-2500/2086-Minimum-Number-of-Buckets-Required-to-Collect-Rainwater-from-Houses/cpp-2086/) | | |
| 2087 | [Minimum Cost Homecoming of a Robot in a Grid](https://leetcode.com/problems/minimum-cost-homecoming-of-a-robot-in-a-grid/) | [无] | [C++](2001-2500/2087-Minimum-Cost-Homecoming-of-a-Robot-in-a-Grid/cpp-2087/) | | |
| 2088 | [Count Fertile Pyramids in a Land](https://leetcode.com/problems/count-fertile-pyramids-in-a-land/) | [无] | [C++](2001-2500/2088-Count-Fertile-Pyramids-in-a-Land/cpp-2088/) | | |
| 2089 | [Find Target Indices After Sorting Array](https://leetcode.com/problems/find-target-indices-after-sorting-array/) | [无] | [C++](2001-2500/2089-Find-Target-Indices-After-Sorting-Array/cpp-2089/) | | |
| 2090 | [K Radius Subarray Averages](https://leetcode.com/problems/k-radius-subarray-averages/) | [无] | [C++](2001-2500/2090-K-Radius-Subarray-Averages/cpp-2090/) | | |
| 2091 | [Removing Minimum and Maximum From Array](https://leetcode.com/problems/removing-minimum-and-maximum-from-array/) | [无] | [C++](2001-2500/2091-Removing-Minimum-and-Maximum-From-Array/cpp-2091/) | | |
| 2092 | [Find All People With Secret](https://leetcode.com/problems/find-all-people-with-secret/) | [无] | [C++](2001-2500/2092-Find-All-People-With-Secret/cpp-2092/) | | |
| 2093 | [Minimum Cost to Reach City With Discounts](https://leetcode.com/problems/minimum-cost-to-reach-city-with-discounts/) | [无] | [C++](2001-2500/2093-Minimum-Cost-to-Reach-City-With-Discounts/cpp-2093/) | | |
| 2094 | [Finding 3-Digit Even Numbers](https://leetcode.com/problems/finding-3-digit-even-numbers/) | [无] | [C++](2001-2500/2094-Finding-3-Digit-Even-Numbers/cpp-2094/) | | |
| 2095 | [Delete the Middle Node of a Linked List](https://leetcode.com/problems/delete-the-middle-node-of-a-linked-list/) | [无] | [C++](2001-2500/2095-Delete-the-Middle-Node-of-a-Linked-List/cpp-2095/) | | |
| 2096 | [Step-By-Step Directions From a Binary Tree Node to Another](https://leetcode.com/problems/step-by-step-directions-from-a-binary-tree-node-to-another/) | [无] | [C++](2001-2500/2096-Step-By-Step-Directions-From-a-Binary-Tree-Node-to-Another/cpp-2096/) | | |
| 2097 | [Valid Arrangement of Pairs](https://leetcode.com/problems/valid-arrangement-of-pairs/) | [无] | [C++](2001-2500/2097-Valid-Arrangement-of-Pairs/cpp-2097/) | | |
| 2098 | [Subsequence of Size K With the Largest Even Sum](https://leetcode.com/problems/subsequence-of-size-k-with-the-largest-even-sum/) | [无] | [C++](2001-2500/2098-Subsequence-of-Size-K-With-the-Largest-Even-Sum/cpp-2098/) | | |
| 2099 | [Find Subsequence of Length K With the Largest Sum](https://leetcode.com/problems/find-subsequence-of-length-k-with-the-largest-sum/) | [无] | [C++](2001-2500/2099-Find-Subsequence-of-Length-K-With-the-Largest-Sum/cpp-2099/) | | |
| 2100 | [Find Good Days to Rob the Bank](https://leetcode.com/problems/find-good-days-to-rob-the-bank/) | [无] | [C++](2001-2500/2100-Find-Good-Days-to-Rob-the-Bank/cpp-2100/) | | |
| 2101 | [Detonate the Maximum Bombs](https://leetcode.com/problems/detonate-the-maximum-bombs/) | [无] | [C++](2001-2500/2101-Detonate-the-Maximum-Bombs/cpp-2101/) | | |
| 2102 | [Sequentially Ordinal Rank Tracker](https://leetcode.com/problems/sequentially-ordinal-rank-tracker/) | [无] | [C++](2001-2500/2102-Sequentially-Ordinal-Rank-Tracker/cpp-2102/) | | |
| 2103 | [Rings and Rods](https://leetcode.com/problems/rings-and-rods/) | [无] | [C++](2001-2500/2103-Rings-and-Rods/cpp-2103/) | | |
| 2104 | [Sum of Subarray Ranges](https://leetcode.com/problems/sum-of-subarray-ranges/) | [无] | [C++](2001-2500/2104-Sum-of-Subarray-Ranges/cpp-2104/) | | |
| 2105 | [Watering Plants II](https://leetcode.com/problems/watering-plants-ii/) | [无] | [C++](2001-2500/2105-Watering-Plants-II/cpp-2105/) | | |
| 2106 | [Maximum Fruits Harvested After at Most K Steps](https://leetcode.com/problems/maximum-fruits-harvested-after-at-most-k-steps/) | [无] | [C++](2001-2500/2106-Maximum-Fruits-Harvested-After-at-Most-K-Steps/cpp-2106/) | | |
| 2107 | [Number of Unique Flavors After Sharing K Candies](https://leetcode.com/problems/number-of-unique-flavors-after-sharing-k-candies/) | [无] | [C++](2001-2500/2107-Number-of-Unique-Flavors-After-Sharing-K-Candies/cpp-2107/) | | |
| 2108 | [Find First Palindromic String in the Array](https://leetcode.com/problems/find-first-palindromic-string-in-the-array/) | [无] | [C++](2001-2500/2108-Find-First-Palindromic-String-in-the-Array/cpp-2108/) | | |
| 2109 | [Adding Spaces to a String](https://leetcode.com/problems/adding-spaces-to-a-string/) | [无] | [C++](2001-2500/2109-Adding-Spaces-to-a-String/cpp-2109/) | | |
| 2110 | [Number of Smooth Descent Periods of a Stock](https://leetcode.com/problems/number-of-smooth-descent-periods-of-a-stock/) | [无] | [C++](2001-2500/2110-Number-of-Smooth-Descent-Periods-of-a-Stock/cpp-2110/) | | |
| 2111 | [Minimum Operations to Make the Array K-Increasing](https://leetcode.com/problems/minimum-operations-to-make-the-array-k-increasing/) | [无] | [C++](2001-2500/2111-Minimum-Operations-to-Make-the-Array-K-Increasing/cpp-2111/) | | |
| 2112 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2113 | [Elements in Array After Removing and Replacing Elements](https://leetcode.com/problems/elements-in-array-after-removing-and-replacing-elements/) | [无] | [C++](2001-2500/2113-Elements-in-Array-After-Removing-and-Replacing-Elements/cpp-2113/) | | |
| 2114 | [Maximum Number of Words Found in Sentences](https://leetcode.com/problems/maximum-number-of-words-found-in-sentences/) | [无] | [C++](2001-2500/2114-Maximum-Number-of-Words-Found-in-Sentences/cpp-2114/) | | |
| 2115 | [Find All Possible Recipes from Given Supplies](https://leetcode.com/problems/find-all-possible-recipes-from-given-supplies/) | [无] | [C++](2001-2500/2115-Find-All-Possible-Recipes-from-Given-Supplies/cpp-2115/) | | |
| 2116 | [Check if a Parentheses String Can Be Valid](https://leetcode.com/problems/check-if-a-parentheses-string-can-be-valid/) | [无] | [C++](2001-2500/2116-Check-if-a-Parentheses-String-Can-Be-Valid/cpp-2116/) | | |
| 2117 | [Abbreviating the Product of a Range](https://leetcode.com/problems/abbreviating-the-product-of-a-range/) | [无] | [C++](2001-2500/2117-Abbreviating-the-Product-of-a-Range/cpp-2117/) | | |
| 2118 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2119 | [A Number After a Double Reversal](https://leetcode.com/problems/a-number-after-a-double-reversal/) | [无] | [C++](2001-2500/2119-A-Number-After-a-Double-Reversal/cpp-2119/) | | |
| 2120 | [Execution of All Suffix Instructions Staying in a Grid](https://leetcode.com/problems/execution-of-all-suffix-instructions-staying-in-a-grid/) | [无] | [C++](2001-2500/2120-Execution-of-All-Suffix-Instructions-Staying-in-a-Grid/cpp-2120/) | | |
| 2121 | [Intervals Between Identical Elements](https://leetcode.com/problems/intervals-between-identical-elements/) | [无] | [C++](2001-2500/2121-Intervals-Between-Identical-Elements/cpp-2121/) | | |
| 2122 | [Recover the Original Array](https://leetcode.com/problems/recover-the-original-array/) | [无] | [C++](2001-2500/2122-Recover-the-Original-Array/cpp-2122/) | | |
| 2123 | [Minimum Operations to Remove Adjacent Ones in Matrix](2001-2500/2123-Minimum-Operations-to-Remove-Adjacent-Ones-in-Matrix/cpp-2123/) | [无] | [C++](2001-2500/2123-Minimum-Operations-to-Remove-Adjacent-Ones-in-Matrix/cpp-2123/) | | |
| 2124 | [Check if All A's Appears Before All B's](https://leetcode.com/problems/check-if-all-as-appears-before-all-bs/) | [无] | [C++](2001-2500/2124-Check-if-All-As-Appears-Before-All-Bs/cpp-2124/) | | |
| 2125 | [Number of Laser Beams in a Bank](https://leetcode.com/problems/number-of-laser-beams-in-a-bank/) | [无] | [C++](2001-2500/2125-Number-of-Laser-Beams-in-a-Bank/cpp-2125/) | | |
| 2126 | [Destroying Asteroids](https://leetcode.com/problems/destroying-asteroids/) | [无] | [C++](2001-2500/2126-Destroying-Asteroids/cpp-2126/) | | |
| 2127 | [Maximum Employees to Be Invited to a Meeting](https://leetcode.com/problems/maximum-employees-to-be-invited-to-a-meeting/) | [无] | [C++](2001-2500/2127-Maximum-Employees-to-Be-Invited-to-a-Meeting/cpp-2127/) | | |
| 2128 | [Remove All Ones With Row and Column Flips](https://leetcode.com/problems/remove-all-ones-with-row-and-column-flips/) | [C++](2001-2500/2128-Remove-All-Ones-With-Row-and-Column-Flips/cpp-2128/) | | | |
| 2129 | [Capitalize the Title](https://leetcode.com/problems/capitalize-the-title/) | [无] | [C++](2001-2500/2129-Capitalize-the-Title/cpp-2129/) | | |
| 2130 | [Maximum Twin Sum of a Linked List](https://leetcode.com/problems/maximum-twin-sum-of-a-linked-list/) | [无] | [C++](2001-2500/2130-Maximum-Twin-Sum-of-a-Linked-List/cpp-2130/) | | |
| 2131 | [Longest Palindrome by Concatenating Two Letter Words](https://leetcode.com/problems/longest-palindrome-by-concatenating-two-letter-words/) | [无] | [C++](2001-2500/2131-Longest-Palindrome-by-Concatenating-Two-Letter-Words/cpp-2131/) | | |
| 2132 | [Stamping the Grid](https://leetcode.com/problems/stamping-the-grid/) | [缺:二维差分数组] | [C++](2001-2500/2132-Stamping-the-Grid/cpp-2132/) | | |
| 2133 | [Check if Every Row and Column Contains All Numbers](https://leetcode.com/problems/check-if-every-row-and-column-contains-all-numbers/) | [无] | [C++](2001-2500/2133-Check-if-Every-Row-and-Column-Contains-All-Numbers/cpp-2133/) | | |
| 2134 | [Minimum Swaps to Group All 1's Together II](https://leetcode.com/problems/minimum-swaps-to-group-all-1s-together-ii/) | [无] | [C++](2001-2500/2134-Minimum-Swaps-to-Group-All-1s-Together-II/cpp-2134/) | | |
| 2135 | [Count Words Obtained After Adding a Letter](https://leetcode.com/problems/count-words-obtained-after-adding-a-letter/) | [无] | [C++](2001-2500/2135-Count-Words-Obtained-After-Adding-a-Letter/cpp-2135/) | | |
| 2136 | [Earliest Possible Day of Full Bloom](https://leetcode.com/problems/earliest-possible-day-of-full-bloom/) | [无] | [C++](2001-2500/2136-Earliest-Possible-Day-of-Full-Bloom/cpp-2136/) | | |
| 2137 | [Pour Water Between Buckets to Make Water Levels Equal](https://leetcode.com/problems/pour-water-between-buckets-to-make-water-levels-equal/) | [无] | [C++](2001-2500/2137-Pour-Water-Between-Buckets-to-Make-Water-Levels-Equal/cpp-2137/) | | |
| 2138 | [Divide a String Into Groups of Size k](https://leetcode.com/problems/divide-a-string-into-groups-of-size-k/) | [无] | [C++](2001-2500/2138-Divide-a-String-Into-Groups-of-Size-k/cpp-2138/) | | |
| 2139 | [Minimum Moves to Reach Target Score](https://leetcode.com/problems/minimum-moves-to-reach-target-score/) | [无] | [C++](2001-2500/2139-Minimum-Moves-to-Reach-Target-Score/cpp-2139/) | | |
| 2140 | [Solving Questions With Brainpower](https://leetcode.com/problems/solving-questions-with-brainpower/) | [无] | [C++](2001-2500/2140-Solving-Questions-With-Brainpower/cpp-2140/) | | |
| 2141 | [Maximum Running Time of N Computers](https://leetcode.com/problems/maximum-running-time-of-n-computers/) | [无] | [C++](2001-2500/2141-Maximum-Running-Time-of-N-Computers/cpp-2141/) | | |
| 2142 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2143 | [Choose Numbers From Two Arrays in Range](https://leetcode.com/problems/choose-numbers-from-two-arrays-in-range/) | [无] | [C++](2001-2500/2143-Choose-Numbers-From-Two-Arrays-in-Range/cpp-2143/) | | |
| 2144 | [Minimum Cost of Buying Candies With Discount](https://leetcode.com/problems/minimum-cost-of-buying-candies-with-discount/) | [无] | [C++](2001-2500/2144-Minimum-Cost-of-Buying-Candies-With-Discount/cpp-2144/) | | |
| 2145 | [Count the Hidden Sequences](https://leetcode.com/problems/count-the-hidden-sequences/) | [无] | [C++](2001-2500/2145-Count-the-Hidden-Sequences/cpp-2145/) | | |
| 2146 | [K Highest Ranked Items Within a Price Range](https://leetcode.com/problems/k-highest-ranked-items-within-a-price-range/) | [无] | [C++](2001-2500/2146-K-Highest-Ranked-Items-Within-a-Price-Range/cpp-2146/) | | |
| 2147 | [Number of Ways to Divide a Long Corridor](https://leetcode.com/problems/number-of-ways-to-divide-a-long-corridor/) | [无]
[缺:数学更简单的写法;dp] | [C++](2001-2500/2147-Number-of-Ways-to-Divide-a-Long-Corridor/cpp-2147/) | | |
| 2148 | [Count Elements With Strictly Smaller and Greater Elements](https://leetcode.com/problems/count-elements-with-strictly-smaller-and-greater-elements/) | [无] | [C++](2001-2500/2148-Count-Elements-With-Strictly-Smaller-and-Greater-Elements/cpp-2148/) | | |
| 2149 | [Rearrange Array Elements by Sign](https://leetcode.com/problems/rearrange-array-elements-by-sign/) | [无] | [C++](2001-2500/2149-Rearrange-Array-Elements-by-Sign/cpp-2149/) | | |
| 2150 | [Find All Lonely Numbers in the Array](https://leetcode.com/problems/find-all-lonely-numbers-in-the-array/) | [无] | [C++](2001-2500/2150-Find-All-Lonely-Numbers-in-the-Array/cpp-2150/) | | |
| 2151 | [Maximum Good People Based on Statements](https://leetcode.com/problems/maximum-good-people-based-on-statements/) | [无] | [C++](2001-2500/2151-Maximum-Good-People-Based-on-Statements/cpp-2151/) | | |
| 2152 | [Minimum Number of Lines to Cover Points](https://leetcode.com/problems/minimum-number-of-lines-to-cover-points/) | [无] | [C++](2001-2500/2152-Minimum-Number-of-Lines-to-Cover-Points/cpp-2152/) | | |
| 2153 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2154 | [Keep Multiplying Found Values by Two](https://leetcode.com/problems/keep-multiplying-found-values-by-two/) | [无] | [C++](2001-2500/2154-Keep-Multiplying-Found-Values-by-Two/cpp-2154/) | | |
| 2155 | [All Divisions With the Highest Score of a Binary Array](https://leetcode.com/problems/all-divisions-with-the-highest-score-of-a-binary-array/) | [无] | [C++](2001-2500/2155-All-Divisions-With-the-Highest-Score-of-a-Binary-Array/cpp-2155/) | | |
| 2156 | [Find Substring With Given Hash Value](https://leetcode.com/problems/find-substring-with-given-hash-value/) | [无] | [C++](2001-2500/2156-Find-Substring-With-Given-Hash-Value/cpp-2156/) | | |
| 2157 | [Groups of Strings](https://leetcode.com/problems/groups-of-strings/) | [无] | [C++](2001-2500/2157-Groups-of-Strings/cpp-2157/) | | |
| 2158 | [Amount of New Area Painted Each Day](https://leetcode.com/problems/amount-of-new-area-painted-each-day/) | [无] | [C++](2001-2500/2158-Amount-of-New-Area-Painted-Each-Day/cpp-2158/) | | |
| 2159 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2160 | [Minimum Sum of Four Digit Number After Splitting Digits](https://leetcode.com/problems/minimum-sum-of-four-digit-number-after-splitting-digits/) | [无] | [C++](2001-2500/2160-Minimum-Sum-of-Four-Digit-Number-After-Splitting-Digits/cpp-2160/) | | |
| 2161 | [Partition Array According to Given Pivot](https://leetcode.com/problems/partition-array-according-to-given-pivot/) | [无] | [C++](2001-2500/2161-Partition-Array-According-to-Given-Pivot/cpp-2161/) | | |
| 2162 | [Minimum Cost to Set Cooking Time](https://leetcode.com/problems/minimum-cost-to-set-cooking-time/) | [无] | [C++](2001-2500/2162-Minimum-Cost-to-Set-Cooking-Time/cpp-2162/) | | |
| 2163 | [Minimum Difference in Sums After Removal of Elements](https://leetcode.com/problems/minimum-difference-in-sums-after-removal-of-elements/) | [无] | [C++](2001-2500/2163-Minimum-Difference-in-Sums-After-Removal-of-Elements/cpp-2163/) | | |
| 2164 | [Sort Even and Odd Indices Independently](https://leetcode.com/problems/sort-even-and-odd-indices-independently/) | [无] | [C++](2001-2500/2164-Sort-Even-and-Odd-Indices-Independently/cpp-2164/) | | |
| 2165 | [Smallest Value of the Rearranged Number](https://leetcode.com/problems/smallest-value-of-the-rearranged-number/) | [无] | [C++](2001-2500/2165-Smallest-Value-of-the-Rearranged-Number/cpp-2165/) | | |
| 2166 | [Design Bitset](https://leetcode.com/problems/design-bitset/) | [无] | [C++](2001-2500/2166-Design-Bitset/cpp-2166/) | | |
| 2167 | [Minimum Time to Remove All Cars Containing Illegal Goods](https://leetcode.com/problems/minimum-time-to-remove-all-cars-containing-illegal-goods/) | [无] | [C++](2001-2500/2167-Minimum-Time-to-Remove-All-Cars-Containing-Illegal-Goods/cpp-2167/) | | |
| 2168 | [Unique Substrings With Equal Digit Frequency](https://leetcode.com/problems/unique-substrings-with-equal-digit-frequency/) | [无] | [C++](2001-2500/2168-Unique-Substrings-With-Equal-Digit-Frequency/cpp-2168/) | | |
| 2169 | [Count Operations to Obtain Zero](https://leetcode.com/problems/count-operations-to-obtain-zero/) | [无] | [C++](2001-2500/2169-Count-Operations-to-Obtain-Zero/cpp-2169/) | | |
| 2170 | [Minimum Operations to Make the Array Alternating](https://leetcode.com/problems/minimum-operations-to-make-the-array-alternating/) | [无] | [C++](2001-2500/2170-Minimum-Operations-to-Make-the-Array-Alternating/cpp-2170/) | | |
| 2171 | [Removing Minimum Number of Magic Beans](https://leetcode.com/problems/removing-minimum-number-of-magic-beans/) | [无] | [C++](2001-2500/2171-Removing-Minimum-Number-of-Magic-Beans/cpp-2171/) | | |
| 2172 | [Maximum AND Sum of Array](https://leetcode.com/problems/maximum-and-sum-of-array/) | [无] | [C++](2001-2500/2172-Maximum-AND-Sum-of-Array/cpp-2172/) | | |
| 2173 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2174 | [Remove All Ones With Row and Column Flips II](https://leetcode.com/problems/remove-all-ones-with-row-and-column-flips-ii/) | [无] | [C++](2001-2500/2174-Remove-All-Ones-With-Row-and-Column-Flips-II/cpp-2174/) | | |
| 2175 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2176 | [Count Equal and Divisible Pairs in an Array](https://leetcode.com/problems/count-equal-and-divisible-pairs-in-an-array/) | [无] | [C++](2001-2500/2176-Count-Equal-and-Divisible-Pairs-in-an-Array/cpp-2176/) | | |
| 2177 | [Find Three Consecutive Integers That Sum to a Given Number](https://leetcode.com/problems/find-three-consecutive-integers-that-sum-to-a-given-number/) | [无] | [C++](2001-2500/2177-Find-Three-Consecutive-Integers-That-Sum-to-a-Given-Number/cpp-2177/) | | |
| 2178 | [Maximum Split of Positive Even Integers](https://leetcode.com/problems/maximum-split-of-positive-even-integers/) | [无] | [C++](2001-2500/2178-Maximum-Split-of-Positive-Even-Integers/cpp-2178/) | | |
| 2179 | [Count Good Triplets in an Array](https://leetcode.com/problems/count-good-triplets-in-an-array/) | [无] | [C++](2001-2500/2179-Count-Good-Triplets-in-an-Array/cpp-2179/) | | |
| 2180 | [Count Integers With Even Digit Sum](https://leetcode.com/problems/count-integers-with-even-digit-sum/) | [无] | [C++](2001-2500/2180-Count-Integers-With-Even-Digit-Sum/cpp-2180/) | | |
| 2181 | [Merge Nodes in Between Zeros](https://leetcode.com/problems/merge-nodes-in-between-zeros/) | [无] | [C++](2001-2500/2181-Merge-Nodes-in-Between-Zeros/cpp-2181/) | | |
| 2182 | [Construct String With Repeat Limit](https://leetcode.com/problems/construct-string-with-repeat-limit/) | [C++](2001-2500/2182-Construct-String-With-Repeat-Limit/cpp-2182/) | | | |
| 2183 | [Count Array Pairs Divisible by K](https://leetcode.com/problems/count-array-pairs-divisible-by-k/) | [无] | [C++](2001-2500/2183-Count-Array-Pairs-Divisible/cpp-2183/) | | |
| 2184 | [Number of Ways to Build Sturdy Brick Wall](https://leetcode.com/problems/number-of-ways-to-build-sturdy-brick-wall/) | [无] | [C++](2001-2500/2184-Number-of-Ways-to-Build-Sturdy-Brick-Wall/cpp-2184/) | | |
| 2185 | [Counting Words With a Given Prefix](https://leetcode.com/problems/counting-words-with-a-given-prefix/) | [无] | [C++](2001-2500/2185-Counting-Words-With-a-Given-Prefix/cpp-2185/) | | |
| 2186 | [Minimum Number of Steps to Make Two Strings Anagram II](https://leetcode.com/problems/minimum-number-of-steps-to-make-two-strings-anagram-ii/) | [无] | [C++](2001-2500/2186-Minimum-Number-of-Steps-to-Make-Two-Strings-Anagram-II/cpp-2186/) | | |
| 2187 | [Minimum Time to Complete Trips](https://leetcode.com/problems/minimum-time-to-complete-trips/) | [无] | [C++](2001-2500/2187-Minimum-Time-to-Complete-Trips/cpp-2187/) | | |
| 2188 | [Minimum Time to Finish the Race](https://leetcode.com/problems/minimum-time-to-finish-the-race/) | [无] | [C++](2001-2500/2188-Minimum-Time-to-Finish-the-Race/cpp-2188/) | | |
| 2189 | [Number of Ways to Build House of Cards](https://leetcode.com/problems/number-of-ways-to-build-house-of-cards/) | [无] | [C++](2001-2500/2189-Number-of-Ways-to-Build-House-of-Cards/cpp-2189/) | | |
| 2190 | [Most Frequent Number Following Key In an Array](https://leetcode.com/problems/most-frequent-number-following-key-in-an-array/) | [无] | [C++](2001-2500/2190-Most-Frequent-Number-Following-Key-In-an-Array/cpp-2190/) | | |
| 2191 | [Sort the Jumbled Numbers](https://leetcode.com/problems/sort-the-jumbled-numbers/) | [无] | [C++](2001-2500/2191-Sort-the-Jumbled-Numbers/cpp-2191/) | | |
| 2192 | [All Ancestors of a Node in a Directed Acyclic Graph](https://leetcode.com/problems/all-ancestors-of-a-node-in-a-directed-acyclic-graph/) | [无] | [C++](2001-2500/2192-All-Ancestors-of-a-Node-in-a-Directed-Acyclic-Graph/cpp-2192/) | | |
| 2193 | [Minimum Number of Moves to Make Palindrome](https://leetcode.com/problems/minimum-number-of-moves-to-make-palindrome/) | [无] | [C++](2001-2500/2193-Minimum-Number-of-Moves-to-Make-Palindrome/cpp-2193/) | | |
| 2194 | [Cells in a Range on an Excel Sheet](https://leetcode.com/problems/cells-in-a-range-on-an-excel-sheet/) | [无] | [C++](2001-2500/2194-Cells-in-a-Range-on-an-Excel-Sheet/cpp-2194/) | | |
| 2195 | [Append K Integers With Minimal Sum](https://leetcode.com/problems/append-k-integers-with-minimal-sum/) | [无] | [C++](2001-2500/2195-Append-K-Integers-With-Minimal-Sum/cpp-2195/) | | |
| 2196 | [Create Binary Tree From Descriptions](https://leetcode.com/problems/create-binary-tree-from-descriptions/) | [无] | [C++](2001-2500/2196-Create-Binary-Tree-From-Descriptions/cpp-2196/) | | |
| 2197 | [Replace Non-Coprime Numbers in Array](https://leetcode.com/problems/replace-non-coprime-numbers-in-array/) | [无] | [C++](2001-2500/2197-Replace-Non-Coprime-Numbers-in-Array/cpp-2197/) | | |
| 2198 | [Number of Single Divisor Triplets](https://leetcode.com/problems/number-of-single-divisor-triplets/) | [无] | [C++](2001-2500/2198-Number-of-Single-Divisor-Triplets/cpp-2198/) | | |
| 2199 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2200 | [Find All K-Distant Indices in an Array](https://leetcode.com/problems/find-all-k-distant-indices-in-an-array/) | [无] | [C++](2001-2500/2200-Find-All-K-Distant-Indices-in-an-Array/cpp-2200/) | | |
| 2201 | [Count Artifacts That Can Be Extracted](https://leetcode.com/problems/count-artifacts-that-can-be-extracted/) | [无] | [C++](2001-2500/2201-Count-Artifacts-That-Can-Be-Extracted/cpp-2201/) | | |
| 2202 | [Maximize the Topmost Element After K Moves](https://leetcode.com/problems/maximize-the-topmost-element-after-k-moves/) | [无] | [C++](2001-2500/2202-Maximize-the-Topmost-Element-After-K-Moves/cpp-2202/) | | |
| 2203 | [Minimum Weighted Subgraph With the Required Paths](https://leetcode.com/problems/minimum-weighted-subgraph-with-the-required-paths/) | [无] | [C++](2001-2500/2203-Minimum-Weighted-Subgraph-With-the-Required-Paths/cpp-2203/) | | |
| 2204 | [Distance to a Cycle in Undirected Graph](https://leetcode.com/problems/distance-to-a-cycle-in-undirected-graph/) | [无] | [C++](2001-2500/2204-Distance-to-a-Cycle-in-Undirected-Graph/cpp-2204/) | | |
| 2205 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2206 | [Divide Array Into Equal Pairs](https://leetcode.com/problems/divide-array-into-equal-pairs/) | [无] | [C++](2001-2500/2206-Divide-Array-Into-Equal-Pairs/cpp-2206/) | | |
| 2207 | [Maximize Number of Subsequences in a String](https://leetcode.com/problems/maximize-number-of-subsequences-in-a-string/) | [无] | [C++](2001-2500/2207-Maximize-Number-of-Subsequences-in-a-String/cpp-2207/) | | |
| 2208 | [Minimum Operations to Halve Array Sum](https://leetcode.com/problems/minimum-operations-to-halve-array-sum/) | [无] | [C++](2001-2500/2208-Minimum-Operations-to-Halve-Array-Sum/cpp-2208/) | | |
| 2209 | [Minimum White Tiles After Covering With Carpets](https://leetcode.com/problems/minimum-white-tiles-after-covering-with-carpets/) | [无] | [C++](2001-2500/2209-Minimum-White-Tiles-After-Covering-With-Carpets/cpp-2209/) | | |
| 2210 | [Count Hills and Valleys in an Array](https://leetcode.com/problems/count-hills-and-valleys-in-an-array/) | [无] | [C++](2001-2500/2210-Count-Hills-and-Valleys-in-an-Array/cpp-2210/) | | |
| 2211 | [Count Collisions on a Road](https://leetcode.com/problems/count-collisions-on-a-road/) | [无] | [C++](2001-2500/2211-Count-Collisions-on-a-Road/cpp-2211/) | | |
| 2212 | [Maximum Points in an Archery Competition](https://leetcode.com/problems/maximum-points-in-an-archery-competition/) | [无] | [C++](2001-2500/2212-Maximum-Points-in-an-Archery-Competition/cpp-2212/) | | |
| 2213 | [Longest Substring of One Repeating Character](https://leetcode.com/problems/longest-substring-of-one-repeating-character/) | [无] | [C++](2001-2500/2213-Longest-Substring-of-One-Repeating-Character/cpp-2213/) | | |
| 2214 | [Minimum Health to Beat Game](https://leetcode.com/problems/minimum-health-to-beat-game/) | [无] | [C++](2001-2500/2214-Minimum-Health-to-Beat-Game/cpp-2214/)| | |
| 2215 | [Find the Difference of Two Arrays](https://leetcode.com/problems/find-the-difference-of-two-arrays/) | [无] | [C++](2001-2500/2215-Find-the-Difference-of-Two-Arrays/cpp-2215/) | | |
| 2216 | [Minimum Deletions to Make Array Beautiful](https://leetcode.com/problems/minimum-deletions-to-make-array-beautiful/) | [无] | [C++](2001-2500/2216-Minimum-Deletions-to-Make-Array-Beautiful/cpp-2216/) | | |
| 2217 | [Find Palindrome With Fixed Length](https://leetcode.com/problems/find-palindrome-with-fixed-length/) | [无] | [C++](2001-2500/2217-Find-Palindrome-With-Fixed-Length/cpp-2217/) | | |
| 2218 | [Maximum Value of K Coins From Piles](https://leetcode.com/problems/maximum-value-of-k-coins-from-piles/) | [无] | [C++](2001-2500/2218-Maximum-Value-of-K-Coins-From-Piles/cpp-2218/) | | |
| 2219 | [Maximum Sum Score of Array](https://leetcode.com/problems/maximum-sum-score-of-array/) | [无] | [C++](2001-2500/2219-Maximum-Sum-Score-of-Array/cpp-2219/) | | |
| 2220 | [Minimum Bit Flips to Convert Number](https://leetcode.com/problems/minimum-bit-flips-to-convert-number/) | [无] | [C++](2001-2500/2220-Minimum-Bit-Flips-to-Convert-Number/cpp-2220/) | | |
| 2221 | [Find Triangular Sum of an Array](https://leetcode.com/problems/find-triangular-sum-of-an-array/) | [无] | [C++](2001-2500/2221-Find-Triangular-Sum-of-an-Array/cpp-2221/) | | |
| 2222 | [Number of Ways to Select Buildings](https://leetcode.com/problems/number-of-ways-to-select-buildings/) | [无] | [C++](2001-2500/2222-Number-of-Ways-to-Select-Buildings/cpp-2222/) | | |
| 2223 | [Sum of Scores of Built Strings](https://leetcode.com/problems/sum-of-scores-of-built-strings/) | [无] | [C++](2001-2500/2223-Sum-of-Scores-of-Built-Strings/cpp-2223/) | | |
| 2224 | [Minimum Number of Operations to Convert Time](https://leetcode.com/problems/minimum-number-of-operations-to-convert-time/) | [无] | [C++](2001-2500/2224-Minimum-Number-of-Operations-to-Convert-Time/cpp-2224/) | | |
| 2225 | [Find Players With Zero or One Losses](https://leetcode.com/problems/find-players-with-zero-or-one-losses/) | [无] | [C++](2001-2500/2225-Find-Players-With-Zero-or-One-Losses/cpp-2225/) | | |
| 2226 | [Maximum Candies Allocated to K Children](https://leetcode.com/problems/maximum-candies-allocated-to-k-children/) | [无] | [C++](2001-2500/2226-Maximum-Candies-Allocated-to-K-Children/cpp-2226/) | | |
| 2227 | [Encrypt and Decrypt Strings](https://leetcode.com/problems/encrypt-and-decrypt-strings/) | [无] | [C++](2001-2500/2227-Encrypt-and-Decrypt-Strings/cpp-2227/) | | |
| 2228 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2229 | [Check if an Array Is Consecutive](https://leetcode.com/problems/check-if-an-array-is-consecutive/) | [无] | [C++](2001-2500/2229-Check-if-an-Array-Is-Consecutive/cpp-2229/) | | |
| 2230 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2231 | [Largest Number After Digit Swaps by Parity](https://leetcode.com/problems/largest-number-after-digit-swaps-by-parity/) | [无] | [C++](2001-2500/2231-Largest-Number-After-Digit-Swaps-by-Parity/cpp-2231/) | | |
| 2232 | [Minimize Result by Adding Parentheses to Expression](https://leetcode.com/problems/minimize-result-by-adding-parentheses-to-expression/) | [无] | [C++](2001-2500/2232-Minimize-Result-by-Adding-Parentheses-to-Expression/cpp-2232/) | | |
| 2233 | [Maximum Product After K Increments](https://leetcode.com/problems/maximum-product-after-k-increments/) | [无] | [C++](2001-2500/2233-Maximum-Product-After-K-Increments/cpp-2233/) | | |
| 2234 | [Maximum Total Beauty of the Gardens](https://leetcode.com/problems/maximum-total-beauty-of-the-gardens/) | [无] | [C++](2001-2500/2234-Maximum-Total-Beauty-of-the-Gardens/cpp-2234/) | | |
| 2235 | [Add Two Integers](https://leetcode.com/problems/add-two-integers/) | [无] | [C++](2001-2500/2235-Add-Two-Integers/cpp-2235/) | | |
| 2236 | [Root Equals Sum of Children](https://leetcode.com/problems/root-equals-sum-of-children/) | [无] | [C++](2001-2500/2236-Root-Equals-Sum-of-Children/cpp-2236/) | | |
| 2237 | [Count Positions on Street With Required Brightness](https://leetcode.com/problems/count-positions-on-street-with-required-brightness/) | [无] | [C++](2001-2500/2237-Count-Positions-on-Street-With-Required-Brightness/cpp-2237/) | | |
| 2238 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2239 | [Find Closest Number to Zero](https://leetcode.com/problems/find-closest-number-to-zero/) | [无] | [C++](2001-2500/2239-Find-Closest-Number-to-Zero/cpp-2239/) | | |
| 2240 | [Number of Ways to Buy Pens and Pencils](https://leetcode.com/problems/number-of-ways-to-buy-pens-and-pencils/) | [无] | [C++](2001-2500/2240-Number-of-Ways-to-Buy-Pens-and-Pencils/cpp-2240/) | | |
| 2241 | [Design an ATM Machine](https://leetcode.com/problems/design-an-atm-machine/) | [无] | [C++](2001-2500/2241-Design-an-ATM-Machine/cpp-2241/) | | |
| 2242 | [Maximum Score of a Node Sequence](https://leetcode.com/problems/maximum-score-of-a-node-sequence/) | [无] | [C++](2001-2500/2242-Maximum-Score-of-a-Node-Sequence/cpp-2242/) | | |
| 2243 | [Calculate Digit Sum of a String](https://leetcode.com/problems/calculate-digit-sum-of-a-string/) | [无] | [C++](2001-2500/2243-Calculate-Digit-Sum-of-a-String/cpp-2243/) | | |
| 2244 | [Minimum Rounds to Complete All Tasks](https://leetcode.com/problems/minimum-rounds-to-complete-all-tasks/) | [无] | [C++](2001-2500/2244-Minimum-Rounds-to-Complete-All-Tasks/cpp-2244/) | | |
| 2245 | [Maximum Trailing Zeros in a Cornered Path](https://leetcode.com/problems/maximum-trailing-zeros-in-a-cornered-path/) | [无] | [C++](2001-2500/2245-Maximum-Trailing-Zeros-in-a-Cornered-Path/cpp-2245/) | | |
| 2246 | [Longest Path With Different Adjacent Characters](https://leetcode.com/problems/longest-path-with-different-adjacent-characters/) | [无] | [C++](2001-2500/2246-Longest-Path-With-Different-Adjacent-Characters/cpp-2246/) | | |
| 2247 | [Maximum Cost of Trip With K Highways](https://leetcode.com/problems/maximum-cost-of-trip-with-k-highways/) | [无] | [C++](2001-2500/2247-Maximum-Cost-of-Trip-With-K-Highways/cpp-2247/) | | |
| 2248 | [Intersection of Multiple Arrays](https://leetcode.com/problems/intersection-of-multiple-arrays/) | [无] | [C++](2001-2500/2248-Intersection-of-Multiple-Arrays/cpp-2248/) | | |
| 2249 | [Count Lattice Points Inside a Circle](https://leetcode.com/problems/count-lattice-points-inside-a-circle/) | [无] | [C++](2001-2500/2249-Count-Lattice-Points-Inside-a-Circle/cpp-2249/) | | |
| 2250 | [Count Number of Rectangles Containing Each Point](https://leetcode.com/problems/count-number-of-rectangles-containing-each-point/) | [无] | [C++](2001-2500/2250-Count-Number-of-Rectangles-Containing-Each-Point/cpp-2250/) | | |
| 2251 | [Number of Flowers in Full Bloom](https://leetcode.com/problems/number-of-flowers-in-full-bloom/) | [无] | [C++](2001-2500/2251-Number-of-Flowers-in-Full-Bloom/cpp-2251/) | | |
| 2252 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2253 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2254 | [Design Video Sharing Platform](https://leetcode.com/problems/design-video-sharing-platform/) | [无] | [C++](2001-2500/2254-Design-Video-Sharing-Platform/cpp-2254/) | | |
| 2255 | [Count Prefixes of a Given String](https://leetcode.com/problems/count-prefixes-of-a-given-string/) | [无] | [C++](2001-2500/2255-Count-Prefixes-of-a-Given-String/cpp-2255/) | | |
| 2256 | [Minimum Average Difference](https://leetcode.com/problems/minimum-average-difference/) | [无] | [C++](2001-2500/2256-Minimum-Average-Difference/cpp-2256/) | | |
| 2257 | [Count Unguarded Cells in the Grid](https://leetcode.com/problems/count-unguarded-cells-in-the-grid/) | [无] | [C++](2001-2500/2257-Count-Unguarded-Cells-in-the-Grid/cpp-2257/) | | |
| 2258 | [Escape the Spreading Fire](https://leetcode.com/problems/escape-the-spreading-fire/) | [无] | [C++](2001-2500/2258-Escape-the-Spreading-Fire/cpp-2258/) | | |
| 2259 | [Remove Digit From Number to Maximize Result](https://leetcode.com/problems/remove-digit-from-number-to-maximize-result/) | [无] | [C++](2001-2500/2259-Remove-Digit-From-Number-to-Maximize-Result/cpp-2259/) | | |
| 2260 | [Minimum Consecutive Cards to Pick Up](https://leetcode.com/problems/minimum-consecutive-cards-to-pick-up/) | [无] | [C++](2001-2500/2260-Minimum-Consecutive-Cards-to-Pick-Up/cpp-2260/) | | |
| 2261 | [K Divisible Elements Subarrays](https://leetcode.com/problems/k-divisible-elements-subarrays/) | [无] | [C++](2001-2500/2261-K-Divisible-Elements-Subarrays/cpp-2261/) | | |
| 2262 | [Total Appeal of A String](https://leetcode.com/problems/total-appeal-of-a-string/) | [无] | [C++](2001-2500/2262-Total-Appeal-of-A-String/cpp-2262/) | | |
| 2263 | [Make Array Non-decreasing or Non-increasing](https://leetcode.com/problems/make-array-non-decreasing-or-non-increasing/) | [无] | [C++](2001-2500/2263-Make-Array-Non-decreasing-or-Non-increasing/cpp-2263/) | | |
| 2264 | [Largest 3-Same-Digit Number in String](https://leetcode.com/problems/largest-3-same-digit-number-in-string/) | [无] | [C++](2001-2500/2264-Largest-3-Same-Digit-Number-in-String/cpp-2264/) | | |
| 2265 | [Count Nodes Equal to Average of Subtree](https://leetcode.com/problems/count-nodes-equal-to-average-of-subtree/) | [无] | [C++](2001-2500/2265-Count-Nodes-Equal-to-Average-of-Subtree/cpp-2265/) | | |
| 2266 | [Count Number of Texts](https://leetcode.com/problems/count-number-of-texts/) | [无] | [C++](2001-2500/2266-Count-Number-of-Texts/cpp-2266/) | | |
| 2267 | [Check if There Is a Valid Parentheses String Path](https://leetcode.com/problems/check-if-there-is-a-valid-parentheses-string-path/) | [无] | [C++](2001-2500/2267-Check-if-There-Is-a-Valid-Parentheses-String-Path/cpp-2267/) | | |
| 2268 | [Minimum Number of Keypresses](https://leetcode.com/problems/minimum-number-of-keypresses/) | [无] | [C++](2001-2500/2268-Minimum-Number-of-Keypresses/cpp-2268/) | | |
| 2269 | [Find the K-Beauty of a Number](https://leetcode.com/problems/find-the-k-beauty-of-a-number/) | [无] | [C++](2001-2500/2269-Find-the-K-Beauty-of-a-Number/cpp-2269/) | | |
| 2270 | [Number of Ways to Split Array](https://leetcode.com/problems/number-of-ways-to-split-array/) | [无] | [C++](2001-2500/2270-Number-of-Ways-to-Split-Array/cpp-2270/) | | |
| 2271 | [Maximum White Tiles Covered by a Carpet](https://leetcode.com/problems/maximum-white-tiles-covered-by-a-carpet/) | [无] | [C++](2001-2500/2271-Maximum-White-Tiles-Covered-by-a-Carpet/cpp-2271/) | | |
| 2272 | | [Substring With Largest Variance](https://leetcode.com/problems/substring-with-largest-variance/description/) | [无] | [C++](2001-2500/2272-Substring-With-Largest-Variance/cpp-2272/) | |
| 2273 | [Find Resultant Array After Removing Anagrams](https://leetcode.com/problems/find-resultant-array-after-removing-anagrams/) | [无] | [C++](2001-2500/2273-Find-Resultant-Array-After-Removing-Anagrams/cpp-2273/) | | |
| 2274 | [Maximum Consecutive Floors Without Special Floors](https://leetcode.com/problems/maximum-consecutive-floors-without-special-floors/) | [无] | [C++](2001-2500/2274-Maximum-Consecutive-Floors-Without-Special-Floors/cpp-2274/) | | |
| 2275 | [Largest Combination With Bitwise AND Greater Than Zero](https://leetcode.com/problems/largest-combination-with-bitwise-and-greater-than-zero/) | [无] | [C++](2001-2500/2275-Largest-Combination-With-Bitwise-AND-Greater-Than-Zero/cpp-2275/) | | |
| 2276 | [Count Integers in Intervals](https://leetcode.com/problems/count-integers-in-intervals/) | [无] | [C++](2001-2500/2276-Count-Integers-in-Intervals/cpp-2276/) | | |
| 2277 | [Closest Node to Path in Tree](https://leetcode.com/problems/closest-node-to-path-in-tree/) | [无] | [C++](2001-2500/2277-Closest-Node-to-Path-in-Tree/cpp-2277/) | | |
| 2278 | [Percentage of Letter in String](https://leetcode.com/problems/percentage-of-letter-in-string/) | [无] | [C++](2001-2500/2278-Percentage-of-Letter-in-String/cpp-2278/) | | |
| 2279 | [Maximum Bags With Full Capacity of Rocks](https://leetcode.com/problems/maximum-bags-with-full-capacity-of-rocks/) | [无] | [C++](2001-2500/2279-Maximum-Bags-With-Full-Capacity-of-Rocks/cpp-2279/) | | |
| 2280 | [Minimum Lines to Represent a Line Chart](https://leetcode.com/problems/minimum-lines-to-represent-a-line-chart/) | [无] | [C++](2001-2500/2280-Minimum-Lines-to-Represent-a-Line-Chart/cpp-2280/) | | |
| 2281 | [Sum of Total Strength of Wizards](https://leetcode.com/problems/sum-of-total-strength-of-wizards/) | [无] | [C++](2001-2500/2281-Sum-of-Total-Strength-of-Wizards/cpp-2281/) | | |
| | | | | | |
| 2283 | [Check if Number Has Equal Digit Count and Digit Value](https://leetcode.com/problems/check-if-number-has-equal-digit-count-and-digit-value/) | [无] | [C++](2001-2500/2283-Check-if-Number-Has-Equal-Digit-Count-and-Digit-Value/cpp-2283/) | | |
| 2284 | [Sender With Largest Word Count](https://leetcode.com/problems/sender-with-largest-word-count/) | [无] | [C++](2001-2500/2284-Sender-With-Largest-Word-Count/cpp-2284/) | | |
| 2285 | [Maximum Total Importance of Roads](https://leetcode.com/problems/maximum-total-importance-of-roads/) | [无] | [C++](2001-2500/2285-Maximum-Total-Importance-of-Roads/cpp-2285/) | | |
| 2286 | [Booking Concert Tickets in Groups](https://leetcode.com/problems/booking-concert-tickets-in-groups/) | [无] | [C++](2001-2500/2286-Booking-Concert-Tickets-in-Groups/cpp-2286/) | | |
| 2287 | [Rearrange Characters to Make Target String](https://leetcode.com/problems/rearrange-characters-to-make-target-string/) | [无] | [C++](2001-2500/2287-Rearrange-Characters-to-Make-Target-String/cpp-2287/) | | |
| 2288 | [Apply Discount to Prices](https://leetcode.com/problems/apply-discount-to-prices/) | [无] | [C++](2001-2500/2288-Apply-Discount-to-Prices/cpp-2288/) | | |
| 2289 | [Steps to Make Array Non-decreasing](https://leetcode.com/problems/steps-to-make-array-non-decreasing/) | [无]
[缺:用 C++ STL list] | [C++](2001-2500/2289-Steps-to-Make-Array-Non-decreasing/cpp-2289/) | | |
| 2290 | [Minimum Obstacle Removal to Reach Corner](https://leetcode.com/problems/minimum-obstacle-removal-to-reach-corner/) | [无] | [C++](2001-2500/2290-Minimum-Obstacle-Removal-to-Reach-Corner/cpp-2290/) | | |
| 2291 | [Maximum Profit From Trading Stocks](https://leetcode.com/problems/maximum-profit-from-trading-stocks/) | [无] | [C++](2001-2500/2291-Maximum-Profit-From-Trading-Stocks/cpp-2291/) | | |
| 2292 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2293 | [Min Max Game](https://leetcode.com/problems/min-max-game/) | [无] | [C++](2001-2500/2293-Min-Max-Game/cpp-2293/) | | |
| 2294 | [Partition Array Such That Maximum Difference Is K](https://leetcode.com/problems/partition-array-such-that-maximum-difference-is-k/) | [无] | [C++](2001-2500/2294-Partition-Array-Such-That-Maximum-Difference-Is-K/cpp-2294/) | | |
| 2295 | [Replace Elements in an Array](https://leetcode.com/problems/replace-elements-in-an-array/) | [无] | [C++](2001-2500/2295-Replace-Elements-in-an-Array/cpp-2295/) | | |
| 2296 | [Design a Text Editor](https://leetcode.com/problems/design-a-text-editor/) | [无] | [C++](2001-2500/2296-Design-a-Text-Editor/cpp-2296/) | | |
| 2297 | [Jump Game IX](https://leetcode.com/problems/jump-game-ix/) | [无] | [C++](2001-2500/2297-Jump-Game-IX/cpp-2297/) | | |
| 2298 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2299 | [Strong Password Checker II](https://leetcode.com/problems/strong-password-checker-ii/) | [无] | [C++](2001-2500/2299-Strong-Password-Checker-II/cpp-2299/) | | |
| 2300 | [Successful Pairs of Spells and Potions](https://leetcode.com/problems/successful-pairs-of-spells-and-potions/) | [无] | [C++](2001-2500/2300-Successful-Pairs-of-Spells-and-Potions/cpp-2300/) | | |
| 2301 | [Match Substring After Replacement](https://leetcode.com/problems/match-substring-after-replacement/) | [无] | [C++](2001-2500/2301-Match-Substring-After-Replacement/cpp-2301/) | | |
| 2302 | [Count Subarrays With Score Less Than K](https://leetcode.com/problems/count-subarrays-with-score-less-than-k/) | [无] | [C++](2001-2500/2302-Count-Subarrays-With-Score-Less-Than-K/cpp-2302/) | | |
| 2303 | [Calculate Amount Paid in Taxes](https://leetcode.com/problems/calculate-amount-paid-in-taxes/) | [无] | [C++](2001-2500/2303-Calculate-Amount-Paid-in-Taxes/cpp-2303/) | | |
| 2304 | [Minimum Path Cost in a Grid](https://leetcode.com/problems/minimum-path-cost-in-a-grid/) | [无] | [C++](2001-2500/2304-Minimum-Path-Cost-in-a-Grid/cpp-2304/) | | |
| 2305 | [Fair Distribution of Cookies](https://leetcode.com/problems/fair-distribution-of-cookies/) | [无] | [C++](2001-2500/2305-Fair-Distribution-of-Cookies/cpp-2305/) | | |
| 2306 | [Naming a Company](https://leetcode.com/problems/naming-a-company/) | [无] | [C++](2001-2500/2306-Naming-a-Company/cpp-2306/) | | |
| | | | | | |
| 2308 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2309 | [Greatest English Letter in Upper and Lower Case](https://leetcode.com/problems/greatest-english-letter-in-upper-and-lower-case/) | [无] | [C++](2001-2500/2309-Greatest-English-Letter-in-Upper-and-Lower-Case/cpp-2309/) | | |
| 2310 | [Sum of Numbers With Units Digit K](https://leetcode.com/problems/sum-of-numbers-with-units-digit-k/) | [无] | [C++](2001-2500/2310-Sum-of-Numbers-With-Units-Digit-K/cpp-2310/) | | |
| | | | | | |
| 2312 | [Selling Pieces of Wood](https://leetcode.com/problems/selling-pieces-of-wood/) | [无] | [C++](2001-2500/2312-Selling-Pieces-of-Wood/cpp-2312/) | | |
| 2313 | [Minimum Flips in Binary Tree to Get Result](https://leetcode.com/problems/minimum-flips-in-binary-tree-to-get-result/) | [无] | [C++](2001-2500/2313-Minimum-Flips-in-Binary-Tree-to-Get-Result/cpp-2313/) | | |
| 2314 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2315 | [Count Asterisks](https://leetcode.com/problems/count-asterisks/) | [无] | [C++](2001-2500/2315-Count-Asterisks/cpp-2315/) | | |
| 2316 | [Count Unreachable Pairs of Nodes in an Undirected Graph](https://leetcode.com/problems/count-unreachable-pairs-of-nodes-in-an-undirected-graph/) | [无] | [C++](2001-2500/2316-Count-Unreachable-Pairs-of-Nodes-in-an-Undirected-Graph/cpp-2316/) | | |
| 2317 | [Maximum XOR After Operations](https://leetcode.com/problems/maximum-xor-after-operations/) | [无] | [C++](2001-2500/2317-Maximum-XOR-After-Operations/cpp-2317/) | | |
| 2318 | [Number of Distinct Roll Sequences](https://leetcode.com/problems/number-of-distinct-roll-sequences/) | [无] | [C++](2001-2500/2318-Number-of-Distinct-Roll-Sequences/cpp-2318/) | | |
| 2319 | [Check if Matrix Is X-Matrix](https://leetcode.com/problems/check-if-matrix-is-x-matrix/) | [无] | [C++](2001-2500/2319-Check-if-Matrix-Is-X-Matrix/cpp-2319/) | | |
| 2320 | [Count Number of Ways to Place Houses](https://leetcode.com/problems/count-number-of-ways-to-place-houses/) | [无] | [C++](2001-2500/2320-Count-Number-of-Ways-to-Place-Houses/cpp-2320/) | | |
| 2321 | [Maximum Score Of Spliced Array](https://leetcode.com/problems/maximum-score-of-spliced-array/) | [无] | [C++](2001-2500/2321-Maximum-Score-Of-Spliced-Array/cpp-2321/) | | |
| 2322 | [Minimum Score After Removals on a Tree](https://leetcode.com/problems/minimum-score-after-removals-on-a-tree/) | [无] | [C++](2001-2500/2322-Minimum-Score-After-Removals-on-a-Tree/cpp-2322/) | | |
| 2323 | [Find Minimum Time to Finish All Jobs II](https://leetcode.com/problems/find-minimum-time-to-finish-all-jobs-ii/) | [无] | [C++](2001-2500/2323-Find-Minimum-Time-to-Finish-All-Jobs-II/cpp-2323/) | | |
| 2324 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2325 | [Decode the Message](https://leetcode.com/problems/decode-the-message/) | [无] | [C++](2001-2500/2325-Decode-the-Message/cpp-2325/) | | |
| 2326 | [Spiral Matrix IV](https://leetcode.com/problems/spiral-matrix-iv/) | [无] | [C++](2001-2500/2326-Spiral-Matrix-IV/cpp-2326/) | | |
| 2327 | [Number of People Aware of a Secret](https://leetcode.com/problems/number-of-people-aware-of-a-secret/) | [无] | [C++](2001-2500/2327-Number-of-People-Aware-of-a-Secret/cpp-2327/) | | |
| 2328 | [Number of Increasing Paths in a Grid](https://leetcode.com/problems/number-of-increasing-paths-in-a-grid/) | [无] | [C++](2001-2500/2328-Number-of-Increasing-Paths-in-a-Grid/cpp-2328/) | | |
| 2329 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2330 | [Valid Palindrome IV](https://leetcode.com/problems/valid-palindrome-iv/) | [无] | [C++](2001-2500/2330-Valid-Palindrome-IV/cpp-2330/) | | |
| 2331 | [Evaluate Boolean Binary Tree](https://leetcode.com/problems/evaluate-boolean-binary-tree/) | [无] | [C++](2001-2500/2331-Evaluate-Boolean-Binary-Tree/cpp-2331/) | | |
| 2332 | [The Latest Time to Catch a Bus](https://leetcode.com/problems/the-latest-time-to-catch-a-bus/) | [无] | [C++](2001-2500/2332-The-Latest-Time-to-Catch-a-Bus/cpp-2332/) | | |
| 2333 | [Minimum Sum of Squared Difference](https://leetcode.com/problems/minimum-sum-of-squared-difference/) | [无] | [C++](2001-2500/2333-Minimum-Sum-of-Squared-Difference/cpp-2333/) | | |
| 2334 | [Subarray With Elements Greater Than Varying Threshold](https://leetcode.com/problems/subarray-with-elements-greater-than-varying-threshold/) | [无] | [C++](2001-2500/2334-Subarray-With-Elements-Greater-Than-Varying-Threshold/cpp-2334/) | | |
| 2335 | [Minimum Amount of Time to Fill Cups](https://leetcode.com/problems/minimum-amount-of-time-to-fill-cups/) | [无] | [C++](2001-2500/2335-Minimum-Amount-of-Time-to-Fill-Cups/cpp-2335/) | | |
| 2336 | [Smallest Number in Infinite Set](https://leetcode.com/problems/smallest-number-in-infinite-set/) | [无] | [C++](2001-2500/2336-Smallest-Number-in-Infinite-Set/cpp-2336/) | | |
| 2337 | [Move Pieces to Obtain a String](https://leetcode.com/problems/move-pieces-to-obtain-a-string/) | [无] | [C++](2001-2500/2337-Move-Pieces-to-Obtain-a-String/cpp-2337/) | | |
| 2338 | [Count the Number of Ideal Arrays](https://leetcode.com/problems/count-the-number-of-ideal-arrays/) | [无] | [C++](2001-2500/2338-Count-the-Number-of-Ideal-Arrays/cpp-2338/) | | |
| 2339 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2340 | [Minimum Adjacent Swaps to Make a Valid Array](https://leetcode.com/problems/minimum-adjacent-swaps-to-make-a-valid-array/) | [无] | [C++](2001-2500/2340-Minimum-Adjacent-Swaps-to-Make-a-Valid-Array/cpp-2340/) | | |
| 2341 | [Maximum Number of Pairs in Array](https://leetcode.com/problems/maximum-number-of-pairs-in-array/) | [无] | [C++](2001-2500/2341-Maximum-Number-of-Pairs-in-Array/cpp-2341/) | | |
| 2342 | [Max Sum of a Pair With Equal Sum of Digits](https://leetcode.com/problems/max-sum-of-a-pair-with-equal-sum-of-digits/) | [无] | [C++](2001-2500/2342-Max-Sum-of-a-Pair-With-Equal-Sum-of-Digits/cpp-2342/) | | |
| 2343 | [Query Kth Smallest Trimmed Number](https://leetcode.com/problems/query-kth-smallest-trimmed-number/) | [无] | [C++](2001-2500/2343-Query-Kth-Smallest-Trimmed-Number/cpp-2343/) | | |
| 2344 | [Minimum Deletions to Make Array Divisible](https://leetcode.com/problems/minimum-deletions-to-make-array-divisible/) | [无] | [C++](2001-2500/2344-Minimum-Deletions-to-Make-Array-Divisible/cpp-2344/) | | |
| 2345 | [Finding the Number of Visible Mountains](https://leetcode.com/problems/finding-the-number-of-visible-mountains/) | [无] | [C++](2001-2500/2345-Finding-the-Number-of-Visible-Mountains/cpp-2345/) | | |
| 2346 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2347 | [Best Poker Hand](https://leetcode.com/problems/best-poker-hand/) | [无] | [C++](2001-2500/2347-Best-Poker-Hand/cpp-2347/) | | |
| 2348 | [Number of Zero-Filled Subarrays](https://leetcode.com/problems/number-of-zero-filled-subarrays/) | [无] | [C++](2001-2500/2348-Number-of-Zero-Filled-Subarrays/cpp-2348/) | | |
| 2349 | [Design a Number Container System](https://leetcode.com/problems/design-a-number-container-system/) | [无] | [C++](2001-2500/2349-Design-a-Number-Container-System/cpp-2349/) | | |
| 2350 | [Shortest Impossible Sequence of Rolls](https://leetcode.com/problems/shortest-impossible-sequence-of-rolls/) | [无] | [C++](2001-2500/2350-Shortest-Impossible-Sequence-of-Rolls/cpp-2350/) | | |
| 2351 | [First Letter to Appear Twice](https://leetcode.com/problems/first-letter-to-appear-twice/) | [无] | [C++](2001-2500/2351-First-Letter-to-Appear-Twice/cpp-2351/) | | |
| 2352 | [Equal Row and Column Pairs](https://leetcode.com/problems/equal-row-and-column-pairs/) | [无] | [C++](2001-2500/2352-Equal-Row-and-Column-Pairs/cpp-2352/) | | |
| 2353 | [Design a Food Rating System](https://leetcode.com/problems/design-a-food-rating-system/) | [无] | [C++](2001-2500/2353-Design-a-Food-Rating-System/cpp-2353/) | | |
| 2354 | [Number of Excellent Pairs](https://leetcode.com/problems/number-of-excellent-pairs/) | [无] | [C++](2001-2500/2354-Number-of-Excellent-Pairs/cpp-2354/) | | |
| | | | | | |
| 2356 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2357 | [Make Array Zero by Subtracting Equal Amounts](https://leetcode.com/problems/make-array-zero-by-subtracting-equal-amounts/) | [无] | [C++](2001-2500/2357-Make-Array-Zero-by-Subtracting-Equal-Amounts/cpp-2357/) | | |
| 2358 | [Maximum Number of Groups Entering a Competition](https://leetcode.com/problems/maximum-number-of-groups-entering-a-competition/) | [无] | [C++](2001-2500/2358-Maximum-Number-of-Groups-Entering-a-Competition/cpp-2358/) | | |
| 2359 | [Find Closest Node to Given Two Nodes](https://leetcode.com/problems/find-closest-node-to-given-two-nodes/) | [无] | [C++](2001-2500/2359-Find-Closest-Node-to-Given-Two-Nodes/cpp-2359/) | | |
| 2360 | [Longest Cycle in a Graph](https://leetcode.com/problems/longest-cycle-in-a-graph/) | [无] | [C++](2001-2500/2360-Longest-Cycle-in-a-Graph/cpp-2360/) | | |
| 2361 | [Minimum Costs Using the Train Line](https://leetcode.com/problems/minimum-costs-using-the-train-line/) | [无] | [C++](2001-2500/2361-Minimum-Costs-Using-the-Train-Line/cpp-2361/) | | |
| 2362 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2363 | [Merge Similar Items](https://leetcode.com/problems/merge-similar-items/) | [无] | [C++](2001-2500/2363-Merge-Similar-Items/cpp-2363/) | | |
| 2364 | [Count Number of Bad Pairs](https://leetcode.com/problems/count-number-of-bad-pairs/) | [无] | [C++](2001-2500/2364-Count-Number-of-Bad-Pairs/cpp-2364/) | | |
| 2365 | [Task Scheduler II](https://leetcode.com/problems/task-scheduler-ii/) | [无] | [C++](2001-2500/2365-Task-Scheduler-II/cpp-2365/) | | |
| 2366 | [Minimum Replacements to Sort the Array](https://leetcode.com/problems/minimum-replacements-to-sort-the-array/) | [无] | [C++](2001-2500/2366-Minimum-Replacements-to-Sort-the-Array/cpp-2366/) | | |
| 2367 | [Number of Arithmetic Triplets](https://leetcode.com/problems/number-of-arithmetic-triplets/) | [无] | [C++](2001-2500/2367-Number-of-Arithmetic-Triplets/cpp-2367/) | | |
| 2368 | [Reachable Nodes With Restrictions](https://leetcode.com/problems/reachable-nodes-with-restrictions/) | [无] | [C++](2001-2500/2368-Reachable-Nodes-With-Restrictions/cpp-2368/) | | |
| 2369 | [Check if There is a Valid Partition For The Array](https://leetcode.com/problems/check-if-there-is-a-valid-partition-for-the-array/) | [无] | [C++](2001-2500/2369-Check-if-There-is-a-Valid-Partition-For-The-Array/cpp-2369/) | | |
| 2370 | [Longest Ideal Subsequence](https://leetcode.com/problems/longest-ideal-subsequence/) | [无] | [C++](2001-2500/2370-Longest-Ideal-Subsequence/cpp-2370/) | | |
| | | | | | |
| 2372 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2373 | [Largest Local Values in a Matrix](https://leetcode.com/problems/largest-local-values-in-a-matrix/) | [无] | [C++](2001-2500/2373-Largest-Local-Values-in-a-Matrix/cpp-2373/) | | |
| 2374 | [Node With Highest Edge Score](https://leetcode.com/problems/node-with-highest-edge-score/) | [无] | [C++](2001-2500/2374-Node-With-Highest-Edge-Score/cpp-2374/) | | |
| 2375 | [Construct Smallest Number From DI String](https://leetcode.com/problems/construct-smallest-number-from-di-string/) | [无] | [C++](2001-2500/2375-Construct-Smallest-Number-From-DI-String/cpp-2375/) | | |
| 2376 | [Count Special Integers](https://leetcode.com/problems/count-special-integers/) | [无] | [C++](2001-2500/2376-Count-Special-Integers/cpp-2376/) | | |
| 2377 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2378 | [Choose Edges to Maximize Score in a Tree](https://leetcode.com/problems/choose-edges-to-maximize-score-in-a-tree/) | [无] | [C++](2001-2500/2378-Choose-Edges-to-Maximize-Score-in-a-Tree/cpp-2378/) | | |
| 2379 | [Minimum Recolors to Get K Consecutive Black Blocks](https://leetcode.com/problems/minimum-recolors-to-get-k-consecutive-black-blocks/) | [无] | [C++](2001-2500/2379-Minimum-Recolors-to-Get-K-Consecutive-Black-Blocks/cpp-2379/) | | |
| 2380 | [Time Needed to Rearrange a Binary String](https://leetcode.com/problems/time-needed-to-rearrange-a-binary-string/) | [无] | [C++](2001-2500/2380-Time-Needed-to-Rearrange-a-Binary-String/cpp-2380/) | | |
| 2381 | [Shifting Letters II](https://leetcode.com/problems/shifting-letters-ii/) | [无] | [C++](2001-2500/2381-Shifting-Letters-II/cpp-2381/) | | |
| 2382 | [Maximum Segment Sum After Removals](https://leetcode.com/problems/maximum-segment-sum-after-removals/) | [无] | [C++](2001-2500/2382-Maximum-Segment-Sum-After-Removals/cpp-2382/) | | |
| 2383 | [Minimum Hours of Training to Win a Competition](https://leetcode.com/problems/minimum-hours-of-training-to-win-a-competition/) | [无] | [C++](2001-2500/2383-Minimum-Hours-of-Training-to-Win-a-Competition/cpp-2383/) | | |
| 2384 | [Largest Palindromic Number](https://leetcode.com/problems/largest-palindromic-number/) | [无] | [C++](2001-2500/2384-Largest-Palindromic-Number/cpp-2384/) | | |
| 2385 | [Amount of Time for Binary Tree to Be Infected](https://leetcode.com/problems/amount-of-time-for-binary-tree-to-be-infected/) | [无] | [C++](2001-2500/2385-Amount-of-Time-for-Binary-Tree-to-Be-Infected/cpp-2385/) | | |
| | | | | | |
| 2387 | [Median of a Row Wise Sorted Matrix](https://leetcode.com/problems/median-of-a-row-wise-sorted-matrix/) | [无] | [C++](2001-2500/2387-Median-of-a-Row-Wise-Sorted-Matrix/cpp-2387/) | | |
| 2388 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2389 | [Longest Subsequence With Limited Sum](https://leetcode.com/problems/longest-subsequence-with-limited-sum/) | [无] | [C++](2001-2500/2389-Longest-Subsequence-With-Limited-Sum/cpp-2389/) | | |
| 2390 | [Removing Stars From a String](https://leetcode.com/problems/removing-stars-from-a-string/) | [无] | [C++](2001-2500/2390-Removing-Stars-From-a-String/cpp-2390/) | | |
| 2391 | [Minimum Amount of Time to Collect Garbage](https://leetcode.com/problems/minimum-amount-of-time-to-collect-garbage/) | [无] | [C++](2001-2500/2391-Minimum-Amount-of-Time-to-Collect-Garbage/cpp-2391/) | | |
| 2392 | [Build a Matrix With Conditions](https://leetcode.com/problems/build-a-matrix-with-conditions/) | [无] | [C++](2001-2500/2392-Build-a-Matrix-With-Conditions/cpp-2392/) | | |
| 2393 | [Count Strictly Increasing Subarrays](https://leetcode.com/problems/count-strictly-increasing-subarrays/) | [无] | [C++](2001-2500/2393-Count-Strictly-Increasing-Subarrays/cpp-2393/) | | |
| 2394 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2395 | [Find Subarrays With Equal Sum](https://leetcode.com/problems/find-subarrays-with-equal-sum/) | [无] | [C++](2001-2500/2395-Find-Subarrays-With-Equal-Sum/cpp-2395/) | | |
| 2396 | [Strictly Palindromic Number](https://leetcode.com/problems/strictly-palindromic-number/) | [无] | [C++](2001-2500/2396-Strictly-Palindromic-Number/cpp-2396/) | | |
| 2397 | [Maximum Rows Covered by Columns](https://leetcode.com/problems/maximum-rows-covered-by-columns/) | [无] | [C++](2001-2500/2397-Maximum-Rows-Covered-by-Columns/cpp-2397/) | | |
| 2398 | [Maximum Number of Robots Within Budget](https://leetcode.com/problems/maximum-number-of-robots-within-budget/) | [无][缺:滑动窗口] | [C++](2001-2500/2398-Maximum-Number-of-Robots-Within-Budget/cpp-2398/) | | |
| 2399 | [Check Distances Between Same Letters](https://leetcode.com/problems/check-distances-between-same-letters/) | [无] | [C++](2001-2500/2399-Check-Distances-Between-Same-Letters/cpp-2399/) | | |
| 2400 | [Number of Ways to Reach a Position After Exactly k Steps](https://leetcode.com/problems/number-of-ways-to-reach-a-position-after-exactly-k-steps/) | [无][缺:数学解] | [C++](2001-2500/2400-Number-of-Ways-to-Reach-a-Position-After-Exactly-k-Steps/cpp-2400/) | | |
| 2401 | [Longest Nice Subarray](https://leetcode.com/problems/longest-nice-subarray/) | [无] | [C++](2001-2500/2401-Longest-Nice-Subarray/cpp-2401/) | | |
| 2402 | [Meeting Rooms III](https://leetcode.com/problems/meeting-rooms-iii/) | [无] | [C++](2001-2500/2402-Meeting-Rooms-III/cpp-2402/) | | |
| 2403 | [Minimum Time to Kill All Monsters](https://leetcode.com/problems/minimum-time-to-kill-all-monsters/) | [无] | [C++](2001-2500/2403-Minimum-Time-to-Kill-All-Monsters/cpp-2403/) | | |
| 2404 | [Most Frequent Even Element](https://leetcode.com/problems/most-frequent-even-element/) | [无] | [C++](2001-2500/2404-Most-Frequent-Even-Element/cpp-2404/) | | |
| 2405 | [Optimal Partition of String](https://leetcode.com/problems/optimal-partition-of-string/) | [无] | [C++](2001-2500/2405-Optimal-Partition-of-String/cpp-2405/) | | |
| 2406 | [Divide Intervals Into Minimum Number of Groups](https://leetcode.com/problems/divide-intervals-into-minimum-number-of-groups/) | [无] | [C++](2001-2500/2406-Divide-Intervals-Into-Minimum-Number-of-Groups/cpp-2406/) | | |
| 2407 | [Longest Increasing Subsequence II](https://leetcode.com/problems/longest-increasing-subsequence-ii/) | [无] | [C++](2001-2500/2407-Longest-Increasing-Subsequence-II/cpp2407/) | | |
| 2408 | [Design SQL](https://leetcode.com/problems/design-sql/) | [无] | [C++](2001-2500/2408-Design-SQL/cpp2408/) | | |
| 2409 | [Count Days Spent Together](https://leetcode.com/problems/count-days-spent-together/) | [无] | [C++](2001-2500/2409-Count-Days-Spent-Together/cpp2409/) | | |
| 2410 | [Maximum Matching of Players With Trainers](https://leetcode.com/problems/maximum-matching-of-players-with-trainers/) | [无] | [C++](2001-2500/2410-Maximum-Matching-of-Players-With-Trainers/cpp2410/) | | |
| 2411 | [Smallest Subarrays With Maximum Bitwise OR](https://leetcode.com/problems/smallest-subarrays-with-maximum-bitwise-or/) | [无][缺:O(n) 算法] | [C++](2001-2500/2411-Smallest-Subarrays-With-Maximum-Bitwise-OR/cpp2411/) | | |
| 2412 | [Minimum Money Required Before Transactions](https://leetcode.com/problems/minimum-money-required-before-transactions/description/) | [无] [缺:不用 sort] | [C++](2001-2500/2412-Minimum-Money-Required-Before-Transactions/cpp-2412/) | | |
| 2413 | [Smallest Even Multiple](https://leetcode.com/problems/smallest-even-multiple/) | [无] | [C++](2001-2500/2413-Smallest-Even-Multiple/cpp-2413/) | | |
| 2414 | [Length of the Longest Alphabetical Continuous Substring](https://leetcode.com/problems/length-of-the-longest-alphabetical-continuous-substring/) | [无] | [C++](2001-2500/2414-Length-of-the-Longest-Alphabetical-Continuous-Substring/cpp-2414/) | | |
| 2415 | [Reverse Odd Levels of Binary Tree](https://leetcode.com/problems/reverse-odd-levels-of-binary-tree/) | [无] | [C++](2001-2500/2415-Reverse-Odd-Levels-of-Binary-Tree/cpp-2415/) | | |
| 2416 | [Sum of Prefix Scores of Strings](https://leetcode.com/problems/sum-of-prefix-scores-of-strings/) | [无] | [C++](2001-2500/2416-Sum-of-Prefix-Scores-of-Strings/cpp-2416/) | | |
| 2417 | [Closest Fair Integer](https://leetcode.com/problems/closest-fair-integer/) | [无] | [C++](2001-2500/2417-Closest-Fair-Integer/cpp-2417/) | | |
| 2418 | [Sort the People](https://leetcode.com/problems/sort-the-people/) | [无] | [C++](2001-2500/2418-Sort-the-People/cpp-2418/) | | |
| 2419 | [Longest Subarray With Maximum Bitwise AND](https://leetcode.com/problems/longest-subarray-with-maximum-bitwise-and/) | [无] | [C++](2001-2500/2419-Longest-Subarray-With-Maximum-Bitwise-AND/cpp-2419/) | | |
| 2420 | [Find All Good Indices](https://leetcode.com/problems/find-all-good-indices/) | [无] | [C++](2001-2500/2420-Find-All-Good-Indices/cpp-2420/) | | |
| 2421 | [Number of Good Paths](https://leetcode.com/problems/number-of-good-paths/) | [无] | [C++](2001-2500/2421-Number-of-Good-Paths/cpp-2421/) | | |
| 2422 | [Merge Operations to Turn Array Into a Palindrome](https://leetcode.com/problems/merge-operations-to-turn-array-into-a-palindrome/) | [无] | [C++](2001-2500/2422-Merge-Operations-to-Turn-Array-Into-a-Palindrome/cpp-2422/) | | |
| 2423 | [Remove Letter To Equalize Frequency](https://leetcode.com/problems/remove-letter-to-equalize-frequency/) | [无] | [C++](2001-2500/2423-Remove-Letter-To-Equalize-Frequency/cpp-2423/) | | |
| 2424 | [Longest Uploaded Prefix](https://leetcode.com/problems/longest-uploaded-prefix/) | [无] | [C++](2001-2500/2424-Longest-Uploaded-Prefix/cpp-2424/) | | |
| 2425 | [Bitwise XOR of All Pairings](https://leetcode.com/problems/bitwise-xor-of-all-pairings/) | [无] | [C++](2001-2500/2425-Bitwise-XOR-of-All-Pairings/cpp-2425/) | | |
| 2426 | [Number of Pairs Satisfying Inequality](https://leetcode.com/problems/number-of-pairs-satisfying-inequality/) | [无]
[缺:493 问题整理] | [C++](2001-2500/2426-Number-of-Pairs-Satisfying-Inequality/cpp-2426/) | | |
| 2427 | [Number of Common Factors](https://leetcode.com/problems/number-of-common-factors/) | [无] | [C++](2001-2500/2427-Number-of-Common-Factors/cpp-2427/) | | |
| 2428 | [Maximum Sum of an Hourglass](https://leetcode.com/problems/maximum-sum-of-an-hourglass/) | [无] | [C++](2001-2500/2428-Maximum-Sum-of-an-Hourglass/cpp-2428/) | | |
| 2429 | [Minimize XOR](https://leetcode.com/problems/minimize-xor/) | [无] | [C++](2001-2500/2429-Minimize-XOR/cpp-2429/) | | |
| 2430 | [Maximum Deletions on a String](https://leetcode.com/problems/maximum-deletions-on-a-string/) | [无] | [C++](2001-2500/2430-Maximum-Deletions-on-a-String/cpp-2430/) | | |
| 2431 | [Maximize Total Tastiness of Purchased Fruits](https://leetcode.com/problems/maximize-total-tastiness-of-purchased-fruits/) | [无] | [C++](2001-2500/2431-Maximize-Total-Tastiness-of-Purchased-Fruits/cpp-2431/) | | |
| 2432 | [The Employee That Worked on the Longest Task](https://leetcode.com/problems/the-employee-that-worked-on-the-longest-task/) | [无] | [C++](2001-2500/2432-The-Employee-That-Worked-on-the-Longest-Task/cpp-2432/) | | |
| 2433 | [Find The Original Array of Prefix Xor](https://leetcode.com/problems/find-the-original-array-of-prefix-xor/) | [无] | [C++](2001-2500/2433-Find-The-Original-Array-of-Prefix-Xor/cpp-2433/) | | |
| 2434 | [Using a Robot to Print the Lexicographically Smallest String](https://leetcode.com/problems/using-a-robot-to-print-the-lexicographically-smallest-string/) | [无] | [C++](2001-2500/2434-Using-a-Robot-to-Print-the-Lexicographically-Smallest-String/cpp-2434/) | | |
| 2435 | [Paths in Matrix Whose Sum Is Divisible by K](https://leetcode.com/problems/paths-in-matrix-whose-sum-is-divisible-by-k/) | [无] | [C++](2001-2500/2435-Paths-in-Matrix-Whose-Sum-Is-Divisible-by-K/cpp-2435/) | | |
| 2436 | [Minimum Split Into Subarrays With GCD Greater Than One](https://leetcode.com/problems/minimum-split-into-subarrays-with-gcd-greater-than-one/) | [无] | [C++](2001-2500/2436-Minimum-Split-Into-Subarrays-With-GCD-Greater-Than-One/cpp-2436/) | | |
| 2437 | [Number of Valid Clock Times](https://leetcode.com/problems/number-of-valid-clock-times/) | [无] | [C++](2001-2500/2437-Number-of-Valid-Clock-Times/cpp-2437/) | | |
| 2438 | [Range Product Queries of Powers](https://leetcode.com/problems/range-product-queries-of-powers/) | [无] | [C++](2001-2500/2438-Range-Product-Queries-of-Powers/cpp-2438/) | | |
| 2439 | [Minimize Maximum of Array](https://leetcode.com/problems/minimize-maximum-of-array/) | [无] | [C++](2001-2500/2439-Minimize-Maximum-of-Array/cpp-2439/) | | |
| 2440 | [Create Components With Same Value](https://leetcode.com/problems/create-components-with-same-value/) | [无] | [C++](2001-2500/2440-Create-Components-With-Same-Value/cpp-2440/) | | |
| 2441 | [Largest Positive Integer That Exists With Its Negative](https://leetcode.com/problems/largest-positive-integer-that-exists-with-its-negative/) | [无] | [C++](2001-2500/2441-Largest-Positive-Integer-That-Exists-With-Its-Negative/cpp-2441/) | | |
| 2442 | [Count Number of Distinct Integers After Reverse Operations](https://leetcode.com/problems/count-number-of-distinct-integers-after-reverse-operations/) | [无] | [C++](2001-2500/2442-Count-Number-of-Distinct-Integers-After-Reverse-Operations/cpp-2442/) | | |
| 2443 | [Sum of Number and Its Reverse](https://leetcode.com/problems/sum-of-number-and-its-reverse/) | [无] | [C++](2001-2500/2443-Sum-of-Number-and-Its-Reverse/cpp-2443/) | | |
| 2444 | [Count Subarrays With Fixed Bounds](https://leetcode.com/problems/count-subarrays-with-fixed-bounds/) | [无] | [C++](2001-2500/2444-Count-Subarrays-With-Fixed-Bounds/cpp-2444/) | | |
| 2445 | [Number of Nodes With Value One](https://leetcode.com/problems/number-of-nodes-with-value-one/) | [无] | [C++](2001-2500/2445-Number-of-Nodes-With-Value-One/cpp-2445/) | | |
| 2446 | [Determine if Two Events Have Conflict](https://leetcode.com/problems/determine-if-two-events-have-conflict/) | [无] | [C++](2001-2500/2446-Determine-if-Two-Events-Have-Conflict/cpp-2446/) | | |
| 2447 | [Number of Subarrays With GCD Equal to K](https://leetcode.com/problems/number-of-subarrays-with-gcd-equal-to-k/) | [无] | [C++](2001-2500/2447-Number-of-Subarrays-With-GCD-Equal-to-K/cpp-2447/) | | |
| 2448 | [Minimum Cost to Make Array Equal](https://leetcode.com/problems/minimum-cost-to-make-array-equal/) | [无] | [C++](2001-2500/2448-Minimum-Cost-to-Make-Array-Equal/cpp-2448/) | | |
| 2449 | [Minimum Number of Operations to Make Arrays Similar](https://leetcode.com/problems/minimum-number-of-operations-to-make-arrays-similar/) | [无] | [C++](2001-2500/2449-Minimum-Number-of-Operations-to-Make-Arrays-Similar/cpp-2449/) | | |
| 2450 | [Number of Distinct Binary Strings After Applying Operations](https://leetcode.com/problems/number-of-distinct-binary-strings-after-applying-operations/) | [无] | [C++](2001-2500/2450-Number-of-Distinct-Binary-Strings-After-Applying-Operations/cpp-2450/) | | |
| 2451 | [Odd String Difference](https://leetcode.com/problems/odd-string-difference/) | [无] | [C++](2001-2500/2451-Odd-String-Difference/cpp-2451/) | | |
| 2452 | [Words Within Two Edits of Dictionary](https://leetcode.com/problems/words-within-two-edits-of-dictionary/) | [无] | [C++](2001-2500/2452-Words-Within-Two-Edits-of-Dictionary/cpp-2452/) | | |
| 2453 | [Destroy Sequential Targets](https://leetcode.com/problems/destroy-sequential-targets/) | [无] | [C++](2001-2500/2453-Destroy-Sequential-Targets/cpp-2453/) | | |
| 2454 | [Next Greater Element IV](https://leetcode.com/problems/next-greater-element-iv/) | [无]
[缺:O(n) 解法] | [C++](2001-2500/2454-Next-Greater-Element-IV/cpp-2454/) | | |
| 2455 | [Average Value of Even Numbers That Are Divisible by Three](https://leetcode.com/problems/average-value-of-even-numbers-that-are-divisible-by-three/) | [无] | [C++](2001-2500/2455-Average-Value-of-Even-Numbers-That-Are-Divisible-by-Three/cpp-2455/) | | |
| 2456 | [Most Popular Video Creator](https://leetcode.com/problems/most-popular-video-creator/) | [无] | [C++](2001-2500/2456-Most-Popular-Video-Creator/cpp-2456/) | | |
| 2457 | [Minimum Addition to Make Integer Beautiful](https://leetcode.com/problems/minimum-addition-to-make-integer-beautiful/) | [无] | [C++](2001-2500/2457-Minimum-Addition-to-Make-Integer-Beautiful/cpp-2457/) | | |
| 2458 | [Height of Binary Tree After Subtree Removal Queries](https://leetcode.com/problems/height-of-binary-tree-after-subtree-removal-queries/) | [无] | [C++](2001-2500/2458-Height-of-Binary-Tree-After-Subtree-Removal-Queries/cpp-2458/) | | |
| 2459 | [Sort Array by Moving Items to Empty Space](https://leetcode.com/problems/sort-array-by-moving-items-to-empty-space/description/) | [无] | [C++](2001-2500/2459-Sort-Array-by-Moving-Items-to-Empty-Space/cpp-2459/) | | |
| 2460 | [Apply Operations to an Array](https://leetcode.com/problems/apply-operations-to-an-array/) | [无] | [C++](2001-2500/2460-Apply-Operations-to-an-Array/cpp-2460/) | | |
| 2461 | [Maximum Sum of Distinct Subarrays With Length K](https://leetcode.com/problems/maximum-sum-of-distinct-subarrays-with-length-k/) | [无] | [C++](2001-2500/2461-Maximum-Sum-of-Distinct-Subarrays-With-Length-K/cpp-2461/) | | |
| 2462 | [Total Cost to Hire K Workers](https://leetcode.com/problems/total-cost-to-hire-k-workers/) | [无] | [C++](2001-2500/2462-Total-Cost-to-Hire-K-Workers/cpp-2462/) | | |
| 2463 | [Minimum Total Distance Traveled](https://leetcode.com/problems/minimum-total-distance-traveled/) | [无] | [C++](2001-2500/2463-Minimum-Total-Distance-Traveled/cpp-2463/) | | |
| 2464 | [Minimum Subarrays in a Valid Split](https://leetcode.com/problems/minimum-subarrays-in-a-valid-split/description/) | [无] | [C++](2001-2500/2464-Minimum-Subarrays-in-a-Valid-Split/cpp-2464/) | | |
| 2465 | [Number of Distinct Averages](https://leetcode.com/problems/number-of-distinct-averages/) | [无] | [C++](2001-2500/2465-Number-of-Distinct-Averages/cpp-2465/) | | |
| 2466 | [Count Ways To Build Good Strings](https://leetcode.com/problems/count-ways-to-build-good-strings/) | [无] | [C++](2001-2500/2466-Count-Ways-To-Build-Good-Strings/cpp-2466/) | | |
| 2467 | [Most Profitable Path in a Tree](https://leetcode.com/problems/most-profitable-path-in-a-tree/) | [无] | [C++](2001-2500/2467-Most-Profitable-Path-in-a-Tree/cpp-2467/) | | |
| 2468 | [Split Message Based on Limit](https://leetcode.com/problems/split-message-based-on-limit/) | [无] | [C++](2001-2500/2468-Split-Message-Based-on-Limit/cpp-2468/) | | |
| 2469 | [Convert the Temperature](https://leetcode.com/problems/convert-the-temperature/) | [无] | [C++](2001-2500/2469-Convert-the-Temperature/cpp-2469/) | | |
| 2470 | [Number of Subarrays With LCM Equal to K](https://leetcode.com/problems/number-of-subarrays-with-lcm-equal-to-k/) | [无] | [C++](2001-2500/2470-Number-of-Subarrays-With-LCM-Equal-to-K/cpp-2470/) | | |
| 2471 | [Minimum Number of Operations to Sort a Binary Tree by Level](https://leetcode.com/problems/minimum-number-of-operations-to-sort-a-binary-tree-by-level/) | [无] | [C++](2001-2500/2471-Minimum-Number-of-Operations-to-Sort-a-Binary-Tree-by-Level/cpp-2471/) | | |
| 2472 | [Maximum Number of Non-overlapping Palindrome Substrings](https://leetcode.com/problems/maximum-number-of-non-overlapping-palindrome-substrings/) | [无] | [C++](2001-2500/2472-Maximum-Number-of-Non-overlapping-Palindrome-Substrings/cpp-2472/) | | |
| 2473 | [Minimum Cost to Buy Apples](https://leetcode.com/problems/minimum-cost-to-buy-apples/description/) | [无] | [C++](2001-2500/2473-Minimum-Cost-to-Buy-Apples/cpp-2473/) | | |
| 2474 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2475 | [Number of Unequal Triplets in Array](https://leetcode.com/problems/number-of-unequal-triplets-in-array/) | [无] | [C++](2001-2500/2475-Number-of-Unequal-Triplets-in-Array/cpp-2475/) | | |
| 2476 | [Closest Nodes Queries in a Binary Search Tree](https://leetcode.com/problems/closest-nodes-queries-in-a-binary-search-tree/) | [无] | [C++](2001-2500/2476-Closest-Nodes-Queries-in-a-Binary-Search-Tree/cpp-2476/) | | |
| 2477 | [Minimum Fuel Cost to Report to the Capital](https://leetcode.com/problems/minimum-fuel-cost-to-report-to-the-capital/) | [无] | [C++](2001-2500/2477-Minimum-Fuel-Cost-to-Report-to-the-Capital/cpp-2477/) | | |
| 2478 | [Number of Beautiful Partitions](https://leetcode.com/problems/number-of-beautiful-partitions/) | [无] | [C++](2001-2500/2478-Number-of-Beautiful-Partitions/cpp-2478/) | | |
| 2479 | [Maximum XOR of Two Non-Overlapping Subtrees](https://leetcode.com/problems/maximum-xor-of-two-non-overlapping-subtrees/description/) | [无] | [C++](2001-2500/2479-Maximum-XOR-of-Two-Non-Overlapping-Subtrees/cpp-2479/) | | |
| 2480 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2481 | [Minimum Cuts to Divide a Circle](https://leetcode.com/problems/minimum-cuts-to-divide-a-circle/) | [无] | [C++](2001-2500/2481-Minimum-Cuts-to-Divide-a-Circle/cpp-2481/) | | |
| 2482 | [Difference Between Ones and Zeros in Row and Column](https://leetcode.com/problems/difference-between-ones-and-zeros-in-row-and-column/) | [无] | [C++](2001-2500/2482-Difference-Between-Ones-and-Zeros-in-Row-and-Column/cpp-2482/) | | |
| 2483 | [Minimum Penalty for a Shop](https://leetcode.com/problems/minimum-penalty-for-a-shop/) | [无] | [C++](2001-2500/2483-Minimum-Penalty-for-a-Shop/cpp-2483/) | | |
| 2484 | [Count Palindromic Subsequences](https://leetcode.com/problems/count-palindromic-subsequences/) | [无] | [C++](2001-2500/2484-Count-Palindromic-Subsequences/cpp-2484/) | | |
| 2485 | [Find the Pivot Integer](https://leetcode.com/problems/find-the-pivot-integer/) | [无] | [C++](2001-2500/2485-Find-the-Pivot-Integer/cpp-2485/) | | |
| 2486 | [Append Characters to String to Make Subsequence](https://leetcode.com/problems/append-characters-to-string-to-make-subsequence/) | [无] | [C++](2001-2500/2486-Append-Characters-to-String-to-Make-Subsequence/cpp-2486/) | | |
| 2487 | [Remove Nodes From Linked List](https://leetcode.com/problems/remove-nodes-from-linked-list/) | [无] | [C++](2001-2500/2487-Remove-Nodes-From-Linked-List/cpp-2487/) | | |
| 2488 | [Count Subarrays With Median K](https://leetcode.com/problems/count-subarrays-with-median-k/) | [无] | [C++](2001-2500/2488-Count-Subarrays-With-Median-K/cpp-2488/) | | |
| 2489 | [Number of Substrings With Fixed Ratio](https://leetcode.com/problems/number-of-substrings-with-fixed-ratio/description/) | [无] | [C++](2001-2500/2489-Number-of-Substrings-With-Fixed-Ratio/cpp-2489/) | | |
| 2490 | [Circular Sentence](https://leetcode.com/problems/circular-sentence/) | [无] | [C++](2001-2500/2490-Circular-Sentence/cpp-2490/) | | |
| 2491 | [Divide Players Into Teams of Equal Skill](https://leetcode.com/problems/divide-players-into-teams-of-equal-skill/) | [无] | [C++](2001-2500/2491-Divide-Players-Into-Teams-of-Equal-Skill/cpp-2491/) | | |
| 2492 | [Minimum Score of a Path Between Two Cities](https://leetcode.com/problems/minimum-score-of-a-path-between-two-cities/) | [无] | [C++](2001-2500/2492-Minimum-Score-of-a-Path-Between-Two-Cities/cpp-2492/) | | |
| 2493 | [Divide Nodes Into the Maximum Number of Groups](https://leetcode.com/problems/divide-nodes-into-the-maximum-number-of-groups/) | [无] | [C++](2001-2500/2493-Divide-Nodes-Into-the-Maximum-Number-of-Groups/cpp-2493/) | | |
| 2494 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2495 | [Number of Subarrays Having Even Product](https://leetcode.com/problems/number-of-subarrays-having-even-product/description/) | [无] | [C++](2001-2500/2495-Number-of-Subarrays-Having-Even-Product/cpp-2495) | | |
| 2496 | [Maximum Value of a String in an Array](https://leetcode.com/problems/maximum-value-of-a-string-in-an-array/) | [无] | [C++](2001-2500/2496-Maximum-Value-of-a-String-in-an-Array/cpp-2496) | | |
| 2497 | [Maximum Star Sum of a Graph](https://leetcode.com/problems/maximum-star-sum-of-a-graph/) | [无] | [C++](2001-2500/2497-Maximum-Star-Sum-of-a-Graph/cpp-2497) | | |
| 2498 | [Frog Jump II](https://leetcode.com/problems/frog-jump-ii/) | [无] | [C++](2001-2500/2498-Frog-Jump-II/cpp-2498/) | | |
| 2499 | [Minimum Total Cost to Make Arrays Unequal](https://leetcode.com/problems/minimum-total-cost-to-make-arrays-unequal/description/) | [无] | [C++](2001-2500/2499-Minimum-Total-Cost-to-Make-Arrays-Unequal/cpp-2499/) | | |
| 2500 | [Delete Greatest Value in Each Row](https://leetcode.com/problems/delete-greatest-value-in-each-row/) | [无] | [C++](2001-2500/2500-Delete-Greatest-Value-in-Each-Row/cpp-2500/) | | |
| 2501 | [Longest Square Streak in an Array](https://leetcode.com/problems/longest-square-streak-in-an-array/) | [无] | [C++](2501-3000/2501-Longest-Square-Streak-in-an-Array/cpp-2501/) | | |
| 2502 | [Design Memory Allocator](https://leetcode.com/problems/design-memory-allocator/) | [无] | [C++](2501-3000/2502-Design-Memory-Allocator/cpp-2502/) | | |
| 2503 | [Maximum Number of Points From Grid Queries](https://leetcode.com/problems/maximum-number-of-points-from-grid-queries/) | [无] | [C++](2501-3000/2503-Maximum-Number-of-Points-From-Grid-Queries/cpp-2503/) | | |
| 2504 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2505 | [Bitwise OR of All Subsequence Sums](https://leetcode.com/problems/bitwise-or-of-all-subsequence-sums/description/) | [无] | [C++](2501-3000/2505-Bitwise-OR-of-All-Subsequence-Sums/cpp-2505/) | | |
| 2506 | [Count Pairs Of Similar Strings](https://leetcode.com/problems/count-pairs-of-similar-strings/) | [无] | [C++](2501-3000/2506-Count-Pairs-Of-Similar-Strings/cpp-2506/) | | |
| 2507 | [Smallest Value After Replacing With Sum of Prime Factors](https://leetcode.com/problems/smallest-value-after-replacing-with-sum-of-prime-factors/) | [无] | [C++](2501-3000/2507-Smallest-Value-After-Replacing-With-Sum-of-Prime-Factors/cpp-2507/) | | |
| 2508 | [Add Edges to Make Degrees of All Nodes Even](https://leetcode.com/problems/add-edges-to-make-degrees-of-all-nodes-even/) | [无] | [C++](2501-3000/2508-Add-Edges-to-Make-Degrees-of-All-Nodes-Even/cpp-2508/) | | |
| 2509 | [Cycle Length Queries in a Tree](https://leetcode.com/problems/cycle-length-queries-in-a-tree/) | [无] | [C++](2501-3000/2509-Cycle-Length-Queries-in-a-Tree/cpp-2509/) | | |
| 2510 | [Check if There is a Path With Equal Number of 0's And 1's](https://leetcode.com/problems/check-if-there-is-a-path-with-equal-number-of-0s-and-1s/description/) | [无] | [C++](2501-3000/2510-Check-if-There-is-a-Path-With-Equal-Number-of-0s-And-1s/cpp-2510/) | | |
| 2511 | [Maximum Enemy Forts That Can Be Captured](https://leetcode.com/problems/maximum-enemy-forts-that-can-be-captured/) | [无] | [C++](2501-3000/2511-Maximum-Enemy-Forts-That-Can-Be-Captured/cpp-2511/) | | |
| 2512 | [Reward Top K Students](https://leetcode.com/problems/reward-top-k-students/) | [无] | [C++](2501-3000/2512-Reward-Top-K-Students/cpp-2512/) | | |
| 2513 | [Minimize the Maximum of Two Arrays](https://leetcode.com/problems/minimize-the-maximum-of-two-arrays/) | [无] | [C++](2501-3000/2513-Minimize-the-Maximum-of-Two-Arrays/cpp-2513/) | | |
| 2514 | [Count Anagrams](https://leetcode.com/problems/count-anagrams/) | [无] | [C++](2501-3000/2514-Count-Anagrams/cpp-2514/) | | |
| 2515 | [Shortest Distance to Target String in a Circular Array](https://leetcode.com/problems/shortest-distance-to-target-string-in-a-circular-array/) | [无] | [C++](2501-3000/2515-Shortest-Distance-to-Target-String-in-a-Circular-Array/cpp-2515/) | | |
| 2516 | [Take K of Each Character From Left and Right](2001-2500/2516-Take-K-of-Each-Character-From-Left-and-Right/cpp-2516/) | [无] | [C++](2501-3000/2516-Take-K-of-Each-Character-From-Left-and-Right/cpp-2516/) | | |
| 2517 | [Maximum Tastiness of Candy Basket](2001-2500/2517-Maximum-Tastiness-of-Candy-Basket/cpp-2517/) | [无] | [C++](2501-3000/2517-Maximum-Tastiness-of-Candy-Basket/cpp-2517/) | | |
| 2518 | [Number of Great Partitions](https://leetcode.com/problems/number-of-great-partitions/) | [无] | [C++](2501-3000/2518-Number-of-Great-Partitions/cpp-2518/) | | |
| 2519 | [Count the Number of K-Big Indices](https://leetcode.com/problems/count-the-number-of-k-big-indices/description/) | [无] | [C++](2501-3000/2519-Count-the-Number-of-K-Big-Indices/cpp-2519/) | | |
| 2520 | [Count the Digits That Divide a Number](https://leetcode.com/problems/count-the-digits-that-divide-a-number/) | [无] | [C++](2501-3000/2520-Count-the-Digits-That-Divide-a-Number/cpp-2520/) | | |
| 2521 | [Distinct Prime Factors of Product of Array](https://leetcode.com/problems/distinct-prime-factors-of-product-of-array/) | [无] | [C++](2501-3000/2521-Distinct-Prime-Factors-of-Product-of-Array/cpp-2521/) | | |
| 2522 | [Partition String Into Substrings With Values at Most K](https://leetcode.com/problems/partition-string-into-substrings-with-values-at-most-k/) | [无] | [C++](2501-3000/2522-Partition-String-Into-Substrings-With-Values-at-Most-K/cpp-2522/) | | |
| 2523 | [Closest Prime Numbers in Range](https://leetcode.com/problems/closest-prime-numbers-in-range/) | [无] | [C++](2501-3000/2523-Closest-Prime-Numbers-in-Range/cpp-2523/) | | |
| 2524 | [Maximum Frequency Score of a Subarray](https://leetcode.com/problems/maximum-frequency-score-of-a-subarray/description/) | [无] | [C++](2501-3000/2524-Maximum-Frequency-Score-of-a-Subarray/cpp-2524/) | | |
| 2525 | [Categorize Box According to Criteria](https://leetcode.com/problems/categorize-box-according-to-criteria/) | [无] | [C++](2501-3000/2525-Categorize-Box-According-to-Criteria/cpp-2525/) | | |
| 2526 | [Find Consecutive Integers from a Data Stream](https://leetcode.com/problems/find-consecutive-integers-from-a-data-stream/) | [无] | [C++](2501-3000/2526-Find-Consecutive-Integers-from-a-Data-Stream/cpp-2526/) | | |
| 2527 | [Find Xor-Beauty of Array](https://leetcode.com/problems/find-xor-beauty-of-array/) | [无] | [C++](2501-3000/2527-Find-Xor-Beauty-of-Array/cpp-2527/) | | |
| 2528 | [Maximize the Minimum Powered City](https://leetcode.com/problems/maximize-the-minimum-powered-city/) | [无] | [C++](2501-3000/2528-Maximize-the-Minimum-Powered-City/cpp-2528/) | | |
| 2529 | [Maximum Count of Positive Integer and Negative Integer](https://leetcode.com/problems/maximum-count-of-positive-integer-and-negative-integer/) | [无] | [C++](2501-3000/2529-Maximum-Count-of-Positive-Integer-and-Negative-Integer/cpp-2529/) | | |
| 2530 | [Maximal Score After Applying K Operations](https://leetcode.com/problems/maximal-score-after-applying-k-operations/) | [无] | [C++](2501-3000/2530-Maximal-Score-After-Applying-K-Operations/cpp-2530/) | | |
| 2531 | [Make Number of Distinct Characters Equal](https://leetcode.com/problems/make-number-of-distinct-characters-equal/) | [无] | [C++](2501-3000/2531-Make-Number-of-Distinct-Characters-Equal/cpp-2531/) | | |
| 2532 | [Time to Cross a Bridge](https://leetcode.com/problems/time-to-cross-a-bridge/description/) | [无] | [C++](2501-3000/2532-Time-to-Cross-a-Bridge/cpp-2532/) | | |
| 2533 | [Number of Good Binary Strings](https://leetcode.com/problems/number-of-good-binary-strings/) | [无] | [C++](2501-3000/2533-Number-of-Good-Binary-Strings/cpp-2533/) | | |
| 2534 | [Time Taken to Cross the Door](https://leetcode.com/problems/time-taken-to-cross-the-door/description/) | [无] | [C++](2501-3000/2534-Time-Taken-to-Cross-the-Door/cpp-2534/) | | |
| 2535 | [Difference Between Element Sum and Digit Sum of an Array](https://leetcode.com/problems/difference-between-element-sum-and-digit-sum-of-an-array/) | [无] | [C++](2501-3000/2535-Difference-Between-Element-Sum-and-Digit-Sum-of-an-Array/cpp-2535/) | | |
| 2536 | [Increment Submatrices by One](https://leetcode.com/problems/increment-submatrices-by-one/) | [无] | [C++](2501-3000/2536-Increment-Submatrices-by-One/cpp-2536/) | | |
| 2537 | [Count the Number of Good Subarrays](https://leetcode.com/problems/count-the-number-of-good-subarrays/) | [无] | [C++](2501-3000/2537-Count-the-Number-of-Good-Subarrays/cpp-2537/) | | |
| | | | | | |
| 2539 | [Count the Number of Good Subsequences](https://leetcode.com/problems/count-the-number-of-good-subsequences/) | [无] | [C++](2501-3000/2539-Count-the-Number-of-Good-Subsequences/cpp-2539/) | | |
| 2540 | [Minimum Common Value](https://leetcode.com/problems/minimum-common-value/) | [无] | [C++](2501-3000/2540-Minimum-Common-Value/cpp-2540/) | | |
| 2541 | [Minimum Operations to Make Array Equal II](https://leetcode.com/problems/minimum-operations-to-make-array-equal-ii/) | [无] | [C++](2501-3000/2541-Minimum-Operations-to-Make-Array-Equal-II/cpp-2541/) | | |
| 2542 | [Maximum Subsequence Score](https://leetcode.com/problems/maximum-subsequence-score/) | [无] | [C++](2501-3000/2542-Maximum-Subsequence-Score/cpp-2542/) | | |
| 2543 | [Check if Point Is Reachable](https://leetcode.com/problems/check-if-point-is-reachable/description/) | [无] | [C++](2501-3000/2543-Check-if-Point-Is-Reachable/cpp-2543/) | | |
| 2544 | [Alternating Digit Sum](https://leetcode.com/problems/alternating-digit-sum/) | [无] | [C++](2501-3000/2544-Alternating-Digit-Sum/cpp-2544/) | | |
| 2545 | [Sort the Students by Their Kth Score](https://leetcode.com/problems/sort-the-students-by-their-kth-score/) | [无] | [C++](2501-3000/2545-Sort-the-Students-by-Their-Kth-Score/cpp-2545/) | | |
| 2546 | [Apply Bitwise Operations to Make Strings Equal](https://leetcode.com/problems/apply-bitwise-operations-to-make-strings-equal/) | [无] | [C++](2501-3000/2546-Apply-Bitwise-Operations-to-Make-Strings-Equal/cpp-2546/) | | |
| 2547 | [Minimum Cost to Split an Array](https://leetcode.com/problems/minimum-cost-to-split-an-array/) | [无] | [C++](2501-3000/2547-Minimum-Cost-to-Split-an-Array/cpp-2547/) | | |
| 2548 | [Maximum Price to Fill a Bag](https://leetcode.com/problems/maximum-price-to-fill-a-bag/) | [无] | [C++](2501-3000/2548-Maximum-Price-to-Fill-a-Bag/cpp-2548/) | | |
| 2549 | [Count Distinct Numbers on Board](https://leetcode.com/problems/count-distinct-numbers-on-board/) | [无] | [C++](2501-3000/2549-Count-Distinct-Numbers-on-Board/cpp-2549/) | | |
| 2550 | [Count Collisions of Monkeys on a Polygon](https://leetcode.com/problems/count-collisions-of-monkeys-on-a-polygon/) | [无] | [C++](2501-3000/2550-Count-Collisions-of-Monkeys-on-a-Polygon/cpp-2550/) | | |
| 2551 | [Put Marbles in Bags](https://leetcode.com/problems/put-marbles-in-bags/) | [无] | [C++](2501-3000/2551-Put-Marbles-in-Bags/cpp-2551/) | | |
| | | | | | |
| 2553 | [Separate the Digits in an Array](https://leetcode.com/problems/separate-the-digits-in-an-array/) | [无] | [C++](2501-3000/2553-Separate-the-Digits-in-an-Array/cpp-2553/) | | |
| 2554 | [Maximum Number of Integers to Choose From a Range I](https://leetcode.com/problems/maximum-number-of-integers-to-choose-from-a-range-i/) | [无] | [C++](2501-3000/2554-Maximum-Number-of-Integers-to-Choose-From-a-Range-I/cpp-2554/) | | |
| 2555 | [Maximize Win From Two Segments](https://leetcode.com/problems/maximize-win-from-two-segments/) | [无] | [C++](2501-3000/2555-Maximize-Win-From-Two-Segments/cpp-2555/) | | |
| 2556 | [Disconnect Path in a Binary Matrix by at Most One Flip](https://leetcode.com/problems/disconnect-path-in-a-binary-matrix-by-at-most-one-flip/) | [无] | [C++](2501-3000/2556-Disconnect-Path-in-a-Binary-Matrix-by-at-Most-One-Flip/cpp-2556/) | | |
| 2557 | [Maximum Number of Integers to Choose From a Range II](https://leetcode.com/problems/maximum-number-of-integers-to-choose-from-a-range-ii/description/) | [无] | [C++](2501-3000/2557-Maximum-Number-of-Integers-to-Choose-From-a-Range-II/cpp-2557/) | | |
| 2558 | [Take Gifts From the Richest Pile](https://leetcode.com/problems/take-gifts-from-the-richest-pile/) | [无] | [C++](2501-3000/2558-Take-Gifts-From-the-Richest-Pile/cpp-2558/) | | |
| 2559 | [Count Vowel Strings in Ranges](https://leetcode.com/problems/count-vowel-strings-in-ranges/) | [无] | [C++](2501-3000/2559-Count-Vowel-Strings-in-Ranges/cpp-2559/) | | |
| 2560 | [House Robber IV](https://leetcode.com/problems/house-robber-iv/) | [无] | [C++](2501-3000/2560-House-Robber-IV/cpp-2560/) | | |
| 2561 | [Rearranging Fruits](https://leetcode.com/problems/rearranging-fruits/) | [无] | [C++](2501-3000/2561-Rearranging-Fruits/cpp-2561/) | | |
| 2562 | [Find the Array Concatenation Value](https://leetcode.com/problems/find-the-array-concatenation-value/) | [无] | [C++](2501-3000/2562-Find-the-Array-Concatenation-Value/cpp-2562/) | | |
| 2563 | [Count the Number of Fair Pairs](https://leetcode.com/problems/count-the-number-of-fair-pairs/) | [无] | [C++](2501-3000/2563-Count-the-Number-of-Fair-Pairs/cpp-2563/) | | |
| 2564 | [Substring XOR Queries](https://leetcode.com/problems/substring-xor-queries/) | [无] | [C++](2501-3000/2564-Substring-XOR-Queries/cpp-2564/) | | |
| 2565 | [Subsequence With the Minimum Score](https://leetcode.com/problems/subsequence-with-the-minimum-score/) | [无] | [C++](2501-3000/2565-Subsequence-With-the-Minimum-Score/cpp-2565/) | | |
| 2566 | [Maximum Difference by Remapping a Digit](https://leetcode.com/problems/maximum-difference-by-remapping-a-digit/) | [无] | [C++](2501-3000/2566-Maximum-Difference-by-Remapping-a-Digit/cpp-2566/) | | |
| 2567 | [Minimum Score by Changing Two Elements](https://leetcode.com/problems/minimum-score-by-changing-two-elements/) | [无] | [C++](2501-3000/2567-Minimum-Score-by-Changing-Two-Elements/cpp-2567/) | | |
| 2568 | [Minimum Impossible OR](https://leetcode.com/problems/minimum-impossible-or/) | [无] | [C++](2501-3000/2568-Minimum-Impossible-OR/cpp-2568/) | | |
| 2569 | [Handling Sum Queries After Update](https://leetcode.com/problems/handling-sum-queries-after-update/) | [无] | [C++](2501-3000/2569-Handling-Sum-Queries-After-Update/cpp-2569/) | | |
| 2570 | [Merge Two 2D Arrays by Summing Values](https://leetcode.com/problems/merge-two-2d-arrays-by-summing-values/) | [无] | [C++](2501-3000/2570-Merge-Two-2D-Arrays-by-Summing-Values/cpp-2570/) | | |
| 2571 | [Minimum Operations to Reduce an Integer to 0](https://leetcode.com/problems/minimum-operations-to-reduce-an-integer-to-0/) | [无] | [C++](2501-3000/2571-Minimum-Operations-to-Reduce-an-Integer-to-0/cpp-2571/) | | |
| 2572 | [Count the Number of Square-Free Subsets](https://leetcode.com/problems/count-the-number-of-square-free-subsets/) | [无] | [C++](2501-3000/2572-Count-the-Number-of-Square-Free-Subsets/cpp-2572/) | | |
| 2573 | [Find the String with LCP](https://leetcode.com/problems/find-the-string-with-lcp/) | [无] | [C++](2501-3000/2573-Find-the-String-with-LCP/cpp-2573/) | | |
| 2574 | [Left and Right Sum Differences](https://leetcode.com/problems/left-and-right-sum-differences/) | [无] | [C++](2501-3000/2574-Left-and-Right-Sum-Differences/cpp-2574/) | | |
| 2575 | [Find the Divisibility Array of a String](https://leetcode.com/problems/find-the-divisibility-array-of-a-string/) | [无] | [C++](2501-3000/2575-Find-the-Divisibility-Array-of-a-String/cpp-2575/) | | |
| 2576 | [Find the Maximum Number of Marked Indices](https://leetcode.com/problems/find-the-maximum-number-of-marked-indices/) | [无] | [C++](2501-3000/2576-Find-the-Maximum-Number-of-Marked-Indices/cpp-2576/) | | |
| 2577 | [Minimum Time to Visit a Cell In a Grid](https://leetcode.com/problems/minimum-time-to-visit-a-cell-in-a-grid/) | [无] | [C++](2501-3000/2577-Minimum-Time-to-Visit-a-Cell-In-a-Grid/cpp-2577/) | | |
| 2578 | [Split With Minimum Sum](https://leetcode.com/problems/split-with-minimum-sum/) | [无] | [C++](2501-3000/2578-Split-With-Minimum-Sum/cpp-2578/) | | |
| 2579 | [Count Total Number of Colored Cells](https://leetcode.com/problems/count-total-number-of-colored-cells/) | [无] | [C++](2501-3000/2579-Count-Total-Number-of-Colored-Cells/cpp-2579/) | | |
| 2580 | [Count Ways to Group Overlapping Ranges](https://leetcode.com/problems/count-ways-to-group-overlapping-ranges/) | [无] | [C++](2501-3000/2580-Count-Ways-to-Group-Overlapping-Ranges/cpp-2580/) | | |
| 2581 | [Count Number of Possible Root Nodes](https://leetcode.com/problems/count-number-of-possible-root-nodes/) | [无] | [C++](2501-3000/2581-Count-Number-of-Possible-Root-Nodes/cpp-2581/) | | |
| 2582 | [Pass the Pillow](https://leetcode.com/problems/pass-the-pillow/) | [无] | [C++](2501-3000/2582-Pass-the-Pillow/cpp-2582/) | | |
| 2583 | [Kth Largest Sum in a Binary Tree](https://leetcode.com/problems/kth-largest-sum-in-a-binary-tree/) | [无] | [C++](2501-3000/2583-Kth-Largest-Sum-in-a-Binary-Tree/cpp-2583/) | | |
| 2584 | [Split the Array to Make Coprime Products](https://leetcode.com/problems/split-the-array-to-make-coprime-products/) | [无] | [C++](2501-3000/2584-Split-the-Array-to-Make-Coprime-Products/cpp-2584/) | | |
| 2585 | [Number of Ways to Earn Points](https://leetcode.com/problems/number-of-ways-to-earn-points/) | [无] | [C++](2501-3000/2585-Number-of-Ways-to-Earn-Points/cpp-2585/) | | |
| 2586 | [Count the Number of Vowel Strings in Range](https://leetcode.com/problems/count-the-number-of-vowel-strings-in-range/) | [无] | [C++](2501-3000/2586-Count-the-Number-of-Vowel-Strings-in-Range/cpp-2586/) | | |
| 2587 | [Rearrange Array to Maximize Prefix Score](https://leetcode.com/problems/rearrange-array-to-maximize-prefix-score/) | [无] | [C++](2501-3000/2587-Rearrange-Array-to-Maximize-Prefix-Score/cpp-2587/) | | |
| 2588 | [Count the Number of Beautiful Subarrays](https://leetcode.com/problems/count-the-number-of-beautiful-subarrays/) | [无] | [C++](2501-3000/2588-Count-the-Number-of-Beautiful-Subarrays/cpp-2588/) | | |
| 2589 | [Minimum Time to Complete All Tasks](https://leetcode.com/problems/minimum-time-to-complete-all-tasks/) | [无] | [C++](2501-3000/2589-Minimum-Time-to-Complete-All-Tasks/cpp-2589/) | | |
| 2590 | [Design a Todo List](https://leetcode.com/problems/design-a-todo-list/description/) | [无] | [C++](2501-3000/2590-Design-a-Todo-List/cpp-2590/) | | |
| 2591 | [Distribute Money to Maximum Children](https://leetcode.com/problems/distribute-money-to-maximum-children/) | [无] | [C++](2501-3000/2591-Distribute-Money-to-Maximum-Children/cpp-2591/) | | |
| 2592 | [Maximize Greatness of an Array](https://leetcode.com/problems/maximize-greatness-of-an-array/) | [无] | [C++](2501-3000/2592-Maximize-Greatness-of-an-Array/cpp-2592/) | | |
| 2593 | [Find Score of an Array After Marking All Elements](https://leetcode.com/problems/find-score-of-an-array-after-marking-all-elements/) | [无] | [C++](2501-3000/2593-Find-Score-of-an-Array-After-Marking-All-Elements/cpp-2593/) | | |
| 2594 | [Minimum Time to Repair Cars](https://leetcode.com/problems/minimum-time-to-repair-cars/) | [无] | [C++](2501-3000/2594-Minimum-Time-to-Repair-Cars/cpp-2594/) | | |
| 2595 | [Number of Even and Odd Bits](https://leetcode.com/problems/number-of-even-and-odd-bits/) | [无] | [C++](2501-3000/2595-Number-of-Even-and-Odd-Bits/cpp-2595/) | | |
| 2596 | [Check Knight Tour Configuration](https://leetcode.com/problems/check-knight-tour-configuration/) | [无] | [C++](2501-3000/2596-Check-Knight-Tour-Configuration/cpp-2596/) | | |
| 2597 | [The Number of Beautiful Subsets](https://leetcode.com/problems/the-number-of-beautiful-subsets/) | [无] | [C++](2501-3000/2597-The-Number-of-Beautiful-Subsets/cpp-2597/) | | |
| 2598 | [Smallest Missing Non-negative Integer After Operations](https://leetcode.com/problems/smallest-missing-non-negative-integer-after-operations/) | [无] | [C++](2501-3000/2598-Smallest-Missing-Non-negative-Integer-After-Operations/cpp-2598/) | | |
| 2599 | [Make the Prefix Sum Non-negative](https://leetcode.com/problems/make-the-prefix-sum-non-negative/description/) | [无] | [C++](2501-3000/2599-Make-the-Prefix-Sum-Non-negative/cpp-2599/) | | |
| 2600 | [K Items With the Maximum Sum](https://leetcode.com/problems/k-items-with-the-maximum-sum/) | [无] | [C++](2501-3000/2600-K-Items-With-the-Maximum-Sum/cpp-2600/) | | |
| 2601 | [Prime Subtraction Operation](https://leetcode.com/problems/prime-subtraction-operation/) | [无] | [C++](2501-3000/2601-Prime-Subtraction-Operation/cpp-2601/) | | |
| 2602 | [Minimum Operations to Make All Array Elements Equal](https://leetcode.com/problems/minimum-operations-to-make-all-array-elements-equal/description/) | [无] | [C++](2501-3000/2602-Minimum-Operations-to-Make-All-Array-Elements-Equal/cpp-2602/) | | |
| 2603 | [Collect Coins in a Tree](https://leetcode.com/problems/collect-coins-in-a-tree/description/) | [无] | [C++](2501-3000/2603-Collect-Coins-in-a-Tree/cpp-2603/) | | |
| 2604 | [Minimum Time to Eat All Grains](https://leetcode.com/problems/minimum-time-to-eat-all-grains/description/) | [无] | [C++](2501-3000/2604-Minimum-Time-to-Eat-All-Grains/cpp-2604/) | | |
| 2605 | [Form Smallest Number From Two Digit Arrays](https://leetcode.com/problems/form-smallest-number-from-two-digit-arrays/) | [无] | [C++](2501-3000/2605-Form-Smallest-Number-From-Two-Digit-Arrays/cpp-2605/) | | |
| 2606 | [Find the Substring With Maximum Cost](https://leetcode.com/problems/find-the-substring-with-maximum-cost/) | [无] | [C++](2501-3000/2606-Find-the-Substring-With-Maximum-Cost/cpp-2606/) | | |
| 2607 | [Make K-Subarray Sums Equal](https://leetcode.com/problems/make-k-subarray-sums-equal/) | [无] | [C++](2501-3000/2607-Make-K-Subarray-Sums-Equal/cpp-2607/) | | |
| 2608 | [Shortest Cycle in a Graph](https://leetcode.com/problems/shortest-cycle-in-a-graph/) | [无] | [C++](2501-3000/2608-Shortest-Cycle-in-a-Graph/cpp-2608/) | | |
| 2609 | [Find the Longest Balanced Substring of a Binary String](https://leetcode.com/problems/find-the-longest-balanced-substring-of-a-binary-string/) | [无] | [C++](2501-3000/2609-Find-the-Longest-Balanced-Substring-of-a-Binary-String/cpp-2609/) | | |
| 2610 | [Convert an Array Into a 2D Array With Conditions](https://leetcode.com/problems/convert-an-array-into-a-2d-array-with-conditions/) | [无] | [C++](2501-3000/2610-Convert-an-Array-Into-a-2D-Array-With-Conditions/cpp-2610/) | | |
| 2611 | [Mice and Cheese](https://leetcode.com/problems/mice-and-cheese/) | [无] | [C++](2501-3000/2611-Mice-and-Cheese/cpp-2611/) | | |
| 2612 | [Minimum Reverse Operations](https://leetcode.com/problems/minimum-reverse-operations/) | [无] | [C++](2501-3000/2612-Minimum-Reverse-Operations/cpp-2612/) | | |
| | | | | | |
| 2614 | [Prime In Diagonal](https://leetcode.com/problems/prime-in-diagonal/) | [无] | [C++](2501-3000/2614-Prime-In-Diagonal/cpp-2614/) | | |
| 2615 | [Sum of Distances](https://leetcode.com/problems/sum-of-distances/) | [无] | [C++](2501-3000/2615-Sum-of-Distances/cpp-2615/) | | |
| 2616 | [Minimize the Maximum Difference of Pairs](https://leetcode.com/problems/minimize-the-maximum-difference-of-pairs/) | [无] | [C++](2501-3000/2616-Minimize-the-Maximum-Difference-of-Pairs/cpp-2616/) | | |
| 2617 | [Minimum Number of Visited Cells in a Grid](https://leetcode.com/problems/minimum-number-of-visited-cells-in-a-grid/) | [无] | [C++](2501-3000/2617-Minimum-Number-of-Visited-Cells-in-a-Grid/cpp-2617/) | | |
| 2618 | JavaScript Problem | - | - | - | - |
| 2619 | JavaScript Problem | - | - | - | - |
| 2620 | JavaScript Problem | - | - | - | - |
| 2621 | JavaScript Problem | - | - | - | - |
| 2622 | JavaScript Problem | - | - | - | - |
| 2623 | JavaScript Problem | - | - | - | - |
| 2624 | JavaScript Problem | - | - | - | - |
| 2625 | JavaScript Problem | - | - | - | - |
| 2626 | JavaScript Problem | - | - | - | - |
| 2627 | JavaScript Problem | - | - | - | - |
| 2628 | JavaScript Problem | - | - | - | - |
| 2629 | JavaScript Problem | - | - | - | - |
| 2630 | JavaScript Problem | - | - | - | - |
| 2631 | JavaScript Problem | - | - | - | - |
| 2632 | JavaScript Problem | - | - | - | - |
| 2633 | JavaScript Problem | - | - | - | - |
| 2634 | JavaScript Problem | - | - | - | - |
| 2635 | JavaScript Problem | - | - | - | - |
| 2636 | JavaScript Problem | - | - | - | - |
| 2637 | JavaScript Problem | - | - | - | - |
| 2638 | [Count the Number of K-Free Subsets](https://leetcode.com/problems/count-the-number-of-k-free-subsets/description/) | [无] | [C++](2501-3000/2638-Count-the-Number-of-K-Free-Subsets/cpp-2638/) | | |
| 2639 | [Find the Width of Columns of a Grid](https://leetcode.com/problems/find-the-width-of-columns-of-a-grid/) | [无] | [C++](2501-3000/2639-Find-the-Width-of-Columns-of-a-Grid/cpp-2639/) | | |
| 2640 | [Find the Score of All Prefixes of an Array](https://leetcode.com/problems/find-the-score-of-all-prefixes-of-an-array/) | [无] | [C++](2501-3000/2640-Find-the-Score-of-All-Prefixes-of-an-Array/cpp-2640/) | | |
| 2641 | [Cousins in Binary Tree II](https://leetcode.com/problems/cousins-in-binary-tree-ii/) | [无] | [C++](2501-3000/2641-Cousins-in-Binary-Tree-II/cpp-2641/) | | |
| 2642 | [Design Graph With Shortest Path Calculator](https://leetcode.com/problems/design-graph-with-shortest-path-calculator/) | [无] | [C++](2501-3000/2642-Design-Graph-With-Shortest-Path-Calculator/cpp-2642/) | | |
| 2643 | [Row With Maximum Ones](https://leetcode.com/problems/row-with-maximum-ones/) | [无] | [C++](2501-3000/2643-Row-With-Maximum-Ones/cpp-2643/) | | |
| 2644 | [Find the Maximum Divisibility Score](https://leetcode.com/problems/find-the-maximum-divisibility-score/) | [无] | [C++](2501-3000/2644-Find-the-Maximum-Divisibility-Score/cpp-2644/) | | |
| 2645 | [Minimum Additions to Make Valid String](https://leetcode.com/problems/minimum-additions-to-make-valid-string/) | [无] | [C++](2501-3000/2645-Minimum-Additions-to-Make-Valid-String/cpp-2645/) | | |
| 2646 | [Minimize the Total Price of the Trips](https://leetcode.com/problems/minimize-the-total-price-of-the-trips/) | [无] | [C++](2501-3000/2646-Minimize-the-Total-Price-of-the-Trips/cpp-2646/) | | |
| 2647 | [Color the Triangle Red](https://leetcode.com/problems/color-the-triangle-red/description/) | [无] | [C++](2501-3000/2647-Color-the-Triangle-Red/cpp-2647/) | | |
| 2648 | JavaScript Problem | - | - | - | - |
| 2649 | JavaScript Problem | - | - | - | - |
| 2650 | JavaScript Problem | - | - | - | - |
| 2651 | [Calculate Delayed Arrival Time](https://leetcode.com/problems/calculate-delayed-arrival-time/) | [无] | [C++](2501-3000/2651-Calculate-Delayed-Arrival-Time/cpp-2651/) | | |
| 2652 | [Sum Multiples](https://leetcode.com/problems/sum-multiples/) | [无] | [C++](2501-3000/2652-Sum-Multiples/cpp-2652/) | | |
| 2653 | [Sliding Subarray Beauty](https://leetcode.com/problems/sliding-subarray-beauty/) | [无] | [C++](2501-3000/2653-Sliding-Subarray-Beauty/cpp-2653/) | | |
| 2654 | [Minimum Number of Operations to Make All Array Elements Equal to 1](https://leetcode.com/problems/minimum-number-of-operations-to-make-all-array-elements-equal-to-1/) | [无] | [C++](2501-3000/2654-Minimum-Number-of-Operations-to-Make-All-Array-Elements-Equal-to-1/cpp-2654/) | | |
| 2655 | [Find Maximal Uncovered Ranges](https://leetcode.com/problems/find-maximal-uncovered-ranges/description/) | [无] | [C++](2501-3000/2655-Find-Maximal-Uncovered-Ranges/cpp-2655/) | | |
| 2656 | [Maximum Sum With Exactly K Elements](https://leetcode.com/problems/maximum-sum-with-exactly-k-elements/) | [无] | [C++](2501-3000/2656-Maximum-Sum-With-Exactly-K-Elements/cpp-2656/) | | |
| 2657 | [Find the Prefix Common Array of Two Arrays](https://leetcode.com/problems/find-the-prefix-common-array-of-two-arrays/) | [无] | [C++](2501-3000/2657-Find-the-Prefix-Common-Array-of-Two-Arrays/cpp-2657/) | | |
| 2658 | [Maximum Number of Fish in a Grid](https://leetcode.com/problems/maximum-number-of-fish-in-a-grid/) | [无] | [C++](2501-3000/2658-Maximum-Number-of-Fish-in-a-Grid/cpp-2658/) | | |
| 2659 | [Make Array Empty](https://leetcode.com/problems/make-array-empty/) | [无] | [C++](2501-3000/2659-Make-Array-Empty/cpp-2659/) | | |
| 2660 | [Determine the Winner of a Bowling Game](https://leetcode.com/problems/determine-the-winner-of-a-bowling-game/) | [无] | [C++](2501-3000/2660-Determine-the-Winner-of-a-Bowling-Game/cpp-2660/) | | |
| 2661 | [First Completely Painted Row or Column](https://leetcode.com/problems/first-completely-painted-row-or-column/) | [无] | [C++](2501-3000/2661-First-Completely-Painted-Row-or-Column/cpp-2661/) | | |
| 2662 | [Minimum Cost of a Path With Special Roads](https://leetcode.com/problems/minimum-cost-of-a-path-with-special-roads/) | [无] | [C++](2501-3000/2662-Minimum-Cost-of-a-Path-With-Special-Roads/cpp-2662/) | | |
| 2663 | [Lexicographically Smallest Beautiful String](https://leetcode.com/problems/lexicographically-smallest-beautiful-string/) | [无] | [C++](2501-3000/2663-Lexicographically-Smallest-Beautiful-String/cpp-2663/) | | |
| 2664 | [The Knight’s Tour](https://leetcode.com/problems/the-knights-tour/) | [无] | [C++](2501-3000/2664-The-Knights-Tour/cpp-2664/) | | |
| 2665 | JavaScript Problem | - | - | - | - |
| 2666 | JavaScript Problem | - | - | - | - |
| 2667 | JavaScript Problem | - | - | - | - |
| 2668 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2669 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2670 | [Find the Distinct Difference Array](https://leetcode.com/problems/find-the-distinct-difference-array/) | [无] | [C++](2501-3000/2670-Find-the-Distinct-Difference-Array/cpp-2670/) | | |
| 2671 | [Frequency Tracker](https://leetcode.com/problems/frequency-tracker/) | [无] | [C++](2501-3000/2671-Frequency-Tracker/cpp-2671/) | | |
| 2672 | [Number of Adjacent Elements With the Same Color](https://leetcode.com/problems/number-of-adjacent-elements-with-the-same-color/) | [无] | [C++](2501-3000/2672-Number-of-Adjacent-Elements-With-the-Same-Color/cpp-2672/) | | |
| 2673 | [Make Costs of Paths Equal in a Binary Tree](https://leetcode.com/problems/make-costs-of-paths-equal-in-a-binary-tree/) | [无] | [C++](2501-3000/2673-Make-Costs-of-Paths-Equal-in-a-Binary-Tree/cpp-2673/) | | |
| 2674 | [Split a Circular Linked List](https://leetcode.com/problems/split-a-circular-linked-list/description/) | [无] | [C++](2501-3000/2674-Split-a-Circular-Linked-List/cpp-2674/) | | |
| 2675 | JavaScript Problem | - | - | - | - |
| 2676 | JavaScript Problem | - | - | - | - |
| 2677 | JavaScript Problem | - | - | - | - |
| 2678 | [Number of Senior Citizens](https://leetcode.com/problems/number-of-senior-citizens/) | [无] | [C++](2501-3000/2678-Number-of-Senior-Citizens/cpp-2678/) | | |
| 2679 | [Sum in a Matrix](https://leetcode.com/problems/sum-in-a-matrix/) | [无] | [C++](2501-3000/2679-Sum-in-a-Matrix/cpp-2679/) | | |
| 2680 | [Maximum OR](https://leetcode.com/problems/maximum-or/) | [无] | [C++](2501-3000/2680-Maximum-OR/cpp-2680/) | | |
| 2681 | [Power of Heroes](https://leetcode.com/problems/power-of-heroes/) | [无] | [C++](2501-3000/2681-Power-of-Heroes/cpp-2681/) | | |
| 2682 | [Find the Losers of the Circular Game](https://leetcode.com/problems/find-the-losers-of-the-circular-game/) | [无] | [C++](2501-3000/2682-Find-the-Losers-of-the-Circular-Game/cpp-2682/) | | |
| 2683 | [Neighboring Bitwise XOR](https://leetcode.com/problems/neighboring-bitwise-xor/) | [无] | [C++](2501-3000/2683-Neighboring-Bitwise-XOR/cpp-2683/) | | |
| 2684 | [Maximum Number of Moves in a Grid](https://leetcode.com/problems/maximum-number-of-moves-in-a-grid/) | [无] | [C++](2501-3000/2684-Maximum-Number-of-Moves-in-a-Grid/cpp-2684/) | | |
| 2685 | [Count the Number of Complete Components](https://leetcode.com/problems/count-the-number-of-complete-components/) | [无] | [C++](2501-3000/2685-Count-the-Number-of-Complete-Components/cpp-2685/) | | |
| 2686 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2687 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2688 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2689 | [Extract Kth Character From The Rope Tree](https://leetcode.com/problems/extract-kth-character-from-the-rope-tree/) | [无] | [C++](2501-3000/2689-Extract-Kth-Character-From-The-Rope-Tree/cpp-2689/) | | |
| 2690 | JavaScript Problem | - | - | - | - |
| 2691 | JavaScript Problem | - | - | - | - |
| 2692 | JavaScript Problem | - | - | - | - |
| 2693 | JavaScript Problem | - | - | - | - |
| 2694 | JavaScript Problem | - | - | - | - |
| 2695 | JavaScript Problem | - | - | - | - |
| 2696 | [Minimum String Length After Removing Substrings](https://leetcode.com/problems/minimum-string-length-after-removing-substrings/) | [无] | [C++](2501-3000/2696-Minimum-String-Length-After-Removing-Substrings/cpp-2696/) | | |
| 2697 | [Lexicographically Smallest Palindrome](https://leetcode.com/problems/lexicographically-smallest-palindrome/) | [无] | [C++](2501-3000/2697-Lexicographically-Smallest-Palindrome/cpp-2697/) | | |
| 2698 | [Find the Punishment Number of an Integer](https://leetcode.com/problems/find-the-punishment-number-of-an-integer/) | [无] | [C++](2501-3000/2698-Find-the-Punishment-Number-of-an-Integer/cpp-2698/) | | |
| 2699 | [Modify Graph Edge Weights](https://leetcode.com/problems/modify-graph-edge-weights/) | [无] | [C++](2501-3000/2699-Modify-Graph-Edge-Weights/cpp-2699/) | | |
| 2700 | JavaScript Problem | - | - | - | - |
| 2701 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2702 | [Minimum Operations to Make Numbers Non-positive](https://leetcode.com/problems/minimum-operations-to-make-numbers-non-positive/description/) | [无] | [C++](2501-3000/2702-Minimum-Operations-to-Make-Numbers-Non-positive/cpp-2702/) | | |
| 2703 | JavaScript Problem | - | - | - | - |
| 2704 | JavaScript Problem | - | - | - | - |
| 2705 | JavaScript Problem | - | - | - | - |
| 2706 | [Buy Two Chocolates](https://leetcode.com/problems/buy-two-chocolates/) | [无] | [C++](2501-3000/2706-Buy-Two-Chocolates/cpp-2706/) | | |
| 2707 | [Extra Characters in a String](https://leetcode.com/problems/extra-characters-in-a-string/) | [无] | [C++](2501-3000/2707-Extra-Characters-in-a-String/cpp-2707/) | | |
| 2708 | [Maximum Strength of a Group](https://leetcode.com/problems/maximum-strength-of-a-group/) | [无] | [C++](2501-3000/2708-Maximum-Strength-of-a-Group/cpp-2708/) | | |
| 2709 | [Greatest Common Divisor Traversal](https://leetcode.com/problems/greatest-common-divisor-traversal/) | [无] | [C++](2501-3000/2709-Greatest-Common-Divisor-Traversal/cpp-2709/) | | |
| 2710 | [Remove Trailing Zeros From a String](https://leetcode.com/problems/remove-trailing-zeros-from-a-string/) | [无] | [C++](2501-3000/2710-Remove-Trailing-Zeros-From-a-String/cpp-2710/) | | |
| 2711 | [Difference of Number of Distinct Values on Diagonals](https://leetcode.com/problems/difference-of-number-of-distinct-values-on-diagonals/) | [无] | [C++](2501-3000/2711-Difference-of-Number-of-Distinct-Values-on-Diagonals/cpp-2711/) | | |
| 2712 | [Minimum Cost to Make All Characters Equal](https://leetcode.com/problems/minimum-cost-to-make-all-characters-equal/) | [无] | [C++](2501-3000/2712-Minimum-Cost-to-Make-All-Characters-Equal/cpp-2712/) | | |
| 2713 | [Maximum Strictly Increasing Cells in a Matrix](https://leetcode.com/problems/maximum-strictly-increasing-cells-in-a-matrix/) | [无] | [C++](2501-3000/2713-Maximum-Strictly-Increasing-Cells-in-a-Matrix/cpp-2713/) | | |
| 2714 | [Find Shortest Path with K Hops](https://leetcode.com/problems/find-shortest-path-with-k-hops/description/) | [无] | [C++](2501-3000/2714-Find-Shortest-Path-with-K-Hops/cpp-2714/) | | |
| 2715 | JavaScript Problem | - | - | - | - |
| 2716 | [Minimize String Length](https://leetcode.com/problems/minimize-string-length/) | [无] | [C++](2501-3000/2716-Minimize-String-Length/cpp-2716/) | | |
| 2717 | [Semi-Ordered Permutation](https://leetcode.com/problems/semi-ordered-permutation/) | [无] | [C++](2501-3000/2717-Semi-Ordered-Permutation/cpp-2717/) | | |
| 2718 | [Sum of Matrix After Queries](https://leetcode.com/problems/sum-of-matrix-after-queries/) | [无] | [C++](2501-3000/2718-Sum-of-Matrix-After-Queries/cpp-2718/) | | |
| 2719 | [Count of Integers](https://leetcode.com/problems/count-of-integers/) | [无] | [C++](2501-3000/2719-Count-of-Integers/cpp-2719/) | | |
| 2720 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2721 | JavaScript Problem | - | - | - | - |
| 2722 | JavaScript Problem | - | - | - | - |
| 2723 | JavaScript Problem | - | - | - | - |
| 2724 | JavaScript Problem | - | - | - | - |
| 2725 | JavaScript Problem | - | - | - | - |
| 2726 | JavaScript Problem | - | - | - | - |
| 2727 | JavaScript Problem | - | - | - | - |
| 2728 | [Count Houses in a Circular Street](https://leetcode.com/problems/count-houses-in-a-circular-street/description/) | [无] | [C++](2501-3000/2728-Count-Houses-in-a-Circular-Street/cpp-2728/) | | |
| 2729 | [Check if The Number is Fascinating](https://leetcode.com/problems/check-if-the-number-is-fascinating/) | [无] | [C++](2501-3000/2729-Check-if-The-Number-is-Fascinating/cpp-2729/) | | |
| 2730 | [Find the Longest Semi-Repetitive Substring](https://leetcode.com/problems/find-the-longest-semi-repetitive-substring/) | [无] | [C++](2501-3000/2730-Find-the-Longest-Semi-Repetitive-Substring/cpp-2730/) | | |
| 2731 | [Movement of Robots](https://leetcode.com/problems/movement-of-robots/) | [无] | [C++](2501-3000/2731-Movement-of-Robots/cpp-2731/) | | |
| 2732 | [Find a Good Subset of the Matrix](https://leetcode.com/problems/find-a-good-subset-of-the-matrix/) | [无] | [C++](2501-3000/2732-Find-a-Good-Subset-of-the-Matrix/cpp-2732/) | | |
| 2733 | [Neither Minimum nor Maximum](https://leetcode.com/problems/neither-minimum-nor-maximum/) | [无] | [C++](2501-3000/2733-Neither-Minimum-nor-Maximum/cpp-2733/) | | |
| 2734 | [Lexicographically Smallest String After Substring Operation](https://leetcode.com/problems/lexicographically-smallest-string-after-substring-operation/) | [无] | [C++](2501-3000/2734-Lexicographically-Smallest-String-After-Substring-Operation/cpp-2734/) | | |
| 2735 | [Collecting Chocolates](https://leetcode.com/problems/collecting-chocolates/) | [无] | [C++](2501-3000/2735-Collecting-Chocolates/cpp-2735/) | | |
| 2736 | [Maximum Sum Queries](https://leetcode.com/problems/maximum-sum-queries/) | [无] | [C++](2501-3000/2736-Maximum-Sum-Queries/cpp-2736/) | | |
| 2737 | [Find the Closest Marked Node](https://leetcode.com/problems/find-the-closest-marked-node/) | [无] | [C++](2501-3000/2737-Find-the-Closest-Marked-Node/cpp-2737/) | | |
| 2738 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| 2739 | [Total Distance Traveled](https://leetcode.com/problems/total-distance-traveled/) | [无] | [C++](2501-3000/2739-Total-Distance-Traveled/cpp-2739/) | | |
| 2740 | [Find the Value of the Partition](https://leetcode.com/problems/find-the-value-of-the-partition/) | [无] | [C++](2501-3000/2740-Find-the-Value-of-the-Partition/cpp-2740/) | | |
| 2741 | [Special Permutations](https://leetcode.com/problems/special-permutations/) | [无] | [C++](2501-3000/2741-Special-Permutations/cpp-2741/) | | |
| 2742 | [Painting the Walls](https://leetcode.com/problems/painting-the-walls/) | [无] | [C++](2501-3000/2742-Painting-the-Walls/cpp-2742/) | | |
| 2743 | [Count Substrings Without Repeating Character](https://leetcode.com/problems/count-substrings-without-repeating-character/description/) | [无] | [C++](2501-3000/2743-Count-Substrings-Without-Repeating-Character/cpp-2743/) | | |
| 2744 | [Find Maximum Number of String Pairs](https://leetcode.com/problems/find-maximum-number-of-string-pairs/) | [无] | [C++](2501-3000/2744-Find-Maximum-Number-of-String-Pairs/cpp-2744/) | | |
| 2745 | [Construct the Longest New String](https://leetcode.com/problems/construct-the-longest-new-string/) | [无] | [C++](2501-3000/2745-Construct-the-Longest-New-String/cpp-2745/) | | |
| 2746 | [Decremental String Concatenation](https://leetcode.com/problems/decremental-string-concatenation/) | [无] | [C++](2501-3000/2746-Decremental-String-Concatenation/cpp-2746/) | | |
| 2747 | [Count Zero Request Servers](https://leetcode.com/problems/count-zero-request-servers/) | [无] | [C++](2501-3000/2747-Count-Zero-Request-Servers/cpp-2747/) | | |
| 2748 | [Number of Beautiful Pairs](https://leetcode.com/problems/number-of-beautiful-pairs/) | [无] | [C++](2501-3000/2748-Number-of-Beautiful-Pairs/cpp-2748/) | | |
| 2749 | [Minimum Operations to Make the Integer Zero](https://leetcode.com/problems/minimum-operations-to-make-the-integer-zero/) | [无] | [C++](2501-3000/2749-Minimum-Operations-to-Make-the-Integer-Zero/cpp-2749/) | | |
| 2750 | [Ways to Split Array Into Good Subarrays](https://leetcode.com/problems/ways-to-split-array-into-good-subarrays/) | [无] | [C++](2501-3000/2750-Ways-to-Split-Array-Into-Good-Subarrays/cpp-2750/) | | |
| 2751 | [Robot Collisions](https://leetcode.com/problems/robot-collisions/) | [无] | [C++](2501-3000/2751-Robot-Collisions/cpp-2751/) | | |
| 2752 | Database Problem: [Link](https://github.com/liuyubobobo/Play-Leetcode-Database/) | - | - | - | - |
| | | | | | |
| 2754 | JavaScript Problem | - | - | - | - |
| 2755 | JavaScript Problem | - | - | - | - |
| 2756 | JavaScript Problem | - | - | - | - |
| 2757 | JavaScript Problem | - | - | - | - |
| 2758 | JavaScript Problem | - | - | - | - |
| 2759 | JavaScript Problem | - | - | - | - |
| 2760 | [Longest Even Odd Subarray With Threshold](https://leetcode.com/problems/longest-even-odd-subarray-with-threshold/) | [无] | [C++](2501-3000/2760-Longest-Even-Odd-Subarray-With-Threshold/cpp-2760/) | | |
| 2761 | [Prime Pairs With Target Sum](https://leetcode.com/problems/prime-pairs-with-target-sum/) | [无] | [C++](2501-3000/2761-Prime-Pairs-With-Target-Sum/cpp-2761/) | | |
| 2762 | [Continuous Subarrays](https://leetcode.com/problems/continuous-subarrays/) | [无] | [C++](2501-3000/2762-Continuous-Subarrays/cpp-2762/) | | |
| 2763 | [Sum of Imbalance Numbers of All Subarrays](https://leetcode.com/problems/sum-of-imbalance-numbers-of-all-subarrays/) | [无] | [C++](2501-3000/2763-Sum-of-Imbalance-Numbers-of-All-Subarrays/cpp-2763/) | | |
| | | | | | |
| 2849 | [Determine if a Cell Is Reachable at a Given Time](https://leetcode.com/problems/determine-if-a-cell-is-reachable-at-a-given-time/) | [无] | [C++](2501-3000/2849-Determine-if-a-Cell-Is-Reachable-at-a-Given-Time/cpp-2849/) | | |
| | | | | | |
### 力扣中文站比赛 [传送门](LC/)
### 力扣中文站其他比赛 [传送门](Others/)